first commit
73
.gitignore
vendored
Normal file
@ -0,0 +1,73 @@
|
||||
# Python
|
||||
__pycache__/
|
||||
*.py[cod]
|
||||
*.pyo
|
||||
*.pyd
|
||||
.Python
|
||||
*.egg-info/
|
||||
dist/
|
||||
build/
|
||||
.eggs/
|
||||
|
||||
# 虛擬環境
|
||||
venv/
|
||||
env/
|
||||
.env/
|
||||
|
||||
# 模型權重與二進位檔
|
||||
*.pt
|
||||
*.pth
|
||||
*.onnx
|
||||
*.bie
|
||||
*.nef
|
||||
*.engine
|
||||
*.tflite
|
||||
*.pb
|
||||
|
||||
# 訓練輸出(很大,不放 git)
|
||||
runs/
|
||||
work_dirs/
|
||||
|
||||
# 資料集圖片(不放 git,改用 DVC 或外部儲存)
|
||||
data4/
|
||||
data50/
|
||||
test14data/
|
||||
teachabledata/
|
||||
numberocr/
|
||||
|
||||
# ONNX 輸出目錄
|
||||
onnx/
|
||||
|
||||
# NumPy 暫存
|
||||
npy/
|
||||
|
||||
# 暫放區
|
||||
暫放區/
|
||||
|
||||
# 權重目錄(除了下載腳本)
|
||||
weights/*.pt
|
||||
weights/*.pth
|
||||
|
||||
# Claude Code 設定
|
||||
.claude/
|
||||
|
||||
# Jupyter Notebook 輸出
|
||||
.ipynb_checkpoints/
|
||||
|
||||
# 系統檔
|
||||
.DS_Store
|
||||
Thumbs.db
|
||||
desktop.ini
|
||||
|
||||
# IDE
|
||||
.vscode/
|
||||
.idea/
|
||||
*.swp
|
||||
*.swo
|
||||
|
||||
# 日誌
|
||||
*.log
|
||||
wandb/
|
||||
|
||||
# 空的佔位檔
|
||||
python
|
||||
52
Dockerfile
Normal file
@ -0,0 +1,52 @@
|
||||
# Start FROM Nvidia PyTorch image https://ngc.nvidia.com/catalog/containers/nvidia:pytorch
|
||||
FROM nvcr.io/nvidia/pytorch:20.10-py3
|
||||
|
||||
# Install dependencies
|
||||
RUN pip install --upgrade pip
|
||||
# COPY requirements.txt .
|
||||
# RUN pip install -r requirements.txt
|
||||
RUN pip install gsutil
|
||||
|
||||
# Create working directory
|
||||
RUN mkdir -p /usr/src/app
|
||||
WORKDIR /usr/src/app
|
||||
|
||||
# Copy contents
|
||||
COPY . /usr/src/app
|
||||
|
||||
# Copy weights
|
||||
#RUN python3 -c "from models import *; \
|
||||
#attempt_download('weights/yolov5s.pt'); \
|
||||
#attempt_download('weights/yolov5m.pt'); \
|
||||
#attempt_download('weights/yolov5l.pt')"
|
||||
|
||||
|
||||
# --------------------------------------------------- Extras Below ---------------------------------------------------
|
||||
|
||||
# Build and Push
|
||||
# t=ultralytics/yolov5:latest && sudo docker build -t $t . && sudo docker push $t
|
||||
# for v in {300..303}; do t=ultralytics/coco:v$v && sudo docker build -t $t . && sudo docker push $t; done
|
||||
|
||||
# Pull and Run
|
||||
# t=ultralytics/yolov5:latest && sudo docker pull $t && sudo docker run -it --ipc=host $t
|
||||
|
||||
# Pull and Run with local directory access
|
||||
# t=ultralytics/yolov5:latest && sudo docker pull $t && sudo docker run -it --ipc=host --gpus all -v "$(pwd)"/coco:/usr/src/coco $t
|
||||
|
||||
# Kill all
|
||||
# sudo docker kill $(sudo docker ps -q)
|
||||
|
||||
# Kill all image-based
|
||||
# sudo docker kill $(sudo docker ps -a -q --filter ancestor=ultralytics/yolov5:latest)
|
||||
|
||||
# Bash into running container
|
||||
# sudo docker container exec -it ba65811811ab bash
|
||||
|
||||
# Bash into stopped container
|
||||
# sudo docker commit 092b16b25c5b usr/resume && sudo docker run -it --gpus all --ipc=host -v "$(pwd)"/coco:/usr/src/coco --entrypoint=sh usr/resume
|
||||
|
||||
# Send weights to GCP
|
||||
# python -c "from utils.general import *; strip_optimizer('runs/train/exp0_*/weights/best.pt', 'tmp.pt')" && gsutil cp tmp.pt gs://*.pt
|
||||
|
||||
# Clean up
|
||||
# docker system prune -a --volumes
|
||||
674
LICENSE
Normal file
@ -0,0 +1,674 @@
|
||||
GNU GENERAL PUBLIC LICENSE
|
||||
Version 3, 29 June 2007
|
||||
|
||||
Copyright (C) 2007 Free Software Foundation, Inc. <http://fsf.org/>
|
||||
Everyone is permitted to copy and distribute verbatim copies
|
||||
of this license document, but changing it is not allowed.
|
||||
|
||||
Preamble
|
||||
|
||||
The GNU General Public License is a free, copyleft license for
|
||||
software and other kinds of works.
|
||||
|
||||
The licenses for most software and other practical works are designed
|
||||
to take away your freedom to share and change the works. By contrast,
|
||||
the GNU General Public License is intended to guarantee your freedom to
|
||||
share and change all versions of a program--to make sure it remains free
|
||||
software for all its users. We, the Free Software Foundation, use the
|
||||
GNU General Public License for most of our software; it applies also to
|
||||
any other work released this way by its authors. You can apply it to
|
||||
your programs, too.
|
||||
|
||||
When we speak of free software, we are referring to freedom, not
|
||||
price. Our General Public Licenses are designed to make sure that you
|
||||
have the freedom to distribute copies of free software (and charge for
|
||||
them if you wish), that you receive source code or can get it if you
|
||||
want it, that you can change the software or use pieces of it in new
|
||||
free programs, and that you know you can do these things.
|
||||
|
||||
To protect your rights, we need to prevent others from denying you
|
||||
these rights or asking you to surrender the rights. Therefore, you have
|
||||
certain responsibilities if you distribute copies of the software, or if
|
||||
you modify it: responsibilities to respect the freedom of others.
|
||||
|
||||
For example, if you distribute copies of such a program, whether
|
||||
gratis or for a fee, you must pass on to the recipients the same
|
||||
freedoms that you received. You must make sure that they, too, receive
|
||||
or can get the source code. And you must show them these terms so they
|
||||
know their rights.
|
||||
|
||||
Developers that use the GNU GPL protect your rights with two steps:
|
||||
(1) assert copyright on the software, and (2) offer you this License
|
||||
giving you legal permission to copy, distribute and/or modify it.
|
||||
|
||||
For the developers' and authors' protection, the GPL clearly explains
|
||||
that there is no warranty for this free software. For both users' and
|
||||
authors' sake, the GPL requires that modified versions be marked as
|
||||
changed, so that their problems will not be attributed erroneously to
|
||||
authors of previous versions.
|
||||
|
||||
Some devices are designed to deny users access to install or run
|
||||
modified versions of the software inside them, although the manufacturer
|
||||
can do so. This is fundamentally incompatible with the aim of
|
||||
protecting users' freedom to change the software. The systematic
|
||||
pattern of such abuse occurs in the area of products for individuals to
|
||||
use, which is precisely where it is most unacceptable. Therefore, we
|
||||
have designed this version of the GPL to prohibit the practice for those
|
||||
products. If such problems arise substantially in other domains, we
|
||||
stand ready to extend this provision to those domains in future versions
|
||||
of the GPL, as needed to protect the freedom of users.
|
||||
|
||||
Finally, every program is threatened constantly by software patents.
|
||||
States should not allow patents to restrict development and use of
|
||||
software on general-purpose computers, but in those that do, we wish to
|
||||
avoid the special danger that patents applied to a free program could
|
||||
make it effectively proprietary. To prevent this, the GPL assures that
|
||||
patents cannot be used to render the program non-free.
|
||||
|
||||
The precise terms and conditions for copying, distribution and
|
||||
modification follow.
|
||||
|
||||
TERMS AND CONDITIONS
|
||||
|
||||
0. Definitions.
|
||||
|
||||
"This License" refers to version 3 of the GNU General Public License.
|
||||
|
||||
"Copyright" also means copyright-like laws that apply to other kinds of
|
||||
works, such as semiconductor masks.
|
||||
|
||||
"The Program" refers to any copyrightable work licensed under this
|
||||
License. Each licensee is addressed as "you". "Licensees" and
|
||||
"recipients" may be individuals or organizations.
|
||||
|
||||
To "modify" a work means to copy from or adapt all or part of the work
|
||||
in a fashion requiring copyright permission, other than the making of an
|
||||
exact copy. The resulting work is called a "modified version" of the
|
||||
earlier work or a work "based on" the earlier work.
|
||||
|
||||
A "covered work" means either the unmodified Program or a work based
|
||||
on the Program.
|
||||
|
||||
To "propagate" a work means to do anything with it that, without
|
||||
permission, would make you directly or secondarily liable for
|
||||
infringement under applicable copyright law, except executing it on a
|
||||
computer or modifying a private copy. Propagation includes copying,
|
||||
distribution (with or without modification), making available to the
|
||||
public, and in some countries other activities as well.
|
||||
|
||||
To "convey" a work means any kind of propagation that enables other
|
||||
parties to make or receive copies. Mere interaction with a user through
|
||||
a computer network, with no transfer of a copy, is not conveying.
|
||||
|
||||
An interactive user interface displays "Appropriate Legal Notices"
|
||||
to the extent that it includes a convenient and prominently visible
|
||||
feature that (1) displays an appropriate copyright notice, and (2)
|
||||
tells the user that there is no warranty for the work (except to the
|
||||
extent that warranties are provided), that licensees may convey the
|
||||
work under this License, and how to view a copy of this License. If
|
||||
the interface presents a list of user commands or options, such as a
|
||||
menu, a prominent item in the list meets this criterion.
|
||||
|
||||
1. Source Code.
|
||||
|
||||
The "source code" for a work means the preferred form of the work
|
||||
for making modifications to it. "Object code" means any non-source
|
||||
form of a work.
|
||||
|
||||
A "Standard Interface" means an interface that either is an official
|
||||
standard defined by a recognized standards body, or, in the case of
|
||||
interfaces specified for a particular programming language, one that
|
||||
is widely used among developers working in that language.
|
||||
|
||||
The "System Libraries" of an executable work include anything, other
|
||||
than the work as a whole, that (a) is included in the normal form of
|
||||
packaging a Major Component, but which is not part of that Major
|
||||
Component, and (b) serves only to enable use of the work with that
|
||||
Major Component, or to implement a Standard Interface for which an
|
||||
implementation is available to the public in source code form. A
|
||||
"Major Component", in this context, means a major essential component
|
||||
(kernel, window system, and so on) of the specific operating system
|
||||
(if any) on which the executable work runs, or a compiler used to
|
||||
produce the work, or an object code interpreter used to run it.
|
||||
|
||||
The "Corresponding Source" for a work in object code form means all
|
||||
the source code needed to generate, install, and (for an executable
|
||||
work) run the object code and to modify the work, including scripts to
|
||||
control those activities. However, it does not include the work's
|
||||
System Libraries, or general-purpose tools or generally available free
|
||||
programs which are used unmodified in performing those activities but
|
||||
which are not part of the work. For example, Corresponding Source
|
||||
includes interface definition files associated with source files for
|
||||
the work, and the source code for shared libraries and dynamically
|
||||
linked subprograms that the work is specifically designed to require,
|
||||
such as by intimate data communication or control flow between those
|
||||
subprograms and other parts of the work.
|
||||
|
||||
The Corresponding Source need not include anything that users
|
||||
can regenerate automatically from other parts of the Corresponding
|
||||
Source.
|
||||
|
||||
The Corresponding Source for a work in source code form is that
|
||||
same work.
|
||||
|
||||
2. Basic Permissions.
|
||||
|
||||
All rights granted under this License are granted for the term of
|
||||
copyright on the Program, and are irrevocable provided the stated
|
||||
conditions are met. This License explicitly affirms your unlimited
|
||||
permission to run the unmodified Program. The output from running a
|
||||
covered work is covered by this License only if the output, given its
|
||||
content, constitutes a covered work. This License acknowledges your
|
||||
rights of fair use or other equivalent, as provided by copyright law.
|
||||
|
||||
You may make, run and propagate covered works that you do not
|
||||
convey, without conditions so long as your license otherwise remains
|
||||
in force. You may convey covered works to others for the sole purpose
|
||||
of having them make modifications exclusively for you, or provide you
|
||||
with facilities for running those works, provided that you comply with
|
||||
the terms of this License in conveying all material for which you do
|
||||
not control copyright. Those thus making or running the covered works
|
||||
for you must do so exclusively on your behalf, under your direction
|
||||
and control, on terms that prohibit them from making any copies of
|
||||
your copyrighted material outside their relationship with you.
|
||||
|
||||
Conveying under any other circumstances is permitted solely under
|
||||
the conditions stated below. Sublicensing is not allowed; section 10
|
||||
makes it unnecessary.
|
||||
|
||||
3. Protecting Users' Legal Rights From Anti-Circumvention Law.
|
||||
|
||||
No covered work shall be deemed part of an effective technological
|
||||
measure under any applicable law fulfilling obligations under article
|
||||
11 of the WIPO copyright treaty adopted on 20 December 1996, or
|
||||
similar laws prohibiting or restricting circumvention of such
|
||||
measures.
|
||||
|
||||
When you convey a covered work, you waive any legal power to forbid
|
||||
circumvention of technological measures to the extent such circumvention
|
||||
is effected by exercising rights under this License with respect to
|
||||
the covered work, and you disclaim any intention to limit operation or
|
||||
modification of the work as a means of enforcing, against the work's
|
||||
users, your or third parties' legal rights to forbid circumvention of
|
||||
technological measures.
|
||||
|
||||
4. Conveying Verbatim Copies.
|
||||
|
||||
You may convey verbatim copies of the Program's source code as you
|
||||
receive it, in any medium, provided that you conspicuously and
|
||||
appropriately publish on each copy an appropriate copyright notice;
|
||||
keep intact all notices stating that this License and any
|
||||
non-permissive terms added in accord with section 7 apply to the code;
|
||||
keep intact all notices of the absence of any warranty; and give all
|
||||
recipients a copy of this License along with the Program.
|
||||
|
||||
You may charge any price or no price for each copy that you convey,
|
||||
and you may offer support or warranty protection for a fee.
|
||||
|
||||
5. Conveying Modified Source Versions.
|
||||
|
||||
You may convey a work based on the Program, or the modifications to
|
||||
produce it from the Program, in the form of source code under the
|
||||
terms of section 4, provided that you also meet all of these conditions:
|
||||
|
||||
a) The work must carry prominent notices stating that you modified
|
||||
it, and giving a relevant date.
|
||||
|
||||
b) The work must carry prominent notices stating that it is
|
||||
released under this License and any conditions added under section
|
||||
7. This requirement modifies the requirement in section 4 to
|
||||
"keep intact all notices".
|
||||
|
||||
c) You must license the entire work, as a whole, under this
|
||||
License to anyone who comes into possession of a copy. This
|
||||
License will therefore apply, along with any applicable section 7
|
||||
additional terms, to the whole of the work, and all its parts,
|
||||
regardless of how they are packaged. This License gives no
|
||||
permission to license the work in any other way, but it does not
|
||||
invalidate such permission if you have separately received it.
|
||||
|
||||
d) If the work has interactive user interfaces, each must display
|
||||
Appropriate Legal Notices; however, if the Program has interactive
|
||||
interfaces that do not display Appropriate Legal Notices, your
|
||||
work need not make them do so.
|
||||
|
||||
A compilation of a covered work with other separate and independent
|
||||
works, which are not by their nature extensions of the covered work,
|
||||
and which are not combined with it such as to form a larger program,
|
||||
in or on a volume of a storage or distribution medium, is called an
|
||||
"aggregate" if the compilation and its resulting copyright are not
|
||||
used to limit the access or legal rights of the compilation's users
|
||||
beyond what the individual works permit. Inclusion of a covered work
|
||||
in an aggregate does not cause this License to apply to the other
|
||||
parts of the aggregate.
|
||||
|
||||
6. Conveying Non-Source Forms.
|
||||
|
||||
You may convey a covered work in object code form under the terms
|
||||
of sections 4 and 5, provided that you also convey the
|
||||
machine-readable Corresponding Source under the terms of this License,
|
||||
in one of these ways:
|
||||
|
||||
a) Convey the object code in, or embodied in, a physical product
|
||||
(including a physical distribution medium), accompanied by the
|
||||
Corresponding Source fixed on a durable physical medium
|
||||
customarily used for software interchange.
|
||||
|
||||
b) Convey the object code in, or embodied in, a physical product
|
||||
(including a physical distribution medium), accompanied by a
|
||||
written offer, valid for at least three years and valid for as
|
||||
long as you offer spare parts or customer support for that product
|
||||
model, to give anyone who possesses the object code either (1) a
|
||||
copy of the Corresponding Source for all the software in the
|
||||
product that is covered by this License, on a durable physical
|
||||
medium customarily used for software interchange, for a price no
|
||||
more than your reasonable cost of physically performing this
|
||||
conveying of source, or (2) access to copy the
|
||||
Corresponding Source from a network server at no charge.
|
||||
|
||||
c) Convey individual copies of the object code with a copy of the
|
||||
written offer to provide the Corresponding Source. This
|
||||
alternative is allowed only occasionally and noncommercially, and
|
||||
only if you received the object code with such an offer, in accord
|
||||
with subsection 6b.
|
||||
|
||||
d) Convey the object code by offering access from a designated
|
||||
place (gratis or for a charge), and offer equivalent access to the
|
||||
Corresponding Source in the same way through the same place at no
|
||||
further charge. You need not require recipients to copy the
|
||||
Corresponding Source along with the object code. If the place to
|
||||
copy the object code is a network server, the Corresponding Source
|
||||
may be on a different server (operated by you or a third party)
|
||||
that supports equivalent copying facilities, provided you maintain
|
||||
clear directions next to the object code saying where to find the
|
||||
Corresponding Source. Regardless of what server hosts the
|
||||
Corresponding Source, you remain obligated to ensure that it is
|
||||
available for as long as needed to satisfy these requirements.
|
||||
|
||||
e) Convey the object code using peer-to-peer transmission, provided
|
||||
you inform other peers where the object code and Corresponding
|
||||
Source of the work are being offered to the general public at no
|
||||
charge under subsection 6d.
|
||||
|
||||
A separable portion of the object code, whose source code is excluded
|
||||
from the Corresponding Source as a System Library, need not be
|
||||
included in conveying the object code work.
|
||||
|
||||
A "User Product" is either (1) a "consumer product", which means any
|
||||
tangible personal property which is normally used for personal, family,
|
||||
or household purposes, or (2) anything designed or sold for incorporation
|
||||
into a dwelling. In determining whether a product is a consumer product,
|
||||
doubtful cases shall be resolved in favor of coverage. For a particular
|
||||
product received by a particular user, "normally used" refers to a
|
||||
typical or common use of that class of product, regardless of the status
|
||||
of the particular user or of the way in which the particular user
|
||||
actually uses, or expects or is expected to use, the product. A product
|
||||
is a consumer product regardless of whether the product has substantial
|
||||
commercial, industrial or non-consumer uses, unless such uses represent
|
||||
the only significant mode of use of the product.
|
||||
|
||||
"Installation Information" for a User Product means any methods,
|
||||
procedures, authorization keys, or other information required to install
|
||||
and execute modified versions of a covered work in that User Product from
|
||||
a modified version of its Corresponding Source. The information must
|
||||
suffice to ensure that the continued functioning of the modified object
|
||||
code is in no case prevented or interfered with solely because
|
||||
modification has been made.
|
||||
|
||||
If you convey an object code work under this section in, or with, or
|
||||
specifically for use in, a User Product, and the conveying occurs as
|
||||
part of a transaction in which the right of possession and use of the
|
||||
User Product is transferred to the recipient in perpetuity or for a
|
||||
fixed term (regardless of how the transaction is characterized), the
|
||||
Corresponding Source conveyed under this section must be accompanied
|
||||
by the Installation Information. But this requirement does not apply
|
||||
if neither you nor any third party retains the ability to install
|
||||
modified object code on the User Product (for example, the work has
|
||||
been installed in ROM).
|
||||
|
||||
The requirement to provide Installation Information does not include a
|
||||
requirement to continue to provide support service, warranty, or updates
|
||||
for a work that has been modified or installed by the recipient, or for
|
||||
the User Product in which it has been modified or installed. Access to a
|
||||
network may be denied when the modification itself materially and
|
||||
adversely affects the operation of the network or violates the rules and
|
||||
protocols for communication across the network.
|
||||
|
||||
Corresponding Source conveyed, and Installation Information provided,
|
||||
in accord with this section must be in a format that is publicly
|
||||
documented (and with an implementation available to the public in
|
||||
source code form), and must require no special password or key for
|
||||
unpacking, reading or copying.
|
||||
|
||||
7. Additional Terms.
|
||||
|
||||
"Additional permissions" are terms that supplement the terms of this
|
||||
License by making exceptions from one or more of its conditions.
|
||||
Additional permissions that are applicable to the entire Program shall
|
||||
be treated as though they were included in this License, to the extent
|
||||
that they are valid under applicable law. If additional permissions
|
||||
apply only to part of the Program, that part may be used separately
|
||||
under those permissions, but the entire Program remains governed by
|
||||
this License without regard to the additional permissions.
|
||||
|
||||
When you convey a copy of a covered work, you may at your option
|
||||
remove any additional permissions from that copy, or from any part of
|
||||
it. (Additional permissions may be written to require their own
|
||||
removal in certain cases when you modify the work.) You may place
|
||||
additional permissions on material, added by you to a covered work,
|
||||
for which you have or can give appropriate copyright permission.
|
||||
|
||||
Notwithstanding any other provision of this License, for material you
|
||||
add to a covered work, you may (if authorized by the copyright holders of
|
||||
that material) supplement the terms of this License with terms:
|
||||
|
||||
a) Disclaiming warranty or limiting liability differently from the
|
||||
terms of sections 15 and 16 of this License; or
|
||||
|
||||
b) Requiring preservation of specified reasonable legal notices or
|
||||
author attributions in that material or in the Appropriate Legal
|
||||
Notices displayed by works containing it; or
|
||||
|
||||
c) Prohibiting misrepresentation of the origin of that material, or
|
||||
requiring that modified versions of such material be marked in
|
||||
reasonable ways as different from the original version; or
|
||||
|
||||
d) Limiting the use for publicity purposes of names of licensors or
|
||||
authors of the material; or
|
||||
|
||||
e) Declining to grant rights under trademark law for use of some
|
||||
trade names, trademarks, or service marks; or
|
||||
|
||||
f) Requiring indemnification of licensors and authors of that
|
||||
material by anyone who conveys the material (or modified versions of
|
||||
it) with contractual assumptions of liability to the recipient, for
|
||||
any liability that these contractual assumptions directly impose on
|
||||
those licensors and authors.
|
||||
|
||||
All other non-permissive additional terms are considered "further
|
||||
restrictions" within the meaning of section 10. If the Program as you
|
||||
received it, or any part of it, contains a notice stating that it is
|
||||
governed by this License along with a term that is a further
|
||||
restriction, you may remove that term. If a license document contains
|
||||
a further restriction but permits relicensing or conveying under this
|
||||
License, you may add to a covered work material governed by the terms
|
||||
of that license document, provided that the further restriction does
|
||||
not survive such relicensing or conveying.
|
||||
|
||||
If you add terms to a covered work in accord with this section, you
|
||||
must place, in the relevant source files, a statement of the
|
||||
additional terms that apply to those files, or a notice indicating
|
||||
where to find the applicable terms.
|
||||
|
||||
Additional terms, permissive or non-permissive, may be stated in the
|
||||
form of a separately written license, or stated as exceptions;
|
||||
the above requirements apply either way.
|
||||
|
||||
8. Termination.
|
||||
|
||||
You may not propagate or modify a covered work except as expressly
|
||||
provided under this License. Any attempt otherwise to propagate or
|
||||
modify it is void, and will automatically terminate your rights under
|
||||
this License (including any patent licenses granted under the third
|
||||
paragraph of section 11).
|
||||
|
||||
However, if you cease all violation of this License, then your
|
||||
license from a particular copyright holder is reinstated (a)
|
||||
provisionally, unless and until the copyright holder explicitly and
|
||||
finally terminates your license, and (b) permanently, if the copyright
|
||||
holder fails to notify you of the violation by some reasonable means
|
||||
prior to 60 days after the cessation.
|
||||
|
||||
Moreover, your license from a particular copyright holder is
|
||||
reinstated permanently if the copyright holder notifies you of the
|
||||
violation by some reasonable means, this is the first time you have
|
||||
received notice of violation of this License (for any work) from that
|
||||
copyright holder, and you cure the violation prior to 30 days after
|
||||
your receipt of the notice.
|
||||
|
||||
Termination of your rights under this section does not terminate the
|
||||
licenses of parties who have received copies or rights from you under
|
||||
this License. If your rights have been terminated and not permanently
|
||||
reinstated, you do not qualify to receive new licenses for the same
|
||||
material under section 10.
|
||||
|
||||
9. Acceptance Not Required for Having Copies.
|
||||
|
||||
You are not required to accept this License in order to receive or
|
||||
run a copy of the Program. Ancillary propagation of a covered work
|
||||
occurring solely as a consequence of using peer-to-peer transmission
|
||||
to receive a copy likewise does not require acceptance. However,
|
||||
nothing other than this License grants you permission to propagate or
|
||||
modify any covered work. These actions infringe copyright if you do
|
||||
not accept this License. Therefore, by modifying or propagating a
|
||||
covered work, you indicate your acceptance of this License to do so.
|
||||
|
||||
10. Automatic Licensing of Downstream Recipients.
|
||||
|
||||
Each time you convey a covered work, the recipient automatically
|
||||
receives a license from the original licensors, to run, modify and
|
||||
propagate that work, subject to this License. You are not responsible
|
||||
for enforcing compliance by third parties with this License.
|
||||
|
||||
An "entity transaction" is a transaction transferring control of an
|
||||
organization, or substantially all assets of one, or subdividing an
|
||||
organization, or merging organizations. If propagation of a covered
|
||||
work results from an entity transaction, each party to that
|
||||
transaction who receives a copy of the work also receives whatever
|
||||
licenses to the work the party's predecessor in interest had or could
|
||||
give under the previous paragraph, plus a right to possession of the
|
||||
Corresponding Source of the work from the predecessor in interest, if
|
||||
the predecessor has it or can get it with reasonable efforts.
|
||||
|
||||
You may not impose any further restrictions on the exercise of the
|
||||
rights granted or affirmed under this License. For example, you may
|
||||
not impose a license fee, royalty, or other charge for exercise of
|
||||
rights granted under this License, and you may not initiate litigation
|
||||
(including a cross-claim or counterclaim in a lawsuit) alleging that
|
||||
any patent claim is infringed by making, using, selling, offering for
|
||||
sale, or importing the Program or any portion of it.
|
||||
|
||||
11. Patents.
|
||||
|
||||
A "contributor" is a copyright holder who authorizes use under this
|
||||
License of the Program or a work on which the Program is based. The
|
||||
work thus licensed is called the contributor's "contributor version".
|
||||
|
||||
A contributor's "essential patent claims" are all patent claims
|
||||
owned or controlled by the contributor, whether already acquired or
|
||||
hereafter acquired, that would be infringed by some manner, permitted
|
||||
by this License, of making, using, or selling its contributor version,
|
||||
but do not include claims that would be infringed only as a
|
||||
consequence of further modification of the contributor version. For
|
||||
purposes of this definition, "control" includes the right to grant
|
||||
patent sublicenses in a manner consistent with the requirements of
|
||||
this License.
|
||||
|
||||
Each contributor grants you a non-exclusive, worldwide, royalty-free
|
||||
patent license under the contributor's essential patent claims, to
|
||||
make, use, sell, offer for sale, import and otherwise run, modify and
|
||||
propagate the contents of its contributor version.
|
||||
|
||||
In the following three paragraphs, a "patent license" is any express
|
||||
agreement or commitment, however denominated, not to enforce a patent
|
||||
(such as an express permission to practice a patent or covenant not to
|
||||
sue for patent infringement). To "grant" such a patent license to a
|
||||
party means to make such an agreement or commitment not to enforce a
|
||||
patent against the party.
|
||||
|
||||
If you convey a covered work, knowingly relying on a patent license,
|
||||
and the Corresponding Source of the work is not available for anyone
|
||||
to copy, free of charge and under the terms of this License, through a
|
||||
publicly available network server or other readily accessible means,
|
||||
then you must either (1) cause the Corresponding Source to be so
|
||||
available, or (2) arrange to deprive yourself of the benefit of the
|
||||
patent license for this particular work, or (3) arrange, in a manner
|
||||
consistent with the requirements of this License, to extend the patent
|
||||
license to downstream recipients. "Knowingly relying" means you have
|
||||
actual knowledge that, but for the patent license, your conveying the
|
||||
covered work in a country, or your recipient's use of the covered work
|
||||
in a country, would infringe one or more identifiable patents in that
|
||||
country that you have reason to believe are valid.
|
||||
|
||||
If, pursuant to or in connection with a single transaction or
|
||||
arrangement, you convey, or propagate by procuring conveyance of, a
|
||||
covered work, and grant a patent license to some of the parties
|
||||
receiving the covered work authorizing them to use, propagate, modify
|
||||
or convey a specific copy of the covered work, then the patent license
|
||||
you grant is automatically extended to all recipients of the covered
|
||||
work and works based on it.
|
||||
|
||||
A patent license is "discriminatory" if it does not include within
|
||||
the scope of its coverage, prohibits the exercise of, or is
|
||||
conditioned on the non-exercise of one or more of the rights that are
|
||||
specifically granted under this License. You may not convey a covered
|
||||
work if you are a party to an arrangement with a third party that is
|
||||
in the business of distributing software, under which you make payment
|
||||
to the third party based on the extent of your activity of conveying
|
||||
the work, and under which the third party grants, to any of the
|
||||
parties who would receive the covered work from you, a discriminatory
|
||||
patent license (a) in connection with copies of the covered work
|
||||
conveyed by you (or copies made from those copies), or (b) primarily
|
||||
for and in connection with specific products or compilations that
|
||||
contain the covered work, unless you entered into that arrangement,
|
||||
or that patent license was granted, prior to 28 March 2007.
|
||||
|
||||
Nothing in this License shall be construed as excluding or limiting
|
||||
any implied license or other defenses to infringement that may
|
||||
otherwise be available to you under applicable patent law.
|
||||
|
||||
12. No Surrender of Others' Freedom.
|
||||
|
||||
If conditions are imposed on you (whether by court order, agreement or
|
||||
otherwise) that contradict the conditions of this License, they do not
|
||||
excuse you from the conditions of this License. If you cannot convey a
|
||||
covered work so as to satisfy simultaneously your obligations under this
|
||||
License and any other pertinent obligations, then as a consequence you may
|
||||
not convey it at all. For example, if you agree to terms that obligate you
|
||||
to collect a royalty for further conveying from those to whom you convey
|
||||
the Program, the only way you could satisfy both those terms and this
|
||||
License would be to refrain entirely from conveying the Program.
|
||||
|
||||
13. Use with the GNU Affero General Public License.
|
||||
|
||||
Notwithstanding any other provision of this License, you have
|
||||
permission to link or combine any covered work with a work licensed
|
||||
under version 3 of the GNU Affero General Public License into a single
|
||||
combined work, and to convey the resulting work. The terms of this
|
||||
License will continue to apply to the part which is the covered work,
|
||||
but the special requirements of the GNU Affero General Public License,
|
||||
section 13, concerning interaction through a network will apply to the
|
||||
combination as such.
|
||||
|
||||
14. Revised Versions of this License.
|
||||
|
||||
The Free Software Foundation may publish revised and/or new versions of
|
||||
the GNU General Public License from time to time. Such new versions will
|
||||
be similar in spirit to the present version, but may differ in detail to
|
||||
address new problems or concerns.
|
||||
|
||||
Each version is given a distinguishing version number. If the
|
||||
Program specifies that a certain numbered version of the GNU General
|
||||
Public License "or any later version" applies to it, you have the
|
||||
option of following the terms and conditions either of that numbered
|
||||
version or of any later version published by the Free Software
|
||||
Foundation. If the Program does not specify a version number of the
|
||||
GNU General Public License, you may choose any version ever published
|
||||
by the Free Software Foundation.
|
||||
|
||||
If the Program specifies that a proxy can decide which future
|
||||
versions of the GNU General Public License can be used, that proxy's
|
||||
public statement of acceptance of a version permanently authorizes you
|
||||
to choose that version for the Program.
|
||||
|
||||
Later license versions may give you additional or different
|
||||
permissions. However, no additional obligations are imposed on any
|
||||
author or copyright holder as a result of your choosing to follow a
|
||||
later version.
|
||||
|
||||
15. Disclaimer of Warranty.
|
||||
|
||||
THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY
|
||||
APPLICABLE LAW. EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT
|
||||
HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY
|
||||
OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO,
|
||||
THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
|
||||
PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM
|
||||
IS WITH YOU. SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF
|
||||
ALL NECESSARY SERVICING, REPAIR OR CORRECTION.
|
||||
|
||||
16. Limitation of Liability.
|
||||
|
||||
IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
|
||||
WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MODIFIES AND/OR CONVEYS
|
||||
THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY
|
||||
GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE
|
||||
USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF
|
||||
DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD
|
||||
PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS),
|
||||
EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF
|
||||
SUCH DAMAGES.
|
||||
|
||||
17. Interpretation of Sections 15 and 16.
|
||||
|
||||
If the disclaimer of warranty and limitation of liability provided
|
||||
above cannot be given local legal effect according to their terms,
|
||||
reviewing courts shall apply local law that most closely approximates
|
||||
an absolute waiver of all civil liability in connection with the
|
||||
Program, unless a warranty or assumption of liability accompanies a
|
||||
copy of the Program in return for a fee.
|
||||
|
||||
END OF TERMS AND CONDITIONS
|
||||
|
||||
How to Apply These Terms to Your New Programs
|
||||
|
||||
If you develop a new program, and you want it to be of the greatest
|
||||
possible use to the public, the best way to achieve this is to make it
|
||||
free software which everyone can redistribute and change under these terms.
|
||||
|
||||
To do so, attach the following notices to the program. It is safest
|
||||
to attach them to the start of each source file to most effectively
|
||||
state the exclusion of warranty; and each file should have at least
|
||||
the "copyright" line and a pointer to where the full notice is found.
|
||||
|
||||
<one line to give the program's name and a brief idea of what it does.>
|
||||
Copyright (C) <year> <name of author>
|
||||
|
||||
This program is free software: you can redistribute it and/or modify
|
||||
it under the terms of the GNU General Public License as published by
|
||||
the Free Software Foundation, either version 3 of the License, or
|
||||
(at your option) any later version.
|
||||
|
||||
This program is distributed in the hope that it will be useful,
|
||||
but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
GNU General Public License for more details.
|
||||
|
||||
You should have received a copy of the GNU General Public License
|
||||
along with this program. If not, see <http://www.gnu.org/licenses/>.
|
||||
|
||||
Also add information on how to contact you by electronic and paper mail.
|
||||
|
||||
If the program does terminal interaction, make it output a short
|
||||
notice like this when it starts in an interactive mode:
|
||||
|
||||
<program> Copyright (C) <year> <name of author>
|
||||
This program comes with ABSOLUTELY NO WARRANTY; for details type `show w'.
|
||||
This is free software, and you are welcome to redistribute it
|
||||
under certain conditions; type `show c' for details.
|
||||
|
||||
The hypothetical commands `show w' and `show c' should show the appropriate
|
||||
parts of the General Public License. Of course, your program's commands
|
||||
might be different; for a GUI interface, you would use an "about box".
|
||||
|
||||
You should also get your employer (if you work as a programmer) or school,
|
||||
if any, to sign a "copyright disclaimer" for the program, if necessary.
|
||||
For more information on this, and how to apply and follow the GNU GPL, see
|
||||
<http://www.gnu.org/licenses/>.
|
||||
|
||||
The GNU General Public License does not permit incorporating your program
|
||||
into proprietary programs. If your program is a subroutine library, you
|
||||
may consider it more useful to permit linking proprietary applications with
|
||||
the library. If this is what you want to do, use the GNU Lesser General
|
||||
Public License instead of this License. But first, please read
|
||||
<http://www.gnu.org/philosophy/why-not-lgpl.html>.
|
||||
270
README.md
Normal file
@ -0,0 +1,270 @@
|
||||
<h1 align="center"> Object Detection </h1>
|
||||
Object Detection task with YOLOv5 model.
|
||||
|
||||
This document contains the explanations of arguments of each script.
|
||||
|
||||
|
||||
You can find the tutorial document for finetuning a pretrained model on COCO128 dataset under the `tutorial` folder, `tutorial/README.md`.
|
||||
|
||||
|
||||
The ipython notebook tutorial is also prepared under the `tutorial` folder as `tutorial/tutorial.ipynb`. You may upload and run this ipython notebook on Google colab.
|
||||
|
||||
# Prerequisites
|
||||
- Python 3.8 or above
|
||||
|
||||
# Installation
|
||||
```bash
|
||||
$ pip install -U pip
|
||||
$ pip install -r requirements.txt
|
||||
```
|
||||
|
||||
# Dataset & Preparation
|
||||
|
||||
The image data, annotations and dataset.yaml are required.
|
||||
|
||||
## MS COCO
|
||||
|
||||
Our traning script accepts MS COCO dataset. You may download the dataset using the following link:
|
||||
|
||||
- Download [2017 MS COCO Dataset](https://cocodataset.org/#download)
|
||||
|
||||
## Custom Datasets
|
||||
|
||||
You can also train the model on a custom dataset.
|
||||
|
||||
### Annotations Format
|
||||
After using a tool like [CVAT](https://github.com/openvinotoolkit/cvat), [makesense.ai](https://www.makesense.ai) or [Labelbox](https://labelbox.com) to label your images, export your labels to YOLO format, with one `*.txt` file per image (if no objects in image, no `*.txt` file is required). The `*.txt` file specifications are:
|
||||
|
||||
- One row per object
|
||||
- Each row is `class x_center y_center width height` format.
|
||||
- Box coordinates must be in normalized xywh format (from 0 - 1). If your boxes are in pixels, divide `x_center` and `width` by image `width`, and `y_center` and `height` by image height.
|
||||
- Class numbers are zero-indexed (start from 0).
|
||||
|
||||
<div align="center">
|
||||
<img src="./tutorial/screenshots/readme_img.jpg" width="50%" />
|
||||
</div>
|
||||
|
||||
The label file corresponding to the above image contains 2 persons (class 0) and a tie (class 27):
|
||||
<div align="center">
|
||||
<img src="./tutorial/screenshots/readme_img2.png" width="40%" />
|
||||
</div>
|
||||
|
||||
### Directory Organization
|
||||
Your own datasets are expected to have the following structure. We assume `/dataset` is next to the `/yolov5` directory. YOLOv5 locates labels automatically for each image by replacing the last instance of `/images/` in each image path with `/labels/`.
|
||||
|
||||
```bash
|
||||
- Dataset name
|
||||
-- images
|
||||
-- train
|
||||
--- img001.jpg
|
||||
--- ...
|
||||
-- val
|
||||
--- img002.jpg
|
||||
--- ...
|
||||
|
||||
-- labels
|
||||
-- train
|
||||
--- img001.txt
|
||||
--- ...
|
||||
-- val
|
||||
--- img002.txt
|
||||
--- ...
|
||||
|
||||
- yolov5
|
||||
|
||||
- generate_npy
|
||||
|
||||
- exporting
|
||||
|
||||
```
|
||||
|
||||
### dataset.yaml
|
||||
|
||||
The yaml file for COCO dataset has been prepared in `./data/coco.yaml`. For custom dataset, you need to prepare the yaml file and save it under `./data/`. The yaml file is expected to have the following format:
|
||||
```bash
|
||||
# train and val datasets (image directory or *.txt file with image paths)
|
||||
train: ./datasets/images/train/
|
||||
val: ./datasets/images/val/
|
||||
|
||||
# number of classes
|
||||
nc: number of classes
|
||||
|
||||
# class names
|
||||
names: list of class names
|
||||
|
||||
```
|
||||
|
||||
# Train
|
||||
|
||||
For training on MS COCO, execute commands in the folder `yolov5`:
|
||||
```shell
|
||||
CUDA_VISIBLE_DEVICES='0' python train.py --data coco.yaml --cfg yolov5s-noupsample.yaml --weights '' --batch-size 64
|
||||
```
|
||||
|
||||
`CUDA_VISIBLE_DEVICES='0'` indicates the gpu ids.
|
||||
|
||||
`--data` the yaml file. (located under `./data/`)
|
||||
|
||||
`--cfg` the model configuration. (located under `./model/`) (`yolov5s-noupsample.yaml` for 520, `yolov5s.yaml` for 720)
|
||||
|
||||
`--hyp` the path to hyperparameters file. (located under `./data/`)
|
||||
|
||||
`--weights` the path to pretained model weights. ('' if train from scratch)
|
||||
|
||||
`--epochs` the number of epochs to train. (Default: 300)
|
||||
|
||||
`--batch-size` batch size. (Default: 16)
|
||||
|
||||
`--img-size` the input size of the model. (Default: (640, 640))
|
||||
|
||||
`--workers` the maximum number of dataloader workers. (Default: 8)
|
||||
|
||||
By default, the trained models are saved under `./runs/train/`.
|
||||
|
||||
## Generating .npy for different model input
|
||||
We can generating `.npy` for different model input by using `yolov5_generate_npy.py`. Execute commands in the folder `generate_npy`:
|
||||
```shell
|
||||
python yolov5_generate_npy.py --input-h 640 --input-w 640
|
||||
```
|
||||
|
||||
`--input-h` the input height. (Default: 640)
|
||||
`--input-w` the input width. (Default: 640)
|
||||
|
||||
We could get `*.npy`
|
||||
|
||||
# Configure the paths yaml file
|
||||
You are expected to create a yaml file which stores all the paths related to the trained models. This yaml file will be used in the following sections. You can check and modify the `pretrained_paths_520.yaml` and `pretrained_paths_720.yaml` under `/yolov5/data/`. The yaml file is expected to contain the following information:
|
||||
|
||||
```shell
|
||||
grid_dir: path_to_npy_file_directory
|
||||
grid20_path: path_to_grid20_npy_file
|
||||
grid40_path: path_to_grid40_npy_file
|
||||
grid80_path: path_to_grid80_npy_file
|
||||
|
||||
yolov5_dir: path_to_yolov5_directory
|
||||
path: path_to_pretrained_yolov5_model_weights_pt_file
|
||||
yaml_path: path_to_the_model_configuration_yaml_file
|
||||
pt_path: path_to_export_yolov5_model_weights_kneron_supported_file
|
||||
onnx_export_file: path_to_export_yolov5_onnx_model_file
|
||||
|
||||
input_w: model_input_weight
|
||||
input_h: model_input_height
|
||||
|
||||
nc: number_of_classes
|
||||
|
||||
names: list_of_class_names
|
||||
```
|
||||
|
||||
# Save and Convert to ONNX
|
||||
This section will introduce how to save the trained model for pytorch1.4 supported format and convert to ONNX.
|
||||
|
||||
## Exporting ONNX model in the PyTorch 1.7 environment
|
||||
We can convert the model to onnx by using `yolov5_export.py`. Execute commands in the folder `yolov5`:
|
||||
```shell
|
||||
python ../exporting/yolov5_export.py --data path_to_pretrained_path_yaml_file
|
||||
```
|
||||
|
||||
`--data` the path to pretrained model paths yaml file (Default: ../yolov5/data/pretrained_paths_520.yaml)
|
||||
|
||||
We could get onnx model.
|
||||
|
||||
|
||||
## Converting onnx by tool chain
|
||||
Pull the latest [ONNX converter](https://github.com/kneron/ONNX_Convertor/tree/master/optimizer_scripts) from github. You may read the latest document from Github for converting ONNX model. Execute commands in the folder `ONNX_Convertor/optimizer_scripts`:
|
||||
(reference: https://github.com/kneron/ONNX_Convertor/tree/master/optimizer_scripts)
|
||||
|
||||
```shell
|
||||
python -m onnxsim input_onnx_model output_onnx_model
|
||||
|
||||
python pytorch2onnx.py input.pth output.onnx
|
||||
```
|
||||
|
||||
We could get converted onnx model.
|
||||
|
||||
|
||||
# Inference
|
||||
|
||||
Before model inference, we assume that the model has been converted to onnx model as in the previous section (even if only inference pth model). Create a yaml file containing the path information. For model inference on a single image, execute commands in the folder `yolov5`:
|
||||
```shell
|
||||
python inference.py --data path_to_pretrained_path_yaml_file --img-path path_to_image --save-path path_to_saved_image
|
||||
```
|
||||
|
||||
`--img-path` the path to the image.
|
||||
|
||||
`--save-path` the path to draw and save the image with bbox.
|
||||
|
||||
`--data` the path to pretrained model paths yaml file. (Default: data/pretrained_paths_520.yaml)
|
||||
|
||||
`--conf_thres` the score threshold of bounding boxes. (Default: 0.3)
|
||||
|
||||
`--iou_thres` the iou threshold for NMS. (Default: 0.3)
|
||||
|
||||
`--onnx` whether is onnx model inference.
|
||||
|
||||
You could find preprocessing and postprocessing processes under the folder `exporting/yolov5/`.
|
||||
|
||||
|
||||
# Evaluation
|
||||
|
||||
## Evaluation Metric
|
||||
We will use mean Average Precision (mAP) for evaluation. You can find the script for computing mAP in `test.py`.
|
||||
|
||||
`mAP`: mAP is the average of Average Precision (AP). AP summarizes a precision-recall curve as the weighted mean of precisions achieved at each threshold, with the increase in recall from the previous threshold used as the weight:
|
||||
|
||||
<img src="https://latex.codecogs.com/svg.image?AP&space;=&space;\sum_n&space;(R_n-R_{n-1})P_n&space;" title="AP = \sum_n (R_n-R_{n-1})P_n " />
|
||||
|
||||
where <img src="https://latex.codecogs.com/svg.image?R_n" title="R_n" /> and <img src="https://latex.codecogs.com/svg.image?P_n" title="P_n" /> are the precision and recall at the nth threshold. The mAP compares the ground-truth bounding box to the detected box and returns a score. The higher the score, the more accurate the model is in its detections.
|
||||
|
||||
## Evaluation on a Dataset
|
||||
For evaluating the trained model on dataset:
|
||||
|
||||
```shell
|
||||
python test.py --weights path_to_pth_model_weight --data path_to_data_yaml_file
|
||||
```
|
||||
|
||||
`--weights` The path to pretrained model weight. (Defalut: best.pt)
|
||||
|
||||
`--data` The path to data yaml file. (Default: data/coco128.yaml)
|
||||
|
||||
`--img-size` Input shape of the model (Default: (640, 640))
|
||||
|
||||
`--conf-thres` Object confidence threshold. (Default: 0.001)
|
||||
|
||||
`--device` Cuda device, i.e. 0 or 0,1,2,3 or cpu. (Default: cpu)
|
||||
|
||||
`--verbose` Whether report mAP by class.
|
||||
|
||||
## End-to-End Evaluation
|
||||
If you would like to perform an end-to-end test with an image dataset, you can use `inference_e2e.py` under the directory `yolov5` to obtain the prediction results.
|
||||
You have to prepare an initial parameter yaml file for the inference runner. You may check `utils/init_params.yaml` for the format.
|
||||
```shell
|
||||
python inference_e2e.py --img-path path_to_dataset_folder --params path_to_init_params_file --save-path path_to_save_json_file
|
||||
```
|
||||
`--img-path` Path to the dataset directory
|
||||
|
||||
`--params` Path to initial parameter yaml file for the inference runner
|
||||
|
||||
`--save-path` Path to save the prediction to a json file
|
||||
|
||||
`--gpu` GPU id (-1 if cpu) (Default: -1)
|
||||
|
||||
The predictions will be saved into a json file that has the following structure:
|
||||
```bash
|
||||
[
|
||||
{'img_path':image_path_1
|
||||
'bbox': [[l,t,w,h,score,class_id], [l,t,w,h,score,class_id]]
|
||||
},
|
||||
{'img_path':image_path_2
|
||||
'bbox': [[l,t,w,h,score,class_id], [l,t,w,h,score,class_id]]
|
||||
},
|
||||
...
|
||||
]
|
||||
```
|
||||
# Model
|
||||
|
||||
Backbone | Input Size | FPS on 520 | FPS on 720 | Model Size | mAP
|
||||
--- | --- |:---:|:---:|:---:|:---:
|
||||
[YOLOv5s (no upsample)](https://github.com/kneron/Model_Zoo/tree/main/detection/yolov5/yolov5s-noupsample) | 640x640 | 4.91429 | - | 13.1M | 40.4%
|
||||
[YOLOv5s (with upsample)](https://github.com/kneron/Model_Zoo/tree/main/detection/yolov5/yolov5s) | 640x640 | - | 24.4114 | 14.6M | 50.9%
|
||||
|
||||
[YOLOv5s (no upsample)](https://github.com/kneron/Model_Zoo/tree/main/detection/yolov5/yolov5s-noupsample) is the yolov5s model backbone without upsampling operation, since 520 hardware does not support upsampling operation.
|
||||
17
data/annapretrained_paths_520.yaml
Normal file
@ -0,0 +1,17 @@
|
||||
grid_dir: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/
|
||||
grid20_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/20_640x640.npy
|
||||
grid40_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/40_640x640.npy
|
||||
grid80_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/80_640x640.npy
|
||||
|
||||
|
||||
yolov5_dir: C:/Users/rd_de/kneronyolov5/yolov5
|
||||
path: C:/Users/rd_de/kneronyolov5/yolov5/runs/train/exp59/weights/best.pt
|
||||
yaml_path: C:/Users/rd_de/kneronyolov5/yolov5/models/yolov5s-noupsample.yaml
|
||||
pt_path: C:/Users/rd_de/kneronyolov5/yolov5/weights/for520best.pt
|
||||
onnx_export_file: C:/Users/rd_de/kneronyolov5/yolov5/runs/train/exp59/weights/best.onnx
|
||||
|
||||
input_w: 640
|
||||
input_h: 640
|
||||
|
||||
nc: 1
|
||||
names: ['License Plate']
|
||||
33
data/coco.yaml
Normal file
@ -0,0 +1,33 @@
|
||||
# train and val data as 1) directory: path/images/, 2) file: path/images.txt, or 3) list: [path1/images/, path2/images/]
|
||||
path: ../datasets/coco # dataset root dir
|
||||
train: /home/ziyan/Dataset/COCO/coco/images/train2017/ # 118287 images
|
||||
val: /home/ziyan/Dataset/COCO/coco/images/val2017/ # 5000 images
|
||||
|
||||
# number of classes
|
||||
nc: 80
|
||||
|
||||
# class names
|
||||
names: ['person', 'bicycle', 'car', 'motorcycle', 'airplane', 'bus', 'train', 'truck', 'boat', 'traffic light',
|
||||
'fire hydrant', 'stop sign', 'parking meter', 'bench', 'bird', 'cat', 'dog', 'horse', 'sheep', 'cow',
|
||||
'elephant', 'bear', 'zebra', 'giraffe', 'backpack', 'umbrella', 'handbag', 'tie', 'suitcase', 'frisbee',
|
||||
'skis', 'snowboard', 'sports ball', 'kite', 'baseball bat', 'baseball glove', 'skateboard', 'surfboard',
|
||||
'tennis racket', 'bottle', 'wine glass', 'cup', 'fork', 'knife', 'spoon', 'bowl', 'banana', 'apple',
|
||||
'sandwich', 'orange', 'broccoli', 'carrot', 'hot dog', 'pizza', 'donut', 'cake', 'chair', 'couch',
|
||||
'potted plant', 'bed', 'dining table', 'toilet', 'tv', 'laptop', 'mouse', 'remote', 'keyboard', 'cell phone',
|
||||
'microwave', 'oven', 'toaster', 'sink', 'refrigerator', 'book', 'clock', 'vase', 'scissors', 'teddy bear',
|
||||
'hair drier', 'toothbrush']
|
||||
|
||||
# Download script/URL (optional)
|
||||
download: |
|
||||
from utils.general import download, Path
|
||||
# Download labels
|
||||
segments = False # segment or box labels
|
||||
dir = Path(yaml['path']) # dataset root dir
|
||||
url = 'https://github.com/ultralytics/yolov5/releases/download/v1.0/'
|
||||
urls = [url + ('coco2017labels-segments.zip' if segments else 'coco2017labels.zip')] # labels
|
||||
download(urls, dir=dir.parent)
|
||||
# Download data
|
||||
urls = ['http://images.cocodataset.org/zips/train2017.zip', # 19G, 118k images
|
||||
'http://images.cocodataset.org/zips/val2017.zip', # 1G, 5k images
|
||||
'http://images.cocodataset.org/zips/test2017.zip'] # 7G, 41k images (optional)
|
||||
download(urls, dir=dir / 'images', threads=3)
|
||||
28
data/coco128.yaml
Normal file
@ -0,0 +1,28 @@
|
||||
# COCO 2017 dataset http://cocodataset.org - first 128 training images
|
||||
# Train command: python train.py --data coco128.yaml
|
||||
# Default dataset location is next to /yolov5:
|
||||
# /parent_folder
|
||||
# /coco128
|
||||
# /yolov5
|
||||
|
||||
|
||||
# download command/URL (optional)
|
||||
download: https://github.com/ultralytics/yolov5/releases/download/v1.0/coco128.zip
|
||||
|
||||
# train and val data as 1) directory: path/images/, 2) file: path/images.txt, or 3) list: [path1/images/, path2/images/]
|
||||
train: ../coco128/images/train2017/ # 128 images
|
||||
val: ../coco128/images/train2017/ # 128 images
|
||||
|
||||
# number of classes
|
||||
nc: 80
|
||||
|
||||
# class names
|
||||
names: ['person', 'bicycle', 'car', 'motorcycle', 'airplane', 'bus', 'train', 'truck', 'boat', 'traffic light',
|
||||
'fire hydrant', 'stop sign', 'parking meter', 'bench', 'bird', 'cat', 'dog', 'horse', 'sheep', 'cow',
|
||||
'elephant', 'bear', 'zebra', 'giraffe', 'backpack', 'umbrella', 'handbag', 'tie', 'suitcase', 'frisbee',
|
||||
'skis', 'snowboard', 'sports ball', 'kite', 'baseball bat', 'baseball glove', 'skateboard', 'surfboard',
|
||||
'tennis racket', 'bottle', 'wine glass', 'cup', 'fork', 'knife', 'spoon', 'bowl', 'banana', 'apple',
|
||||
'sandwich', 'orange', 'broccoli', 'carrot', 'hot dog', 'pizza', 'donut', 'cake', 'chair', 'couch',
|
||||
'potted plant', 'bed', 'dining table', 'toilet', 'tv', 'laptop', 'mouse', 'remote', 'keyboard', 'cell phone',
|
||||
'microwave', 'oven', 'toaster', 'sink', 'refrigerator', 'book', 'clock', 'vase', 'scissors', 'teddy bear',
|
||||
'hair drier', 'toothbrush']
|
||||
9
data/custom.yaml
Normal file
@ -0,0 +1,9 @@
|
||||
# train and val data as directory: path/labels/
|
||||
train: ../image_data/images/train/
|
||||
val: ../image_data/images/val/
|
||||
|
||||
# number of classes
|
||||
nc: 3
|
||||
|
||||
# class names
|
||||
names: ['air conditioner', 'dog', 'fence']
|
||||
38
data/hyp.finetune.yaml
Normal file
@ -0,0 +1,38 @@
|
||||
# Hyperparameters for VOC finetuning
|
||||
# python train.py --batch 64 --weights yolov5m.pt --data voc.yaml --img 512 --epochs 50
|
||||
# See tutorials for hyperparameter evolution https://github.com/ultralytics/yolov5#tutorials
|
||||
|
||||
|
||||
# Hyperparameter Evolution Results
|
||||
# Generations: 306
|
||||
# P R mAP.5 mAP.5:.95 box obj cls
|
||||
# Metrics: 0.6 0.936 0.896 0.684 0.0115 0.00805 0.00146
|
||||
|
||||
lr0: 0.0032
|
||||
lrf: 0.12
|
||||
momentum: 0.843
|
||||
weight_decay: 0.00036
|
||||
warmup_epochs: 2.0
|
||||
warmup_momentum: 0.5
|
||||
warmup_bias_lr: 0.05
|
||||
box: 0.0296
|
||||
cls: 0.243
|
||||
cls_pw: 0.631
|
||||
obj: 0.301
|
||||
obj_pw: 0.911
|
||||
iou_t: 0.2
|
||||
anchor_t: 2.91
|
||||
# anchors: 3.63
|
||||
fl_gamma: 0.0
|
||||
hsv_h: 0.0138
|
||||
hsv_s: 0.664
|
||||
hsv_v: 0.464
|
||||
degrees: 0.373
|
||||
translate: 0.245
|
||||
scale: 0.898
|
||||
shear: 0.602
|
||||
perspective: 0.0
|
||||
flipud: 0.00856
|
||||
fliplr: 0.5
|
||||
mosaic: 1.0 #0.0
|
||||
mixup: 0.243
|
||||
33
data/hyp.scratch.yaml
Normal file
@ -0,0 +1,33 @@
|
||||
# Hyperparameters for COCO training from scratch
|
||||
# python train.py --batch 40 --cfg yolov5m.yaml --weights '' --data coco.yaml --img 640 --epochs 300
|
||||
# See tutorials for hyperparameter evolution https://github.com/ultralytics/yolov5#tutorials
|
||||
|
||||
|
||||
lr0: 0.01 # initial learning rate (SGD=1E-2, Adam=1E-3)
|
||||
lrf: 0.2 # final OneCycleLR learning rate (lr0 * lrf)
|
||||
momentum: 0.937 # SGD momentum/Adam beta1
|
||||
weight_decay: 0.0005 # optimizer weight decay 5e-4
|
||||
warmup_epochs: 3.0 # warmup epochs (fractions ok)
|
||||
warmup_momentum: 0.8 # warmup initial momentum
|
||||
warmup_bias_lr: 0.1 # warmup initial bias lr
|
||||
box: 0.05 # box loss gain
|
||||
cls: 0.5 # cls loss gain
|
||||
cls_pw: 1.0 # cls BCELoss positive_weight
|
||||
obj: 1.0 # obj loss gain (scale with pixels)
|
||||
obj_pw: 1.0 # obj BCELoss positive_weight
|
||||
iou_t: 0.20 # IoU training threshold
|
||||
anchor_t: 4.0 # anchor-multiple threshold
|
||||
# anchors: 3 # anchors per output layer (0 to ignore)
|
||||
fl_gamma: 0.0 # focal loss gamma (efficientDet default gamma=1.5)
|
||||
hsv_h: 0.015 # image HSV-Hue augmentation (fraction)
|
||||
hsv_s: 0.7 # image HSV-Saturation augmentation (fraction)
|
||||
hsv_v: 0.4 # image HSV-Value augmentation (fraction)
|
||||
degrees: 0.0 # image rotation (+/- deg)
|
||||
translate: 0.1 # image translation (+/- fraction)
|
||||
scale: 0.5 # image scale (+/- gain)
|
||||
shear: 0.0 # image shear (+/- deg)
|
||||
perspective: 0.0 # image perspective (+/- fraction), range 0-0.001
|
||||
flipud: 0.0 # image flip up-down (probability)
|
||||
fliplr: 0.5 # image flip left-right (probability)
|
||||
mosaic: 1.0 # image mosaic (probability)
|
||||
mixup: 0.0 # image mixup (probability)
|
||||
21
data/mepretrained_paths_520.yaml
Normal file
@ -0,0 +1,21 @@
|
||||
grid_dir: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/
|
||||
grid20_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/20_640x640.npy
|
||||
grid40_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/40_640x640.npy
|
||||
grid80_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/80_640x640.npy
|
||||
|
||||
|
||||
yolov5_dir: C:/Users/rd_de/kneronyolov5/yolov5
|
||||
path: C:/Users/rd_de/golfaceyolov5/yolov5/runs/train/exp24/weights/best.pt
|
||||
yaml_path: C:/Users/rd_de/golfaceyolov5/yolov5/models/yolov5s-noupsample.yaml
|
||||
pt_path: C:/Users/rd_de/golfaceyolov5/yolov5/weights/for520best.pt
|
||||
onnx_export_file: C:/Users/rd_de/golfaceyolov5/yolov5/runs/train/exp24/weights/best.onnx
|
||||
|
||||
input_w: 640
|
||||
input_h: 640
|
||||
|
||||
nc: 4
|
||||
names: ['100', '1000', '50', '500']
|
||||
|
||||
|
||||
#nc: 6
|
||||
#names: ['Break circuit', 'bulge', 'foreign object', 'scratch', 'short circuit', 'white spot']
|
||||
17
data/mepretrained_paths_630.yaml
Normal file
@ -0,0 +1,17 @@
|
||||
grid_dir: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/
|
||||
grid20_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/20_640x640.npy
|
||||
grid40_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/40_640x640.npy
|
||||
grid80_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/80_640x640.npy
|
||||
|
||||
|
||||
yolov5_dir: C:/Users/rd_de/kneronyolov5/yolov5
|
||||
path: C:/Users/rd_de/golfaceyolov5/yolov5/runs/train/exp16/weights/best.pt
|
||||
yaml_path: C:/Users/rd_de/golfaceyolov5/yolov5/models/yolov5s.yaml
|
||||
pt_path: C:/Users/rd_de/golfaceyolov5/yolov5/weights/for720best.pt
|
||||
onnx_export_file: C:/Users/rd_de/golfaceyolov5/yolov5/runs/train/exp16/weights/best.onnx
|
||||
|
||||
input_w: 640
|
||||
input_h: 640
|
||||
|
||||
nc: 4
|
||||
names: ['car', 'greenery', 'person', 'tree']
|
||||
17
data/mepretrained_paths_630class2.yaml
Normal file
@ -0,0 +1,17 @@
|
||||
grid_dir: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/
|
||||
grid20_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/20_640x640.npy
|
||||
grid40_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/40_640x640.npy
|
||||
grid80_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/80_640x640.npy
|
||||
|
||||
|
||||
yolov5_dir: C:/Users/rd_de/kneronyolov5/yolov5
|
||||
path: C:/Users/rd_de/golfaceyolov5/yolov5/runs/train/exp13/weights/best.pt
|
||||
yaml_path: C:/Users/rd_de/golfaceyolov5/yolov5/models/yolov5s.yaml
|
||||
pt_path: C:/Users/rd_de/golfaceyolov5/yolov5/weights/for720best.pt
|
||||
onnx_export_file: C:/Users/rd_de/golfaceyolov5/yolov5/runs/train/exp13/weights/best.onnx
|
||||
|
||||
input_w: 640
|
||||
input_h: 640
|
||||
|
||||
nc: 2
|
||||
names: ['bunker', 'pond']
|
||||
16
data/mepretrained_paths_630class8.yaml
Normal file
@ -0,0 +1,16 @@
|
||||
grid_dir: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/
|
||||
grid20_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/20_640x640.npy
|
||||
grid40_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/40_640x640.npy
|
||||
grid80_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/80_640x640.npy
|
||||
|
||||
|
||||
yolov5_dir: C:/Users/rd_de/kneronyolov5/yolov5
|
||||
path: C:/Users/rd_de/golfaceyolov5/yolov5/runs/train/exp29/weights/best.pt
|
||||
yaml_path: C:/Users/rd_de/golfaceyolov5/yolov5/models/yolov5s.yaml
|
||||
pt_path: C:/Users/rd_de/golfaceyolov5/yolov5/weights/for720best.pt
|
||||
onnx_export_file: C:/Users/rd_de/golfaceyolov5/yolov5/runs/train/exp29/weights/best.onnx
|
||||
|
||||
nc: 8
|
||||
names: ['bunker', 'car', 'grass', 'greenery', 'person', 'pond', 'road', 'tree']
|
||||
input_w: 640
|
||||
input_h: 640
|
||||
17
data/mepretrained_paths_720.yaml
Normal file
@ -0,0 +1,17 @@
|
||||
grid_dir: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/
|
||||
grid20_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/20_640x640.npy
|
||||
grid40_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/40_640x640.npy
|
||||
grid80_path: C:/Users/rd_de/kneronyolov5/ai_training/detection/yolov5/generate_npy/80_640x640.npy
|
||||
|
||||
|
||||
yolov5_dir: C:/Users/rd_de/kneronyolov5/yolov5
|
||||
path: C:/Users/rd_de/golfaceyolov5/yolov5/runs/train/exp19/weights/best.pt
|
||||
yaml_path: C:/Users/rd_de/golfaceyolov5/yolov5/models/yolov5s.yaml
|
||||
pt_path: C:/Users/rd_de/golfaceyolov5/yolov5/weights/for720best.pt
|
||||
onnx_export_file: C:/Users/rd_de/golfaceyolov5/yolov5/runs/train/exp19/weights/best.onnx
|
||||
|
||||
input_w: 640
|
||||
input_h: 640
|
||||
|
||||
nc: 4
|
||||
names: ['car', 'greenery', 'person', 'tree']
|
||||
25
data/model_paths_520_coco128.yaml
Normal file
@ -0,0 +1,25 @@
|
||||
grid_dir: ../generate_npy/
|
||||
grid20_path: ../generate_npy/20_640x640.npy
|
||||
grid40_path: ../generate_npy/40_640x640.npy
|
||||
grid80_path: ../generate_npy/80_640x640.npy
|
||||
|
||||
yolov5_dir: ./
|
||||
path: ./runs/train/exp/weights/best.pt
|
||||
yaml_path: ./models/yolov5s-noupsample.yaml
|
||||
pt_path: ./yolov5s-noupsample-coco128.pt # pytorch 1.4
|
||||
onnx_export_file: ./yolov5s-noupsample-coco128.onnx
|
||||
|
||||
input_w: 640
|
||||
input_h: 640
|
||||
# number of classes
|
||||
nc: 80
|
||||
# class names
|
||||
names: ['person', 'bicycle', 'car', 'motorcycle', 'airplane', 'bus', 'train', 'truck', 'boat', 'traffic light',
|
||||
'fire hydrant', 'stop sign', 'parking meter', 'bench', 'bird', 'cat', 'dog', 'horse', 'sheep', 'cow',
|
||||
'elephant', 'bear', 'zebra', 'giraffe', 'backpack', 'umbrella', 'handbag', 'tie', 'suitcase', 'frisbee',
|
||||
'skis', 'snowboard', 'sports ball', 'kite', 'baseball bat', 'baseball glove', 'skateboard', 'surfboard',
|
||||
'tennis racket', 'bottle', 'wine glass', 'cup', 'fork', 'knife', 'spoon', 'bowl', 'banana', 'apple',
|
||||
'sandwich', 'orange', 'broccoli', 'carrot', 'hot dog', 'pizza', 'donut', 'cake', 'chair', 'couch',
|
||||
'potted plant', 'bed', 'dining table', 'toilet', 'tv', 'laptop', 'mouse', 'remote', 'keyboard', 'cell phone',
|
||||
'microwave', 'oven', 'toaster', 'sink', 'refrigerator', 'book', 'clock', 'vase', 'scissors', 'teddy bear',
|
||||
'hair drier', 'toothbrush']
|
||||
25
data/pretrained_paths_520.yaml
Normal file
@ -0,0 +1,25 @@
|
||||
grid_dir: ../generate_npy/
|
||||
grid20_path: ../generate_npy/20_640x640.npy
|
||||
grid40_path: ../generate_npy/40_640x640.npy
|
||||
grid80_path: ../generate_npy/80_640x640.npy
|
||||
|
||||
yolov5_dir: ./
|
||||
path: ./best.pt
|
||||
yaml_path: ./models/yolov5s-noupsample.yaml
|
||||
pt_path: ./yolov5s-noupsample.pt # pytorch 1.4
|
||||
onnx_export_file: ./yolov5s-noupsample.onnx
|
||||
|
||||
input_w: 640
|
||||
input_h: 640
|
||||
# number of classes
|
||||
nc: 80
|
||||
# class names
|
||||
names: ['person', 'bicycle', 'car', 'motorcycle', 'airplane', 'bus', 'train', 'truck', 'boat', 'traffic light',
|
||||
'fire hydrant', 'stop sign', 'parking meter', 'bench', 'bird', 'cat', 'dog', 'horse', 'sheep', 'cow',
|
||||
'elephant', 'bear', 'zebra', 'giraffe', 'backpack', 'umbrella', 'handbag', 'tie', 'suitcase', 'frisbee',
|
||||
'skis', 'snowboard', 'sports ball', 'kite', 'baseball bat', 'baseball glove', 'skateboard', 'surfboard',
|
||||
'tennis racket', 'bottle', 'wine glass', 'cup', 'fork', 'knife', 'spoon', 'bowl', 'banana', 'apple',
|
||||
'sandwich', 'orange', 'broccoli', 'carrot', 'hot dog', 'pizza', 'donut', 'cake', 'chair', 'couch',
|
||||
'potted plant', 'bed', 'dining table', 'toilet', 'tv', 'laptop', 'mouse', 'remote', 'keyboard', 'cell phone',
|
||||
'microwave', 'oven', 'toaster', 'sink', 'refrigerator', 'book', 'clock', 'vase', 'scissors', 'teddy bear',
|
||||
'hair drier', 'toothbrush']
|
||||
25
data/pretrained_paths_720.yaml
Normal file
@ -0,0 +1,25 @@
|
||||
grid_dir: ../generate_npy/
|
||||
grid20_path: ../generate_npy/20_640x640.npy
|
||||
grid40_path: ../generate_npy/40_640x640.npy
|
||||
grid80_path: ../generate_npy/80_640x640.npy
|
||||
|
||||
yolov5_dir: ./
|
||||
path: ./best.pt
|
||||
yaml_path: ./models/yolov5s.yaml
|
||||
pt_path: ./yolov5s.pt # pytorch 1.4
|
||||
onnx_export_file: ./yolov5s.onnx
|
||||
|
||||
input_w: 640
|
||||
input_h: 640
|
||||
# number of classes
|
||||
nc: 80
|
||||
# class names
|
||||
names: ['person', 'bicycle', 'car', 'motorcycle', 'airplane', 'bus', 'train', 'truck', 'boat', 'traffic light',
|
||||
'fire hydrant', 'stop sign', 'parking meter', 'bench', 'bird', 'cat', 'dog', 'horse', 'sheep', 'cow',
|
||||
'elephant', 'bear', 'zebra', 'giraffe', 'backpack', 'umbrella', 'handbag', 'tie', 'suitcase', 'frisbee',
|
||||
'skis', 'snowboard', 'sports ball', 'kite', 'baseball bat', 'baseball glove', 'skateboard', 'surfboard',
|
||||
'tennis racket', 'bottle', 'wine glass', 'cup', 'fork', 'knife', 'spoon', 'bowl', 'banana', 'apple',
|
||||
'sandwich', 'orange', 'broccoli', 'carrot', 'hot dog', 'pizza', 'donut', 'cake', 'chair', 'couch',
|
||||
'potted plant', 'bed', 'dining table', 'toilet', 'tv', 'laptop', 'mouse', 'remote', 'keyboard', 'cell phone',
|
||||
'microwave', 'oven', 'toaster', 'sink', 'refrigerator', 'book', 'clock', 'vase', 'scissors', 'teddy bear',
|
||||
'hair drier', 'toothbrush']
|
||||
24
data/scripts/get_coco.sh
Normal file
@ -0,0 +1,24 @@
|
||||
#!/bin/bash
|
||||
# COCO 2017 dataset http://cocodataset.org
|
||||
# Download command: bash data/scripts/get_coco.sh
|
||||
# Train command: python train.py --data coco.yaml
|
||||
# Default dataset location is next to /yolov5:
|
||||
# /parent_folder
|
||||
# /coco
|
||||
# /yolov5
|
||||
|
||||
# Download/unzip labels
|
||||
d='../' # unzip directory
|
||||
url=https://github.com/ultralytics/yolov5/releases/download/v1.0/
|
||||
f='coco2017labels.zip' # 68 MB
|
||||
echo 'Downloading' $url$f ' ...' && curl -L $url$f -o $f && unzip -q $f -d $d && rm $f # download, unzip, remove
|
||||
|
||||
# Download/unzip images
|
||||
d='../coco/images' # unzip directory
|
||||
url=http://images.cocodataset.org/zips/
|
||||
f1='train2017.zip' # 19G, 118k images
|
||||
f2='val2017.zip' # 1G, 5k images
|
||||
f3='test2017.zip' # 7G, 41k images (optional)
|
||||
for f in $f1 $f2; do
|
||||
echo 'Downloading' $url$f ' ...' && curl -L $url$f -o $f && unzip -q $f -d $d && rm $f # download, unzip, remove
|
||||
done
|
||||
137
data/scripts/get_voc.sh
Normal file
@ -0,0 +1,137 @@
|
||||
#!/bin/bash
|
||||
# PASCAL VOC dataset http://host.robots.ox.ac.uk/pascal/VOC/
|
||||
# Download command: bash data/scripts/get_voc.sh
|
||||
# Train command: python train.py --data voc.yaml
|
||||
# Default dataset location is next to /yolov5:
|
||||
# /parent_folder
|
||||
# /VOC
|
||||
# /yolov5
|
||||
|
||||
start=$(date +%s)
|
||||
mkdir -p ../tmp
|
||||
cd ../tmp/
|
||||
|
||||
# Download/unzip images and labels
|
||||
d='.' # unzip directory
|
||||
url=https://github.com/ultralytics/yolov5/releases/download/v1.0/
|
||||
f1=VOCtrainval_06-Nov-2007.zip # 446MB, 5012 images
|
||||
f2=VOCtest_06-Nov-2007.zip # 438MB, 4953 images
|
||||
f3=VOCtrainval_11-May-2012.zip # 1.95GB, 17126 images
|
||||
for f in $f1 $f2 $f3; do
|
||||
echo 'Downloading' $url$f ' ...' && curl -L $url$f -o $f && unzip -q $f -d $d && rm $f # download, unzip, remove
|
||||
done
|
||||
|
||||
end=$(date +%s)
|
||||
runtime=$((end - start))
|
||||
echo "Completed in" $runtime "seconds"
|
||||
|
||||
echo "Splitting dataset..."
|
||||
python3 - "$@" <<END
|
||||
import xml.etree.ElementTree as ET
|
||||
import pickle
|
||||
import os
|
||||
from os import listdir, getcwd
|
||||
from os.path import join
|
||||
|
||||
sets=[('2012', 'train'), ('2012', 'val'), ('2007', 'train'), ('2007', 'val'), ('2007', 'test')]
|
||||
|
||||
classes = ["aeroplane", "bicycle", "bird", "boat", "bottle", "bus", "car", "cat", "chair", "cow", "diningtable", "dog", "horse", "motorbike", "person", "pottedplant", "sheep", "sofa", "train", "tvmonitor"]
|
||||
|
||||
|
||||
def convert(size, box):
|
||||
dw = 1./(size[0])
|
||||
dh = 1./(size[1])
|
||||
x = (box[0] + box[1])/2.0 - 1
|
||||
y = (box[2] + box[3])/2.0 - 1
|
||||
w = box[1] - box[0]
|
||||
h = box[3] - box[2]
|
||||
x = x*dw
|
||||
w = w*dw
|
||||
y = y*dh
|
||||
h = h*dh
|
||||
return (x,y,w,h)
|
||||
|
||||
def convert_annotation(year, image_id):
|
||||
in_file = open('VOCdevkit/VOC%s/Annotations/%s.xml'%(year, image_id))
|
||||
out_file = open('VOCdevkit/VOC%s/labels/%s.txt'%(year, image_id), 'w')
|
||||
tree=ET.parse(in_file)
|
||||
root = tree.getroot()
|
||||
size = root.find('size')
|
||||
w = int(size.find('width').text)
|
||||
h = int(size.find('height').text)
|
||||
|
||||
for obj in root.iter('object'):
|
||||
difficult = obj.find('difficult').text
|
||||
cls = obj.find('name').text
|
||||
if cls not in classes or int(difficult)==1:
|
||||
continue
|
||||
cls_id = classes.index(cls)
|
||||
xmlbox = obj.find('bndbox')
|
||||
b = (float(xmlbox.find('xmin').text), float(xmlbox.find('xmax').text), float(xmlbox.find('ymin').text), float(xmlbox.find('ymax').text))
|
||||
bb = convert((w,h), b)
|
||||
out_file.write(str(cls_id) + " " + " ".join([str(a) for a in bb]) + '\n')
|
||||
|
||||
wd = getcwd()
|
||||
|
||||
for year, image_set in sets:
|
||||
if not os.path.exists('VOCdevkit/VOC%s/labels/'%(year)):
|
||||
os.makedirs('VOCdevkit/VOC%s/labels/'%(year))
|
||||
image_ids = open('VOCdevkit/VOC%s/ImageSets/Main/%s.txt'%(year, image_set)).read().strip().split()
|
||||
list_file = open('%s_%s.txt'%(year, image_set), 'w')
|
||||
for image_id in image_ids:
|
||||
list_file.write('%s/VOCdevkit/VOC%s/JPEGImages/%s.jpg\n'%(wd, year, image_id))
|
||||
convert_annotation(year, image_id)
|
||||
list_file.close()
|
||||
|
||||
END
|
||||
|
||||
cat 2007_train.txt 2007_val.txt 2012_train.txt 2012_val.txt >train.txt
|
||||
cat 2007_train.txt 2007_val.txt 2007_test.txt 2012_train.txt 2012_val.txt >train.all.txt
|
||||
|
||||
python3 - "$@" <<END
|
||||
|
||||
import shutil
|
||||
import os
|
||||
os.system('mkdir ../VOC/')
|
||||
os.system('mkdir ../VOC/images')
|
||||
os.system('mkdir ../VOC/images/train')
|
||||
os.system('mkdir ../VOC/images/val')
|
||||
|
||||
os.system('mkdir ../VOC/labels')
|
||||
os.system('mkdir ../VOC/labels/train')
|
||||
os.system('mkdir ../VOC/labels/val')
|
||||
|
||||
import os
|
||||
print(os.path.exists('../tmp/train.txt'))
|
||||
f = open('../tmp/train.txt', 'r')
|
||||
lines = f.readlines()
|
||||
|
||||
for line in lines:
|
||||
line = "/".join(line.split('/')[-5:]).strip()
|
||||
if (os.path.exists("../" + line)):
|
||||
os.system("cp ../"+ line + " ../VOC/images/train")
|
||||
|
||||
line = line.replace('JPEGImages', 'labels')
|
||||
line = line.replace('jpg', 'txt')
|
||||
if (os.path.exists("../" + line)):
|
||||
os.system("cp ../"+ line + " ../VOC/labels/train")
|
||||
|
||||
|
||||
print(os.path.exists('../tmp/2007_test.txt'))
|
||||
f = open('../tmp/2007_test.txt', 'r')
|
||||
lines = f.readlines()
|
||||
|
||||
for line in lines:
|
||||
line = "/".join(line.split('/')[-5:]).strip()
|
||||
if (os.path.exists("../" + line)):
|
||||
os.system("cp ../"+ line + " ../VOC/images/val")
|
||||
|
||||
line = line.replace('JPEGImages', 'labels')
|
||||
line = line.replace('jpg', 'txt')
|
||||
if (os.path.exists("../" + line)):
|
||||
os.system("cp ../"+ line + " ../VOC/labels/val")
|
||||
|
||||
END
|
||||
|
||||
rm -rf ../tmp # remove temporary directory
|
||||
echo "VOC download done."
|
||||
|
After Width: | Height: | Size: 49 KiB |
|
After Width: | Height: | Size: 45 KiB |
|
After Width: | Height: | Size: 60 KiB |
|
After Width: | Height: | Size: 43 KiB |
|
After Width: | Height: | Size: 31 KiB |
|
After Width: | Height: | Size: 32 KiB |
|
After Width: | Height: | Size: 38 KiB |
|
After Width: | Height: | Size: 34 KiB |
|
After Width: | Height: | Size: 38 KiB |
|
After Width: | Height: | Size: 40 KiB |
@ -0,0 +1,3 @@
|
||||
0 0.3703125 0.66875 0.1203125 0.0109375
|
||||
1 0.6375 0.73046875 0.15625 0.14140625
|
||||
1 0.41875 0.76875 0.28828125 0.0765625
|
||||
@ -0,0 +1,2 @@
|
||||
0 0.771875 0.50859375 0.03203125 0.0703125
|
||||
0 0.71484375 0.46171875 0.05 0.0515625
|
||||
@ -0,0 +1,3 @@
|
||||
0 0.02265625 0.95078125 0.0453125 0.0953125
|
||||
0 0.09375 0.7875 0.0328125 0.07421875
|
||||
0 0.15703125 0.68046875 0.04921875 0.090625
|
||||
@ -0,0 +1,2 @@
|
||||
0 0.0203125 0.92109375 0.040625 0.1578125
|
||||
0 0.1046875 0.73046875 0.0609375 0.07421875
|
||||
@ -0,0 +1,2 @@
|
||||
1 0.590625 0.2671875 0.0546875 0.03125
|
||||
1 0.6546875 0.28359375 0.06875 0.03046875
|
||||
@ -0,0 +1,2 @@
|
||||
1 0.67265625 0.31640625 0.1453125 0.09765625
|
||||
1 0.81484375 0.38359375 0.12421875 0.11015625
|
||||
@ -0,0 +1,3 @@
|
||||
1 0.8921875 0.42734375 0.0265625 0.03671875
|
||||
1 0.94609375 0.47578125 0.02890625 0.05703125
|
||||
1 0.98671875 0.53046875 0.025 0.05546875
|
||||
@ -0,0 +1,3 @@
|
||||
1 0.80078125 0.45234375 0.115625 0.07890625
|
||||
1 0.93671875 0.53359375 0.1265625 0.1671875
|
||||
1 0.678125 0.41171875 0.03125 0.0265625
|
||||
@ -0,0 +1 @@
|
||||
1 0.6609375 0.4421875 0.03046875 0.02265625
|
||||
@ -0,0 +1 @@
|
||||
1 0.5234375 0.390625 0.0328125 0.01640625
|
||||
172
detect.py
Normal file
@ -0,0 +1,172 @@
|
||||
import argparse
|
||||
import time
|
||||
from pathlib import Path
|
||||
|
||||
import cv2
|
||||
import torch
|
||||
import torch.backends.cudnn as cudnn
|
||||
from numpy import random
|
||||
|
||||
from models.experimental import attempt_load
|
||||
from utils.datasets import LoadStreams, LoadImages
|
||||
from utils.general import check_img_size, non_max_suppression, apply_classifier, scale_coords, xyxy2xywh, \
|
||||
strip_optimizer, set_logging, increment_path
|
||||
from utils.plots import plot_one_box
|
||||
from utils.torch_utils import select_device, load_classifier, time_synchronized
|
||||
|
||||
|
||||
def detect(save_img=False):
|
||||
source, weights, view_img, save_txt, imgsz = opt.source, opt.weights, opt.view_img, opt.save_txt, opt.img_size
|
||||
webcam = source.isnumeric() or source.endswith('.txt') or source.lower().startswith(
|
||||
('rtsp://', 'rtmp://', 'http://'))
|
||||
|
||||
# Directories
|
||||
save_dir = Path(increment_path(Path(opt.project) / opt.name, exist_ok=opt.exist_ok)) # increment run
|
||||
(save_dir / 'labels' if save_txt else save_dir).mkdir(parents=True, exist_ok=True) # make dir
|
||||
|
||||
# Initialize
|
||||
set_logging()
|
||||
device = select_device(opt.device)
|
||||
half = device.type != 'cpu' # half precision only supported on CUDA
|
||||
|
||||
# Load model
|
||||
model = attempt_load(weights, map_location=device) # load FP32 model
|
||||
imgsz = check_img_size(imgsz, s=model.stride.max()) # check img_size
|
||||
if half:
|
||||
model.half() # to FP16
|
||||
|
||||
# Second-stage classifier
|
||||
classify = False
|
||||
if classify:
|
||||
modelc = load_classifier(name='resnet101', n=2) # initialize
|
||||
modelc.load_state_dict(torch.load('weights/resnet101.pt', map_location=device)['model']).to(device).eval()
|
||||
|
||||
# Set Dataloader
|
||||
vid_path, vid_writer = None, None
|
||||
if webcam:
|
||||
view_img = True
|
||||
cudnn.benchmark = True # set True to speed up constant image size inference
|
||||
dataset = LoadStreams(source, img_size=imgsz)
|
||||
else:
|
||||
save_img = True
|
||||
dataset = LoadImages(source, img_size=imgsz)
|
||||
|
||||
# Get names and colors
|
||||
names = model.module.names if hasattr(model, 'module') else model.names
|
||||
colors = [[random.randint(0, 255) for _ in range(3)] for _ in names]
|
||||
|
||||
# Run inference
|
||||
t0 = time.time()
|
||||
img = torch.zeros((1, 3, imgsz, imgsz), device=device) # init img
|
||||
_ = model(img.half() if half else img) if device.type != 'cpu' else None # run once
|
||||
for path, img, im0s, vid_cap in dataset:
|
||||
img = torch.from_numpy(img).to(device)
|
||||
img = img.half() if half else img.float() # uint8 to fp16/32
|
||||
img /= 255.0 # 0 - 255 to 0.0 - 1.0
|
||||
if img.ndimension() == 3:
|
||||
img = img.unsqueeze(0)
|
||||
|
||||
# Inference
|
||||
t1 = time_synchronized()
|
||||
pred = model(img, augment=opt.augment)[0]
|
||||
|
||||
# Apply NMS
|
||||
pred = non_max_suppression(pred, opt.conf_thres, opt.iou_thres, classes=opt.classes, agnostic=opt.agnostic_nms)
|
||||
t2 = time_synchronized()
|
||||
|
||||
# Apply Classifier
|
||||
if classify:
|
||||
pred = apply_classifier(pred, modelc, img, im0s)
|
||||
|
||||
# Process detections
|
||||
for i, det in enumerate(pred): # detections per image
|
||||
if webcam: # batch_size >= 1
|
||||
p, s, im0 = Path(path[i]), '%g: ' % i, im0s[i].copy()
|
||||
else:
|
||||
p, s, im0 = Path(path), '', im0s
|
||||
|
||||
save_path = str(save_dir / p.name)
|
||||
txt_path = str(save_dir / 'labels' / p.stem) + ('_%g' % dataset.frame if dataset.mode == 'video' else '')
|
||||
s += '%gx%g ' % img.shape[2:] # print string
|
||||
gn = torch.tensor(im0.shape)[[1, 0, 1, 0]] # normalization gain whwh
|
||||
if len(det):
|
||||
# Rescale boxes from img_size to im0 size
|
||||
det[:, :4] = scale_coords(img.shape[2:], det[:, :4], im0.shape).round()
|
||||
|
||||
# Print results
|
||||
for c in det[:, -1].unique():
|
||||
n = (det[:, -1] == c).sum() # detections per class
|
||||
s += '%g %ss, ' % (n, names[int(c)]) # add to string
|
||||
|
||||
# Write results
|
||||
for *xyxy, conf, cls in reversed(det):
|
||||
if save_txt: # Write to file
|
||||
xywh = (xyxy2xywh(torch.tensor(xyxy).view(1, 4)) / gn).view(-1).tolist() # normalized xywh
|
||||
line = (cls, *xywh, conf) if opt.save_conf else (cls, *xywh) # label format
|
||||
with open(txt_path + '.txt', 'a') as f:
|
||||
f.write(('%g ' * len(line)).rstrip() % line + '\n')
|
||||
|
||||
if save_img or view_img: # Add bbox to image
|
||||
label = '%s %.2f' % (names[int(cls)], conf)
|
||||
plot_one_box(xyxy, im0, label=label, color=colors[int(cls)], line_thickness=3)
|
||||
|
||||
# Print time (inference + NMS)
|
||||
print('%sDone. (%.3fs)' % (s, t2 - t1))
|
||||
|
||||
# Stream results
|
||||
if view_img:
|
||||
cv2.imshow(p, im0)
|
||||
if cv2.waitKey(1) == ord('q'): # q to quit
|
||||
raise StopIteration
|
||||
|
||||
# Save results (image with detections)
|
||||
if save_img:
|
||||
if dataset.mode == 'images':
|
||||
cv2.imwrite(save_path, im0)
|
||||
else:
|
||||
if vid_path != save_path: # new video
|
||||
vid_path = save_path
|
||||
if isinstance(vid_writer, cv2.VideoWriter):
|
||||
vid_writer.release() # release previous video writer
|
||||
|
||||
fourcc = 'mp4v' # output video codec
|
||||
fps = vid_cap.get(cv2.CAP_PROP_FPS)
|
||||
w = int(vid_cap.get(cv2.CAP_PROP_FRAME_WIDTH))
|
||||
h = int(vid_cap.get(cv2.CAP_PROP_FRAME_HEIGHT))
|
||||
vid_writer = cv2.VideoWriter(save_path, cv2.VideoWriter_fourcc(*fourcc), fps, (w, h))
|
||||
vid_writer.write(im0)
|
||||
|
||||
if save_txt or save_img:
|
||||
print('Results saved to %s' % save_dir)
|
||||
|
||||
print('Done. (%.3fs)' % (time.time() - t0))
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
parser = argparse.ArgumentParser()
|
||||
parser.add_argument('--weights', nargs='+', type=str, default='yolov5s.pt', help='model.pt path(s)')
|
||||
parser.add_argument('--source', type=str, default='data/images', help='source') # file/folder, 0 for webcam
|
||||
parser.add_argument('--img-size', type=int, default=640, help='inference size (pixels)')
|
||||
parser.add_argument('--conf-thres', type=float, default=0.25, help='object confidence threshold')
|
||||
parser.add_argument('--iou-thres', type=float, default=0.45, help='IOU threshold for NMS')
|
||||
parser.add_argument('--device', default='', help='cuda device, i.e. 0 or 0,1,2,3 or cpu')
|
||||
parser.add_argument('--view-img', action='store_true', help='display results')
|
||||
parser.add_argument('--save-txt', action='store_true', help='save results to *.txt')
|
||||
parser.add_argument('--save-conf', action='store_true', help='save confidences in --save-txt labels')
|
||||
parser.add_argument('--classes', nargs='+', type=int, help='filter by class: --class 0, or --class 0 2 3')
|
||||
parser.add_argument('--agnostic-nms', action='store_true', help='class-agnostic NMS')
|
||||
parser.add_argument('--augment', action='store_true', help='augmented inference')
|
||||
parser.add_argument('--update', action='store_true', help='update all models')
|
||||
parser.add_argument('--project', default='runs/detect', help='save results to project/name')
|
||||
parser.add_argument('--name', default='exp', help='save results to project/name')
|
||||
parser.add_argument('--exist-ok', action='store_true', help='existing project/name ok, do not increment')
|
||||
opt = parser.parse_args()
|
||||
print(opt)
|
||||
|
||||
with torch.no_grad():
|
||||
if opt.update: # update all models (to fix SourceChangeWarning)
|
||||
for opt.weights in ['yolov5s.pt', 'yolov5m.pt', 'yolov5l.pt', 'yolov5x.pt']:
|
||||
detect()
|
||||
strip_optimizer(opt.weights)
|
||||
else:
|
||||
detect()
|
||||
94
export.py
Normal file
@ -0,0 +1,94 @@
|
||||
"""Exports a YOLOv5 *.pt model to ONNX and TorchScript formats
|
||||
|
||||
Usage:
|
||||
$ export PYTHONPATH="$PWD" && python models/export.py --weights ./weights/yolov5s.pt --img 640 --batch 1
|
||||
"""
|
||||
|
||||
import argparse
|
||||
import sys
|
||||
import time
|
||||
|
||||
sys.path.append('./') # to run '$ python *.py' files in subdirectories
|
||||
|
||||
import torch
|
||||
import torch.nn as nn
|
||||
|
||||
import models
|
||||
from models.experimental import attempt_load
|
||||
from utils.activations import Hardswish
|
||||
from utils.general import set_logging, check_img_size
|
||||
|
||||
if __name__ == '__main__':
|
||||
parser = argparse.ArgumentParser()
|
||||
parser.add_argument('--weights', type=str, default='./yolov5s.pt', help='weights path') # from yolov5/models/
|
||||
parser.add_argument('--img-size', nargs='+', type=int, default=[640, 640], help='image size') # height, width
|
||||
parser.add_argument('--batch-size', type=int, default=1, help='batch size')
|
||||
opt = parser.parse_args()
|
||||
opt.img_size *= 2 if len(opt.img_size) == 1 else 1 # expand
|
||||
print(opt)
|
||||
set_logging()
|
||||
t = time.time()
|
||||
|
||||
# Load PyTorch model
|
||||
model = attempt_load(opt.weights, map_location=torch.device('cpu')) # load FP32 model
|
||||
labels = model.names
|
||||
|
||||
# Checks
|
||||
gs = int(max(model.stride)) # grid size (max stride)
|
||||
opt.img_size = [check_img_size(x, gs) for x in opt.img_size] # verify img_size are gs-multiples
|
||||
|
||||
# Input
|
||||
img = torch.zeros(opt.batch_size, 3, *opt.img_size) # image size(1,3,320,192) iDetection
|
||||
|
||||
# Update model
|
||||
for k, m in model.named_modules():
|
||||
m._non_persistent_buffers_set = set() # pytorch 1.6.0 compatibility
|
||||
if isinstance(m, models.common.Conv) and isinstance(m.act, nn.Hardswish):
|
||||
m.act = Hardswish() # assign activation
|
||||
# if isinstance(m, models.yolo.Detect):
|
||||
# m.forward = m.forward_export # assign forward (optional)
|
||||
model.model[-1].export = True # set Detect() layer export=True
|
||||
y = model(img) # dry run
|
||||
|
||||
# TorchScript export
|
||||
try:
|
||||
print('\nStarting TorchScript export with torch %s...' % torch.__version__)
|
||||
f = opt.weights.replace('.pt', '.torchscript.pt') # filename
|
||||
ts = torch.jit.trace(model, img)
|
||||
ts.save(f)
|
||||
print('TorchScript export success, saved as %s' % f)
|
||||
except Exception as e:
|
||||
print('TorchScript export failure: %s' % e)
|
||||
|
||||
# ONNX export
|
||||
try:
|
||||
import onnx
|
||||
|
||||
print('\nStarting ONNX export with onnx %s...' % onnx.__version__)
|
||||
f = opt.weights.replace('.pt', '.onnx') # filename
|
||||
torch.onnx.export(model, img, f, verbose=False, opset_version=12, input_names=['images'],
|
||||
output_names=['classes', 'boxes'] if y is None else ['output'])
|
||||
|
||||
# Checks
|
||||
onnx_model = onnx.load(f) # load onnx model
|
||||
onnx.checker.check_model(onnx_model) # check onnx model
|
||||
# print(onnx.helper.printable_graph(onnx_model.graph)) # print a human readable model
|
||||
print('ONNX export success, saved as %s' % f)
|
||||
except Exception as e:
|
||||
print('ONNX export failure: %s' % e)
|
||||
|
||||
# CoreML export
|
||||
try:
|
||||
import coremltools as ct
|
||||
|
||||
print('\nStarting CoreML export with coremltools %s...' % ct.__version__)
|
||||
# convert model from torchscript and apply pixel scaling as per detect.py
|
||||
model = ct.convert(ts, inputs=[ct.ImageType(name='image', shape=img.shape, scale=1 / 255.0, bias=[0, 0, 0])])
|
||||
f = opt.weights.replace('.pt', '.mlmodel') # filename
|
||||
model.save(f)
|
||||
print('CoreML export success, saved as %s' % f)
|
||||
except Exception as e:
|
||||
print('CoreML export failure: %s' % e)
|
||||
|
||||
# Finish
|
||||
print('\nExport complete (%.2fs). Visualize with https://github.com/lutzroeder/netron.' % (time.time() - t))
|
||||
119
hubconf.py
Normal file
@ -0,0 +1,119 @@
|
||||
"""File for accessing YOLOv5 via PyTorch Hub https://pytorch.org/hub/
|
||||
|
||||
Usage:
|
||||
import torch
|
||||
model = torch.hub.load('ultralytics/yolov5', 'yolov5s', pretrained=True, channels=3, classes=80)
|
||||
"""
|
||||
|
||||
from pathlib import Path
|
||||
|
||||
import torch
|
||||
|
||||
from models.yolo import Model
|
||||
from utils.general import set_logging
|
||||
from utils.google_utils import attempt_download
|
||||
|
||||
dependencies = ['torch', 'yaml']
|
||||
set_logging()
|
||||
|
||||
|
||||
def create(name, pretrained, channels, classes):
|
||||
"""Creates a specified YOLOv5 model
|
||||
|
||||
Arguments:
|
||||
name (str): name of model, i.e. 'yolov5s'
|
||||
pretrained (bool): load pretrained weights into the model
|
||||
channels (int): number of input channels
|
||||
classes (int): number of model classes
|
||||
|
||||
Returns:
|
||||
pytorch model
|
||||
"""
|
||||
config = Path(__file__).parent / 'models' / f'{name}.yaml' # model.yaml path
|
||||
try:
|
||||
model = Model(config, channels, classes)
|
||||
if pretrained:
|
||||
fname = f'{name}.pt' # checkpoint filename
|
||||
attempt_download(fname) # download if not found locally
|
||||
ckpt = torch.load(fname, map_location=torch.device('cpu')) # load
|
||||
state_dict = ckpt['model'].float().state_dict() # to FP32
|
||||
state_dict = {k: v for k, v in state_dict.items() if model.state_dict()[k].shape == v.shape} # filter
|
||||
model.load_state_dict(state_dict, strict=False) # load
|
||||
if len(ckpt['model'].names) == classes:
|
||||
model.names = ckpt['model'].names # set class names attribute
|
||||
# model = model.autoshape() # for PIL/cv2/np inputs and NMS
|
||||
return model
|
||||
|
||||
except Exception as e:
|
||||
help_url = 'https://github.com/ultralytics/yolov5/issues/36'
|
||||
s = 'Cache maybe be out of date, try force_reload=True. See %s for help.' % help_url
|
||||
raise Exception(s) from e
|
||||
|
||||
|
||||
def yolov5s(pretrained=False, channels=3, classes=80):
|
||||
"""YOLOv5-small model from https://github.com/ultralytics/yolov5
|
||||
|
||||
Arguments:
|
||||
pretrained (bool): load pretrained weights into the model, default=False
|
||||
channels (int): number of input channels, default=3
|
||||
classes (int): number of model classes, default=80
|
||||
|
||||
Returns:
|
||||
pytorch model
|
||||
"""
|
||||
return create('yolov5s', pretrained, channels, classes)
|
||||
|
||||
|
||||
def yolov5m(pretrained=False, channels=3, classes=80):
|
||||
"""YOLOv5-medium model from https://github.com/ultralytics/yolov5
|
||||
|
||||
Arguments:
|
||||
pretrained (bool): load pretrained weights into the model, default=False
|
||||
channels (int): number of input channels, default=3
|
||||
classes (int): number of model classes, default=80
|
||||
|
||||
Returns:
|
||||
pytorch model
|
||||
"""
|
||||
return create('yolov5m', pretrained, channels, classes)
|
||||
|
||||
|
||||
def yolov5l(pretrained=False, channels=3, classes=80):
|
||||
"""YOLOv5-large model from https://github.com/ultralytics/yolov5
|
||||
|
||||
Arguments:
|
||||
pretrained (bool): load pretrained weights into the model, default=False
|
||||
channels (int): number of input channels, default=3
|
||||
classes (int): number of model classes, default=80
|
||||
|
||||
Returns:
|
||||
pytorch model
|
||||
"""
|
||||
return create('yolov5l', pretrained, channels, classes)
|
||||
|
||||
|
||||
def yolov5x(pretrained=False, channels=3, classes=80):
|
||||
"""YOLOv5-xlarge model from https://github.com/ultralytics/yolov5
|
||||
|
||||
Arguments:
|
||||
pretrained (bool): load pretrained weights into the model, default=False
|
||||
channels (int): number of input channels, default=3
|
||||
classes (int): number of model classes, default=80
|
||||
|
||||
Returns:
|
||||
pytorch model
|
||||
"""
|
||||
return create('yolov5x', pretrained, channels, classes)
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
model = create(name='yolov5s', pretrained=True, channels=3, classes=80) # example
|
||||
model = model.fuse().autoshape() # for PIL/cv2/np inputs and NMS
|
||||
|
||||
# Verify inference
|
||||
from PIL import Image
|
||||
|
||||
imgs = [Image.open(x) for x in Path('data/images').glob('*.jpg')]
|
||||
results = model(imgs)
|
||||
results.show()
|
||||
results.print()
|
||||
44
kneron/bie2nef.py
Normal file
@ -0,0 +1,44 @@
|
||||
import ktc
|
||||
import os
|
||||
import shutil
|
||||
import subprocess
|
||||
|
||||
# 設定 `.bie` 和 `.nef` 的存放目錄
|
||||
onnx_dir = "runs/train/exp24/weights/"
|
||||
bie_file = os.path.join(onnx_dir, "input.kdp720.scaled.bie") # 確保 `.bie` 路徑正確
|
||||
|
||||
# 確保 `.bie` 檔案存在
|
||||
if not os.path.exists(bie_file):
|
||||
raise FileNotFoundError(f"❌ Error: BIE file not found at {bie_file}")
|
||||
|
||||
print(f"✅ Found BIE file: {bie_file}")
|
||||
|
||||
# 初始化 ModelConfig
|
||||
km = ktc.ModelConfig(20008, "0001", "720", bie_path=bie_file)
|
||||
|
||||
# 執行 `.nef` 轉換
|
||||
nef_model_path = ktc.compile([km])
|
||||
|
||||
# 打印出 `.nef` 生成的路徑
|
||||
print(f"🔍 Generated NEF file at: {nef_model_path}")
|
||||
|
||||
# 確保 `.nef` 轉換成功
|
||||
if not nef_model_path or not os.path.exists(nef_model_path):
|
||||
raise RuntimeError(f"❌ Error: NEF model was not generated at {nef_model_path}")
|
||||
|
||||
# 確保目標資料夾存在
|
||||
os.makedirs(onnx_dir, exist_ok=True)
|
||||
|
||||
# 移動 `.nef` 到指定資料夾
|
||||
nef_save_path = os.path.join(onnx_dir, os.path.basename(nef_model_path))
|
||||
shutil.copy(nef_model_path, nef_save_path)
|
||||
|
||||
# **立即檢查 `.nef` 是否真的存在**
|
||||
if os.path.exists(nef_save_path):
|
||||
print(f"\n✅ NEF file successfully saved to: {nef_save_path}")
|
||||
else:
|
||||
raise RuntimeError(f"❌ Error: NEF file NOT found in {nef_save_path} after copying!")
|
||||
|
||||
# **執行 `ls` 指令來確認 Python 內部真的看到 `.nef`**
|
||||
print("\n🔍 Listing files in target directory:")
|
||||
subprocess.run(["ls", "-lh", onnx_dir])
|
||||
0
kneron/exporting/yolov5/__init__.py
Normal file
224
kneron/exporting/yolov5/common.py
Normal file
@ -0,0 +1,224 @@
|
||||
# This file contains modules common to various models
|
||||
import torch.nn as nn
|
||||
import torch
|
||||
import torch.nn.functional as F
|
||||
def autopad(k, p=None): # kernel, padding
|
||||
# Pad to 'same'
|
||||
if p is None:
|
||||
p = k // 2 if isinstance(k, int) else [x // 2 for x in k] # auto-pad
|
||||
return p
|
||||
|
||||
|
||||
def DWConv(c1, c2, k=1, s=1, act=True):
|
||||
# Depthwise convolution
|
||||
return Conv(c1, c2, k, s, g=math.gcd(c1, c2), act=act)
|
||||
|
||||
|
||||
class Conv(nn.Module):
|
||||
# Standard convolution
|
||||
def __init__(self, c1, c2, k=1, s=1, p=None, g=1, act=True): # ch_in, ch_out, kernel, stride, padding, groups
|
||||
super(Conv, self).__init__()
|
||||
self.conv = nn.Conv2d(c1, c2, k, s, autopad(k, p), groups=g, bias=False)
|
||||
self.bn = nn.BatchNorm2d(c2)
|
||||
self.act = nn.LeakyReLU(0.1, inplace=True) if act else nn.Identity()
|
||||
|
||||
def forward(self, x):
|
||||
return self.act(self.bn(self.conv(x)))
|
||||
|
||||
def fuseforward(self, x):
|
||||
return self.act(self.conv(x))
|
||||
|
||||
|
||||
class Bottleneck(nn.Module):
|
||||
# Standard bottleneck
|
||||
def __init__(self, c1, c2, shortcut=True, g=1, e=0.5): # ch_in, ch_out, shortcut, groups, expansion
|
||||
super(Bottleneck, self).__init__()
|
||||
c_ = int(c2 * e) # hidden channels
|
||||
self.cv1 = Conv(c1, c_, 1, 1)
|
||||
self.cv2 = Conv(c_, c2, 3, 1, g=g)
|
||||
self.add = shortcut and c1 == c2
|
||||
|
||||
def forward(self, x):
|
||||
return x + self.cv2(self.cv1(x)) if self.add else self.cv2(self.cv1(x))
|
||||
|
||||
|
||||
class BottleneckCSP(nn.Module):
|
||||
# CSP Bottleneck https://github.com/WongKinYiu/CrossStagePartialNetworks
|
||||
def __init__(self, c1, c2, n=1, shortcut=True, g=1, e=0.5): # ch_in, ch_out, number, shortcut, groups, expansion
|
||||
super(BottleneckCSP, self).__init__()
|
||||
c_ = int(c2 * e) # hidden channels
|
||||
self.cv1 = Conv(c1, c_, 1, 1)
|
||||
self.cv2 = nn.Conv2d(c1, c_, 1, 1, bias=False)
|
||||
self.cv3 = nn.Conv2d(c_, c_, 1, 1, bias=False)
|
||||
self.cv4 = Conv(2 * c_, c2, 1, 1)
|
||||
self.bn = nn.BatchNorm2d(2 * c_) # applied to cat(cv2, cv3)
|
||||
self.act = nn.LeakyReLU(0.1, inplace=True)
|
||||
self.m = nn.Sequential(*[Bottleneck(c_, c_, shortcut, g, e=1.0) for _ in range(n)])
|
||||
|
||||
def forward(self, x):
|
||||
y1 = self.cv3(self.m(self.cv1(x)))
|
||||
y2 = self.cv2(x)
|
||||
return self.cv4(self.act(self.bn(torch.cat((y1, y2), dim=1))))
|
||||
|
||||
class SPP(nn.Module):
|
||||
# Spatial pyramid pooling layer used in YOLOv3-SPP
|
||||
def __init__(self, c1, c2, k=(5, 9, 13)):
|
||||
super(SPP, self).__init__()
|
||||
c_ = c1 // 2 # hidden channels
|
||||
self.cv1 = Conv(c1, c_, 1, 1)
|
||||
self.cv2 = Conv(c_ * (len(k) + 1), c2, 1, 1)
|
||||
self.m = nn.ModuleList([nn.MaxPool2d(kernel_size=x, stride=1, padding=x // 2) for x in k])
|
||||
|
||||
def forward(self, x):
|
||||
x = self.cv1(x)
|
||||
return self.cv2(torch.cat([x] + [m(x) for m in self.m], 1))
|
||||
|
||||
|
||||
class Focus(nn.Module):#
|
||||
# Focus wh information into c-space
|
||||
def __init__(self, c1, c2, k=1, s=1, p=None, g=1, act=True): # ch_in, ch_out, kernel, stride, padding, groups
|
||||
super(Focus, self).__init__()
|
||||
self.conv = Conv(c1 * 4, c2, k, s, p, g, act)
|
||||
w1_1 = torch.tensor([[[1., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]]])
|
||||
w1_2 = torch.tensor([[[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[1., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]]])
|
||||
w1_3 = torch.tensor([[[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[1., 0., 0.],[0., 0., 0.],[0., 0., 0.]]])
|
||||
w3_1 = torch.tensor([[[0., 1., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]]])
|
||||
w3_2 = torch.tensor([[[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 1., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]]])
|
||||
w3_3 = torch.tensor([[[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 1., 0.],[0., 0., 0.],[0., 0., 0.]]])
|
||||
w2_1 = torch.tensor([[[0., 0., 0.],[1., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]]])
|
||||
w2_2 = torch.tensor([[[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[1., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]]])
|
||||
w2_3 = torch.tensor([[[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[1., 0., 0.],[0., 0., 0.]]])
|
||||
w4_1 = torch.tensor([[[0., 0., 0.],[0., 1., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]]])
|
||||
w4_2 = torch.tensor([[[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 1., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]]])
|
||||
w4_3 = torch.tensor([[[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 0., 0.],[0., 0., 0.]], [[0., 0., 0.],[0., 1., 0.],[0., 0., 0.]]])
|
||||
w1_1 = w1_1.view(1, 3, 3, 3)
|
||||
w1_2 = w1_2.view(1, 3, 3, 3)
|
||||
w1_3 = w1_3.view(1, 3, 3, 3)
|
||||
w2_1 = w2_1.view(1, 3, 3, 3)
|
||||
w2_2 = w2_2.view(1, 3, 3, 3)
|
||||
w2_3 = w2_3.view(1, 3, 3, 3)
|
||||
w3_1 = w3_1.view(1, 3, 3, 3)
|
||||
w3_2 = w3_2.view(1, 3, 3, 3)
|
||||
w3_3 = w3_3.view(1, 3, 3, 3)
|
||||
w4_1 = w4_1.view(1, 3, 3, 3)
|
||||
w4_2 = w4_2.view(1, 3, 3, 3)
|
||||
w4_3 = w4_3.view(1, 3, 3, 3)
|
||||
self.w_cat = torch.cat([w1_1, w1_2,w1_3, w2_1,w2_2,w2_3, w3_1,w3_2,w3_3, w4_1,w4_2,w4_3], 0)
|
||||
self.p2d = (0, 2, 0, 2)
|
||||
|
||||
def forward(self, x): # x(b,c,w,h) -> y(b,4c,w/2,h/2)
|
||||
# x = x.type(torch.cuda.FloatTensor)
|
||||
#x_gt = self.conv(torch.cat([x[..., ::2, ::2], x[..., 1::2, ::2], x[..., ::2, 1::2], x[..., 1::2, 1::2]], 1))
|
||||
x_pad = F.pad(x, self.p2d, 'constant', 0)
|
||||
xx = F.conv2d(x_pad, self.w_cat.to(x.device),stride=2)
|
||||
xx = self.conv(xx)
|
||||
#print(torch.sum(x_gt - xx))
|
||||
return xx
|
||||
|
||||
|
||||
|
||||
class Focus_ori(nn.Module):#
|
||||
# Focus wh information into c-space
|
||||
def __init__(self, c1, c2, k=1, s=1, p=None, g=1, act=True): # ch_in, ch_out, kernel, stride, padding, groups
|
||||
super(Focus, self).__init__()
|
||||
self.conv = Conv(c1 * 4, c2, k, s, p, g, act)
|
||||
|
||||
def forward(self, x): # x(b,c,w,h) -> y(b,4c,w/2,h/2)
|
||||
x = x.type(torch.cuda.FloatTensor)
|
||||
return self.conv(torch.cat([x[..., ::2, ::2], x[..., 1::2, ::2], x[..., ::2, 1::2], x[..., 1::2, 1::2]], 1))
|
||||
|
||||
class Concat(nn.Module):
|
||||
# Concatenate a list of tensors along dimension
|
||||
def __init__(self, dimension=1):
|
||||
super(Concat, self).__init__()
|
||||
self.d = dimension
|
||||
|
||||
def forward(self, x):
|
||||
return torch.cat(x, self.d)
|
||||
|
||||
|
||||
class Flatten(nn.Module):
|
||||
# Use after nn.AdaptiveAvgPool2d(1) to remove last 2 dimensions
|
||||
@staticmethod
|
||||
def forward(x):
|
||||
return x.view(x.size(0), -1)
|
||||
|
||||
|
||||
class Classify(nn.Module):
|
||||
# Classification head, i.e. x(b,c1,20,20) to x(b,c2)
|
||||
def __init__(self, c1, c2, k=1, s=1, p=None, g=1): # ch_in, ch_out, kernel, stride, padding, groups
|
||||
super(Classify, self).__init__()
|
||||
self.aap = nn.AdaptiveAvgPool2d(1) # to x(b,c1,1,1)
|
||||
self.conv = nn.Conv2d(c1, c2, k, s, autopad(k, p), groups=g, bias=False) # to x(b,c2,1,1)
|
||||
self.flat = Flatten()
|
||||
|
||||
def forward(self, x):
|
||||
z = torch.cat([self.aap(y) for y in (x if isinstance(x, list) else [x])], 1) # cat if list
|
||||
return self.flat(self.conv(z)) # flatten to x(b,c2)
|
||||
|
||||
class MixConv2d(nn.Module):
|
||||
# Mixed Depthwise Conv https://arxiv.org/abs/1907.09595
|
||||
def __init__(self, c1, c2, k=(1, 3), s=1, equal_ch=True):
|
||||
super(MixConv2d, self).__init__()
|
||||
groups = len(k)
|
||||
if equal_ch: # equal c_ per group
|
||||
i = torch.linspace(0, groups - 1E-6, c2).floor() # c2 indices
|
||||
c_ = [(i == g).sum() for g in range(groups)] # intermediate channels
|
||||
else: # equal weight.numel() per group
|
||||
b = [c2] + [0] * groups
|
||||
a = np.eye(groups + 1, groups, k=-1)
|
||||
a -= np.roll(a, 1, axis=1)
|
||||
a *= np.array(k) ** 2
|
||||
a[0] = 1
|
||||
c_ = np.linalg.lstsq(a, b, rcond=None)[0].round() # solve for equal weight indices, ax = b
|
||||
|
||||
self.m = nn.ModuleList([nn.Conv2d(c1, int(c_[g]), k[g], s, k[g] // 2, bias=False) for g in range(groups)])
|
||||
self.bn = nn.BatchNorm2d(c2)
|
||||
self.act = nn.LeakyReLU(0.1, inplace=True)
|
||||
|
||||
def forward(self, x):
|
||||
return x + self.act(self.bn(torch.cat([m(x) for m in self.m], 1)))
|
||||
|
||||
class CrossConv(nn.Module):
|
||||
# Cross Convolution Downsample
|
||||
def __init__(self, c1, c2, k=3, s=1, g=1, e=1.0, shortcut=False):
|
||||
# ch_in, ch_out, kernel, stride, groups, expansion, shortcut
|
||||
super(CrossConv, self).__init__()
|
||||
c_ = int(c2 * e) # hidden channels
|
||||
self.cv1 = Conv(c1, c_, (1, k), (1, s))
|
||||
self.cv2 = Conv(c_, c2, (k, 1), (s, 1), g=g)
|
||||
self.add = shortcut and c1 == c2
|
||||
|
||||
def forward(self, x):
|
||||
return x + self.cv2(self.cv1(x)) if self.add else self.cv2(self.cv1(x))
|
||||
|
||||
# class C3(nn.Module):
|
||||
# # Cross Convolution CSP
|
||||
# def __init__(self, c1, c2, n=1, shortcut=True, g=1, e=0.5): # ch_in, ch_out, number, shortcut, groups, expansion
|
||||
# super(C3, self).__init__()
|
||||
# c_ = int(c2 * e) # hidden channels
|
||||
# self.cv1 = Conv(c1, c_, 1, 1)
|
||||
# self.cv2 = nn.Conv2d(c1, c_, 1, 1, bias=False)
|
||||
# self.cv3 = nn.Conv2d(c_, c_, 1, 1, bias=False)
|
||||
# self.cv4 = Conv(2 * c_, c2, 1, 1)
|
||||
# self.bn = nn.BatchNorm2d(2 * c_) # applied to cat(cv2, cv3)
|
||||
# self.act = nn.LeakyReLU(0.1, inplace=True)
|
||||
# self.m = nn.Sequential(*[CrossConv(c_, c_, 3, 1, g, 1.0, shortcut) for _ in range(n)])
|
||||
|
||||
# def forward(self, x):
|
||||
# y1 = self.cv3(self.m(self.cv1(x)))
|
||||
# y2 = self.cv2(x)
|
||||
# return self.cv4(self.act(self.bn(torch.cat((y1, y2), dim=1))))
|
||||
|
||||
class C3(nn.Module):
|
||||
# CSP Bottleneck with 3 convolutions
|
||||
def __init__(self, c1, c2, n=1, shortcut=True, g=1, e=0.5): # ch_in, ch_out, number, shortcut, groups, expansion
|
||||
super(C3, self).__init__()
|
||||
c_ = int(c2 * e) # hidden channels
|
||||
self.cv1 = Conv(c1, c_, 1, 1)
|
||||
self.cv2 = Conv(c1, c_, 1, 1)
|
||||
self.cv3 = Conv(2 * c_, c2, 1) # act=FReLU(c2)
|
||||
self.m = nn.Sequential(*[Bottleneck(c_, c_, shortcut, g, e=1.0) for _ in range(n)])
|
||||
|
||||
def forward(self, x):
|
||||
return self.cv3(torch.cat((self.m(self.cv1(x)), self.cv2(x)), dim=1))
|
||||
684
kneron/exporting/yolov5/kneron_preprocessing/API.py
Normal file
@ -0,0 +1,684 @@
|
||||
# -*- coding: utf-8 -*-
|
||||
|
||||
import numpy as np
|
||||
import os
|
||||
from .funcs.utils import str2int, str2bool
|
||||
from . import Flow
|
||||
|
||||
flow = Flow()
|
||||
flow.set_numerical_type('floating')
|
||||
flow_520 = Flow()
|
||||
flow_520.set_numerical_type('520')
|
||||
flow_720 = Flow()
|
||||
flow_720.set_numerical_type('720')
|
||||
|
||||
DEFAULT = None
|
||||
default = {
|
||||
'crop':{
|
||||
'align_w_to_4':False
|
||||
},
|
||||
'resize':{
|
||||
'type':'bilinear',
|
||||
'calculate_ratio_using_CSim':False
|
||||
}
|
||||
}
|
||||
|
||||
def set_default_as_520():
|
||||
"""
|
||||
Set some default parameter as 520 setting
|
||||
|
||||
crop.align_w_to_4 = True
|
||||
crop.pad_square_to_4 = True
|
||||
resize.type = 'fixed_520'
|
||||
resize.calculate_ratio_using_CSim = True
|
||||
"""
|
||||
global default
|
||||
default['crop']['align_w_to_4'] = True
|
||||
default['resize']['type'] = 'fixed_520'
|
||||
default['resize']['calculate_ratio_using_CSim'] = True
|
||||
return
|
||||
|
||||
def set_default_as_floating():
|
||||
"""
|
||||
Set some default parameter as floating setting
|
||||
|
||||
crop.align_w_to_4 = False
|
||||
crop.pad_square_to_4 = False
|
||||
resize.type = 'bilinear'
|
||||
resize.calculate_ratio_using_CSim = False
|
||||
"""
|
||||
global default
|
||||
default['crop']['align_w_to_4'] = False
|
||||
default['resize']['type'] = 'bilinear'
|
||||
default['resize']['calculate_ratio_using_CSim'] = False
|
||||
pass
|
||||
|
||||
def print_info_on():
|
||||
"""
|
||||
turn print infomation on.
|
||||
"""
|
||||
flow.set_print_info(True)
|
||||
flow_520.set_print_info(True)
|
||||
|
||||
def print_info_off():
|
||||
"""
|
||||
turn print infomation off.
|
||||
"""
|
||||
flow.set_print_info(False)
|
||||
flow_520.set_print_info(False)
|
||||
|
||||
def load_image(image):
|
||||
"""
|
||||
load_image function
|
||||
load load_image and output as rgb888 format np.array
|
||||
|
||||
Args:
|
||||
image: [np.array/str], can be np.array or image file path
|
||||
|
||||
Returns:
|
||||
out: [np.array], rgb888 format
|
||||
|
||||
Examples:
|
||||
"""
|
||||
image = flow.load_image(image, is_raw = False)
|
||||
return image
|
||||
|
||||
def load_bin(image, fmt=None, size=None):
|
||||
"""
|
||||
load_bin function
|
||||
load bin file and output as rgb888 format np.array
|
||||
|
||||
Args:
|
||||
image: [str], bin file path
|
||||
fmt: [str], "rgb888" / "rgb565" / "nir"
|
||||
size: [tuble], (image_w, image_h)
|
||||
|
||||
Returns:
|
||||
out: [np.array], rgb888 format
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.load_bin(image,'rgb565',(raw_w,raw_h))
|
||||
"""
|
||||
assert isinstance(size, tuple)
|
||||
assert isinstance(fmt, str)
|
||||
# assert (fmt.lower() in ['rgb888', "rgb565" , "nir",'RGB888', "RGB565" , "NIR", 'NIR888', 'nir888'])
|
||||
|
||||
image = flow.load_image(image, is_raw = True, raw_img_type='bin', raw_img_fmt = fmt, img_in_width = size[0], img_in_height = size[1])
|
||||
flow.set_color_conversion(source_format=fmt, out_format = 'rgb888')
|
||||
image,_ = flow.funcs['color'](image)
|
||||
return image
|
||||
|
||||
def load_hex(file, fmt=None, size=None):
|
||||
"""
|
||||
load_hex function
|
||||
load hex file and output as rgb888 format np.array
|
||||
|
||||
Args:
|
||||
image: [str], hex file path
|
||||
fmt: [str], "rgb888" / "yuv444" / "ycbcr444" / "yuv422" / "ycbcr422" / "rgb565"
|
||||
size: [tuble], (image_w, image_h)
|
||||
|
||||
Returns:
|
||||
out: [np.array], rgb888 format
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.load_hex(image,'rgb565',(raw_w,raw_h))
|
||||
"""
|
||||
assert isinstance(size, tuple)
|
||||
assert isinstance(fmt, str)
|
||||
assert (fmt.lower() in ['rgb888',"yuv444" , "ycbcr444" , "yuv422" , "ycbcr422" , "rgb565"])
|
||||
|
||||
image = flow.load_image(file, is_raw = True, raw_img_type='hex', raw_img_fmt = fmt, img_in_width = size[0], img_in_height = size[1])
|
||||
flow.set_color_conversion(source_format=fmt, out_format = 'rgb888')
|
||||
image,_ = flow.funcs['color'](image)
|
||||
return image
|
||||
|
||||
def dump_image(image, output=None, file_fmt='txt',image_fmt='rgb888',order=0):
|
||||
"""
|
||||
dump_image function
|
||||
|
||||
dump txt, bin or hex, default is txt
|
||||
image format as following format: RGB888, RGBA8888, RGB565, NIR, YUV444, YCbCr444, YUV422, YCbCr422, default is RGB888
|
||||
|
||||
Args:
|
||||
image: [np.array/str], can be np.array or image file path
|
||||
output: [str], dump file path
|
||||
file_fmt: [str], "bin" / "txt" / "hex", set dump file format, default is txt
|
||||
image_fmt: [str], RGB888 / RGBA8888 / RGB565 / NIR / YUV444 / YCbCr444 / YUV422 / YCbCr422, default is RGB888
|
||||
|
||||
Examples:
|
||||
>>> kneron_preprocessing.API.dump_image(image_data,out_path,fmt='bin')
|
||||
"""
|
||||
if isinstance(image, str):
|
||||
image = load_image(image)
|
||||
|
||||
assert isinstance(image, np.ndarray)
|
||||
if output is None:
|
||||
return
|
||||
|
||||
flow.set_output_setting(is_dump=False, dump_format=file_fmt, image_format=image_fmt ,output_file=output)
|
||||
flow.dump_image(image)
|
||||
return
|
||||
|
||||
def convert(image, out_fmt = 'RGB888', source_fmt = 'RGB888'):
|
||||
"""
|
||||
color convert
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
out_fmt: [str], "rgb888" / "rgba8888" / "rgb565" / "yuv" / "ycbcr" / "yuv422" / "ycbcr422"
|
||||
source_fmt: [str], "rgb888" / "rgba8888" / "rgb565" / "yuv" / "ycbcr" / "yuv422" / "ycbcr422"
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
|
||||
"""
|
||||
flow.set_color_conversion(source_format = source_fmt, out_format=out_fmt, simulation=False)
|
||||
image,_ = flow.funcs['color'](image)
|
||||
return image
|
||||
|
||||
def get_crop_range(box,align_w_to_4=DEFAULT, pad_square_to_4=False,rounding_type=0):
|
||||
"""
|
||||
get exact crop box according different setting
|
||||
|
||||
Args:
|
||||
box: [tuble], (x1, y1, x2, y2)
|
||||
align_w_to_4: [bool], crop length in w direction align to 4 or not, default False
|
||||
pad_square_to_4: [bool], pad to square(align 4) or not, default False
|
||||
rounding_type: [int], 0-> x1,y1 take floor, x2,y2 take ceil; 1->all take rounding
|
||||
|
||||
Returns:
|
||||
out: [tuble,4], (crop_x1, crop_y1, crop_x2, crop_y2)
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.get_crop_range((272,145,461,341), align_w_to_4=True, pad_square_to_4=True)
|
||||
(272, 145, 460, 341)
|
||||
"""
|
||||
if box is None:
|
||||
return (0,0,0,0)
|
||||
if align_w_to_4 is None:
|
||||
align_w_to_4 = default['crop']['align_w_to_4']
|
||||
|
||||
flow.set_crop(type='specific', start_x=box[0],start_y=box[1],end_x=box[2],end_y=box[3], align_w_to_4=align_w_to_4, pad_square_to_4=pad_square_to_4,rounding_type=rounding_type)
|
||||
image = np.zeros((1,1,3)).astype('uint8')
|
||||
_,info = flow.funcs['crop'](image)
|
||||
|
||||
return info['box']
|
||||
|
||||
def crop(image, box=None, align_w_to_4=DEFAULT, pad_square_to_4=False,rounding_type=0 ,info_out = {}):
|
||||
"""
|
||||
crop function
|
||||
|
||||
specific crop range by box
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
box: [tuble], (x1, y1, x2, y2)
|
||||
align_w_to_4: [bool], crop length in w direction align to 4 or not, default False
|
||||
pad_square_to_4: [bool], pad to square(align 4) or not, default False
|
||||
rounding_type: [int], 0-> x1,y1 take floor, x2,y2 take ceil; 1->all take rounding
|
||||
info_out: [dic], save the final crop box into info_out['box']
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> info = {}
|
||||
>>> image_data = kneron_preprocessing.API.crop(image_data,(272,145,461,341), align_w_to_4=True, info_out=info)
|
||||
>>> info['box']
|
||||
(272, 145, 460, 341)
|
||||
|
||||
>>> info = {}
|
||||
>>> image_data = kneron_preprocessing.API.crop(image_data,(272,145,461,341), pad_square_to_4=True, info_out=info)
|
||||
>>> info['box']
|
||||
(268, 145, 464, 341)
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
if box is None:
|
||||
return image
|
||||
if align_w_to_4 is None:
|
||||
align_w_to_4 = default['crop']['align_w_to_4']
|
||||
|
||||
flow.set_crop(type='specific', start_x=box[0],start_y=box[1],end_x=box[2],end_y=box[3], align_w_to_4=align_w_to_4, pad_square_to_4=pad_square_to_4,rounding_type=rounding_type)
|
||||
image,info = flow.funcs['crop'](image)
|
||||
|
||||
info_out['box'] = info['box']
|
||||
return image
|
||||
|
||||
def crop_center(image, range=None, align_w_to_4=DEFAULT, pad_square_to_4=False,rounding_type=0 ,info_out = {}):
|
||||
"""
|
||||
crop function
|
||||
|
||||
center crop by range
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
range: [tuble], (crop_w, crop_h)
|
||||
align_w_to_4: [bool], crop length in w direction align to 4 or not, default False
|
||||
pad_square_to_4: [bool], pad to square(align 4) or not, default False
|
||||
rounding_type: [int], 0-> x1,y1 take floor, x2,y2 take ceil; 1->all take rounding
|
||||
info_out: [dic], save the final crop box into info_out['box']
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> info = {}
|
||||
>>> image_data = kneron_preprocessing.API.crop_center(image_data,(102,40), align_w_to_4=True,info_out=info)
|
||||
>>> info['box']
|
||||
(268, 220, 372, 260)
|
||||
|
||||
>>> info = {}
|
||||
>>> image_data = kneron_preprocessing.API.crop_center(image_data,(102,40), pad_square_to_4=True, info_out=info)
|
||||
>>> info['box']
|
||||
(269, 192, 371, 294)
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
if range is None:
|
||||
return image
|
||||
if align_w_to_4 is None:
|
||||
align_w_to_4 = default['crop']['align_w_to_4']
|
||||
|
||||
flow.set_crop(type='center', crop_w=range[0],crop_h=range[1], align_w_to_4=align_w_to_4, pad_square_to_4=pad_square_to_4,rounding_type=rounding_type)
|
||||
image,info = flow.funcs['crop'](image)
|
||||
|
||||
info_out['box'] = info['box']
|
||||
return image
|
||||
|
||||
def crop_corner(image, range=None, align_w_to_4=DEFAULT,pad_square_to_4=False,rounding_type=0 ,info_out = {}):
|
||||
"""
|
||||
crop function
|
||||
|
||||
corner crop by range
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
range: [tuble], (crop_w, crop_h)
|
||||
align_w_to_4: [bool], crop length in w direction align to 4 or not, default False
|
||||
pad_square_to_4: [bool], pad to square(align 4) or not, default False
|
||||
rounding_type: [int], 0-> x1,y1 take floor, x2,y2 take ceil; 1->all take rounding
|
||||
info_out: [dic], save the final crop box into info_out['box']
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> info = {}
|
||||
>>> image_data = kneron_preprocessing.API.crop_corner(image_data,(102,40), align_w_to_4=True,info_out=info)
|
||||
>>> info['box']
|
||||
(0, 0, 104, 40)
|
||||
|
||||
>>> info = {}
|
||||
>>> image_data = kneron_preprocessing.API.crop_corner(image_data,(102,40), pad_square_to_4=True,info_out=info)
|
||||
>>> info['box']
|
||||
(0, -28, 102, 74)
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
if range is None:
|
||||
return image
|
||||
if align_w_to_4 is None:
|
||||
align_w_to_4 = default['crop']['align_w_to_4']
|
||||
|
||||
flow.set_crop(type='corner', crop_w=range[0],crop_h=range[1], align_w_to_4=align_w_to_4, pad_square_to_4=pad_square_to_4)
|
||||
image, info = flow.funcs['crop'](image)
|
||||
|
||||
info_out['box'] = info['box']
|
||||
return image
|
||||
|
||||
def resize(image, size=None, keep_ratio = True, zoom = True, type=DEFAULT, calculate_ratio_using_CSim = DEFAULT, info_out = {}):
|
||||
"""
|
||||
resize function
|
||||
|
||||
resize type can be bilinear or bilicubic as floating type, fixed or fixed_520/fixed_720 as fixed type.
|
||||
fixed_520/fixed_720 type has add some function to simulate 520/720 bug.
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
size: [tuble], (input_w, input_h)
|
||||
keep_ratio: [bool], keep_ratio or not, default True
|
||||
zoom: [bool], enable resize can zoom image or not, default True
|
||||
type: [str], "bilinear" / "bilicubic" / "cv2" / "fixed" / "fixed_520" / "fixed_720"
|
||||
calculate_ratio_using_CSim: [bool], calculate the ratio and scale using Csim function and C float, default False
|
||||
info_out: [dic], save the final scale size(w,h) into info_out['size']
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> info = {}
|
||||
>>> image_data = kneron_preprocessing.API.resize(image_data,size=(56,56),type='fixed',info_out=info)
|
||||
>>> info_out['size']
|
||||
(54,56)
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
if size is None:
|
||||
return image
|
||||
if type is None:
|
||||
type = default['resize']['type']
|
||||
if calculate_ratio_using_CSim is None:
|
||||
calculate_ratio_using_CSim = default['resize']['calculate_ratio_using_CSim']
|
||||
|
||||
flow.set_resize(resize_w = size[0], resize_h = size[1], type=type, keep_ratio=keep_ratio,zoom=zoom, calculate_ratio_using_CSim=calculate_ratio_using_CSim)
|
||||
image, info = flow.funcs['resize'](image)
|
||||
info_out['size'] = info['size']
|
||||
|
||||
return image
|
||||
|
||||
def pad(image, pad_l=0, pad_r=0, pad_t=0, pad_b=0, pad_val=0):
|
||||
"""
|
||||
pad function
|
||||
|
||||
specific left, right, top and bottom pad size.
|
||||
|
||||
Args:
|
||||
image[np.array]: input
|
||||
pad_l: [int], pad size from left, default 0
|
||||
pad_r: [int], pad size form right, default 0
|
||||
pad_t: [int], pad size from top, default 0
|
||||
pad_b: [int], pad size form bottom, default 0
|
||||
pad_val: [float], the value of pad, , default 0
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.pad(image_data,20,40,20,40,-0.5)
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
|
||||
flow.set_padding(type='specific',pad_l=pad_l,pad_r=pad_r,pad_t=pad_t,pad_b=pad_b,pad_val=pad_val)
|
||||
image, _ = flow.funcs['padding'](image)
|
||||
return image
|
||||
|
||||
def pad_center(image,size=None, pad_val=0):
|
||||
"""
|
||||
pad function
|
||||
|
||||
center pad with pad size.
|
||||
|
||||
Args:
|
||||
image[np.array]: input
|
||||
size: [tuble], (padded_size_w, padded_size_h)
|
||||
pad_val: [float], the value of pad, , default 0
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.pad_center(image_data,size=(56,56),pad_val=-0.5)
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
if size is None:
|
||||
return image
|
||||
assert ( (image.shape[0] <= size[1]) & (image.shape[1] <= size[0]) )
|
||||
|
||||
flow.set_padding(type='center',padded_w=size[0],padded_h=size[1],pad_val=pad_val)
|
||||
image, _ = flow.funcs['padding'](image)
|
||||
return image
|
||||
|
||||
def pad_corner(image,size=None, pad_val=0):
|
||||
"""
|
||||
pad function
|
||||
|
||||
corner pad with pad size.
|
||||
|
||||
Args:
|
||||
image[np.array]: input
|
||||
size: [tuble], (padded_size_w, padded_size_h)
|
||||
pad_val: [float], the value of pad, , default 0
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.pad_corner(image_data,size=(56,56),pad_val=-0.5)
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
if size is None:
|
||||
return image
|
||||
assert ( (image.shape[0] <= size[1]) & (image.shape[1] <= size[0]) )
|
||||
|
||||
flow.set_padding(type='corner',padded_w=size[0],padded_h=size[1],pad_val=pad_val)
|
||||
image, _ = flow.funcs['padding'](image)
|
||||
return image
|
||||
|
||||
def norm(image,scale=256.,bias=-0.5, mean=None, std=None):
|
||||
"""
|
||||
norm function
|
||||
|
||||
x = (x/scale - bias)
|
||||
x[0,1,2] = x - mean[0,1,2]
|
||||
x[0,1,2] = x / std[0,1,2]
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
scale: [float], default = 256
|
||||
bias: [float], default = -0.5
|
||||
mean: [tuble,3], default = None
|
||||
std: [tuble,3], default = None
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.norm(image_data)
|
||||
>>> image_data = kneron_preprocessing.API.norm(image_data,mean=[0.485, 0.456, 0.406], std=[0.229, 0.224, 0.225])
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
|
||||
flow.set_normalize(type='specific',scale=scale, bias=bias, mean=mean, std =std)
|
||||
image, _ = flow.funcs['normalize'](image)
|
||||
return image
|
||||
|
||||
def inproc_520(image,raw_fmt='rgb565',raw_size=None,npu_size=None, crop_box=None, pad_mode=0, norm='kneron', gray=False, rotate=0, radix=8, bit_width=8, round_w_to_16=True, NUM_BANK_LINE=32,BANK_ENTRY_CNT=512,MAX_IMG_PREPROC_ROW_NUM=511,MAX_IMG_PREPROC_COL_NUM=256):
|
||||
"""
|
||||
inproc_520
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
crop_box: [tuble], (x1, y1, x2, y2), if None will skip crop
|
||||
pad_mode: [int], 0: pad 2 sides, 1: pad 1 side, 2: no pad. default = 0
|
||||
norm: [str], default = 'kneron'
|
||||
rotate: [int], 0 / 1 / 2 ,default = 0
|
||||
radix: [int], default = 8
|
||||
bit_width: [int], default = 8
|
||||
round_w_to_16: [bool], default = True
|
||||
gray: [bool], default = False
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.inproc_520(image_data,npu_size=(56,56),crop_box=(272,145,460,341),pad_mode=1)
|
||||
"""
|
||||
# assert isinstance(image, np.ndarray)
|
||||
|
||||
if (not isinstance(image, np.ndarray)):
|
||||
flow_520.set_raw_img(is_raw_img='yes',raw_img_type = 'bin',raw_img_fmt=raw_fmt, img_in_width=raw_size[0], img_in_height=raw_size[1])
|
||||
else:
|
||||
flow_520.set_raw_img(is_raw_img='no')
|
||||
flow_520.set_color_conversion(source_format='rgb888')
|
||||
|
||||
if npu_size is None:
|
||||
return image
|
||||
|
||||
flow_520.set_model_size(w=npu_size[0],h=npu_size[1])
|
||||
|
||||
## Crop
|
||||
if crop_box != None:
|
||||
flow_520.set_crop(start_x=crop_box[0],start_y=crop_box[1],end_x=crop_box[2],end_y=crop_box[3])
|
||||
crop_fisrt = True
|
||||
else:
|
||||
crop_fisrt = False
|
||||
|
||||
## Color
|
||||
if gray:
|
||||
flow_520.set_color_conversion(out_format='l',simulation='no')
|
||||
else:
|
||||
flow_520.set_color_conversion(out_format='rgb888',simulation='no')
|
||||
|
||||
## Resize & Pad
|
||||
pad_mode = str2int(pad_mode)
|
||||
if (pad_mode == 0):
|
||||
pad_type = 'center'
|
||||
resize_keep_ratio = 'yes'
|
||||
elif (pad_mode == 1):
|
||||
pad_type = 'corner'
|
||||
resize_keep_ratio = 'yes'
|
||||
else:
|
||||
pad_type = 'center'
|
||||
resize_keep_ratio = 'no'
|
||||
|
||||
flow_520.set_resize(keep_ratio=resize_keep_ratio)
|
||||
flow_520.set_padding(type=pad_type)
|
||||
|
||||
## Norm
|
||||
flow_520.set_normalize(type=norm)
|
||||
|
||||
## 520 inproc
|
||||
flow_520.set_520_setting(radix=radix,bit_width=bit_width,rotate=rotate,crop_fisrt=crop_fisrt,round_w_to_16=round_w_to_16,NUM_BANK_LINE=NUM_BANK_LINE,BANK_ENTRY_CNT=BANK_ENTRY_CNT,MAX_IMG_PREPROC_ROW_NUM=MAX_IMG_PREPROC_ROW_NUM,MAX_IMG_PREPROC_COL_NUM=MAX_IMG_PREPROC_COL_NUM)
|
||||
image_data, _ = flow_520.run_whole_process(image)
|
||||
|
||||
return image_data
|
||||
|
||||
def inproc_720(image,raw_fmt='rgb565',raw_size=None,npu_size=None, crop_box=None, pad_mode=0, norm='kneron', gray=False):
|
||||
"""
|
||||
inproc_720
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
crop_box: [tuble], (x1, y1, x2, y2), if None will skip crop
|
||||
pad_mode: [int], 0: pad 2 sides, 1: pad 1 side, 2: no pad. default = 0
|
||||
norm: [str], default = 'kneron'
|
||||
rotate: [int], 0 / 1 / 2 ,default = 0
|
||||
radix: [int], default = 8
|
||||
bit_width: [int], default = 8
|
||||
round_w_to_16: [bool], default = True
|
||||
gray: [bool], default = False
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.inproc_520(image_data,npu_size=(56,56),crop_box=(272,145,460,341),pad_mode=1)
|
||||
"""
|
||||
# assert isinstance(image, np.ndarray)
|
||||
|
||||
if (not isinstance(image, np.ndarray)):
|
||||
flow_720.set_raw_img(is_raw_img='yes',raw_img_type = 'bin',raw_img_fmt=raw_fmt, img_in_width=raw_size[0], img_in_height=raw_size[1])
|
||||
else:
|
||||
flow_720.set_raw_img(is_raw_img='no')
|
||||
flow_720.set_color_conversion(source_format='rgb888')
|
||||
|
||||
if npu_size is None:
|
||||
return image
|
||||
|
||||
flow_720.set_model_size(w=npu_size[0],h=npu_size[1])
|
||||
|
||||
## Crop
|
||||
if crop_box != None:
|
||||
flow_720.set_crop(start_x=crop_box[0],start_y=crop_box[1],end_x=crop_box[2],end_y=crop_box[3])
|
||||
crop_fisrt = True
|
||||
else:
|
||||
crop_fisrt = False
|
||||
|
||||
## Color
|
||||
if gray:
|
||||
flow_720.set_color_conversion(out_format='l',simulation='no')
|
||||
else:
|
||||
flow_720.set_color_conversion(out_format='rgb888',simulation='no')
|
||||
|
||||
## Resize & Pad
|
||||
pad_mode = str2int(pad_mode)
|
||||
if (pad_mode == 0):
|
||||
pad_type = 'center'
|
||||
resize_keep_ratio = 'yes'
|
||||
elif (pad_mode == 1):
|
||||
pad_type = 'corner'
|
||||
resize_keep_ratio = 'yes'
|
||||
else:
|
||||
pad_type = 'center'
|
||||
resize_keep_ratio = 'no'
|
||||
|
||||
flow_720.set_resize(keep_ratio=resize_keep_ratio)
|
||||
flow_720.set_padding(type=pad_type)
|
||||
|
||||
## 720 inproc
|
||||
# flow_720.set_720_setting(radix=radix,bit_width=bit_width,rotate=rotate,crop_fisrt=crop_fisrt,round_w_to_16=round_w_to_16,NUM_BANK_LINE=NUM_BANK_LINE,BANK_ENTRY_CNT=BANK_ENTRY_CNT,MAX_IMG_PREPROC_ROW_NUM=MAX_IMG_PREPROC_ROW_NUM,MAX_IMG_PREPROC_COL_NUM=MAX_IMG_PREPROC_COL_NUM)
|
||||
image_data, _ = flow_720.run_whole_process(image)
|
||||
|
||||
return image_data
|
||||
|
||||
def bit_match(data1, data2):
|
||||
"""
|
||||
bit_match function
|
||||
|
||||
check data1 is equal to data2 or not.
|
||||
|
||||
Args:
|
||||
data1: [np.array / str], can be array or txt/bin file
|
||||
data2: [np.array / str], can be array or txt/bin file
|
||||
|
||||
Returns:
|
||||
out1: [bool], is match or not
|
||||
out2: [np.array], if not match, save the position for mismatched data
|
||||
|
||||
Examples:
|
||||
>>> result, mismatched = kneron_preprocessing.API.bit_match(data1,data2)
|
||||
"""
|
||||
if isinstance(data1, str):
|
||||
if os.path.splitext(data1)[1] == '.bin':
|
||||
data1 = np.fromfile(data1, dtype='uint8')
|
||||
elif os.path.splitext(data1)[1] == '.txt':
|
||||
data1 = np.loadtxt(data1)
|
||||
|
||||
assert isinstance(data1, np.ndarray)
|
||||
|
||||
if isinstance(data2, str):
|
||||
if os.path.splitext(data2)[1] == '.bin':
|
||||
data2 = np.fromfile(data2, dtype='uint8')
|
||||
elif os.path.splitext(data2)[1] == '.txt':
|
||||
data2 = np.loadtxt(data2)
|
||||
|
||||
assert isinstance(data2, np.ndarray)
|
||||
|
||||
|
||||
data1 = data1.reshape((-1,1))
|
||||
data2 = data2.reshape((-1,1))
|
||||
|
||||
if not(len(data1) == len(data2)):
|
||||
print('error len')
|
||||
return False, np.zeros((1))
|
||||
else:
|
||||
ans = data2 - data1
|
||||
if len(np.where(ans>0)[0]) > 0:
|
||||
print('error',np.where(ans>0)[0])
|
||||
return False, np.where(ans>0)[0]
|
||||
else:
|
||||
print('pass')
|
||||
return True, np.zeros((1))
|
||||
|
||||
def cpr_to_crp(x_start, x_end, y_start, y_end, pad_l, pad_r, pad_t, pad_b, rx_start, rx_end, ry_start, ry_end):
|
||||
"""
|
||||
calculate the parameters of crop->pad->resize flow to HW crop->resize->padding flow
|
||||
|
||||
Args:
|
||||
|
||||
Returns:
|
||||
|
||||
Examples:
|
||||
|
||||
"""
|
||||
pad_l = round(pad_l * (rx_end-rx_start) / (x_end - x_start + pad_l + pad_r))
|
||||
pad_r = round(pad_r * (rx_end-rx_start) / (x_end - x_start + pad_l + pad_r))
|
||||
pad_t = round(pad_t * (ry_end-ry_start) / (y_end - y_start + pad_t + pad_b))
|
||||
pad_b = round(pad_b * (ry_end-ry_start) / (y_end - y_start + pad_t + pad_b))
|
||||
|
||||
rx_start +=pad_l
|
||||
rx_end -=pad_r
|
||||
ry_start +=pad_t
|
||||
ry_end -=pad_b
|
||||
|
||||
return x_start, x_end, y_start, y_end, pad_l, pad_r, pad_t, pad_b, rx_start, rx_end, ry_start, ry_end
|
||||
172
kneron/exporting/yolov5/kneron_preprocessing/Cflow.py
Normal file
@ -0,0 +1,172 @@
|
||||
import numpy as np
|
||||
import argparse
|
||||
import kneron_preprocessing
|
||||
|
||||
def main_(args):
|
||||
image = args.input_file
|
||||
filefmt = args.file_fmt
|
||||
if filefmt == 'bin':
|
||||
raw_format = args.raw_format
|
||||
raw_w = args.input_width
|
||||
raw_h = args.input_height
|
||||
|
||||
image_data = kneron_preprocessing.API.load_bin(image,raw_format,(raw_w,raw_h))
|
||||
else:
|
||||
image_data = kneron_preprocessing.API.load_image(image)
|
||||
|
||||
|
||||
npu_w = args.width
|
||||
npu_h = args.height
|
||||
|
||||
crop_first = True if args.crop_first == "True" else False
|
||||
if crop_first:
|
||||
x1 = args.x_pos
|
||||
y1 = args.y_pos
|
||||
x2 = args.crop_w + x1
|
||||
y2 = args.crop_h + y1
|
||||
crop_box = [x1,y1,x2,y2]
|
||||
else:
|
||||
crop_box = None
|
||||
|
||||
pad_mode = args.pad_mode
|
||||
norm_mode = args.norm_mode
|
||||
bitwidth = args.bitwidth
|
||||
radix = args.radix
|
||||
rotate = args.rotate_mode
|
||||
|
||||
##
|
||||
image_data = kneron_preprocessing.API.inproc_520(image_data,npu_size=(npu_w,npu_h),crop_box=crop_box,pad_mode=pad_mode,norm=norm_mode,rotate=rotate,radix=radix,bit_width=bitwidth)
|
||||
|
||||
output_file = args.output_file
|
||||
kneron_preprocessing.API.dump_image(image_data,output_file,'bin','rgba')
|
||||
|
||||
return
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
argparser = argparse.ArgumentParser(
|
||||
description="preprocessing"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-i',
|
||||
'--input_file',
|
||||
help="input file name"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-ff',
|
||||
'--file_fmt',
|
||||
help="input file format, jpg or bin"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-rf',
|
||||
'--raw_format',
|
||||
help="input file image format, rgb or rgb565 or nir"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-i_w',
|
||||
'--input_width',
|
||||
type=int,
|
||||
help="input image width"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-i_h',
|
||||
'--input_height',
|
||||
type=int,
|
||||
help="input image height"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-o',
|
||||
'--output_file',
|
||||
help="output file name"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-s_w',
|
||||
'--width',
|
||||
type=int,
|
||||
help="output width for npu input",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-s_h',
|
||||
'--height',
|
||||
type=int,
|
||||
help="output height for npu input",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-c_f',
|
||||
'--crop_first',
|
||||
help="crop first True or False",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-x',
|
||||
'--x_pos',
|
||||
type=int,
|
||||
help="left up coordinate x",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-y',
|
||||
'--y_pos',
|
||||
type=int,
|
||||
help="left up coordinate y",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-c_w',
|
||||
'--crop_w',
|
||||
type=int,
|
||||
help="crop width",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-c_h',
|
||||
'--crop_h',
|
||||
type=int,
|
||||
help="crop height",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-p_m',
|
||||
'--pad_mode',
|
||||
type=int,
|
||||
help=" 0: pad 2 sides, 1: pad 1 side, 2: no pad.",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-n_m',
|
||||
'--norm_mode',
|
||||
help="normalizaton mode: yolo, kneron, tf."
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-r_m',
|
||||
'--rotate_mode',
|
||||
type=int,
|
||||
help="rotate mode:0,1,2"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-bw',
|
||||
'--bitwidth',
|
||||
type=int,
|
||||
help="Int for bitwidth"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-r',
|
||||
'--radix',
|
||||
type=int,
|
||||
help="Int for radix"
|
||||
)
|
||||
|
||||
args = argparser.parse_args()
|
||||
main_(args)
|
||||
1226
kneron/exporting/yolov5/kneron_preprocessing/Flow.py
Normal file
2
kneron/exporting/yolov5/kneron_preprocessing/__init__.py
Normal file
@ -0,0 +1,2 @@
|
||||
from .Flow import *
|
||||
from .API import *
|
||||
@ -0,0 +1,285 @@
|
||||
import numpy as np
|
||||
from PIL import Image
|
||||
from .utils import signed_rounding, clip, str2bool
|
||||
|
||||
format_bit = 10
|
||||
c00_yuv = 1
|
||||
c02_yuv = 1436
|
||||
c10_yuv = 1
|
||||
c11_yuv = -354
|
||||
c12_yuv = -732
|
||||
c20_yuv = 1
|
||||
c21_yuv = 1814
|
||||
c00_ycbcr = 1192
|
||||
c02_ycbcr = 1634
|
||||
c10_ycbcr = 1192
|
||||
c11_ycbcr = -401
|
||||
c12_ycbcr = -833
|
||||
c20_ycbcr = 1192
|
||||
c21_ycbcr = 2065
|
||||
|
||||
Matrix_ycbcr_to_rgb888 = np.array(
|
||||
[[1.16438356e+00, 1.16438356e+00, 1.16438356e+00],
|
||||
[2.99747219e-07, - 3.91762529e-01, 2.01723263e+00],
|
||||
[1.59602686e+00, - 8.12968294e-01, 3.04059479e-06]])
|
||||
|
||||
Matrix_rgb888_to_ycbcr = np.array(
|
||||
[[0.25678824, - 0.14822353, 0.43921569],
|
||||
[0.50412941, - 0.29099216, - 0.36778824],
|
||||
[0.09790588, 0.43921569, - 0.07142745]])
|
||||
|
||||
Matrix_rgb888_to_yuv = np.array(
|
||||
[[ 0.29899106, -0.16877996, 0.49988381],
|
||||
[ 0.5865453, -0.33110385, -0.41826072],
|
||||
[ 0.11446364, 0.49988381, -0.08162309]])
|
||||
|
||||
# Matrix_rgb888_to_yuv = np.array(
|
||||
# [[0.299, - 0.147, 0.615],
|
||||
# [0.587, - 0.289, - 0.515],
|
||||
# [0.114, 0.436, - 0.100]])
|
||||
|
||||
# Matrix_yuv_to_rgb888 = np.array(
|
||||
# [[1.000, 1.000, 1.000],
|
||||
# [0.000, - 0.394, 2.032],
|
||||
# [1.140, - 0.581, 0.000]])
|
||||
|
||||
class runner(object):
|
||||
def __init__(self):
|
||||
self.set = {
|
||||
'print_info':'no',
|
||||
'model_size':[0,0],
|
||||
'numerical_type':'floating',
|
||||
"source_format": "rgb888",
|
||||
"out_format": "rgb888",
|
||||
"options": {
|
||||
"simulation": "no",
|
||||
"simulation_format": "rgb888"
|
||||
}
|
||||
}
|
||||
|
||||
def update(self, **kwargs):
|
||||
#
|
||||
self.set.update(kwargs)
|
||||
|
||||
## simulation
|
||||
self.funs = []
|
||||
if str2bool(self.set['options']['simulation']) and self.set['source_format'].lower() in ['RGB888', 'rgb888', 'RGB', 'rgb']:
|
||||
if self.set['options']['simulation_format'].lower() in ['YUV422', 'yuv422', 'YUV', 'yuv']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_YUV422)
|
||||
self.set['source_format'] = 'YUV422'
|
||||
elif self.set['options']['simulation_format'].lower() in ['YCBCR422', 'YCbCr422', 'ycbcr422', 'YCBCR', 'YCbCr', 'ycbcr']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_YCbCr422)
|
||||
self.set['source_format'] = 'YCbCr422'
|
||||
elif self.set['options']['simulation_format'].lower() in['RGB565', 'rgb565']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_RGB565)
|
||||
self.set['source_format'] = 'RGB565'
|
||||
|
||||
## to rgb888
|
||||
if self.set['source_format'].lower() in ['YUV444', 'yuv444','YUV422', 'yuv422', 'YUV', 'yuv']:
|
||||
self.funs.append(self._ColorConversion_YUV_to_RGB888)
|
||||
elif self.set['source_format'].lower() in ['YCBCR444', 'YCbCr444', 'ycbcr444','YCBCR422', 'YCbCr422', 'ycbcr422', 'YCBCR', 'YCbCr', 'ycbcr']:
|
||||
self.funs.append(self._ColorConversion_YCbCr_to_RGB888)
|
||||
elif self.set['source_format'].lower() in ['RGB565', 'rgb565']:
|
||||
self.funs.append(self._ColorConversion_RGB565_to_RGB888)
|
||||
elif self.set['source_format'].lower() in ['l', 'L' , 'nir', 'NIR']:
|
||||
self.funs.append(self._ColorConversion_L_to_RGB888)
|
||||
elif self.set['source_format'].lower() in ['RGBA8888', 'rgba8888' , 'RGBA', 'rgba']:
|
||||
self.funs.append(self._ColorConversion_RGBA8888_to_RGB888)
|
||||
|
||||
## output format
|
||||
if self.set['out_format'].lower() in ['L', 'l']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_L)
|
||||
elif self.set['out_format'].lower() in['RGB565', 'rgb565']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_RGB565)
|
||||
elif self.set['out_format'].lower() in['RGBA', 'RGBA8888','rgba','rgba8888']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_RGBA8888)
|
||||
elif self.set['out_format'].lower() in['YUV', 'YUV444','yuv','yuv444']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_YUV444)
|
||||
elif self.set['out_format'].lower() in['YUV422','yuv422']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_YUV422)
|
||||
elif self.set['out_format'].lower() in['YCBCR', 'YCBCR444','YCbCr','YCbCr444','ycbcr','ycbcr444']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_YCbCr444)
|
||||
elif self.set['out_format'].lower() in['YCBCR422','YCbCr422','ycbcr422']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_YCbCr422)
|
||||
|
||||
def print_info(self):
|
||||
print("<colorConversion>",
|
||||
"source_format:", self.set['source_format'],
|
||||
', out_format:', self.set['out_format'],
|
||||
', simulation:', self.set['options']['simulation'],
|
||||
', simulation_format:', self.set['options']['simulation_format'])
|
||||
|
||||
def run(self, image_data):
|
||||
assert isinstance(image_data, np.ndarray)
|
||||
# print info
|
||||
if str2bool(self.set['print_info']):
|
||||
self.print_info()
|
||||
|
||||
# color
|
||||
for _, f in enumerate(self.funs):
|
||||
image_data = f(image_data)
|
||||
|
||||
# output
|
||||
info = {}
|
||||
return image_data, info
|
||||
|
||||
def _ColorConversion_RGB888_to_YUV444(self, image):
|
||||
## floating
|
||||
image = image.astype('float')
|
||||
image = (image @ Matrix_rgb888_to_yuv + 0.5).astype('uint8')
|
||||
return image
|
||||
|
||||
def _ColorConversion_RGB888_to_YUV422(self, image):
|
||||
# rgb888 to yuv444
|
||||
image = self._ColorConversion_RGB888_to_YUV444(image)
|
||||
|
||||
# yuv444 to yuv422
|
||||
u2 = image[:, 0::2, 1]
|
||||
u4 = np.repeat(u2, 2, axis=1)
|
||||
v2 = image[:, 1::2, 2]
|
||||
v4 = np.repeat(v2, 2, axis=1)
|
||||
image[..., 1] = u4
|
||||
image[..., 2] = v4
|
||||
return image
|
||||
|
||||
def _ColorConversion_YUV_to_RGB888(self, image):
|
||||
## fixed
|
||||
h, w, c = image.shape
|
||||
image_f = image.reshape((h * w, c))
|
||||
image_rgb_f = np.zeros(image_f.shape, dtype=np.uint8)
|
||||
|
||||
for i in range(h * w):
|
||||
image_y = image_f[i, 0] *1024
|
||||
if image_f[i, 1] > 127:
|
||||
image_u = -((~(image_f[i, 1] - 1)) & 0xFF)
|
||||
else:
|
||||
image_u = image_f[i, 1]
|
||||
if image_f[i, 2] > 127:
|
||||
image_v = -((~(image_f[i, 2] - 1)) & 0xFF)
|
||||
else:
|
||||
image_v = image_f[i, 2]
|
||||
|
||||
image_r = c00_yuv * image_y + c02_yuv * image_v
|
||||
image_g = c10_yuv * image_y + c11_yuv * image_u + c12_yuv * image_v
|
||||
image_b = c20_yuv * image_y + c21_yuv * image_u
|
||||
|
||||
image_r = signed_rounding(image_r, format_bit)
|
||||
image_g = signed_rounding(image_g, format_bit)
|
||||
image_b = signed_rounding(image_b, format_bit)
|
||||
|
||||
image_r = image_r >> format_bit
|
||||
image_g = image_g >> format_bit
|
||||
image_b = image_b >> format_bit
|
||||
|
||||
image_rgb_f[i, 0] = clip(image_r, 0, 255)
|
||||
image_rgb_f[i, 1] = clip(image_g, 0, 255)
|
||||
image_rgb_f[i, 2] = clip(image_b, 0, 255)
|
||||
|
||||
image_rgb = image_rgb_f.reshape((h, w, c))
|
||||
return image_rgb
|
||||
|
||||
def _ColorConversion_RGB888_to_YCbCr444(self, image):
|
||||
## floating
|
||||
image = image.astype('float')
|
||||
image = (image @ Matrix_rgb888_to_ycbcr + 0.5).astype('uint8')
|
||||
image[:, :, 0] += 16
|
||||
image[:, :, 1] += 128
|
||||
image[:, :, 2] += 128
|
||||
|
||||
return image
|
||||
|
||||
def _ColorConversion_RGB888_to_YCbCr422(self, image):
|
||||
# rgb888 to ycbcr444
|
||||
image = self._ColorConversion_RGB888_to_YCbCr444(image)
|
||||
|
||||
# ycbcr444 to ycbcr422
|
||||
cb2 = image[:, 0::2, 1]
|
||||
cb4 = np.repeat(cb2, 2, axis=1)
|
||||
cr2 = image[:, 1::2, 2]
|
||||
cr4 = np.repeat(cr2, 2, axis=1)
|
||||
image[..., 1] = cb4
|
||||
image[..., 2] = cr4
|
||||
return image
|
||||
|
||||
def _ColorConversion_YCbCr_to_RGB888(self, image):
|
||||
## floating
|
||||
if (self.set['numerical_type'] == 'floating'):
|
||||
image = image.astype('float')
|
||||
image[:, :, 0] -= 16
|
||||
image[:, :, 1] -= 128
|
||||
image[:, :, 2] -= 128
|
||||
image = ((image @ Matrix_ycbcr_to_rgb888) + 0.5).astype('uint8')
|
||||
return image
|
||||
|
||||
## fixed
|
||||
h, w, c = image.shape
|
||||
image_f = image.reshape((h * w, c))
|
||||
image_rgb_f = np.zeros(image_f.shape, dtype=np.uint8)
|
||||
|
||||
for i in range(h * w):
|
||||
image_y = (image_f[i, 0] - 16) * c00_ycbcr
|
||||
image_cb = image_f[i, 1] - 128
|
||||
image_cr = image_f[i, 2] - 128
|
||||
|
||||
image_r = image_y + c02_ycbcr * image_cr
|
||||
image_g = image_y + c11_ycbcr * image_cb + c12_ycbcr * image_cr
|
||||
image_b = image_y + c21_ycbcr * image_cb
|
||||
|
||||
image_r = signed_rounding(image_r, format_bit)
|
||||
image_g = signed_rounding(image_g, format_bit)
|
||||
image_b = signed_rounding(image_b, format_bit)
|
||||
|
||||
image_r = image_r >> format_bit
|
||||
image_g = image_g >> format_bit
|
||||
image_b = image_b >> format_bit
|
||||
|
||||
image_rgb_f[i, 0] = clip(image_r, 0, 255)
|
||||
image_rgb_f[i, 1] = clip(image_g, 0, 255)
|
||||
image_rgb_f[i, 2] = clip(image_b, 0, 255)
|
||||
|
||||
image_rgb = image_rgb_f.reshape((h, w, c))
|
||||
return image_rgb
|
||||
|
||||
def _ColorConversion_RGB888_to_RGB565(self, image):
|
||||
assert (len(image.shape)==3)
|
||||
assert (image.shape[2]>=3)
|
||||
|
||||
image_rgb565 = np.zeros(image.shape, dtype=np.uint8)
|
||||
image_rgb = image.astype('uint8')
|
||||
image_rgb565[:, :, 0] = image_rgb[:, :, 0] >> 3
|
||||
image_rgb565[:, :, 1] = image_rgb[:, :, 1] >> 2
|
||||
image_rgb565[:, :, 2] = image_rgb[:, :, 2] >> 3
|
||||
return image_rgb565
|
||||
|
||||
def _ColorConversion_RGB565_to_RGB888(self, image):
|
||||
assert (len(image.shape)==3)
|
||||
assert (image.shape[2]==3)
|
||||
|
||||
image_rgb = np.zeros(image.shape, dtype=np.uint8)
|
||||
image_rgb[:, :, 0] = image[:, :, 0] << 3
|
||||
image_rgb[:, :, 1] = image[:, :, 1] << 2
|
||||
image_rgb[:, :, 2] = image[:, :, 2] << 3
|
||||
return image_rgb
|
||||
|
||||
def _ColorConversion_L_to_RGB888(self, image):
|
||||
image_L = image.astype('uint8')
|
||||
img = Image.fromarray(image_L).convert('RGB')
|
||||
image_data = np.array(img).astype('uint8')
|
||||
return image_data
|
||||
|
||||
def _ColorConversion_RGB888_to_L(self, image):
|
||||
image_rgb = image.astype('uint8')
|
||||
img = Image.fromarray(image_rgb).convert('L')
|
||||
image_data = np.array(img).astype('uint8')
|
||||
return image_data
|
||||
|
||||
def _ColorConversion_RGBA8888_to_RGB888(self, image):
|
||||
assert (len(image.shape)==3)
|
||||
assert (image.shape[2]==4)
|
||||
return image[:,:,:3]
|
||||
|
||||
def _ColorConversion_RGB888_to_RGBA8888(self, image):
|
||||
assert (len(image.shape)==3)
|
||||
assert (image.shape[2]==3)
|
||||
imageA = np.concatenate((image, np.zeros((image.shape[0], image.shape[1], 1), dtype=np.uint8) ), axis=2)
|
||||
return imageA
|
||||
145
kneron/exporting/yolov5/kneron_preprocessing/funcs/Crop.py
Normal file
@ -0,0 +1,145 @@
|
||||
import numpy as np
|
||||
from PIL import Image
|
||||
from .utils import str2int, str2float, str2bool, pad_square_to_4
|
||||
from .utils_520 import round_up_n
|
||||
from .Runner_base import Runner_base, Param_base
|
||||
|
||||
class General(Param_base):
|
||||
type = 'center'
|
||||
align_w_to_4 = False
|
||||
pad_square_to_4 = False
|
||||
rounding_type = 0
|
||||
crop_w = 0
|
||||
crop_h = 0
|
||||
start_x = 0.
|
||||
start_y = 0.
|
||||
end_x = 0.
|
||||
end_y = 0.
|
||||
def update(self, **dic):
|
||||
self.type = dic['type']
|
||||
self.align_w_to_4 = str2bool(dic['align_w_to_4'])
|
||||
self.rounding_type = str2int(dic['rounding_type'])
|
||||
self.crop_w = str2int(dic['crop_w'])
|
||||
self.crop_h = str2int(dic['crop_h'])
|
||||
self.start_x = str2float(dic['start_x'])
|
||||
self.start_y = str2float(dic['start_y'])
|
||||
self.end_x = str2float(dic['end_x'])
|
||||
self.end_y = str2float(dic['end_y'])
|
||||
|
||||
def __str__(self):
|
||||
str_out = [
|
||||
', type:',str(self.type),
|
||||
', align_w_to_4:',str(self.align_w_to_4),
|
||||
', pad_square_to_4:',str(self.pad_square_to_4),
|
||||
', crop_w:',str(self.crop_w),
|
||||
', crop_h:',str(self.crop_h),
|
||||
', start_x:',str(self.start_x),
|
||||
', start_y:',str(self.start_y),
|
||||
', end_x:',str(self.end_x),
|
||||
', end_y:',str(self.end_y)]
|
||||
return(' '.join(str_out))
|
||||
|
||||
class runner(Runner_base):
|
||||
## overwrite the class in Runner_base
|
||||
general = General()
|
||||
|
||||
def __str__(self):
|
||||
return('<Crop>')
|
||||
|
||||
def update(self, **kwargs):
|
||||
##
|
||||
super().update(**kwargs)
|
||||
|
||||
##
|
||||
if (self.general.start_x != self.general.end_x) and (self.general.start_y != self.general.end_y):
|
||||
self.general.type = 'specific'
|
||||
elif(self.general.type != 'specific'):
|
||||
if self.general.crop_w == 0 or self.general.crop_h == 0:
|
||||
self.general.crop_w = self.common.model_size[0]
|
||||
self.general.crop_h = self.common.model_size[1]
|
||||
assert(self.general.crop_w > 0)
|
||||
assert(self.general.crop_h > 0)
|
||||
assert(self.general.type.lower() in ['CENTER', 'Center', 'center', 'CORNER', 'Corner', 'corner'])
|
||||
else:
|
||||
assert(self.general.type == 'specific')
|
||||
|
||||
def run(self, image_data):
|
||||
## init
|
||||
img = Image.fromarray(image_data)
|
||||
w, h = img.size
|
||||
|
||||
## get range
|
||||
if self.general.type.lower() in ['CENTER', 'Center', 'center']:
|
||||
x1, y1, x2, y2 = self._calcuate_xy_center(w, h)
|
||||
elif self.general.type.lower() in ['CORNER', 'Corner', 'corner']:
|
||||
x1, y1, x2, y2 = self._calcuate_xy_corner(w, h)
|
||||
else:
|
||||
x1 = self.general.start_x
|
||||
y1 = self.general.start_y
|
||||
x2 = self.general.end_x
|
||||
y2 = self.general.end_y
|
||||
assert( ((x1 != x2) and (y1 != y2)) )
|
||||
|
||||
## rounding
|
||||
if self.general.rounding_type == 0:
|
||||
x1 = int(np.floor(x1))
|
||||
y1 = int(np.floor(y1))
|
||||
x2 = int(np.ceil(x2))
|
||||
y2 = int(np.ceil(y2))
|
||||
else:
|
||||
x1 = int(round(x1))
|
||||
y1 = int(round(y1))
|
||||
x2 = int(round(x2))
|
||||
y2 = int(round(y2))
|
||||
|
||||
if self.general.align_w_to_4:
|
||||
# x1 = (x1+1) &(~3) #//+2
|
||||
# x2 = (x2+2) &(~3) #//+1
|
||||
x1 = (x1+3) &(~3) #//+2
|
||||
left = w - x2
|
||||
left = (left+3) &(~3)
|
||||
x2 = w - left
|
||||
|
||||
## pad_square_to_4
|
||||
if str2bool(self.general.pad_square_to_4):
|
||||
x1,x2,y1,y2 = pad_square_to_4(x1,x2,y1,y2)
|
||||
|
||||
# do crop
|
||||
box = (x1,y1,x2,y2)
|
||||
img = img.crop(box)
|
||||
|
||||
# print info
|
||||
if str2bool(self.common.print_info):
|
||||
self.general.start_x = x1
|
||||
self.general.start_y = y1
|
||||
self.general.end_x = x2
|
||||
self.general.end_y = y2
|
||||
self.general.crop_w = x2 - x1
|
||||
self.general.crop_h = y2 - y1
|
||||
self.print_info()
|
||||
|
||||
# output
|
||||
image_data = np.array(img)
|
||||
info = {}
|
||||
info['box'] = box
|
||||
|
||||
return image_data, info
|
||||
|
||||
|
||||
## protect fun
|
||||
def _calcuate_xy_center(self, w, h):
|
||||
x1 = w/2 - self.general.crop_w / 2
|
||||
y1 = h/2 - self.general.crop_h / 2
|
||||
x2 = w/2 + self.general.crop_w / 2
|
||||
y2 = h/2 + self.general.crop_h / 2
|
||||
return x1, y1, x2, y2
|
||||
|
||||
def _calcuate_xy_corner(self, _1, _2):
|
||||
x1 = 0
|
||||
y1 = 0
|
||||
x2 = self.general.crop_w
|
||||
y2 = self.general.crop_h
|
||||
return x1, y1, x2, y2
|
||||
|
||||
def do_crop(self, image_data, startW, startH, endW, endH):
|
||||
return image_data[startH:endH, startW:endW, :]
|
||||
186
kneron/exporting/yolov5/kneron_preprocessing/funcs/Normalize.py
Normal file
@ -0,0 +1,186 @@
|
||||
import numpy as np
|
||||
from .utils import str2bool, str2int, str2float, clip_ary
|
||||
|
||||
class runner(object):
|
||||
def __init__(self):
|
||||
self.set = {
|
||||
'general': {
|
||||
'print_info':'no',
|
||||
'model_size':[0,0],
|
||||
'numerical_type':'floating',
|
||||
'type': 'kneron'
|
||||
},
|
||||
'floating':{
|
||||
"scale": 1,
|
||||
"bias": 0,
|
||||
"mean": "",
|
||||
"std": "",
|
||||
},
|
||||
'hw':{
|
||||
"radix":8,
|
||||
"shift":"",
|
||||
"sub":""
|
||||
}
|
||||
}
|
||||
return
|
||||
|
||||
def update(self, **kwargs):
|
||||
#
|
||||
self.set.update(kwargs)
|
||||
|
||||
#
|
||||
if self.set['general']['numerical_type'] == '520':
|
||||
if self.set['general']['type'].lower() in ['TF', 'Tf', 'tf']:
|
||||
self.fun_normalize = self._chen_520
|
||||
self.shift = 7 - self.set['hw']['radix']
|
||||
self.sub = 128
|
||||
elif self.set['general']['type'].lower() in ['YOLO', 'Yolo', 'yolo']:
|
||||
self.fun_normalize = self._chen_520
|
||||
self.shift = 8 - self.set['hw']['radix']
|
||||
self.sub = 0
|
||||
elif self.set['general']['type'].lower() in ['KNERON', 'Kneron', 'kneron']:
|
||||
self.fun_normalize = self._chen_520
|
||||
self.shift = 8 - self.set['hw']['radix']
|
||||
self.sub = 128
|
||||
else:
|
||||
self.fun_normalize = self._chen_520
|
||||
self.shift = 0
|
||||
self.sub = 0
|
||||
elif self.set['general']['numerical_type'] == '720':
|
||||
self.fun_normalize = self._chen_720
|
||||
self.shift = 0
|
||||
self.sub = 0
|
||||
else:
|
||||
if self.set['general']['type'].lower() in ['TORCH', 'Torch', 'torch']:
|
||||
self.fun_normalize = self._normalize_torch
|
||||
self.set['floating']['scale'] = 255.
|
||||
self.set['floating']['mean'] = [0.485, 0.456, 0.406]
|
||||
self.set['floating']['std'] = [0.229, 0.224, 0.225]
|
||||
elif self.set['general']['type'].lower() in ['TF', 'Tf', 'tf']:
|
||||
self.fun_normalize = self._normalize_tf
|
||||
self.set['floating']['scale'] = 127.5
|
||||
self.set['floating']['bias'] = -1.
|
||||
elif self.set['general']['type'].lower() in ['CAFFE', 'Caffe', 'caffe']:
|
||||
self.fun_normalize = self._normalize_caffe
|
||||
self.set['floating']['mean'] = [103.939, 116.779, 123.68]
|
||||
elif self.set['general']['type'].lower() in ['YOLO', 'Yolo', 'yolo']:
|
||||
self.fun_normalize = self._normalize_yolo
|
||||
self.set['floating']['scale'] = 255.
|
||||
elif self.set['general']['type'].lower() in ['KNERON', 'Kneron', 'kneron']:
|
||||
self.fun_normalize = self._normalize_kneron
|
||||
self.set['floating']['scale'] = 256.
|
||||
self.set['floating']['bias'] = -0.5
|
||||
else:
|
||||
self.fun_normalize = self._normalize_customized
|
||||
self.set['floating']['scale'] = str2float(self.set['floating']['scale'])
|
||||
self.set['floating']['bias'] = str2float(self.set['floating']['bias'])
|
||||
if self.set['floating']['mean'] != None:
|
||||
if len(self.set['floating']['mean']) != 3:
|
||||
self.set['floating']['mean'] = None
|
||||
if self.set['floating']['std'] != None:
|
||||
if len(self.set['floating']['std']) != 3:
|
||||
self.set['floating']['std'] = None
|
||||
|
||||
|
||||
def print_info(self):
|
||||
if self.set['general']['numerical_type'] == '520':
|
||||
print("<normalize>",
|
||||
'numerical_type', self.set['general']['numerical_type'],
|
||||
", type:", self.set['general']['type'],
|
||||
', shift:',self.shift,
|
||||
', sub:', self.sub)
|
||||
else:
|
||||
print("<normalize>",
|
||||
'numerical_type', self.set['general']['numerical_type'],
|
||||
", type:", self.set['general']['type'],
|
||||
', scale:',self.set['floating']['scale'],
|
||||
', bias:', self.set['floating']['bias'],
|
||||
', mean:', self.set['floating']['mean'],
|
||||
', std:',self.set['floating']['std'])
|
||||
|
||||
def run(self, image_data):
|
||||
# print info
|
||||
if str2bool(self.set['general']['print_info']):
|
||||
self.print_info()
|
||||
|
||||
# norm
|
||||
image_data = self.fun_normalize(image_data)
|
||||
|
||||
# output
|
||||
info = {}
|
||||
return image_data, info
|
||||
|
||||
def _normalize_torch(self, x):
|
||||
if len(x.shape) != 3:
|
||||
return x
|
||||
x = x.astype('float')
|
||||
x = x / self.set['floating']['scale']
|
||||
x[..., 0] -= self.set['floating']['mean'][0]
|
||||
x[..., 1] -= self.set['floating']['mean'][1]
|
||||
x[..., 2] -= self.set['floating']['mean'][2]
|
||||
x[..., 0] /= self.set['floating']['std'][0]
|
||||
x[..., 1] /= self.set['floating']['std'][1]
|
||||
x[..., 2] /= self.set['floating']['std'][2]
|
||||
return x
|
||||
|
||||
def _normalize_tf(self, x):
|
||||
# print('_normalize_tf')
|
||||
x = x.astype('float')
|
||||
x = x / self.set['floating']['scale']
|
||||
x = x + self.set['floating']['bias']
|
||||
return x
|
||||
|
||||
def _normalize_caffe(self, x):
|
||||
if len(x.shape) != 3:
|
||||
return x
|
||||
x = x.astype('float')
|
||||
x = x[..., ::-1]
|
||||
x[..., 0] -= self.set['floating']['mean'][0]
|
||||
x[..., 1] -= self.set['floating']['mean'][1]
|
||||
x[..., 2] -= self.set['floating']['mean'][2]
|
||||
return x
|
||||
|
||||
def _normalize_yolo(self, x):
|
||||
# print('_normalize_yolo')
|
||||
x = x.astype('float')
|
||||
x = x / self.set['floating']['scale']
|
||||
return x
|
||||
|
||||
def _normalize_kneron(self, x):
|
||||
# print('_normalize_kneron')
|
||||
x = x.astype('float')
|
||||
x = x/self.set['floating']['scale']
|
||||
x = x + self.set['floating']['bias']
|
||||
return x
|
||||
|
||||
def _normalize_customized(self, x):
|
||||
# print('_normalize_customized')
|
||||
x = x.astype('float')
|
||||
if self.set['floating']['scale'] != 0:
|
||||
x = x/ self.set['floating']['scale']
|
||||
x = x + self.set['floating']['bias']
|
||||
if self.set['floating']['mean'] is not None:
|
||||
x[..., 0] -= self.set['floating']['mean'][0]
|
||||
x[..., 1] -= self.set['floating']['mean'][1]
|
||||
x[..., 2] -= self.set['floating']['mean'][2]
|
||||
if self.set['floating']['std'] is not None:
|
||||
x[..., 0] /= self.set['floating']['std'][0]
|
||||
x[..., 1] /= self.set['floating']['std'][1]
|
||||
x[..., 2] /= self.set['floating']['std'][2]
|
||||
|
||||
return x
|
||||
|
||||
def _chen_520(self, x):
|
||||
# print('_chen_520')
|
||||
x = (x - self.sub).astype('uint8')
|
||||
x = (np.right_shift(x,self.shift))
|
||||
x=x.astype('uint8')
|
||||
return x
|
||||
|
||||
def _chen_720(self, x):
|
||||
# print('_chen_720')
|
||||
if self.shift == 1:
|
||||
x = x + np.array([[self.sub], [self.sub], [self.sub]])
|
||||
else:
|
||||
x = x + np.array([[self.sub], [self.sub], [self.sub]])
|
||||
return x
|
||||
187
kneron/exporting/yolov5/kneron_preprocessing/funcs/Padding.py
Normal file
@ -0,0 +1,187 @@
|
||||
import numpy as np
|
||||
from PIL import Image
|
||||
from .utils import str2bool, str2int, str2float
|
||||
from .Runner_base import Runner_base, Param_base
|
||||
|
||||
class General(Param_base):
|
||||
type = ''
|
||||
pad_val = ''
|
||||
padded_w = ''
|
||||
padded_h = ''
|
||||
pad_l = ''
|
||||
pad_r = ''
|
||||
pad_t = ''
|
||||
pad_b = ''
|
||||
padding_ch = 3
|
||||
padding_ch_type = 'RGB'
|
||||
def update(self, **dic):
|
||||
self.type = dic['type']
|
||||
self.pad_val = dic['pad_val']
|
||||
self.padded_w = str2int(dic['padded_w'])
|
||||
self.padded_h = str2int(dic['padded_h'])
|
||||
self.pad_l = str2int(dic['pad_l'])
|
||||
self.pad_r = str2int(dic['pad_r'])
|
||||
self.pad_t = str2int(dic['pad_t'])
|
||||
self.pad_b = str2int(dic['pad_b'])
|
||||
|
||||
def __str__(self):
|
||||
str_out = [
|
||||
', type:',str(self.type),
|
||||
', pad_val:',str(self.pad_val),
|
||||
', pad_l:',str(self.pad_l),
|
||||
', pad_r:',str(self.pad_r),
|
||||
', pad_r:',str(self.pad_t),
|
||||
', pad_b:',str(self.pad_b),
|
||||
', padding_ch:',str(self.padding_ch)]
|
||||
return(' '.join(str_out))
|
||||
|
||||
class Hw(Param_base):
|
||||
radix = 8
|
||||
normalize_type = 'floating'
|
||||
def update(self, **dic):
|
||||
self.radix = dic['radix']
|
||||
self.normalize_type = dic['normalize_type']
|
||||
|
||||
def __str__(self):
|
||||
str_out = [
|
||||
', radix:', str(self.radix),
|
||||
', normalize_type:',str(self.normalize_type)]
|
||||
return(' '.join(str_out))
|
||||
|
||||
|
||||
class runner(Runner_base):
|
||||
## overwrite the class in Runner_base
|
||||
general = General()
|
||||
hw = Hw()
|
||||
|
||||
def __str__(self):
|
||||
return('<Padding>')
|
||||
|
||||
def update(self, **kwargs):
|
||||
super().update(**kwargs)
|
||||
|
||||
## update pad type & pad length
|
||||
if (self.general.pad_l != 0) or (self.general.pad_r != 0) or (self.general.pad_t != 0) or (self.general.pad_b != 0):
|
||||
self.general.type = 'specific'
|
||||
assert(self.general.pad_l >= 0)
|
||||
assert(self.general.pad_r >= 0)
|
||||
assert(self.general.pad_t >= 0)
|
||||
assert(self.general.pad_b >= 0)
|
||||
elif(self.general.type != 'specific'):
|
||||
if self.general.padded_w == 0 or self.general.padded_h == 0:
|
||||
self.general.padded_w = self.common.model_size[0]
|
||||
self.general.padded_h = self.common.model_size[1]
|
||||
assert(self.general.padded_w > 0)
|
||||
assert(self.general.padded_h > 0)
|
||||
assert(self.general.type.lower() in ['CENTER', 'Center', 'center', 'CORNER', 'Corner', 'corner'])
|
||||
else:
|
||||
assert(self.general.type == 'specific')
|
||||
|
||||
## decide pad_val & padding ch
|
||||
# if numerical_type is floating
|
||||
if (self.common.numerical_type == 'floating'):
|
||||
if self.general.pad_val != 'edge':
|
||||
self.general.pad_val = str2float(self.general.pad_val)
|
||||
self.general.padding_ch = 3
|
||||
self.general.padding_ch_type = 'RGB'
|
||||
# if numerical_type is 520 or 720
|
||||
else:
|
||||
if self.general.pad_val == '':
|
||||
if self.hw.normalize_type.lower() in ['TF', 'Tf', 'tf']:
|
||||
self.general.pad_val = np.uint8(-128 >> (7 - self.hw.radix))
|
||||
elif self.hw.normalize_type.lower() in ['YOLO', 'Yolo', 'yolo']:
|
||||
self.general.pad_val = np.uint8(0 >> (8 - self.hw.radix))
|
||||
elif self.hw.normalize_type.lower() in ['KNERON', 'Kneron', 'kneron']:
|
||||
self.general.pad_val = np.uint8(-128 >> (8 - self.hw.radix))
|
||||
else:
|
||||
self.general.pad_val = np.uint8(0 >> (8 - self.hw.radix))
|
||||
else:
|
||||
self.general.pad_val = str2int(self.general.pad_val)
|
||||
self.general.padding_ch = 4
|
||||
self.general.padding_ch_type = 'RGBA'
|
||||
|
||||
def run(self, image_data):
|
||||
# init
|
||||
shape = image_data.shape
|
||||
w = shape[1]
|
||||
h = shape[0]
|
||||
if len(shape) < 3:
|
||||
self.general.padding_ch = 1
|
||||
self.general.padding_ch_type = 'L'
|
||||
else:
|
||||
if shape[2] == 3 and self.general.padding_ch == 4:
|
||||
image_data = np.concatenate((image_data, np.zeros((h, w, 1), dtype=np.uint8) ), axis=2)
|
||||
|
||||
## padding
|
||||
if self.general.type.lower() in ['CENTER', 'Center', 'center']:
|
||||
img_pad = self._padding_center(image_data, w, h)
|
||||
elif self.general.type.lower() in ['CORNER', 'Corner', 'corner']:
|
||||
img_pad = self._padding_corner(image_data, w, h)
|
||||
else:
|
||||
img_pad = self._padding_sp(image_data, w, h)
|
||||
|
||||
# print info
|
||||
if str2bool(self.common.print_info):
|
||||
self.print_info()
|
||||
|
||||
# output
|
||||
info = {}
|
||||
return img_pad, info
|
||||
|
||||
## protect fun
|
||||
def _padding_center(self, img, ori_w, ori_h):
|
||||
# img_pad = Image.new(self.general.padding_ch_type, (self.general.padded_w, self.general.padded_h), int(self.general.pad_val[0]))
|
||||
# img = Image.fromarray(img)
|
||||
# img_pad.paste(img, ((self.general.padded_w-ori_w)//2, (self.general.padded_h-ori_h)//2))
|
||||
# return img_pad
|
||||
padH = self.general.padded_h - ori_h
|
||||
padW = self.general.padded_w - ori_w
|
||||
self.general.pad_t = padH // 2
|
||||
self.general.pad_b = (padH // 2) + (padH % 2)
|
||||
self.general.pad_l = padW // 2
|
||||
self.general.pad_r = (padW // 2) + (padW % 2)
|
||||
if self.general.pad_l < 0 or self.general.pad_r <0 or self.general.pad_t <0 or self.general.pad_b<0:
|
||||
return img
|
||||
img_pad = self._padding_sp(img,ori_w,ori_h)
|
||||
return img_pad
|
||||
|
||||
def _padding_corner(self, img, ori_w, ori_h):
|
||||
# img_pad = Image.new(self.general.padding_ch_type, (self.general.padded_w, self.general.padded_h), self.general.pad_val)
|
||||
# img_pad.paste(img, (0, 0))
|
||||
self.general.pad_l = 0
|
||||
self.general.pad_r = self.general.padded_w - ori_w
|
||||
self.general.pad_t = 0
|
||||
self.general.pad_b = self.general.padded_h - ori_h
|
||||
if self.general.pad_l < 0 or self.general.pad_r <0 or self.general.pad_t <0 or self.general.pad_b<0:
|
||||
return img
|
||||
img_pad = self._padding_sp(img,ori_w,ori_h)
|
||||
return img_pad
|
||||
|
||||
def _padding_sp(self, img, ori_w, ori_h):
|
||||
# block_t = np.zeros((self.general.pad_t, self.general.pad_l + self.general.pad_r + ori_w, self.general.padding_ch), dtype=np.float)
|
||||
# block_l = np.zeros((ori_h, self.general.pad_l, self.general.padding_ch), dtype=np.float)
|
||||
# block_r = np.zeros((ori_h, self.general.pad_r, self.general.padding_ch), dtype=np.float)
|
||||
# block_b = np.zeros((self.general.pad_b, self.general.pad_l + self.general.pad_r + ori_w, self.general.padding_ch), dtype=np.float)
|
||||
# for i in range(self.general.padding_ch):
|
||||
# block_t[:, :, i] = np.ones(block_t[:, :, i].shape, dtype=np.float) * self.general.pad_val
|
||||
# block_l[:, :, i] = np.ones(block_l[:, :, i].shape, dtype=np.float) * self.general.pad_val
|
||||
# block_r[:, :, i] = np.ones(block_r[:, :, i].shape, dtype=np.float) * self.general.pad_val
|
||||
# block_b[:, :, i] = np.ones(block_b[:, :, i].shape, dtype=np.float) * self.general.pad_val
|
||||
# padded_image_hor = np.concatenate((block_l, img, block_r), axis=1)
|
||||
# padded_image = np.concatenate((block_t, padded_image_hor, block_b), axis=0)
|
||||
# return padded_image
|
||||
if self.general.padding_ch == 1:
|
||||
pad_range = ( (self.general.pad_t, self.general.pad_b),(self.general.pad_l, self.general.pad_r) )
|
||||
else:
|
||||
pad_range = ((self.general.pad_t, self.general.pad_b),(self.general.pad_l, self.general.pad_r),(0,0))
|
||||
|
||||
if isinstance(self.general.pad_val, str):
|
||||
if self.general.pad_val == 'edge':
|
||||
padded_image = np.pad(img, pad_range, mode="edge")
|
||||
else:
|
||||
padded_image = np.pad(img, pad_range, mode="constant",constant_values=0)
|
||||
else:
|
||||
padded_image = np.pad(img, pad_range, mode="constant",constant_values=self.general.pad_val)
|
||||
|
||||
return padded_image
|
||||
|
||||
237
kneron/exporting/yolov5/kneron_preprocessing/funcs/Resize.py
Normal file
@ -0,0 +1,237 @@
|
||||
import numpy as np
|
||||
import cv2
|
||||
from PIL import Image
|
||||
from .utils import str2bool, str2int
|
||||
from ctypes import c_float
|
||||
from .Runner_base import Runner_base, Param_base
|
||||
|
||||
class General(Param_base):
|
||||
type = 'bilinear'
|
||||
keep_ratio = True
|
||||
zoom = True
|
||||
calculate_ratio_using_CSim = True
|
||||
resize_w = 0
|
||||
resize_h = 0
|
||||
resized_w = 0
|
||||
resized_h = 0
|
||||
def update(self, **dic):
|
||||
self.type = dic['type']
|
||||
self.keep_ratio = str2bool(dic['keep_ratio'])
|
||||
self.zoom = str2bool(dic['zoom'])
|
||||
self.calculate_ratio_using_CSim = str2bool(dic['calculate_ratio_using_CSim'])
|
||||
self.resize_w = str2int(dic['resize_w'])
|
||||
self.resize_h = str2int(dic['resize_h'])
|
||||
|
||||
def __str__(self):
|
||||
str_out = [
|
||||
', type:',str(self.type),
|
||||
', keep_ratio:',str(self.keep_ratio),
|
||||
', zoom:',str(self.zoom),
|
||||
', calculate_ratio_using_CSim:',str(self.calculate_ratio_using_CSim),
|
||||
', resize_w:',str(self.resize_w),
|
||||
', resize_h:',str(self.resize_h),
|
||||
', resized_w:',str(self.resized_w),
|
||||
', resized_h:',str(self.resized_h)]
|
||||
return(' '.join(str_out))
|
||||
|
||||
class Hw(Param_base):
|
||||
resize_bit = 12
|
||||
def update(self, **dic):
|
||||
pass
|
||||
|
||||
def __str__(self):
|
||||
str_out = [
|
||||
', resize_bit:',str(self.resize_bit)]
|
||||
return(' '.join(str_out))
|
||||
|
||||
class runner(Runner_base):
|
||||
## overwrite the class in Runner_base
|
||||
general = General()
|
||||
hw = Hw()
|
||||
|
||||
def __str__(self):
|
||||
return('<Resize>')
|
||||
|
||||
def update(self, **kwargs):
|
||||
super().update(**kwargs)
|
||||
|
||||
## if resize size has not been assigned, then it will take model size as resize size
|
||||
if self.general.resize_w == 0 or self.general.resize_h == 0:
|
||||
self.general.resize_w = self.common.model_size[0]
|
||||
self.general.resize_h = self.common.model_size[1]
|
||||
assert(self.general.resize_w > 0)
|
||||
assert(self.general.resize_h > 0)
|
||||
|
||||
##
|
||||
if self.common.numerical_type == '520':
|
||||
self.general.type = 'fixed_520'
|
||||
elif self.common.numerical_type == '720':
|
||||
self.general.type = 'fixed_720'
|
||||
assert(self.general.type.lower() in ['BILINEAR', 'Bilinear', 'bilinear', 'BICUBIC', 'Bicubic', 'bicubic', 'FIXED', 'Fixed', 'fixed', 'FIXED_520', 'Fixed_520', 'fixed_520', 'FIXED_720', 'Fixed_720', 'fixed_720','CV', 'cv', 'opencv', 'OpenCV', 'CV2', 'cv2'])
|
||||
|
||||
|
||||
def run(self, image_data):
|
||||
## init
|
||||
ori_w = image_data.shape[1]
|
||||
ori_h = image_data.shape[0]
|
||||
info = {}
|
||||
|
||||
##
|
||||
if self.general.keep_ratio:
|
||||
self.general.resized_w, self.general.resized_h = self.calcuate_scale_keep_ratio(self.general.resize_w,self.general.resize_h, ori_w, ori_h, self.general.calculate_ratio_using_CSim)
|
||||
else:
|
||||
self.general.resized_w = int(self.general.resize_w)
|
||||
self.general.resized_h = int(self.general.resize_h)
|
||||
assert(self.general.resized_w > 0)
|
||||
assert(self.general.resized_h > 0)
|
||||
|
||||
##
|
||||
if (self.general.resized_w > ori_w) or (self.general.resized_h > ori_h):
|
||||
if not self.general.zoom:
|
||||
info['size'] = (ori_w,ori_h)
|
||||
if str2bool(self.common.print_info):
|
||||
print('no resize')
|
||||
self.print_info()
|
||||
return image_data, info
|
||||
|
||||
## resize
|
||||
if self.general.type.lower() in ['BILINEAR', 'Bilinear', 'bilinear']:
|
||||
image_data = self.do_resize_bilinear(image_data, self.general.resized_w, self.general.resized_h)
|
||||
elif self.general.type.lower() in ['BICUBIC', 'Bicubic', 'bicubic']:
|
||||
image_data = self.do_resize_bicubic(image_data, self.general.resized_w, self.general.resized_h)
|
||||
elif self.general.type.lower() in ['CV', 'cv', 'opencv', 'OpenCV', 'CV2', 'cv2']:
|
||||
image_data = self.do_resize_cv2(image_data, self.general.resized_w, self.general.resized_h)
|
||||
elif self.general.type.lower() in ['FIXED', 'Fixed', 'fixed', 'FIXED_520', 'Fixed_520', 'fixed_520', 'FIXED_720', 'Fixed_720', 'fixed_720']:
|
||||
image_data = self.do_resize_fixed(image_data, self.general.resized_w, self.general.resized_h, self.hw.resize_bit, self.general.type)
|
||||
|
||||
|
||||
# output
|
||||
info['size'] = (self.general.resized_w, self.general.resized_h)
|
||||
|
||||
# print info
|
||||
if str2bool(self.common.print_info):
|
||||
self.print_info()
|
||||
|
||||
return image_data, info
|
||||
|
||||
def calcuate_scale_keep_ratio(self, tar_w, tar_h, ori_w, ori_h, calculate_ratio_using_CSim):
|
||||
if not calculate_ratio_using_CSim:
|
||||
scale_w = tar_w * 1.0 / ori_w*1.0
|
||||
scale_h = tar_h * 1.0 / ori_h*1.0
|
||||
scale = scale_w if scale_w < scale_h else scale_h
|
||||
new_w = int(round(ori_w * scale))
|
||||
new_h = int(round(ori_h * scale))
|
||||
return new_w, new_h
|
||||
|
||||
## calculate_ratio_using_CSim
|
||||
scale_w = c_float(tar_w * 1.0 / (ori_w * 1.0)).value
|
||||
scale_h = c_float(tar_h * 1.0 / (ori_h * 1.0)).value
|
||||
scale_ratio = 0.0
|
||||
scale_target_w = 0
|
||||
scale_target_h = 0
|
||||
padH = 0
|
||||
padW = 0
|
||||
|
||||
bScaleW = True if scale_w < scale_h else False
|
||||
if bScaleW:
|
||||
scale_ratio = scale_w
|
||||
scale_target_w = int(c_float(scale_ratio * ori_w + 0.5).value)
|
||||
scale_target_h = int(c_float(scale_ratio * ori_h + 0.5).value)
|
||||
assert (abs(scale_target_w - tar_w) <= 1), "Error: scale down width cannot meet expectation\n"
|
||||
padH = tar_h - scale_target_h
|
||||
padW = 0
|
||||
assert (padH >= 0), "Error: padH shouldn't be less than zero\n"
|
||||
else:
|
||||
scale_ratio = scale_h
|
||||
scale_target_w = int(c_float(scale_ratio * ori_w + 0.5).value)
|
||||
scale_target_h = int(c_float(scale_ratio * ori_h + 0.5).value)
|
||||
assert (abs(scale_target_h - tar_h) <= 1), "Error: scale down height cannot meet expectation\n"
|
||||
padW = tar_w - scale_target_w
|
||||
padH = 0
|
||||
assert (padW >= 0), "Error: padW shouldn't be less than zero\n"
|
||||
new_w = tar_w - padW
|
||||
new_h = tar_h - padH
|
||||
return new_w, new_h
|
||||
|
||||
def do_resize_bilinear(self, image_data, resized_w, resized_h):
|
||||
img = Image.fromarray(image_data)
|
||||
img = img.resize((resized_w, resized_h), Image.BILINEAR)
|
||||
image_data = np.array(img).astype('uint8')
|
||||
return image_data
|
||||
|
||||
def do_resize_bicubic(self, image_data, resized_w, resized_h):
|
||||
img = Image.fromarray(image_data)
|
||||
img = img.resize((resized_w, resized_h), Image.BICUBIC)
|
||||
image_data = np.array(img).astype('uint8')
|
||||
return image_data
|
||||
|
||||
def do_resize_cv2(self, image_data, resized_w, resized_h):
|
||||
image_data = cv2.resize(image_data, (resized_w, resized_h))
|
||||
image_data = np.array(image_data)
|
||||
# image_data = np.array(image_data).astype('uint8')
|
||||
return image_data
|
||||
|
||||
def do_resize_fixed(self, image_data, resized_w, resized_h, resize_bit, type):
|
||||
if len(image_data.shape) < 3:
|
||||
m, n = image_data.shape
|
||||
tmp = np.zeros((m,n,3), dtype=np.uint8)
|
||||
tmp[:,:,0] = image_data
|
||||
image_data = tmp
|
||||
c = 3
|
||||
gray = True
|
||||
else:
|
||||
m, n, c = image_data.shape
|
||||
gray = False
|
||||
|
||||
resolution = 1 << resize_bit
|
||||
|
||||
# Width
|
||||
ratio = int(((n - 1) << resize_bit) / (resized_w - 1))
|
||||
ratio_cnt = 0
|
||||
src_x = 0
|
||||
resized_image_w = np.zeros((m, resized_w, c), dtype=np.uint8)
|
||||
|
||||
for dst_x in range(resized_w):
|
||||
while ratio_cnt > resolution:
|
||||
ratio_cnt = ratio_cnt - resolution
|
||||
src_x = src_x + 1
|
||||
mul1 = np.ones((m, c)) * (resolution - ratio_cnt)
|
||||
mul2 = np.ones((m, c)) * ratio_cnt
|
||||
resized_image_w[:, dst_x, :] = np.multiply(np.multiply(
|
||||
image_data[:, src_x, :], mul1) + np.multiply(image_data[:, src_x + 1, :], mul2), 1/resolution)
|
||||
ratio_cnt = ratio_cnt + ratio
|
||||
|
||||
# Height
|
||||
ratio = int(((m - 1) << resize_bit) / (resized_h - 1))
|
||||
## NPU HW special case 2 , only on 520
|
||||
if type.lower() in ['FIXED_520', 'Fixed_520', 'fixed_520']:
|
||||
if (((ratio * (resized_h - 1)) % 4096 == 0) and ratio != 4096):
|
||||
ratio -= 1
|
||||
|
||||
ratio_cnt = 0
|
||||
src_x = 0
|
||||
resized_image = np.zeros(
|
||||
(resized_h, resized_w, c), dtype=np.uint8)
|
||||
for dst_x in range(resized_h):
|
||||
while ratio_cnt > resolution:
|
||||
ratio_cnt = ratio_cnt - resolution
|
||||
src_x = src_x + 1
|
||||
|
||||
mul1 = np.ones((resized_w, c)) * (resolution - ratio_cnt)
|
||||
mul2 = np.ones((resized_w, c)) * ratio_cnt
|
||||
|
||||
## NPU HW special case 1 , both on 520 / 720
|
||||
if (((dst_x > 0) and ratio_cnt == resolution) and (ratio != resolution)):
|
||||
if type.lower() in ['FIXED_520', 'Fixed_520', 'fixed_520','FIXED_720', 'Fixed_720', 'fixed_720' ]:
|
||||
resized_image[dst_x, :, :] = np.multiply(np.multiply(
|
||||
resized_image_w[src_x+1, :, :], mul1) + np.multiply(resized_image_w[src_x + 2, :, :], mul2), 1/resolution)
|
||||
else:
|
||||
resized_image[dst_x, :, :] = np.multiply(np.multiply(
|
||||
resized_image_w[src_x, :, :], mul1) + np.multiply(resized_image_w[src_x + 1, :, :], mul2), 1/resolution)
|
||||
|
||||
ratio_cnt = ratio_cnt + ratio
|
||||
|
||||
if gray:
|
||||
resized_image = resized_image[:,:,0]
|
||||
|
||||
return resized_image
|
||||
45
kneron/exporting/yolov5/kneron_preprocessing/funcs/Rotate.py
Normal file
@ -0,0 +1,45 @@
|
||||
import numpy as np
|
||||
from .utils import str2bool, str2int
|
||||
|
||||
class runner(object):
|
||||
def __init__(self, *args, **kwargs):
|
||||
self.set = {
|
||||
'operator': '',
|
||||
"rotate_direction": 0,
|
||||
|
||||
}
|
||||
self.update(*args, **kwargs)
|
||||
|
||||
def update(self, *args, **kwargs):
|
||||
self.set.update(kwargs)
|
||||
self.rotate_direction = str2int(self.set['rotate_direction'])
|
||||
|
||||
# print info
|
||||
if str2bool(self.set['b_print']):
|
||||
self.print_info()
|
||||
|
||||
def print_info(self):
|
||||
print("<rotate>",
|
||||
'rotate_direction', self.rotate_direction,)
|
||||
|
||||
|
||||
def run(self, image_data):
|
||||
image_data = self._rotate(image_data)
|
||||
return image_data
|
||||
|
||||
def _rotate(self,img):
|
||||
if self.rotate_direction == 1 or self.rotate_direction == 2:
|
||||
col, row, unit = img.shape
|
||||
pInBuf = img.reshape((-1,1))
|
||||
pOutBufTemp = np.zeros((col* row* unit))
|
||||
for r in range(row):
|
||||
for c in range(col):
|
||||
for u in range(unit):
|
||||
if self.rotate_direction == 1:
|
||||
pOutBufTemp[unit * (c * row + (row - r - 1))+u] = pInBuf[unit * (r * col + c)+u]
|
||||
elif self.rotate_direction == 2:
|
||||
pOutBufTemp[unit * (row * (col - c - 1) + r)+u] = pInBuf[unit * (r * col + c)+u]
|
||||
|
||||
img = pOutBufTemp.reshape((col,row,unit))
|
||||
|
||||
return img
|
||||
@ -0,0 +1,59 @@
|
||||
from abc import ABCMeta, abstractmethod
|
||||
|
||||
class Param_base(object):
|
||||
@abstractmethod
|
||||
def update(self,**dic):
|
||||
raise NotImplementedError("Must override")
|
||||
|
||||
def load_dic(self, key, **dic):
|
||||
if key in dic:
|
||||
param = eval('self.'+key)
|
||||
param = dic[key]
|
||||
|
||||
def __str__(self):
|
||||
str_out = []
|
||||
return(' '.join(str_out))
|
||||
|
||||
|
||||
class Common(Param_base):
|
||||
print_info = False
|
||||
model_size = [0,0]
|
||||
numerical_type = 'floating'
|
||||
|
||||
def update(self, **dic):
|
||||
self.print_info = dic['print_info']
|
||||
self.model_size = dic['model_size']
|
||||
self.numerical_type = dic['numerical_type']
|
||||
|
||||
def __str__(self):
|
||||
str_out = ['numerical_type:',str(self.numerical_type)]
|
||||
return(' '.join(str_out))
|
||||
|
||||
class Runner_base(metaclass=ABCMeta):
|
||||
common = Common()
|
||||
general = Param_base()
|
||||
floating = Param_base()
|
||||
hw = Param_base()
|
||||
|
||||
def update(self, **kwargs):
|
||||
## update param
|
||||
self.common.update(**kwargs['common'])
|
||||
self.general.update(**kwargs['general'])
|
||||
assert(self.common.numerical_type.lower() in ['floating', '520', '720'])
|
||||
if (self.common.numerical_type == 'floating'):
|
||||
if (self.floating.__class__.__name__ != 'Param_base'):
|
||||
self.floating.update(**kwargs['floating'])
|
||||
else:
|
||||
if (self.hw.__class__.__name__ != 'Param_base'):
|
||||
self.hw.update(**kwargs['hw'])
|
||||
|
||||
def print_info(self):
|
||||
if (self.common.numerical_type == 'floating'):
|
||||
print(self, self.common, self.general, self.floating)
|
||||
else:
|
||||
print(self, self.common, self.general, self.hw)
|
||||
|
||||
|
||||
|
||||
|
||||
|
||||
@ -0,0 +1,2 @@
|
||||
from . import ColorConversion, Padding, Resize, Crop, Normalize, Rotate
|
||||
|
||||
372
kneron/exporting/yolov5/kneron_preprocessing/funcs/utils.py
Normal file
@ -0,0 +1,372 @@
|
||||
import numpy as np
|
||||
from PIL import Image
|
||||
import struct
|
||||
|
||||
def pad_square_to_4(x_start, x_end, y_start, y_end):
|
||||
w_int = x_end - x_start
|
||||
h_int = y_end - y_start
|
||||
pad = w_int - h_int
|
||||
if pad > 0:
|
||||
pad_s = (pad >> 1) &(~3)
|
||||
pad_e = pad - pad_s
|
||||
y_start -= pad_s
|
||||
y_end += pad_e
|
||||
else:#//pad <=0
|
||||
pad_s = -(((pad) >> 1) &(~3))
|
||||
pad_e = (-pad) - pad_s
|
||||
x_start -= pad_s
|
||||
x_end += pad_e
|
||||
return x_start, x_end, y_start, y_end
|
||||
|
||||
def str_fill(value):
|
||||
if len(value) == 1:
|
||||
value = "0" + value
|
||||
elif len(value) == 0:
|
||||
value = "00"
|
||||
|
||||
return value
|
||||
|
||||
def clip_ary(value):
|
||||
list_v = []
|
||||
for i in range(len(value)):
|
||||
v = value[i] % 256
|
||||
list_v.append(v)
|
||||
|
||||
return list_v
|
||||
|
||||
def str2bool(v):
|
||||
if isinstance(v,bool):
|
||||
return v
|
||||
return v.lower() in ('TRUE', 'True', 'true', '1', 'T', 't', 'Y', 'YES', 'y', 'yes')
|
||||
|
||||
|
||||
def str2int(s):
|
||||
if s == "":
|
||||
s = 0
|
||||
s = int(s)
|
||||
return s
|
||||
|
||||
def str2float(s):
|
||||
if s == "":
|
||||
s = 0
|
||||
s = float(s)
|
||||
return s
|
||||
|
||||
def clip(value, mini, maxi):
|
||||
if value < mini:
|
||||
result = mini
|
||||
elif value > maxi:
|
||||
result = maxi
|
||||
else:
|
||||
result = value
|
||||
|
||||
return result
|
||||
|
||||
|
||||
def clip_ary(value):
|
||||
list_v = []
|
||||
for i in range(len(value)):
|
||||
v = value[i] % 256
|
||||
list_v.append(v)
|
||||
|
||||
return list_v
|
||||
|
||||
|
||||
def signed_rounding(value, bit):
|
||||
if value < 0:
|
||||
value = value - (1 << (bit - 1))
|
||||
else:
|
||||
value = value + (1 << (bit - 1))
|
||||
|
||||
return value
|
||||
|
||||
def hex_loader(data_folder,**kwargs):
|
||||
format_mode = kwargs['raw_img_fmt']
|
||||
src_h = kwargs['img_in_height']
|
||||
src_w = kwargs['img_in_width']
|
||||
|
||||
if format_mode in ['YUV444', 'yuv444', 'YCBCR444', 'YCbCr444', 'ycbcr444']:
|
||||
output = hex_yuv444(data_folder,src_h,src_w)
|
||||
elif format_mode in ['RGB565', 'rgb565']:
|
||||
output = hex_rgb565(data_folder,src_h,src_w)
|
||||
elif format_mode in ['YUV422', 'yuv422', 'YCBCR422', 'YCbCr422', 'ycbcr422']:
|
||||
output = hex_yuv422(data_folder,src_h,src_w)
|
||||
|
||||
return output
|
||||
|
||||
def hex_rgb565(hex_folder,src_h,src_w):
|
||||
pix_per_line = 8
|
||||
byte_per_line = 16
|
||||
|
||||
f = open(hex_folder)
|
||||
pixel_r = []
|
||||
pixel_g = []
|
||||
pixel_b = []
|
||||
|
||||
# Ignore the first line
|
||||
f.readline()
|
||||
input_line = int((src_h * src_w)/pix_per_line)
|
||||
for i in range(input_line):
|
||||
readline = f.readline()
|
||||
for j in range(int(byte_per_line/2)-1, -1, -1):
|
||||
data1 = int(readline[(j * 4 + 0):(j * 4 + 2)], 16)
|
||||
data0 = int(readline[(j * 4 + 2):(j * 4 + 4)], 16)
|
||||
r = ((data1 & 0xf8) >> 3)
|
||||
g = (((data0 & 0xe0) >> 5) + ((data1 & 0x7) << 3))
|
||||
b = (data0 & 0x1f)
|
||||
pixel_r.append(r)
|
||||
pixel_g.append(g)
|
||||
pixel_b.append(b)
|
||||
|
||||
ary_r = np.array(pixel_r, dtype=np.uint8)
|
||||
ary_g = np.array(pixel_g, dtype=np.uint8)
|
||||
ary_b = np.array(pixel_b, dtype=np.uint8)
|
||||
output = np.concatenate((ary_r[:, None], ary_g[:, None], ary_b[:, None]), axis=1)
|
||||
output = output.reshape((src_h, src_w, 3))
|
||||
|
||||
return output
|
||||
|
||||
def hex_yuv444(hex_folder,src_h,src_w):
|
||||
pix_per_line = 4
|
||||
byte_per_line = 16
|
||||
|
||||
f = open(hex_folder)
|
||||
byte0 = []
|
||||
byte1 = []
|
||||
byte2 = []
|
||||
byte3 = []
|
||||
|
||||
# Ignore the first line
|
||||
f.readline()
|
||||
input_line = int((src_h * src_w)/pix_per_line)
|
||||
for i in range(input_line):
|
||||
readline = f.readline()
|
||||
for j in range(byte_per_line-1, -1, -1):
|
||||
data = int(readline[(j*2):(j*2+2)], 16)
|
||||
if (j+1) % 4 == 0:
|
||||
byte0.append(data)
|
||||
elif (j+2) % 4 == 0:
|
||||
byte1.append(data)
|
||||
elif (j+3) % 4 == 0:
|
||||
byte2.append(data)
|
||||
elif (j+4) % 4 == 0:
|
||||
byte3.append(data)
|
||||
# ary_a = np.array(byte0, dtype=np.uint8)
|
||||
ary_v = np.array(byte1, dtype=np.uint8)
|
||||
ary_u = np.array(byte2, dtype=np.uint8)
|
||||
ary_y = np.array(byte3, dtype=np.uint8)
|
||||
output = np.concatenate((ary_y[:, None], ary_u[:, None], ary_v[:, None]), axis=1)
|
||||
output = output.reshape((src_h, src_w, 3))
|
||||
|
||||
return output
|
||||
|
||||
def hex_yuv422(hex_folder,src_h,src_w):
|
||||
pix_per_line = 8
|
||||
byte_per_line = 16
|
||||
f = open(hex_folder)
|
||||
pixel_y = []
|
||||
pixel_u = []
|
||||
pixel_v = []
|
||||
|
||||
# Ignore the first line
|
||||
f.readline()
|
||||
input_line = int((src_h * src_w)/pix_per_line)
|
||||
for i in range(input_line):
|
||||
readline = f.readline()
|
||||
for j in range(int(byte_per_line/4)-1, -1, -1):
|
||||
data3 = int(readline[(j * 8 + 0):(j * 8 + 2)], 16)
|
||||
data2 = int(readline[(j * 8 + 2):(j * 8 + 4)], 16)
|
||||
data1 = int(readline[(j * 8 + 4):(j * 8 + 6)], 16)
|
||||
data0 = int(readline[(j * 8 + 6):(j * 8 + 8)], 16)
|
||||
pixel_y.append(data3)
|
||||
pixel_y.append(data1)
|
||||
pixel_u.append(data2)
|
||||
pixel_u.append(data2)
|
||||
pixel_v.append(data0)
|
||||
pixel_v.append(data0)
|
||||
|
||||
ary_y = np.array(pixel_y, dtype=np.uint8)
|
||||
ary_u = np.array(pixel_u, dtype=np.uint8)
|
||||
ary_v = np.array(pixel_v, dtype=np.uint8)
|
||||
output = np.concatenate((ary_y[:, None], ary_u[:, None], ary_v[:, None]), axis=1)
|
||||
output = output.reshape((src_h, src_w, 3))
|
||||
|
||||
return output
|
||||
|
||||
def bin_loader(data_folder,**kwargs):
|
||||
format_mode = kwargs['raw_img_fmt']
|
||||
src_h = kwargs['img_in_height']
|
||||
src_w = kwargs['img_in_width']
|
||||
if format_mode in ['YUV','yuv','YUV444', 'yuv444', 'YCBCR','YCbCr','ycbcr','YCBCR444', 'YCbCr444', 'ycbcr444']:
|
||||
output = bin_yuv444(data_folder,src_h,src_w)
|
||||
elif format_mode in ['RGB565', 'rgb565']:
|
||||
output = bin_rgb565(data_folder,src_h,src_w)
|
||||
elif format_mode in ['NIR', 'nir','NIR888', 'nir888']:
|
||||
output = bin_nir(data_folder,src_h,src_w)
|
||||
elif format_mode in ['YUV422', 'yuv422', 'YCBCR422', 'YCbCr422', 'ycbcr422']:
|
||||
output = bin_yuv422(data_folder,src_h,src_w)
|
||||
elif format_mode in ['RGB888','rgb888']:
|
||||
output = np.fromfile(data_folder, dtype='uint8')
|
||||
output = output.reshape(src_h,src_w,3)
|
||||
elif format_mode in ['RGBA8888','rgba8888', 'RGBA' , 'rgba']:
|
||||
output_temp = np.fromfile(data_folder, dtype='uint8')
|
||||
output_temp = output_temp.reshape(src_h,src_w,4)
|
||||
output = output_temp[:,:,0:3]
|
||||
|
||||
return output
|
||||
|
||||
def bin_yuv444(in_img_path,src_h,src_w):
|
||||
# load bin
|
||||
struct_fmt = '1B'
|
||||
struct_len = struct.calcsize(struct_fmt)
|
||||
struct_unpack = struct.Struct(struct_fmt).unpack_from
|
||||
|
||||
row = src_h
|
||||
col = src_w
|
||||
pixels = row*col
|
||||
|
||||
raw = []
|
||||
with open(in_img_path, "rb") as f:
|
||||
while True:
|
||||
data = f.read(struct_len)
|
||||
if not data: break
|
||||
s = struct_unpack(data)
|
||||
raw.append(s[0])
|
||||
|
||||
|
||||
raw = raw[:pixels*4]
|
||||
|
||||
#
|
||||
output = np.zeros((pixels * 3), dtype=np.uint8)
|
||||
cnt = 0
|
||||
for i in range(0, pixels*4, 4):
|
||||
#Y
|
||||
output[cnt] = raw[i+3]
|
||||
#U
|
||||
cnt += 1
|
||||
output[cnt] = raw[i+2]
|
||||
#V
|
||||
cnt += 1
|
||||
output[cnt] = raw[i+1]
|
||||
|
||||
cnt += 1
|
||||
|
||||
output = output.reshape((src_h,src_w,3))
|
||||
return output
|
||||
|
||||
def bin_yuv422(in_img_path,src_h,src_w):
|
||||
# load bin
|
||||
struct_fmt = '1B'
|
||||
struct_len = struct.calcsize(struct_fmt)
|
||||
struct_unpack = struct.Struct(struct_fmt).unpack_from
|
||||
|
||||
row = src_h
|
||||
col = src_w
|
||||
pixels = row*col
|
||||
|
||||
raw = []
|
||||
with open(in_img_path, "rb") as f:
|
||||
while True:
|
||||
data = f.read(struct_len)
|
||||
if not data: break
|
||||
s = struct_unpack(data)
|
||||
raw.append(s[0])
|
||||
|
||||
|
||||
raw = raw[:pixels*2]
|
||||
|
||||
#
|
||||
output = np.zeros((pixels * 3), dtype=np.uint8)
|
||||
cnt = 0
|
||||
for i in range(0, pixels*2, 4):
|
||||
#Y0
|
||||
output[cnt] = raw[i+3]
|
||||
#U0
|
||||
cnt += 1
|
||||
output[cnt] = raw[i+2]
|
||||
#V0
|
||||
cnt += 1
|
||||
output[cnt] = raw[i]
|
||||
#Y1
|
||||
cnt += 1
|
||||
output[cnt] = raw[i+1]
|
||||
#U1
|
||||
cnt += 1
|
||||
output[cnt] = raw[i+2]
|
||||
#V1
|
||||
cnt += 1
|
||||
output[cnt] = raw[i]
|
||||
|
||||
cnt += 1
|
||||
|
||||
output = output.reshape((src_h,src_w,3))
|
||||
return output
|
||||
|
||||
def bin_rgb565(in_img_path,src_h,src_w):
|
||||
# load bin
|
||||
struct_fmt = '1B'
|
||||
struct_len = struct.calcsize(struct_fmt)
|
||||
struct_unpack = struct.Struct(struct_fmt).unpack_from
|
||||
|
||||
row = src_h
|
||||
col = src_w
|
||||
pixels = row*col
|
||||
|
||||
rgba565 = []
|
||||
with open(in_img_path, "rb") as f:
|
||||
while True:
|
||||
data = f.read(struct_len)
|
||||
if not data: break
|
||||
s = struct_unpack(data)
|
||||
rgba565.append(s[0])
|
||||
|
||||
|
||||
rgba565 = rgba565[:pixels*2]
|
||||
|
||||
# rgb565_bin to numpy_array
|
||||
output = np.zeros((pixels * 3), dtype=np.uint8)
|
||||
cnt = 0
|
||||
for i in range(0, pixels*2, 2):
|
||||
temp = rgba565[i]
|
||||
temp2 = rgba565[i+1]
|
||||
#R-5
|
||||
output[cnt] = (temp2 >>3)
|
||||
|
||||
#G-6
|
||||
cnt += 1
|
||||
output[cnt] = ((temp & 0xe0) >> 5) + ((temp2 & 0x07) << 3)
|
||||
|
||||
#B-5
|
||||
cnt += 1
|
||||
output[cnt] = (temp & 0x1f)
|
||||
|
||||
cnt += 1
|
||||
|
||||
output = output.reshape((src_h,src_w,3))
|
||||
return output
|
||||
|
||||
def bin_nir(in_img_path,src_h,src_w):
|
||||
# load bin
|
||||
struct_fmt = '1B'
|
||||
struct_len = struct.calcsize(struct_fmt)
|
||||
struct_unpack = struct.Struct(struct_fmt).unpack_from
|
||||
|
||||
nir = []
|
||||
with open(in_img_path, "rb") as f:
|
||||
while True:
|
||||
data = f.read(struct_len)
|
||||
if not data: break
|
||||
s = struct_unpack(data)
|
||||
nir.append(s[0])
|
||||
|
||||
nir = nir[:src_h*src_w]
|
||||
pixels = len(nir)
|
||||
# nir_bin to numpy_array
|
||||
output = np.zeros((len(nir) * 3), dtype=np.uint8)
|
||||
for i in range(0, pixels):
|
||||
output[i*3]=nir[i]
|
||||
output[i*3+1]=nir[i]
|
||||
output[i*3+2]=nir[i]
|
||||
|
||||
output = output.reshape((src_h,src_w,3))
|
||||
return output
|
||||
@ -0,0 +1,50 @@
|
||||
import math
|
||||
|
||||
def round_up_16(num):
|
||||
return ((num + (16 - 1)) & ~(16 - 1))
|
||||
|
||||
def round_up_n(num, n):
|
||||
if (num > 0):
|
||||
temp = float(num) / n
|
||||
return math.ceil(temp) * n
|
||||
else:
|
||||
return -math.ceil(float(-num) / n) * n
|
||||
|
||||
def cal_img_row_offset(crop_num, pad_num, start_row, out_row, orig_row):
|
||||
|
||||
scaled_img_row = int(out_row - (pad_num[1] + pad_num[3]))
|
||||
if ((start_row - pad_num[1]) > 0):
|
||||
img_str_row = int((start_row - pad_num[1]))
|
||||
else:
|
||||
img_str_row = 0
|
||||
valid_row = int(orig_row - (crop_num[1] + crop_num[3]))
|
||||
img_str_row = int(valid_row * img_str_row / scaled_img_row)
|
||||
return int(img_str_row + crop_num[1])
|
||||
|
||||
def get_pad_num(pad_num_orig, left, up, right, bottom):
|
||||
pad_num = [0]*4
|
||||
for i in range(0,4):
|
||||
pad_num[i] = pad_num_orig[i]
|
||||
|
||||
if not (left):
|
||||
pad_num[0] = 0
|
||||
if not (up):
|
||||
pad_num[1] = 0
|
||||
if not (right):
|
||||
pad_num[2] = 0
|
||||
if not (bottom):
|
||||
pad_num[3] = 0
|
||||
|
||||
return pad_num
|
||||
|
||||
def get_byte_per_pixel(raw_fmt):
|
||||
if raw_fmt.lower() in ['RGB888', 'rgb888', 'RGB', 'rgb888']:
|
||||
return 4
|
||||
elif raw_fmt.lower() in ['YUV', 'yuv', 'YUV422', 'yuv422']:
|
||||
return 2
|
||||
elif raw_fmt.lower() in ['RGB565', 'rgb565']:
|
||||
return 2
|
||||
elif raw_fmt.lower() in ['NIR888', 'nir888', 'NIR', 'nir']:
|
||||
return 1
|
||||
else:
|
||||
return -1
|
||||
@ -0,0 +1,42 @@
|
||||
import numpy as np
|
||||
from PIL import Image
|
||||
|
||||
def twos_complement(value):
|
||||
value = int(value)
|
||||
# msb = (value & 0x8000) * (1/np.power(2, 15))
|
||||
msb = (value & 0x8000) >> 15
|
||||
if msb == 1:
|
||||
if (((~value) & 0xFFFF) + 1) >= 0xFFFF:
|
||||
result = ((~value) & 0xFFFF)
|
||||
else:
|
||||
result = (((~value) & 0xFFFF) + 1)
|
||||
result = result * (-1)
|
||||
else:
|
||||
result = value
|
||||
|
||||
return result
|
||||
|
||||
|
||||
def twos_complement_pix(value):
|
||||
h, _ = value.shape
|
||||
for i in range(h):
|
||||
value[i, 0] = twos_complement(value[i, 0])
|
||||
|
||||
return value
|
||||
|
||||
def clip(value, mini, maxi):
|
||||
if value < mini:
|
||||
result = mini
|
||||
elif value > maxi:
|
||||
result = maxi
|
||||
else:
|
||||
result = value
|
||||
|
||||
return result
|
||||
|
||||
def clip_pix(value, mini, maxi):
|
||||
h, _ = value.shape
|
||||
for i in range(h):
|
||||
value[i, 0] = clip(value[i, 0], mini, maxi)
|
||||
|
||||
return value
|
||||
45
kneron/exporting/yolov5/quantize_yolov5.py
Normal file
@ -0,0 +1,45 @@
|
||||
import os
|
||||
import numpy as np
|
||||
import torch
|
||||
import ktc # Kneron Toolchain
|
||||
from yolov5_preprocess import Yolov5_preprocess # 使用你的預處理
|
||||
import kneron_preprocessing
|
||||
|
||||
# 設定裝置
|
||||
device = torch.device("cuda" if torch.cuda.is_available() else "cpu")
|
||||
|
||||
# 設定圖片大小(與訓練時一致)
|
||||
imgsz_h, imgsz_w = 640, 640
|
||||
|
||||
# 量化數據集目錄(請確保這個資料夾存在)
|
||||
data_path = "/data50"
|
||||
img_list = []
|
||||
|
||||
# 設定 ONNX 模型路徑(確保這個路徑在 Docker 內部是否正確)
|
||||
onnx_model_path = "/workspace/yolov5/latest.opt.onnx"
|
||||
|
||||
# **初始化 Kneron ModelConfig 物件**
|
||||
km = ktc.ModelConfig(20008, "0001", "720", onnx_model=onnx_model_path)
|
||||
|
||||
# 遍歷 data50 並進行預處理
|
||||
for root, _, files in os.walk(data_path):
|
||||
for f in files:
|
||||
fullpath = os.path.join(root, f)
|
||||
|
||||
# 執行與訓練相同的預處理
|
||||
img_data, _ = Yolov5_preprocess(fullpath, device, imgsz_h, imgsz_w)
|
||||
|
||||
# 確保格式為 NumPy 陣列
|
||||
img_data = img_data.cpu().numpy()
|
||||
|
||||
print(f"Processed: {fullpath}")
|
||||
img_list.append(img_data)
|
||||
|
||||
# 轉為 NumPy 格式
|
||||
img_list = np.array(img_list)
|
||||
|
||||
# **執行 BIE 量化分析**
|
||||
bie_model_path = km.analysis({"input": img_list})
|
||||
|
||||
# 輸出成功訊息
|
||||
print("\n✅ Fixed-point analysis done! BIE model saved to:", bie_model_path)
|
||||
68
kneron/exporting/yolov5/readme.txt
Normal file
@ -0,0 +1,68 @@
|
||||
(1)yolov5_app.py for ploting moldel inference results
|
||||
cd applications
|
||||
python yolov5_app.py
|
||||
|
||||
(2)yolov5_evaluation.py for evaluating moldel mAP at hw_repo
|
||||
cd applications
|
||||
python yolov5_evaluation.py
|
||||
|
||||
#mAP @ yolov5s_v2_op9_sig_batch1_input05_640x640_nearest_convert.onnx with(upsampling rearest)
|
||||
Average Precision (AP) @[ IoU=0.50:0.95 | area= all | maxDets=100 ] = 0.346
|
||||
Average Precision (AP) @[ IoU=0.50 | area= all | maxDets=100 ] = 0.533
|
||||
Average Precision (AP) @[ IoU=0.75 | area= all | maxDets=100 ] = 0.372
|
||||
Average Precision (AP) @[ IoU=0.50:0.95 | area= small | maxDets=100 ] = 0.196
|
||||
Average Precision (AP) @[ IoU=0.50:0.95 | area=medium | maxDets=100 ] = 0.391
|
||||
Average Precision (AP) @[ IoU=0.50:0.95 | area= large | maxDets=100 ] = 0.442
|
||||
Average Recall (AR) @[ IoU=0.50:0.95 | area= all | maxDets= 1 ] = 0.279
|
||||
Average Recall (AR) @[ IoU=0.50:0.95 | area= all | maxDets= 10 ] = 0.456
|
||||
Average Recall (AR) @[ IoU=0.50:0.95 | area= all | maxDets=100 ] = 0.503
|
||||
Average Recall (AR) @[ IoU=0.50:0.95 | area= small | maxDets=100 ] = 0.320
|
||||
Average Recall (AR) @[ IoU=0.50:0.95 | area=medium | maxDets=100 ] = 0.557
|
||||
Average Recall (AR) @[ IoU=0.50:0.95 | area= large | maxDets=100 ] = 0.618
|
||||
|
||||
(3)yolov5_compare_pth_onnx.py for comparing the results of pytorch moldel and onnx model
|
||||
cd applications
|
||||
python yolov5_compare_pth_onnx.py
|
||||
|
||||
(4)v2 model is in the below link.
|
||||
10.200.210.221:/mnt/models/Object_models/YOLOv5/yolov5s_v2_state_dict_input05.pt
|
||||
10.200.210.221:/mnt/models/Object_models/YOLOv5/yolov5s_v2_op9_sig_batch1_input05_640x640_nearest_convert.onnx
|
||||
|
||||
(5)the parameters setting
|
||||
(5.1)In order to get high mAP in coco val2017, please use
|
||||
101620_yolov5_init_params.json
|
||||
{
|
||||
"model_path": "/mnt/models/Object_models/YOLOv5/yolov5s_v2_state_dict_input05.pt",
|
||||
"grid20_path": "/mnt/models/Object_models/YOLOv5/20_640x640.npy",
|
||||
"grid40_path": "/mnt/models/Object_models/YOLOv5/40_640x640.npy",
|
||||
"grid80_path": "/mnt/models/Object_models/YOLOv5/80_640x640.npy",
|
||||
"num_classes": 80,
|
||||
"imgsz_h": 640,
|
||||
"imgsz_w": 640,
|
||||
"conf_thres": 0.001,
|
||||
"iou_thres": 0.65,
|
||||
"top_k_num": 3000
|
||||
}
|
||||
|
||||
|
||||
(5.2)For video usage scenarios, please use
|
||||
102320_yolov5_init_params.json
|
||||
{
|
||||
"model_path": "/mnt/models/Object_models/YOLOv5/yolov5s_v2_state_dict_input05.pt",
|
||||
"grid20_path": "/mnt/models/Object_models/YOLOv5/20_640x352.npy",
|
||||
"grid40_path": "/mnt/models/Object_models/YOLOv5/40_640x352.npy",
|
||||
"grid80_path": "/mnt/models/Object_models/YOLOv5/80_640x352.npy",
|
||||
"num_classes": 80,
|
||||
"imgsz_h": 352,
|
||||
"imgsz_w": 640,
|
||||
"conf_thres": 0.3,
|
||||
"iou_thres": 0.5,
|
||||
"top_k_num": 3000
|
||||
}
|
||||
|
||||
(5.3)The differences of above setting are
|
||||
(5.3.1) Video uses input (640w*352h) to run faster.
|
||||
Coco has high or flat wide images, so it is better to use input (640w*640h)
|
||||
|
||||
(5.3.2) Using the yolov5 official website setting test coco val2017, the confidence setting is low "conf_thres": 0.001, and the iou setting of NMS is high "iou_thres": 0.65, which gets a better mAP.
|
||||
But running video needs to be set to "conf_thres": 0.3, so that there are not too many false positives, and the iou setting of NMS "iou_thres": 0.5 is more friendly to close objects
|
||||
164
kneron/exporting/yolov5/yolo_v2.py
Normal file
@ -0,0 +1,164 @@
|
||||
import argparse
|
||||
from copy import deepcopy
|
||||
import torch
|
||||
#from experimental import *
|
||||
from .common import *
|
||||
#from .common_v3 import *
|
||||
from pathlib import Path
|
||||
import math
|
||||
import yaml
|
||||
|
||||
class Detect(nn.Module):
|
||||
def __init__(self, nc=80, anchors=(), ch=()): # detection layer
|
||||
super(Detect, self).__init__()
|
||||
self.stride = None # strides computed during build
|
||||
self.nc = nc # number of classes
|
||||
self.no = nc + 5 # number of outputs per anchor
|
||||
self.nl = len(anchors) # number of detection layers
|
||||
self.na = len(anchors[0]) // 2 # number of anchors
|
||||
self.grid = [torch.zeros(1)] * self.nl # init grid
|
||||
a = torch.tensor(anchors).float().view(self.nl, -1, 2)
|
||||
self.register_buffer('anchors', a) # shape(nl,na,2)
|
||||
self.register_buffer('anchor_grid', a.clone().view(self.nl, 1, -1, 1, 1, 2)) # shape(nl,1,na,1,1,2)
|
||||
self.m = nn.ModuleList(nn.Conv2d(x, self.no * self.na, 1) for x in ch) # output conv
|
||||
self.export = False # onnx export
|
||||
|
||||
def forward(self, x):
|
||||
# x = x.copy() # for profiling
|
||||
z = [] # inference output
|
||||
self.training |= self.export
|
||||
for i in range(self.nl):
|
||||
x[i] = self.m[i](x[i]) # conv
|
||||
|
||||
# bs, _, ny, nx = x[i].shape # x(bs,255,20,20) to x(bs,3,20,20,85)
|
||||
# x[i] = x[i].view(bs, self.na, self.no, ny, nx).permute(0, 1, 3, 4, 2).contiguous()
|
||||
x[i] = x[i].sigmoid()
|
||||
|
||||
|
||||
|
||||
# return x if self.training else (torch.cat(z, 1), x)
|
||||
return x
|
||||
|
||||
@staticmethod
|
||||
def _make_grid(nx=20, ny=20):
|
||||
yv, xv = torch.meshgrid([torch.arange(ny), torch.arange(nx)])
|
||||
return torch.stack((xv, yv), 2).view((1, 1, ny, nx, 2)).float()
|
||||
|
||||
class Model(nn.Module):
|
||||
def __init__(self, cfg='yolov5s.yaml', ch=3, nc=None): # model, input channels, number of classes
|
||||
super(Model, self).__init__()
|
||||
with open(cfg) as f:
|
||||
self.yaml = yaml.load(f, Loader=yaml.FullLoader) # model dict
|
||||
|
||||
# Define model
|
||||
if nc and nc != self.yaml['nc']:
|
||||
print('Overriding %s nc=%g with nc=%g' % (cfg, self.yaml['nc'], nc))
|
||||
self.yaml['nc'] = nc # override yaml value
|
||||
self.model, self.save = parse_model(deepcopy(self.yaml), ch=[ch]) # model, savelist, ch_out
|
||||
# print([x.shape for x in self.forward(torch.zeros(1, ch, 64, 64))])
|
||||
|
||||
# Build strides, anchors
|
||||
m = self.model[-1] # Detect()
|
||||
if isinstance(m, Detect):
|
||||
s = 128 # 2x min stride
|
||||
#m.stride = torch.tensor([s / x.shape[-2] for x in self.forward(torch.zeros(1, ch, s, s))]) # forward
|
||||
# FocusNoSliceCat
|
||||
m.stride = torch.tensor([8.0,16.0,32.0]) # forward
|
||||
m.anchors /= m.stride.view(-1, 1, 1)
|
||||
check_anchor_order(m)
|
||||
self.stride = m.stride
|
||||
self._initialize_biases() # only run once
|
||||
# print('Strides: %s' % m.stride.tolist())
|
||||
|
||||
# Init weights, biases
|
||||
initialize_weights(self)
|
||||
|
||||
|
||||
def forward(self, x, augment=False, profile=False):
|
||||
y, dt = [], [] # outputs
|
||||
for m in self.model:
|
||||
if m.f != -1: # if not from previous layer
|
||||
x = y[m.f] if isinstance(m.f, int) else [x if j == -1 else y[j] for j in m.f] # from earlier layers
|
||||
x = m(x) # run
|
||||
y.append(x if m.i in self.save else None) # save output
|
||||
return x
|
||||
|
||||
def _initialize_biases(self, cf=None): # initialize biases into Detect(), cf is class frequency
|
||||
# cf = torch.bincount(torch.tensor(np.concatenate(dataset.labels, 0)[:, 0]).long(), minlength=nc) + 1.
|
||||
m = self.model[-1] # Detect() module
|
||||
for mi, s in zip(m.m, m.stride): # from
|
||||
b = mi.bias.view(m.na, -1) # conv.bias(255) to (3,85)
|
||||
b[:, 4] += math.log(8 / (640 / s) ** 2) # obj (8 objects per 640 image)
|
||||
b[:, 5:] += math.log(0.6 / (m.nc - 0.99)) if cf is None else torch.log(cf / cf.sum()) # cls
|
||||
mi.bias = torch.nn.Parameter(b.view(-1), requires_grad=True)
|
||||
|
||||
def make_divisible(x, divisor):
|
||||
# Returns x evenly divisble by divisor
|
||||
return math.ceil(x / divisor) * divisor
|
||||
|
||||
def check_anchor_order(m):
|
||||
# Check anchor order against stride order for YOLOv5 Detect() module m, and correct if necessary
|
||||
a = m.anchor_grid.prod(-1).view(-1) # anchor area
|
||||
da = a[-1] - a[0] # delta a
|
||||
ds = m.stride[-1] - m.stride[0] # delta s
|
||||
if da.sign() != ds.sign(): # same order
|
||||
print('Reversing anchor order')
|
||||
m.anchors[:] = m.anchors.flip(0)
|
||||
m.anchor_grid[:] = m.anchor_grid.flip(0)
|
||||
|
||||
def initialize_weights(model):
|
||||
for m in model.modules():
|
||||
t = type(m)
|
||||
if t is nn.Conv2d:
|
||||
pass # nn.init.kaiming_normal_(m.weight, mode='fan_out', nonlinearity='relu')
|
||||
elif t is nn.BatchNorm2d:
|
||||
m.eps = 1e-3
|
||||
m.momentum = 0.03
|
||||
elif t in [nn.LeakyReLU, nn.ReLU, nn.ReLU6]:
|
||||
m.inplace = True
|
||||
|
||||
def parse_model(d, ch): # model_dict, input_channels(3) #original
|
||||
#print('\n%3s%18s%3s%10s %-40s%-30s' % ('', 'from', 'n', 'params', 'module', 'arguments'))
|
||||
anchors, nc, gd, gw = d['anchors'], d['nc'], d['depth_multiple'], d['width_multiple']
|
||||
na = (len(anchors[0]) // 2) if isinstance(anchors, list) else anchors # number of anchors
|
||||
no = na * (nc + 5) # number of outputs = anchors * (classes + 5)
|
||||
|
||||
layers, save, c2 = [], [], ch[-1] # layers, savelist, ch out
|
||||
for i, (f, n, m, args) in enumerate(d['backbone'] + d['head']): # from, number, module, args
|
||||
m = eval(m) if isinstance(m, str) else m # eval strings
|
||||
for j, a in enumerate(args):
|
||||
try:
|
||||
args[j] = eval(a) if isinstance(a, str) else a # eval strings
|
||||
except:
|
||||
pass
|
||||
|
||||
n = max(round(n * gd), 1) if n > 1 else n # depth gain
|
||||
if m in [nn.Conv2d, Conv, Bottleneck, SPP, DWConv, Focus, BottleneckCSP]:
|
||||
#print('*m',m)
|
||||
c1, c2 = ch[f], args[0]
|
||||
c2 = make_divisible(c2 * gw, 8) if c2 != no else c2
|
||||
args = [c1, c2, *args[1:]]
|
||||
if m in [BottleneckCSP]:
|
||||
args.insert(2, n)
|
||||
n = 1
|
||||
elif m is nn.BatchNorm2d:
|
||||
args = [ch[f]]
|
||||
elif m is Concat:
|
||||
c2 = sum([ch[-1 if x == -1 else x + 1] for x in f])
|
||||
elif m is Detect:
|
||||
args.append([ch[x + 1] for x in f])
|
||||
if isinstance(args[1], int): # number of anchors
|
||||
args[1] = [list(range(args[1] * 2))] * len(f)
|
||||
else:
|
||||
c2 = ch[f]
|
||||
|
||||
m_ = nn.Sequential(*[m(*args) for _ in range(n)]) if n > 1 else m(*args) # module
|
||||
t = str(m)[8:-2].replace('__main__.', '') # module type
|
||||
np = sum([x.numel() for x in m_.parameters()]) # number params
|
||||
m_.i, m_.f, m_.type, m_.np = i, f, t, np # attach index, 'from' index, type, number params
|
||||
#print('%3s%18s%3s%10.0f %-40s%-30s' % (i, f, n, np, t, args)) # print
|
||||
save.extend(x % i for x in ([f] if isinstance(f, int) else f) if x != -1) # append to savelist
|
||||
layers.append(m_)
|
||||
ch.append(c2)
|
||||
return nn.Sequential(*layers), sorted(save)
|
||||
|
||||
334
kneron/exporting/yolov5/yolov5_postprocess.py
Normal file
@ -0,0 +1,334 @@
|
||||
# coding: utf-8
|
||||
import torch
|
||||
import torchvision
|
||||
import time
|
||||
import numpy as np
|
||||
import sys
|
||||
np.set_printoptions(threshold=sys.maxsize)
|
||||
def box_iou(box1, box2):
|
||||
# https://github.com/pytorch/vision/blob/master/torchvision/ops/boxes.py
|
||||
"""
|
||||
Return intersection-over-union (Jaccard index) of boxes.
|
||||
Both sets of boxes are expected to be in (x1, y1, x2, y2) format.
|
||||
Arguments:
|
||||
box1 (Tensor[N, 4])
|
||||
box2 (Tensor[M, 4])
|
||||
Returns:
|
||||
iou (Tensor[N, M]): the NxM matrix containing the pairwise
|
||||
IoU values for every element in boxes1 and boxes2
|
||||
"""
|
||||
|
||||
def box_area(box):
|
||||
# box = 4xn
|
||||
return (box[2] - box[0]) * (box[3] - box[1])
|
||||
|
||||
area1 = box_area(box1.t())
|
||||
area2 = box_area(box2.t())
|
||||
|
||||
# inter(N,M) = (rb(N,M,2) - lt(N,M,2)).clamp(0).prod(2)
|
||||
inter = (torch.min(box1[:, None, 2:], box2[:, 2:]) - torch.max(box1[:, None, :2], box2[:, :2])).clamp(0).prod(2)
|
||||
return inter / (area1[:, None] + area2 - inter) # iou = inter / (area1 + area2 - inter)
|
||||
|
||||
def xywh2xyxy(x):
|
||||
# Convert nx4 boxes from [x, y, w, h] to [x1, y1, x2, y2] where xy1=top-left, xy2=bottom-right
|
||||
y = torch.zeros_like(x) if isinstance(x, torch.Tensor) else np.zeros_like(x)
|
||||
y[:, 0] = x[:, 0] - x[:, 2] / 2 # top left x
|
||||
y[:, 1] = x[:, 1] - x[:, 3] / 2 # top left y
|
||||
y[:, 2] = x[:, 0] + x[:, 2] / 2 # bottom right x
|
||||
y[:, 3] = x[:, 1] + x[:, 3] / 2 # bottom right y
|
||||
return y
|
||||
|
||||
def non_max_suppression(prediction, conf_thres=0.1, iou_thres=0.6, top_k_num=3000, merge=False, classes=None, agnostic=False):
|
||||
"""Performs Non-Maximum Suppression (NMS) on inference results
|
||||
|
||||
Returns:
|
||||
detections with shape: nx6 (x1, y1, x2, y2, conf, cls)
|
||||
"""
|
||||
# print('conf_thres',conf_thres)
|
||||
if prediction.dtype is torch.float16:
|
||||
prediction = prediction.float() # to FP32
|
||||
|
||||
nc = prediction[0].shape[1] - 5 # number of classes
|
||||
xc = prediction[..., 4] > conf_thres # candidates
|
||||
|
||||
# Settings
|
||||
min_wh, max_wh = 2, 4096 # (pixels) minimum and maximum box width and height
|
||||
max_det = 300 # maximum number of detections per image
|
||||
time_limit = 10.0 # seconds to quit after
|
||||
multi_label = nc > 1 # multiple labels per box (adds 0.5ms/img)
|
||||
|
||||
t = time.time()
|
||||
output = [None] * prediction.shape[0]
|
||||
for xi, x in enumerate(prediction): # image index, image inference
|
||||
# Apply constraints
|
||||
# x[((x[..., 2:4] < min_wh) | (x[..., 2:4] > max_wh)).any(1), 4] = 0 # width-height
|
||||
x = x[xc[xi]] # confidence
|
||||
|
||||
# If none remain process next image
|
||||
if not x.shape[0]:
|
||||
continue
|
||||
|
||||
# Compute conf
|
||||
x[:, 5:] *= x[:, 4:5] # conf = obj_conf * cls_conf
|
||||
|
||||
# Box (center x, center y, width, height) to (x1, y1, x2, y2)
|
||||
box = xywh2xyxy(x[:, :4])
|
||||
|
||||
# Detections matrix nx6 (xyxy, conf, cls)
|
||||
if multi_label:
|
||||
i, j = (x[:, 5:] > conf_thres).nonzero().t()
|
||||
x = torch.cat((box[i], x[i, j + 5, None], j[:, None].float()), 1)
|
||||
else: # best class only
|
||||
conf, j = x[:, 5:].max(1, keepdim=True)
|
||||
x = torch.cat((box, conf, j.float()), 1)[conf.view(-1) > conf_thres]
|
||||
|
||||
|
||||
|
||||
# If none remain process next image
|
||||
n = x.shape[0] # number of boxes
|
||||
if not n:
|
||||
continue
|
||||
|
||||
# Sort by confidence
|
||||
# x = x[x[:, 4].argsort(descending=True)]
|
||||
|
||||
# Batched NMS
|
||||
c = x[:, 5:6] * (0 if agnostic else max_wh) # classes
|
||||
boxes, scores = x[:, :4] + c, x[:, 4] # boxes (offset by class), scores
|
||||
# # Sort by confidence
|
||||
ind_Sort_by_confidence = x[:, 4].argsort(descending=True)
|
||||
boxes = boxes[ind_Sort_by_confidence][:top_k_num] #
|
||||
scores = scores[ind_Sort_by_confidence][:top_k_num] #
|
||||
x = x[ind_Sort_by_confidence][:top_k_num] #
|
||||
# cross classes nms
|
||||
i = torchvision.ops.boxes.nms(boxes, scores, iou_thres)
|
||||
if i.shape[0] > max_det: # limit detections
|
||||
i = i[:max_det]
|
||||
# if merge and (1 < n < 3E3): # Merge NMS (boxes merged using weighted mean)
|
||||
# update boxes as boxes(i,4) = weights(i,n) * boxes(n,4)
|
||||
# iou = box_iou(boxes[i], boxes) > iou_thres # iou matrix
|
||||
# weights = iou * scores[None] # box weights
|
||||
# x[i, :4] = torch.mm(weights, x[:, :4]).float() / weights.sum(1, keepdim=True) # merged boxes
|
||||
# if redundant:
|
||||
# i = i[iou.sum(1) > 1] # require redundancy
|
||||
|
||||
output[xi] = x[i]
|
||||
if (time.time() - t) > time_limit:
|
||||
break # time limit exceeded
|
||||
|
||||
return output
|
||||
|
||||
def non_max_suppression_kneron(prediction, conf_thres=0.1, iou_thres=0.6, top_k_num=3000, merge=False, classes=None, agnostic=False):
|
||||
"""Performs Non-Maximum Suppression (NMS) on inference results
|
||||
|
||||
Returns:
|
||||
detections with shape: nx6 (x1, y1, x2, y2, conf, cls)
|
||||
"""
|
||||
if prediction.dtype is torch.float16:
|
||||
prediction = prediction.float() # to FP32
|
||||
|
||||
nc = prediction[0].shape[1] - 5 # number of classes
|
||||
xc = prediction[..., 4] > conf_thres # candidates
|
||||
|
||||
# Settings
|
||||
min_wh, max_wh = 2, 4096 # (pixels) minimum and maximum box width and height
|
||||
max_det = 300 # maximum number of detections per image
|
||||
time_limit = 10.0 # seconds to quit after
|
||||
multi_label = nc > 1 # multiple labels per box (adds 0.5ms/img)
|
||||
|
||||
t = time.time()
|
||||
output = [None] * prediction.shape[0]
|
||||
for xi, x in enumerate(prediction): # image index, image inference
|
||||
# Apply constraints
|
||||
# x[((x[..., 2:4] < min_wh) | (x[..., 2:4] > max_wh)).any(1), 4] = 0 # width-height
|
||||
x = x[xc[xi]] # confidence
|
||||
|
||||
# If none remain process next image
|
||||
if not x.shape[0]:
|
||||
continue
|
||||
|
||||
# Compute conf
|
||||
x[:, 5:] *= x[:, 4:5] # conf = obj_conf * cls_conf
|
||||
|
||||
# Box (center x, center y, width, height) to (x1, y1, x2, y2)
|
||||
box = xywh2xyxy(x[:, :4])
|
||||
|
||||
# Detections matrix nx6 (xyxy, conf, cls)
|
||||
if multi_label:
|
||||
i, j = (x[:, 5:] > conf_thres).nonzero().t()
|
||||
x = torch.cat((box[i], x[i, j + 5, None], j[:, None].float()), 1)
|
||||
else: # best class only
|
||||
conf, j = x[:, 5:].max(1, keepdim=True)
|
||||
x = torch.cat((box, conf, j.float()), 1)[conf.view(-1) > conf_thres]
|
||||
|
||||
|
||||
|
||||
# If none remain process next image
|
||||
n = x.shape[0] # number of boxes
|
||||
if not n:
|
||||
continue
|
||||
|
||||
# Sort by confidence
|
||||
# x = x[x[:, 4].argsort(descending=True)]
|
||||
|
||||
# Batched NMS
|
||||
c = x[:, 5:6] * (0 if agnostic else max_wh) # classes
|
||||
boxes, scores = x[:, :4] + c, x[:, 4] # boxes (offset by class), scores
|
||||
# Sort by confidence
|
||||
ind_Sort_by_confidence = x[:, 4].argsort(descending=True)
|
||||
boxes = boxes[ind_Sort_by_confidence][:top_k_num] #
|
||||
scores = scores[ind_Sort_by_confidence][:top_k_num] #
|
||||
x = x[ind_Sort_by_confidence][:top_k_num] #
|
||||
# cross classes nms
|
||||
i = torchvision.ops.boxes.nms(boxes, scores, iou_thres)
|
||||
if i.shape[0] > max_det: # limit detections
|
||||
i = i[:max_det]
|
||||
|
||||
|
||||
output[xi] = x[i]
|
||||
if (time.time() - t) > time_limit:
|
||||
break # time limit exceeded
|
||||
|
||||
return output
|
||||
|
||||
def clip_coords(boxes, img_shape):
|
||||
# Clip bounding xyxy bounding boxes to image shape (height, width)
|
||||
boxes[:, 0].clamp_(0, img_shape[1]) # x1
|
||||
boxes[:, 1].clamp_(0, img_shape[0]) # y1
|
||||
boxes[:, 2].clamp_(0, img_shape[1]) # x2
|
||||
boxes[:, 3].clamp_(0, img_shape[0]) # y2
|
||||
|
||||
def scale_coords_ori(img1_shape, coords, img0_shape, ratio_pad=None):
|
||||
# Rescale coords (xyxy) from img1_shape to img0_shape
|
||||
if ratio_pad is None: # calculate from img0_shape
|
||||
gain = min(img1_shape[0] / img0_shape[0], img1_shape[1] / img0_shape[1]) # gain = old / new
|
||||
pad = (img1_shape[1] - img0_shape[1] * gain) / 2, (img1_shape[0] - img0_shape[0] * gain) / 2 # wh padding
|
||||
else:
|
||||
gain = ratio_pad[0][0]
|
||||
pad = ratio_pad[1]
|
||||
|
||||
coords[:, [0, 2]] -= pad[0] # x padding
|
||||
coords[:, [1, 3]] -= pad[1] # y padding
|
||||
coords[:, :4] /= gain
|
||||
clip_coords(coords, img0_shape)
|
||||
return coords
|
||||
|
||||
def scale_coords(img1_shape, coords, img0_shape, ratio_pad=None):
|
||||
# Rescale coords (xyxy) from img1_shape to img0_shape
|
||||
if ratio_pad is None: # calculate from img0_shape
|
||||
gain = min(img1_shape[0] / img0_shape[0], img1_shape[1] / img0_shape[1]) # gain = old / new
|
||||
#pad = (img1_shape[1] - img0_shape[1] * gain) / 2, (img1_shape[0] - img0_shape[0] * gain) / 2 # wh padding
|
||||
else:
|
||||
gain = ratio_pad[0][0]
|
||||
#pad = ratio_pad[1]
|
||||
|
||||
# coords[:, [0, 2]] -= pad[0] # x padding
|
||||
# coords[:, [1, 3]] -= pad[1] # y padding
|
||||
coords[:, :4] /= gain
|
||||
clip_coords(coords, img0_shape)
|
||||
return coords
|
||||
|
||||
def scale_coords_test(img1_shape, coords, img0_shape, ratio_pad=None):
|
||||
|
||||
coords[:, 0] /= (img1_shape[1] / img0_shape[1])
|
||||
coords[:, 2] /= (img1_shape[1] / img0_shape[1])
|
||||
coords[:, 1] /= (img1_shape[0] / img0_shape[0])
|
||||
coords[:, 3] /= (img1_shape[0] / img0_shape[0])
|
||||
clip_coords(coords, img0_shape)
|
||||
return coords
|
||||
|
||||
def classes_mapping(det, num_classes):
|
||||
det[:, 5] = det[:, 5] + 1.0
|
||||
|
||||
def Yolov5_postprocess(pred, img_shape, im0_shape, conf_thres, iou_thres, top_k_num, num_classes, vanish_point, e2e_coco) :
|
||||
classes, agnostic_nms = None, False#
|
||||
img_h = im0_shape[0]
|
||||
vanish_y2 = vanish_point * float(img_h)
|
||||
# Apply NMS
|
||||
pred = non_max_suppression(pred, conf_thres, iou_thres, top_k_num, classes=classes, agnostic=agnostic_nms)
|
||||
#return pred
|
||||
dets = []
|
||||
for i, det in enumerate(pred): # detections per image
|
||||
gn = torch.tensor(im0_shape)[[1, 0, 1, 0]] # normalization gain whwh
|
||||
if det is not None and len(det):
|
||||
# Rescale boxes from img_size to im0 size
|
||||
det[:, :4] = scale_coords(img_shape[2:], det[:, :4], im0_shape).round()
|
||||
det = det[det[:,3]>=vanish_y2]
|
||||
# (x1,y1,x2,y2) -> (x1,y1,w,h) for public_field.py
|
||||
det[:, 2] = det[:, 2] - det[:, 0]
|
||||
det[:, 3] = det[:, 3] - det[:, 1]
|
||||
# classes(0~79) -> classes(1~80) for public_field.py
|
||||
if e2e_coco:
|
||||
classes_mapping(det, num_classes)
|
||||
det = det.cpu().numpy()
|
||||
dets.append(det)
|
||||
|
||||
if dets and len(dets) > 0:
|
||||
dets = np.asarray(dets)
|
||||
dets = np.squeeze(dets, axis=0) # remove outer []
|
||||
dets = dets.tolist()
|
||||
|
||||
return dets
|
||||
|
||||
def make_grid(nx=20, ny=20):
|
||||
yv, xv = torch.meshgrid([torch.arange(ny), torch.arange(nx)])
|
||||
grids = torch.stack((xv, yv), 2).view((1, 1, ny, nx, 2)).float()
|
||||
return grids
|
||||
|
||||
def Yolov5_postprocess_onnx_sig(out,img_shape, im0_shape, conf_thres, iou_thres, top_k_num, grids, num_classes, anchors,vanish_point, e2e_coco) :
|
||||
nc = num_classes # number of classes
|
||||
no = nc + 5 # number of outputs per anchor
|
||||
nl = len(anchors) # number of detection layers
|
||||
na = len(anchors[0]) // 2 # number of anchors
|
||||
a = torch.tensor(anchors).float().view(3, -1, 2)
|
||||
anchor_grid = a.clone().view(3, 1, -1, 1, 1, 2)
|
||||
stride = torch.tensor([ 8., 16., 32.])
|
||||
z = []
|
||||
for i in range(nl):
|
||||
x = torch.from_numpy(out[i])
|
||||
# print('x.shape',x.shape)
|
||||
bs, _, ny, nx = x.shape # x(bs,3,20,20,85)
|
||||
x = x.view(bs, na, no, ny, nx).permute(0, 1, 3, 4, 2).contiguous()
|
||||
# grid_r = make_grid(nx, ny) ##grid
|
||||
# grid_r = grid_r.numpy() ##grid
|
||||
# file_name = str(i)+'.npy' ##grid
|
||||
# np.save(file_name,grid_r) ##grid
|
||||
grid = grids[i]#
|
||||
#y = x.sigmoid()
|
||||
y = x
|
||||
y[..., 0:2] = (y[..., 0:2] * 2. - 0.5 + grid) * stride[i] # xy
|
||||
y[..., 2:4] = (y[..., 2:4] * 2) ** 2 * anchor_grid[i] # wh
|
||||
z.append(y.view(bs, -1, no))
|
||||
|
||||
pred = torch.cat(z, 1)
|
||||
return Yolov5_postprocess(pred, img_shape, im0_shape, conf_thres, iou_thres, top_k_num, num_classes,vanish_point, e2e_coco)
|
||||
|
||||
def Yolov5_postprocess_sig(out,img_shape, im0_shape, conf_thres, iou_thres, top_k_num, grids, num_classes, anchors,vanish_point, e2e_coco) :
|
||||
nc = num_classes # number of classes
|
||||
no = nc + 5 # number of outputs per anchor
|
||||
nl = len(anchors) # number of detection layers
|
||||
na = len(anchors[0]) // 2 # number of anchors
|
||||
a = torch.tensor(anchors).float().view(3, -1, 2)
|
||||
anchor_grid = a.clone().view(3, 1, -1, 1, 1, 2).to(out[0].device)
|
||||
stride = torch.tensor([ 8., 16., 32.]).to(out[0].device)
|
||||
z = []
|
||||
for i in range(nl):
|
||||
x = out[i]
|
||||
bs, _, ny, nx = x.shape # x(bs,255,20,20) to x(bs,3,20,20,85)
|
||||
# print('x.shape',x.shape)
|
||||
x = x.view(bs, na, no, ny, nx).permute(0, 1, 3, 4, 2).contiguous()
|
||||
|
||||
# grid_r = make_grid(nx, ny) ##grid
|
||||
# grid_r = grid_r.numpy() ##grid
|
||||
# file_name = str(i)+'.npy' ##grid
|
||||
# np.save(file_name,grid_r) ##grid
|
||||
|
||||
grid = grids[i].to(out[0].device) #
|
||||
#y = x.sigmoid()
|
||||
y = x
|
||||
y[..., 0:2] = (y[..., 0:2] * 2. - 0.5 + grid) * stride[i] # xy
|
||||
y[..., 2:4] = (y[..., 2:4] * 2) ** 2 * anchor_grid[i] # wh
|
||||
z.append(y.view(bs, -1, no))
|
||||
# exit(0)
|
||||
pred = torch.cat(z, 1)
|
||||
return Yolov5_postprocess(pred, img_shape, im0_shape, conf_thres, iou_thres, top_k_num, num_classes,vanish_point, e2e_coco)
|
||||
160
kneron/exporting/yolov5/yolov5_preprocess.py
Normal file
@ -0,0 +1,160 @@
|
||||
# coding: utf-8
|
||||
import torch
|
||||
import cv2
|
||||
import numpy as np
|
||||
import math
|
||||
import time
|
||||
from . import kneron_preprocessing
|
||||
kneron_preprocessing.API.set_default_as_520()
|
||||
torch.backends.cudnn.deterministic = True
|
||||
img_formats = ['.bmp', '.jpg', '.jpeg', '.png', '.tif', '.tiff', '.dng']
|
||||
def make_divisible(x, divisor):
|
||||
# Returns x evenly divisble by divisor
|
||||
return math.ceil(x / divisor) * divisor
|
||||
|
||||
def check_img_size(img_size, s=32):
|
||||
# Verify img_size is a multiple of stride s
|
||||
new_size = make_divisible(img_size, int(s)) # ceil gs-multiple
|
||||
if new_size != img_size:
|
||||
print('WARNING: --img-size %g must be multiple of max stride %g, updating to %g' % (img_size, s, new_size))
|
||||
return new_size
|
||||
|
||||
def letterbox_ori(img, new_shape=(640, 640), color=(0, 0, 0), auto=True, scaleFill=False, scaleup=True):
|
||||
# Resize image to a 32-pixel-multiple rectangle https://github.com/ultralytics/yolov3/issues/232
|
||||
shape = img.shape[:2] # current shape [height, width]
|
||||
if isinstance(new_shape, int):
|
||||
new_shape = (new_shape, new_shape)
|
||||
|
||||
# Scale ratio (new / old)
|
||||
r = min(new_shape[0] / shape[0], new_shape[1] / shape[1])
|
||||
if not scaleup: # only scale down, do not scale up (for better test mAP)
|
||||
r = min(r, 1.0)
|
||||
|
||||
# Compute padding
|
||||
ratio = r, r # width, height ratios
|
||||
new_unpad = int(round(shape[1] * r)), int(round(shape[0] * r)) # width, height
|
||||
dw, dh = new_shape[1] - new_unpad[0], new_shape[0] - new_unpad[1] # wh padding
|
||||
|
||||
dw /= 2 # divide padding into 2 sides
|
||||
dh /= 2
|
||||
|
||||
if shape[::-1] != new_unpad: # resize
|
||||
img = cv2.resize(img, new_unpad, interpolation=cv2.INTER_LINEAR)
|
||||
#img = kneron_preprocessing.API.resize(img,size=new_unpad, keep_ratio = False)
|
||||
|
||||
top, bottom = int(round(dh - 0.1)), int(round(dh + 0.1))
|
||||
left, right = int(round(dw - 0.1)), int(round(dw + 0.1))
|
||||
# top, bottom = int(0), int(round(dh + 0.1))
|
||||
# left, right = int(0), int(round(dw + 0.1))
|
||||
img = cv2.copyMakeBorder(img, top, bottom, left, right, cv2.BORDER_CONSTANT, value=color) # add border
|
||||
#img = kneron_preprocessing.API.pad(img, left, right, top, bottom, 0)
|
||||
|
||||
return img, ratio, (dw, dh)
|
||||
|
||||
def letterbox(img, new_shape=(640, 640), color=(0, 0, 0), auto=True, scaleFill=False, scaleup=True):
|
||||
# Resize image to a 32-pixel-multiple rectangle https://github.com/ultralytics/yolov3/issues/232
|
||||
shape = img.shape[:2] # current shape [height, width]
|
||||
if isinstance(new_shape, int):
|
||||
new_shape = (new_shape, new_shape)
|
||||
|
||||
# Scale ratio (new / old)
|
||||
r = min(new_shape[0] / shape[0], new_shape[1] / shape[1])
|
||||
if not scaleup: # only scale down, do not scale up (for better test mAP)
|
||||
r = min(r, 1.0)
|
||||
|
||||
# Compute padding
|
||||
ratio = r, r # width, height ratios
|
||||
new_unpad = int(round(shape[1] * r)), int(round(shape[0] * r)) # width, height
|
||||
dw, dh = new_shape[1] - new_unpad[0], new_shape[0] - new_unpad[1] # wh padding
|
||||
|
||||
# dw /= 2 # divide padding into 2 sides
|
||||
# dh /= 2
|
||||
|
||||
if shape[::-1] != new_unpad: # resize
|
||||
#img = cv2.resize(img, new_unpad, interpolation=cv2.INTER_LINEAR)
|
||||
img = kneron_preprocessing.API.resize(img,size=new_unpad, keep_ratio = False)
|
||||
|
||||
# top, bottom = int(round(dh - 0.1)), int(round(dh + 0.1))
|
||||
# left, right = int(round(dw - 0.1)), int(round(dw + 0.1))
|
||||
top, bottom = int(0), int(round(dh + 0.1))
|
||||
left, right = int(0), int(round(dw + 0.1))
|
||||
#img = cv2.copyMakeBorder(img, top, bottom, left, right, cv2.BORDER_CONSTANT, value=color) # add border
|
||||
img = kneron_preprocessing.API.pad(img, left, right, top, bottom, 0)
|
||||
|
||||
return img, ratio, (dw, dh)
|
||||
|
||||
def letterbox_test(img, new_shape=(640, 640), color=(0, 0, 0), auto=True, scaleFill=False, scaleup=True):
|
||||
|
||||
ratio = 1.0, 1.0
|
||||
dw, dh = 0, 0
|
||||
img = kneron_preprocessing.API.resize(img, size=(480, 256), keep_ratio=False, type='bilinear')
|
||||
return img, ratio, (dw, dh)
|
||||
|
||||
def LoadImages(path,img_size): #_rgb # for inference
|
||||
if isinstance(path, str):
|
||||
img0 = cv2.imread(path) # BGR
|
||||
else:
|
||||
img0 = path # BGR
|
||||
|
||||
# Padded resize
|
||||
img = letterbox(img0, new_shape=img_size)[0]
|
||||
# Convert
|
||||
img = img[:, :, ::-1].transpose(2, 0, 1) # BGR to RGB, to 3x416x416
|
||||
img = np.ascontiguousarray(img)
|
||||
return img, img0
|
||||
|
||||
def LoadImages_yyy(path,img_size): #_yyy # for inference
|
||||
if isinstance(path, str):
|
||||
img0 = cv2.imread(path) # BGR
|
||||
else:
|
||||
img0 = path # BGR
|
||||
|
||||
yvu = cv2.cvtColor(img0, cv2.COLOR_BGR2YCrCb)
|
||||
y, v, u = cv2.split(yvu)
|
||||
img0 = np.stack((y,)*3, axis=-1)
|
||||
|
||||
# Padded resize
|
||||
img = letterbox(img0, new_shape=img_size)[0]
|
||||
|
||||
# Convert
|
||||
img = img[:, :, ::-1].transpose(2, 0, 1) # BGR to RGB, to 3x416x416
|
||||
img = np.ascontiguousarray(img)
|
||||
return img, img0
|
||||
|
||||
def LoadImages_yuv420(path,img_size): #_yuv420 # for inference
|
||||
if isinstance(path, str):
|
||||
img0 = cv2.imread(path) # BGR
|
||||
else:
|
||||
img0 = path # BGR
|
||||
img_h, img_w = img0.shape[:2]
|
||||
img_h = (img_h // 2) * 2
|
||||
img_w = (img_w // 2) * 2
|
||||
img = img0[:img_h,:img_w,:]
|
||||
yuv = cv2.cvtColor(img, cv2.COLOR_BGR2YUV_I420)
|
||||
img0= cv2.cvtColor(yuv, cv2.COLOR_YUV2BGR_I420) #yuv420
|
||||
|
||||
|
||||
# Padded resize
|
||||
img = letterbox(img0, new_shape=img_size)[0]
|
||||
|
||||
# Convert
|
||||
img = img[:, :, ::-1].transpose(2, 0, 1) # BGR to RGB, to 3x416x416
|
||||
img = np.ascontiguousarray(img)
|
||||
return img, img0
|
||||
|
||||
def Yolov5_preprocess(image_path, device, imgsz_h, imgsz_w) :
|
||||
model_stride_max = 32
|
||||
imgsz_h = check_img_size(imgsz_h, s=model_stride_max) # check img_size
|
||||
imgsz_w = check_img_size(imgsz_w, s=model_stride_max) # check img_size
|
||||
img, im0 = LoadImages(image_path, img_size=(imgsz_h,imgsz_w))
|
||||
img = kneron_preprocessing.API.norm(img) #path1
|
||||
#print('img',img.shape)
|
||||
img = torch.from_numpy(img).to(device) #path1,path2
|
||||
# img = img.float() # uint8 to fp16/32 #path2
|
||||
# img /= 255.0#256.0 - 0.5 # 0 - 255 to -0.5 - 0.5 #path2
|
||||
|
||||
if img.ndimension() == 3:
|
||||
img = img.unsqueeze(0)
|
||||
|
||||
return img, im0
|
||||
|
||||
91
kneron/exporting/yolov5/yolov5_runner.py
Normal file
@ -0,0 +1,91 @@
|
||||
import torch
|
||||
torch.set_printoptions(precision=10)
|
||||
torch.set_printoptions(threshold=99999999999)
|
||||
torch.backends.cudnn.deterministic = True
|
||||
from .yolov5_preprocess import *
|
||||
from .yolov5_postprocess import *
|
||||
from .yolo_v2 import Model as Model_v2
|
||||
import onnxruntime
|
||||
import time
|
||||
import os
|
||||
from collections import Counter
|
||||
import torch.nn.functional as F
|
||||
import random
|
||||
from pathlib import Path
|
||||
|
||||
class Yolov5Runner:
|
||||
def __init__(self, model_path, yaml_path, grid20_path, grid40_path, grid80_path, num_classes, imgsz_h, imgsz_w, conf_thres, iou_thres, top_k_num, vanish_point, **kwargs):#is_onnx,
|
||||
"""
|
||||
inputs :
|
||||
model_path : str ,path to model
|
||||
"""
|
||||
self.model_path = model_path
|
||||
self.imgsz_h = imgsz_h
|
||||
self.imgsz_w = imgsz_w
|
||||
self.conf_thres = conf_thres
|
||||
self.iou_thres = iou_thres
|
||||
self.top_k_num = top_k_num
|
||||
self.vanish_point = vanish_point
|
||||
self.num_classes = num_classes
|
||||
self.DEVICE = torch.device("cpu")#torch.device('cuda:0')#
|
||||
self.grid20 = torch.from_numpy(np.load(grid20_path))
|
||||
self.grid40 = torch.from_numpy(np.load(grid40_path))
|
||||
self.grid80 = torch.from_numpy(np.load(grid80_path))
|
||||
self.grids = [self.grid80, self.grid40, self.grid20]
|
||||
if 'onnx' not in model_path:
|
||||
self.yolov5_model = Model_v2(yaml_path, nc=num_classes)
|
||||
self.yolov5_model.load_state_dict(torch.load(model_path, map_location=self.DEVICE))#,strict=False)
|
||||
self.yolov5_model.float().eval()
|
||||
self.yolov5_model.to(self.DEVICE)
|
||||
self.yolov5_model.eval()
|
||||
else:
|
||||
#onnxruntime.set_default_logger_severity(0)
|
||||
self.sess = onnxruntime.InferenceSession(model_path)
|
||||
# self.sess.set_providers(['CUDAExecutionProvider'])
|
||||
self.input_name = self.sess.get_inputs()[0].name
|
||||
self.onnx_batch_size = self.sess.get_inputs()[0].shape[0]
|
||||
self.onnx_img_size_h = self.sess.get_inputs()[0].shape[2]
|
||||
self.onnx_img_size_w = self.sess.get_inputs()[0].shape[3]
|
||||
|
||||
self.anchors = [[10, 13, 16, 30, 33, 23], [30, 61, 62, 45, 59, 119], [116, 90, 156, 198, 373, 326]] #yolov5
|
||||
print('self.vanish_point',self.vanish_point)
|
||||
self.e2e_coco = kwargs.get('e2e_coco', False)
|
||||
|
||||
def run(self, img_path):
|
||||
"""
|
||||
inputs :
|
||||
img_path : path of the image
|
||||
outputs :
|
||||
dets : list
|
||||
"""
|
||||
self.yolov5_model.eval()
|
||||
with torch.no_grad():
|
||||
img, im0 = Yolov5_preprocess(img_path, self.DEVICE, self.imgsz_h, self.imgsz_w)
|
||||
if next(self.yolov5_model.parameters()).is_cuda:
|
||||
img = img.type(torch.cuda.FloatTensor)
|
||||
else:
|
||||
img = img.type(torch.FloatTensor)
|
||||
pred = self.yolov5_model(img, augment=False)
|
||||
img_shape, im0_shape = img.shape, im0.shape
|
||||
dets = Yolov5_postprocess_sig(pred,img_shape, im0_shape, self.conf_thres, self.iou_thres, self.top_k_num, self.grids, self.num_classes, self.anchors,self.vanish_point)
|
||||
return dets
|
||||
|
||||
def run_onnx(self, img_path):
|
||||
"""
|
||||
inputs :
|
||||
img_path : path of the image
|
||||
outputs :
|
||||
dets : list
|
||||
"""
|
||||
with torch.no_grad():
|
||||
img, im0 = Yolov5_preprocess(img_path, self.DEVICE, self.imgsz_h, self.imgsz_w)
|
||||
np_images = np.array(img.cpu())
|
||||
np_images = np_images.astype(np.float32)
|
||||
pred_onnx = self.sess.run(None, {self.input_name: np_images })
|
||||
img_shape, im0_shape = img.shape, im0.shape
|
||||
# print('img_shape',img_shape)
|
||||
# print('im0_shape', im0_shape)
|
||||
dets_onnx = Yolov5_postprocess_onnx_sig(pred_onnx,img_shape, im0_shape, self.conf_thres, self.iou_thres, self.top_k_num, self.grids, self.num_classes, self.anchors,self.vanish_point, self.e2e_coco)
|
||||
return dets_onnx
|
||||
|
||||
|
||||
80
kneron/exporting/yolov5_export.py
Normal file
@ -0,0 +1,80 @@
|
||||
import os
|
||||
import torch
|
||||
import sys
|
||||
import yaml
|
||||
import argparse
|
||||
|
||||
from yolov5.yolov5_runner import Yolov5Runner
|
||||
|
||||
def save_weight(num_classes):
|
||||
current_path=os.getcwd()
|
||||
par_path = os.path.dirname(current_path)
|
||||
sys.path.append(os.path.join(par_path, 'yolov5'))
|
||||
from models.yolo import Model
|
||||
num_classes = num_classes
|
||||
device=torch.device('cpu')
|
||||
ckpt = torch.load(path, map_location=device)
|
||||
model = Model(yaml_path, nc=num_classes)
|
||||
ckpt['model'] = {k: v for k, v in ckpt['model'].float().state_dict().items() if k in model.state_dict() and model.state_dict()[k].shape == v.shape}
|
||||
model.load_state_dict(ckpt['model'])
|
||||
torch.save(model.state_dict(),pt_path,_use_new_zipfile_serialization=False)
|
||||
|
||||
def export_onnx(input_h, input_w, num_classes):
|
||||
|
||||
onnx_batch_size, onnx_img_h, onnx_img_w = 1, input_h, input_w
|
||||
yolov5_model = Yolov5Runner(model_path=pt_path, yaml_path=yaml_path, grid20_path=grid20_path, grid40_path=grid40_path, grid80_path=grid80_path, num_classes=num_classes, imgsz_h=onnx_img_h, imgsz_w=onnx_img_w, conf_thres=0.001, iou_thres=0.65, top_k_num=3000, vanish_point=0.0)
|
||||
|
||||
# Input
|
||||
img = torch.zeros((onnx_batch_size, 3, onnx_img_h, onnx_img_w))
|
||||
# img = img.type(torch.cuda.FloatTensor)
|
||||
|
||||
# Load PyTorch model
|
||||
model = yolov5_model.yolov5_model
|
||||
model.eval()
|
||||
model.model[-1].export = True # set Detect() layer export=True
|
||||
y = model(img) # dry run
|
||||
|
||||
# ONNX export
|
||||
try:
|
||||
import onnx
|
||||
print('\nStarting ONNX export with onnx %s...' % onnx.__version__)
|
||||
print('****onnx file****',onnx_export_file)
|
||||
torch.onnx.export(model, img, onnx_export_file, verbose=False, opset_version=11, keep_initializers_as_inputs=True, input_names=['images'], output_names=['classes', 'boxes'] if y is None else ['output'])
|
||||
# Checks
|
||||
onnx_model = onnx.load(onnx_export_file) # load onnx model
|
||||
onnx.checker.check_model(onnx_model) # check onnx model
|
||||
print(onnx.helper.printable_graph(onnx_model.graph)) # print a human readable model
|
||||
print('ONNX export success, saved as %s' % onnx_export_file)
|
||||
except Exception as e:
|
||||
print('ONNX export failure: %s' % e)
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
parser = argparse.ArgumentParser()
|
||||
parser.add_argument('--data', type=str, default='../yolov5/data/pretrained_paths_520.yaml', help='the path to pretrained model paths yaml file')
|
||||
|
||||
args = parser.parse_args()
|
||||
|
||||
with open(args.data) as f:
|
||||
data_dict = yaml.load(f, Loader=yaml.FullLoader) # data dict
|
||||
|
||||
os.environ["CUDA_VISIBLE_DEVICES"] = '0'
|
||||
num_classes = data_dict['nc']
|
||||
input_w = data_dict['input_w']
|
||||
input_h = data_dict['input_h']
|
||||
grid_dir = data_dict['grid_dir']
|
||||
grid20_path = data_dict['grid20_path']
|
||||
grid40_path = data_dict['grid40_path']
|
||||
grid80_path = data_dict['grid80_path']
|
||||
path = data_dict['path']
|
||||
pt_path=data_dict['pt_path']
|
||||
yaml_path=data_dict['yaml_path']
|
||||
onnx_export_file = data_dict['onnx_export_file']
|
||||
save_weight(num_classes)
|
||||
export_onnx(input_h, input_w, num_classes)
|
||||
|
||||
|
||||
|
||||
|
||||
|
||||
|
||||
64
kneron/inference.py
Normal file
@ -0,0 +1,64 @@
|
||||
import os
|
||||
import sys
|
||||
import argparse
|
||||
import yaml
|
||||
import cv2
|
||||
import numpy as np
|
||||
|
||||
def draw(img_path, bboxes, save_path = None, names = None):
|
||||
|
||||
img = cv2.imread(img_path)
|
||||
for bbox in bboxes:
|
||||
l,t,w,h,score,class_id=bbox
|
||||
if names is not None:
|
||||
class_id = names[int(class_id)]
|
||||
img = cv2.rectangle(img,(int(l),int(t)),(int(l+w),int(t+h)),(0, 255, 0),6)
|
||||
text = "{}".format(class_id) + " {}".format(np.round(score, 3))
|
||||
img = cv2.putText(img, text, (int(l), int(t)-10), cv2.FONT_HERSHEY_SIMPLEX, 0.5, (0, 255, 0), 2)
|
||||
if save_path is None:
|
||||
save_path = img_path
|
||||
output_file = os.path.join(save_path, "output.jpg") # 確保有圖片副檔名
|
||||
cv2.imwrite(output_file, img)
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
parser = argparse.ArgumentParser()
|
||||
parser.add_argument('--img-path', type=str, default=None, help='path to image')
|
||||
parser.add_argument('--save-path', type=str, default=None, help='path to save image')
|
||||
parser.add_argument('--data', type=str, default='data/pretrained_paths_520.yaml', help='the path to pretrained model paths yaml file')
|
||||
parser.add_argument('--conf_thres', type=float, default=0.3, help='confidence threshold')
|
||||
parser.add_argument('--iou_thres', type=float, default=0.5, help='iou threshold for NMS')
|
||||
parser.add_argument('--onnx', help='inference onnx model',action='store_true')
|
||||
|
||||
args = parser.parse_args()
|
||||
|
||||
par_path = os.path.abspath(os.path.join(os.getcwd(), os.pardir))
|
||||
sys.path.append(par_path)
|
||||
sys.path.append(os.path.join(par_path, 'exporting') )
|
||||
|
||||
from yolov5.yolov5_runner import Yolov5Runner
|
||||
|
||||
with open(args.data) as f:
|
||||
data_dict = yaml.load(f, Loader=yaml.FullLoader) # data dict
|
||||
|
||||
num_classes = data_dict['nc']
|
||||
input_w = data_dict['input_w']
|
||||
input_h = data_dict['input_h']
|
||||
grid_dir = data_dict['grid_dir']
|
||||
grid20_path = data_dict['grid20_path']
|
||||
grid40_path = data_dict['grid40_path']
|
||||
grid80_path = data_dict['grid80_path']
|
||||
path = data_dict['path']
|
||||
|
||||
|
||||
if args.onnx:
|
||||
yolov5_model = Yolov5Runner(model_path=data_dict['onnx_export_file'], yaml_path=data_dict['yaml_path'], grid20_path=grid20_path, grid40_path=grid40_path, grid80_path=grid80_path, num_classes=num_classes, imgsz_h=input_h, imgsz_w=input_w, conf_thres=args.conf_thres, iou_thres=args.iou_thres, top_k_num=3000, vanish_point=0.0)
|
||||
bboxes = yolov5_model.run_onnx(args.img_path)
|
||||
else:
|
||||
yolov5_model = Yolov5Runner(model_path=data_dict['pt_path'], yaml_path=data_dict['yaml_path'], grid20_path=grid20_path, grid40_path=grid40_path, grid80_path=grid80_path, num_classes=num_classes, imgsz_h=input_h, imgsz_w=input_w, conf_thres=args.conf_thres, iou_thres=args.iou_thres, top_k_num=3000, vanish_point=0.0)
|
||||
bboxes = yolov5_model.run(args.img_path)
|
||||
|
||||
print(bboxes)
|
||||
|
||||
if args.save_path is not None:
|
||||
draw(args.img_path, bboxes, save_path = args.save_path, names = data_dict['names'])
|
||||
53
kneron/inference_e2e.py
Normal file
@ -0,0 +1,53 @@
|
||||
import os
|
||||
import sys
|
||||
import argparse
|
||||
import yaml
|
||||
from tqdm import tqdm
|
||||
import json
|
||||
|
||||
if __name__ == '__main__':
|
||||
parser = argparse.ArgumentParser()
|
||||
parser.add_argument('--img-path', type=str, help='Path to the dataset directory.')
|
||||
parser.add_argument('--params', type=str, help='Path to the init params file.')
|
||||
parser.add_argument('--save-path', type=str, help='Path to save output in json.')
|
||||
|
||||
args = parser.parse_args()
|
||||
|
||||
par_path = os.path.abspath(os.path.join(os.getcwd(), os.pardir))
|
||||
sys.path.append(par_path)
|
||||
sys.path.append(os.path.join(par_path, 'exporting') )
|
||||
|
||||
from yolov5.yolov5_runner import Yolov5Runner
|
||||
|
||||
with open(args.params, "r", encoding="utf-8") as f:
|
||||
params_dict = yaml.load(f, Loader=yaml.FullLoader) # data dict
|
||||
|
||||
num_classes = params_dict['nc']
|
||||
input_w = params_dict['input_w']
|
||||
input_h = params_dict['input_h']
|
||||
grid20_path = params_dict['grid20_path']
|
||||
grid40_path = params_dict['grid40_path']
|
||||
grid80_path = params_dict['grid80_path']
|
||||
conf_thres = params_dict['conf_thres']
|
||||
iou_thres = params_dict['iou_thres']
|
||||
model_type = params_dict['model_type']
|
||||
e2e_coco = params_dict['e2e_coco']
|
||||
|
||||
if model_type == 'onnx':
|
||||
yolov5_model = Yolov5Runner(model_path=params_dict['onnx_path'], yaml_path=params_dict['model_yaml_path'], grid20_path=grid20_path, grid40_path=grid40_path, grid80_path=grid80_path, num_classes=num_classes, imgsz_h=input_h, imgsz_w=input_w, conf_thres=conf_thres, iou_thres=iou_thres, top_k_num=3000, vanish_point=0.0, e2e_coco=e2e_coco)
|
||||
else:
|
||||
yolov5_model = Yolov5Runner(model_path=params_dict['pt_path'], yaml_path=params_dict['model_yaml_path'], grid20_path=grid20_path, grid40_path=grid40_path, grid80_path=grid80_path, num_classes=num_classes, imgsz_h=input_h, imgsz_w=input_w, conf_thres=conf_thres, iou_thres=iou_thres, top_k_num=3000, vanish_point=0.0, e2e_coco=e2e_coco)
|
||||
|
||||
img_list = os.listdir(args.img_path)
|
||||
results = []
|
||||
for img_name in tqdm(img_list):
|
||||
if img_name.split('.')[-1] not in ['png', 'jpg']:
|
||||
continue
|
||||
img_path = os.path.join(args.img_path, img_name)
|
||||
if model_type == 'onnx':
|
||||
bboxes = yolov5_model.run_onnx(img_path)
|
||||
else:
|
||||
bboxes = yolov5_model.run(img_path)
|
||||
results.append({'img_path': img_path, 'bbox': bboxes } )
|
||||
with open(args.save_path, 'w') as fp:
|
||||
json.dump(results, fp)
|
||||
72
kneron/ktc720.py
Normal file
@ -0,0 +1,72 @@
|
||||
import ktc
|
||||
import numpy as np
|
||||
import os
|
||||
import onnx
|
||||
from PIL import Image
|
||||
import torch
|
||||
from yolov5_preprocess import Yolov5_preprocess
|
||||
import kneron_preprocessing
|
||||
|
||||
onnx_path = 'runs/train/exp24/weights/best_simplified.onnx'
|
||||
m = onnx.load(onnx_path)
|
||||
m = ktc.onnx_optimizer.onnx2onnx_flow(m)
|
||||
onnx.save(m,'latest.opt.onnx')
|
||||
km = ktc.ModelConfig(20008, "0001", "720", onnx_model=m)
|
||||
eval_result = km.evaluate()
|
||||
print("\nNpu performance evaluation result:\n" + str(eval_result))
|
||||
|
||||
device = torch.device("cuda" if torch.cuda.is_available() else "cpu")
|
||||
|
||||
imgsz_h, imgsz_w = 640, 640
|
||||
|
||||
data_path = "data50"
|
||||
files_found = [f for _, _, files in os.walk(data_path) for f in files if f.lower().endswith((".jpg", ".jpeg", ".png", ".bmp"))]
|
||||
|
||||
if not files_found:
|
||||
raise FileNotFoundError(f"❌ Error: No images found in {data_path}! Please check your dataset.")
|
||||
|
||||
print(f"✅ Found {len(files_found)} images in {data_path}")
|
||||
|
||||
# **獲取 ONNX 模型的輸入名稱**
|
||||
input_name = m.graph.input[0].name # 確保 key 與 ONNX input name 一致
|
||||
# 存儲預處理後的圖片數據
|
||||
img_list = []
|
||||
|
||||
# 遍歷 data50 並進行預處理
|
||||
for root, _, files in os.walk(data_path):
|
||||
for f in files:
|
||||
fullpath = os.path.join(root, f)
|
||||
|
||||
# **只處理圖片文件**
|
||||
if not f.lower().endswith((".jpg", ".jpeg", ".png", ".bmp")):
|
||||
print(f"⚠️ Skipping non-image file: {fullpath}")
|
||||
continue
|
||||
|
||||
# **嘗試處理圖片**
|
||||
try:
|
||||
img_data, _ = Yolov5_preprocess(fullpath, device, imgsz_h, imgsz_w)
|
||||
img_data = img_data.cpu().numpy()
|
||||
print(f"✅ Processed: {fullpath}")
|
||||
img_list.append(img_data)
|
||||
except Exception as e:
|
||||
print(f"❌ Failed to process {fullpath}: {e}")
|
||||
|
||||
# **確保 img_list 不是空的**
|
||||
if not img_list:
|
||||
raise ValueError("❌ Error: No valid images were processed! Please check the image paths and formats.")
|
||||
|
||||
# **執行 BIE 量化**
|
||||
bie_model_path = km.analysis({input_name: img_list})
|
||||
|
||||
# **確認 BIE 模型是否生成**
|
||||
if not os.path.exists(bie_model_path):
|
||||
raise RuntimeError(f"❌ Error: BIE model was not generated! Please check your quantization process.")
|
||||
|
||||
# 顯示成功訊息
|
||||
print("\n✅ Fixed-point analysis done! BIE model saved to:", bie_model_path)
|
||||
|
||||
# 確保 `km` 已經初始化,並且 `.bie` 模型已生成
|
||||
nef_model_path = ktc.compile([km])
|
||||
|
||||
# 顯示成功訊息
|
||||
print("\n✅ Compile done! NEF file saved to:", nef_model_path)
|
||||
33
kneron/oldquantize_yolov5.py
Normal file
@ -0,0 +1,33 @@
|
||||
import os
|
||||
import numpy as np
|
||||
import torch
|
||||
from yolov5_preprocess import Yolov5_preprocess # 使用你的預處理
|
||||
import kneron_preprocessing
|
||||
|
||||
# 設定裝置
|
||||
device = torch.device("cuda" if torch.cuda.is_available() else "cpu")
|
||||
|
||||
# 設定圖片大小(與訓練時一致)
|
||||
imgsz_h, imgsz_w = 640, 640
|
||||
|
||||
# 量化數據集目錄(請確保這個資料夾存在)
|
||||
data_path = "/data50"
|
||||
img_list = []
|
||||
|
||||
# 遍歷 voc_data50 並進行預處理
|
||||
for root, _, files in os.walk(data_path):
|
||||
for f in files:
|
||||
fullpath = os.path.join(root, f)
|
||||
|
||||
# 執行與訓練相同的預處理
|
||||
img_data, _ = Yolov5_preprocess(fullpath, device, imgsz_h, imgsz_w)
|
||||
|
||||
print(f"Processed: {fullpath}")
|
||||
img_list.append(img_data)
|
||||
|
||||
# 轉為 NumPy 格式
|
||||
img_list = np.array(img_list)
|
||||
|
||||
# 執行 BIE 量化分析
|
||||
bie_model_path = km.analysis({"input": img_list})
|
||||
print("\nFixed-point analysis done. Saved bie model to '" + str(bie_model_path) + "'")
|
||||
110
kneron/onnx2nef520.py
Normal file
@ -0,0 +1,110 @@
|
||||
import ktc
|
||||
import numpy as np
|
||||
import os
|
||||
import onnx
|
||||
import shutil
|
||||
from PIL import Image
|
||||
import torch
|
||||
from yolov5_preprocess import Yolov5_preprocess
|
||||
import kneron_preprocessing
|
||||
|
||||
# 設定 ONNX 模型儲存路徑
|
||||
onnx_dir = 'runs/train/exp24/weights/'
|
||||
onnx_path = os.path.join(onnx_dir, 'best_no_sigmoid.onnx')
|
||||
|
||||
# 確保目標資料夾存在
|
||||
os.makedirs(onnx_dir, exist_ok=True)
|
||||
|
||||
# 加載並優化 ONNX 模型
|
||||
m = onnx.load(onnx_path)
|
||||
m = ktc.onnx_optimizer.onnx2onnx_flow(m)
|
||||
opt_onnx_path = os.path.join(onnx_dir, 'latest.opt.onnx')
|
||||
onnx.save(m, opt_onnx_path)
|
||||
|
||||
km = ktc.ModelConfig(20008, "0001", "520", onnx_model=m)
|
||||
eval_result = km.evaluate()
|
||||
print("\nNpu performance evaluation result:\n" + str(eval_result))
|
||||
|
||||
device = torch.device("cuda" if torch.cuda.is_available() else "cpu")
|
||||
|
||||
imgsz_h, imgsz_w = 640, 640
|
||||
|
||||
data_path = "datacoin"
|
||||
files_found = [f for _, _, files in os.walk(data_path) for f in files if f.lower().endswith((".jpg", ".jpeg", ".png", ".bmp"))]
|
||||
|
||||
if not files_found:
|
||||
raise FileNotFoundError(f"\u274c Error: No images found in {data_path}! Please check your dataset.")
|
||||
|
||||
print(f"\u2705 Found {len(files_found)} images in {data_path}")
|
||||
|
||||
# 獲取 ONNX 模型的輸入名稱
|
||||
input_name = m.graph.input[0].name # 確保 key 與 ONNX input name 一致
|
||||
|
||||
# 存儲預處理後的圖片數據
|
||||
img_list = []
|
||||
|
||||
# 遍歷 data50 並進行預處理
|
||||
for root, _, files in os.walk(data_path):
|
||||
for f in files:
|
||||
fullpath = os.path.join(root, f)
|
||||
|
||||
# 只處理圖片文件
|
||||
if not f.lower().endswith((".jpg", ".jpeg", ".png", ".bmp")):
|
||||
print(f"\u26a0\ufe0f Skipping non-image file: {fullpath}")
|
||||
continue
|
||||
|
||||
# 嘗試處理圖片
|
||||
try:
|
||||
img_data, _ = Yolov5_preprocess(fullpath, device, imgsz_h, imgsz_w)
|
||||
img_data = img_data.cpu().numpy()
|
||||
print(f"\u2705 Processed: {fullpath}")
|
||||
img_list.append(img_data)
|
||||
except Exception as e:
|
||||
print(f"\u274c Failed to process {fullpath}: {e}")
|
||||
|
||||
# 確保 img_list 不是空的
|
||||
if not img_list:
|
||||
raise ValueError("\u274c Error: No valid images were processed! Please check the image paths and formats.")
|
||||
|
||||
# 執行 BIE 量化
|
||||
bie_model_path = km.analysis({input_name: img_list})
|
||||
|
||||
# 確保 BIE 檔案儲存到指定目錄
|
||||
bie_save_path = os.path.join(onnx_dir, os.path.basename(bie_model_path))
|
||||
shutil.copy(bie_model_path, bie_save_path) # 使用 shutil.move 來處理跨磁碟移動
|
||||
|
||||
# 確認 BIE 模型是否生成
|
||||
if not os.path.exists(bie_save_path):
|
||||
raise RuntimeError(f"\u274c Error: BIE model was not generated! Please check your quantization process.")
|
||||
|
||||
print("\n\u2705 Fixed-point analysis done! BIE model saved to:", bie_save_path)
|
||||
|
||||
# 確保 `km` 已經初始化,並且 `.bie` 模型已生成
|
||||
nef_model_path = ktc.compile([km])
|
||||
|
||||
# 確保 nef_model_path 不是 None 或空值
|
||||
if not nef_model_path:
|
||||
raise RuntimeError("❌ Error: ktc.compile() did not return a valid .nef file path!")
|
||||
|
||||
# 確保 NEF 目標資料夾存在
|
||||
os.makedirs(onnx_dir, exist_ok=True)
|
||||
|
||||
# 確保 nef_model_path 不是 None 或空值
|
||||
if not nef_model_path:
|
||||
raise RuntimeError("❌ Error: ktc.compile() did not return a valid .nef file path!")
|
||||
|
||||
# 確保 .nef 檔案存在
|
||||
if not os.path.exists(nef_model_path):
|
||||
raise RuntimeError(f"❌ Error: NEF model was not generated at {nef_model_path}! Please check your compilation process.")
|
||||
|
||||
# 確保 NEF 檔案儲存到指定目錄
|
||||
nef_save_path = os.path.join(onnx_dir, os.path.basename(nef_model_path))
|
||||
if os.path.exists(nef_model_path):
|
||||
shutil.copy(nef_model_path, nef_save_path)
|
||||
else:
|
||||
raise RuntimeError(f"❌ Error: NEF model was expected at {nef_model_path}, but it does not exist!") # 同樣使用 shutil.move
|
||||
|
||||
if not os.path.exists(nef_save_path):
|
||||
raise RuntimeError(f"\u274c Error: NEF model was not generated! Please check your compilation process.")
|
||||
|
||||
print("\n\u2705 Compile done! NEF file saved to:", nef_save_path)
|
||||
110
kneron/onnx2nef630.py
Normal file
@ -0,0 +1,110 @@
|
||||
import ktc
|
||||
import numpy as np
|
||||
import os
|
||||
import onnx
|
||||
import shutil
|
||||
from PIL import Image
|
||||
import torch
|
||||
from yolov5_preprocess import Yolov5_preprocess
|
||||
import kneron_preprocessing
|
||||
|
||||
# 設定 ONNX 模型儲存路徑
|
||||
onnx_dir = 'runs/train/exp29/weights/'
|
||||
onnx_path = os.path.join(onnx_dir, 'best_simplified.onnx')
|
||||
|
||||
# 確保目標資料夾存在
|
||||
os.makedirs(onnx_dir, exist_ok=True)
|
||||
|
||||
# 加載並優化 ONNX 模型
|
||||
m = onnx.load(onnx_path)
|
||||
m = ktc.onnx_optimizer.onnx2onnx_flow(m)
|
||||
opt_onnx_path = os.path.join(onnx_dir, 'latest.opt.onnx')
|
||||
onnx.save(m, opt_onnx_path)
|
||||
|
||||
km = ktc.ModelConfig(20008, "0001", "630", onnx_model=m)
|
||||
eval_result = km.evaluate()
|
||||
print("\nNpu performance evaluation result:\n" + str(eval_result))
|
||||
|
||||
device = torch.device("cuda" if torch.cuda.is_available() else "cpu")
|
||||
|
||||
imgsz_h, imgsz_w = 640, 640
|
||||
|
||||
data_path = "data4"
|
||||
files_found = [f for _, _, files in os.walk(data_path) for f in files if f.lower().endswith((".jpg", ".jpeg", ".png", ".bmp"))]
|
||||
|
||||
if not files_found:
|
||||
raise FileNotFoundError(f"\u274c Error: No images found in {data_path}! Please check your dataset.")
|
||||
|
||||
print(f"\u2705 Found {len(files_found)} images in {data_path}")
|
||||
|
||||
# 獲取 ONNX 模型的輸入名稱
|
||||
input_name = m.graph.input[0].name # 確保 key 與 ONNX input name 一致
|
||||
|
||||
# 存儲預處理後的圖片數據
|
||||
img_list = []
|
||||
|
||||
# 遍歷 data50 並進行預處理
|
||||
for root, _, files in os.walk(data_path):
|
||||
for f in files:
|
||||
fullpath = os.path.join(root, f)
|
||||
|
||||
# 只處理圖片文件
|
||||
if not f.lower().endswith((".jpg", ".jpeg", ".png", ".bmp")):
|
||||
print(f"\u26a0\ufe0f Skipping non-image file: {fullpath}")
|
||||
continue
|
||||
|
||||
# 嘗試處理圖片
|
||||
try:
|
||||
img_data, _ = Yolov5_preprocess(fullpath, device, imgsz_h, imgsz_w)
|
||||
img_data = img_data.cpu().numpy()
|
||||
print(f"\u2705 Processed: {fullpath}")
|
||||
img_list.append(img_data)
|
||||
except Exception as e:
|
||||
print(f"\u274c Failed to process {fullpath}: {e}")
|
||||
|
||||
# 確保 img_list 不是空的
|
||||
if not img_list:
|
||||
raise ValueError("\u274c Error: No valid images were processed! Please check the image paths and formats.")
|
||||
|
||||
# 執行 BIE 量化
|
||||
bie_model_path = km.analysis({input_name: img_list})
|
||||
|
||||
# 確保 BIE 檔案儲存到指定目錄
|
||||
bie_save_path = os.path.join(onnx_dir, os.path.basename(bie_model_path))
|
||||
shutil.copy(bie_model_path, bie_save_path) # 使用 shutil.move 來處理跨磁碟移動
|
||||
|
||||
# 確認 BIE 模型是否生成
|
||||
if not os.path.exists(bie_save_path):
|
||||
raise RuntimeError(f"\u274c Error: BIE model was not generated! Please check your quantization process.")
|
||||
|
||||
print("\n\u2705 Fixed-point analysis done! BIE model saved to:", bie_save_path)
|
||||
|
||||
# 確保 `km` 已經初始化,並且 `.bie` 模型已生成
|
||||
nef_model_path = ktc.compile([km])
|
||||
|
||||
# 確保 nef_model_path 不是 None 或空值
|
||||
if not nef_model_path:
|
||||
raise RuntimeError("❌ Error: ktc.compile() did not return a valid .nef file path!")
|
||||
|
||||
# 確保 NEF 目標資料夾存在
|
||||
os.makedirs(onnx_dir, exist_ok=True)
|
||||
|
||||
# 確保 nef_model_path 不是 None 或空值
|
||||
if not nef_model_path:
|
||||
raise RuntimeError("❌ Error: ktc.compile() did not return a valid .nef file path!")
|
||||
|
||||
# 確保 .nef 檔案存在
|
||||
if not os.path.exists(nef_model_path):
|
||||
raise RuntimeError(f"❌ Error: NEF model was not generated at {nef_model_path}! Please check your compilation process.")
|
||||
|
||||
# 確保 NEF 檔案儲存到指定目錄
|
||||
nef_save_path = os.path.join(onnx_dir, os.path.basename(nef_model_path))
|
||||
if os.path.exists(nef_model_path):
|
||||
shutil.copy(nef_model_path, nef_save_path)
|
||||
else:
|
||||
raise RuntimeError(f"❌ Error: NEF model was expected at {nef_model_path}, but it does not exist!") # 同樣使用 shutil.move
|
||||
|
||||
if not os.path.exists(nef_save_path):
|
||||
raise RuntimeError(f"\u274c Error: NEF model was not generated! Please check your compilation process.")
|
||||
|
||||
print("\n\u2705 Compile done! NEF file saved to:", nef_save_path)
|
||||
110
kneron/onnx2nef720.py
Normal file
@ -0,0 +1,110 @@
|
||||
import ktc
|
||||
import numpy as np
|
||||
import os
|
||||
import onnx
|
||||
import shutil
|
||||
from PIL import Image
|
||||
import torch
|
||||
from yolov5_preprocess import Yolov5_preprocess
|
||||
import kneron_preprocessing
|
||||
|
||||
# 設定 ONNX 模型儲存路徑
|
||||
onnx_dir = 'runs/train/exp73/weights/'
|
||||
onnx_path = os.path.join(onnx_dir, 'best_simplified.onnx')
|
||||
|
||||
# 確保目標資料夾存在
|
||||
os.makedirs(onnx_dir, exist_ok=True)
|
||||
|
||||
# 加載並優化 ONNX 模型
|
||||
m = onnx.load(onnx_path)
|
||||
m = ktc.onnx_optimizer.onnx2onnx_flow(m)
|
||||
opt_onnx_path = os.path.join(onnx_dir, 'latest.opt.onnx')
|
||||
onnx.save(m, opt_onnx_path)
|
||||
|
||||
km = ktc.ModelConfig(20008, "0001", "720", onnx_model=m)
|
||||
eval_result = km.evaluate()
|
||||
print("\nNpu performance evaluation result:\n" + str(eval_result))
|
||||
|
||||
device = torch.device("cuda" if torch.cuda.is_available() else "cpu")
|
||||
|
||||
imgsz_h, imgsz_w = 640, 640
|
||||
|
||||
data_path = "data50"
|
||||
files_found = [f for _, _, files in os.walk(data_path) for f in files if f.lower().endswith((".jpg", ".jpeg", ".png", ".bmp"))]
|
||||
|
||||
if not files_found:
|
||||
raise FileNotFoundError(f"\u274c Error: No images found in {data_path}! Please check your dataset.")
|
||||
|
||||
print(f"\u2705 Found {len(files_found)} images in {data_path}")
|
||||
|
||||
# 獲取 ONNX 模型的輸入名稱
|
||||
input_name = m.graph.input[0].name # 確保 key 與 ONNX input name 一致
|
||||
|
||||
# 存儲預處理後的圖片數據
|
||||
img_list = []
|
||||
|
||||
# 遍歷 data50 並進行預處理
|
||||
for root, _, files in os.walk(data_path):
|
||||
for f in files:
|
||||
fullpath = os.path.join(root, f)
|
||||
|
||||
# 只處理圖片文件
|
||||
if not f.lower().endswith((".jpg", ".jpeg", ".png", ".bmp")):
|
||||
print(f"\u26a0\ufe0f Skipping non-image file: {fullpath}")
|
||||
continue
|
||||
|
||||
# 嘗試處理圖片
|
||||
try:
|
||||
img_data, _ = Yolov5_preprocess(fullpath, device, imgsz_h, imgsz_w)
|
||||
img_data = img_data.cpu().numpy()
|
||||
print(f"\u2705 Processed: {fullpath}")
|
||||
img_list.append(img_data)
|
||||
except Exception as e:
|
||||
print(f"\u274c Failed to process {fullpath}: {e}")
|
||||
|
||||
# 確保 img_list 不是空的
|
||||
if not img_list:
|
||||
raise ValueError("\u274c Error: No valid images were processed! Please check the image paths and formats.")
|
||||
|
||||
# 執行 BIE 量化
|
||||
bie_model_path = km.analysis({input_name: img_list})
|
||||
|
||||
# 確保 BIE 檔案儲存到指定目錄
|
||||
bie_save_path = os.path.join(onnx_dir, os.path.basename(bie_model_path))
|
||||
shutil.copy(bie_model_path, bie_save_path) # 使用 shutil.move 來處理跨磁碟移動
|
||||
|
||||
# 確認 BIE 模型是否生成
|
||||
if not os.path.exists(bie_save_path):
|
||||
raise RuntimeError(f"\u274c Error: BIE model was not generated! Please check your quantization process.")
|
||||
|
||||
print("\n\u2705 Fixed-point analysis done! BIE model saved to:", bie_save_path)
|
||||
|
||||
# 確保 `km` 已經初始化,並且 `.bie` 模型已生成
|
||||
nef_model_path = ktc.compile([km])
|
||||
|
||||
# 確保 nef_model_path 不是 None 或空值
|
||||
if not nef_model_path:
|
||||
raise RuntimeError("❌ Error: ktc.compile() did not return a valid .nef file path!")
|
||||
|
||||
# 確保 NEF 目標資料夾存在
|
||||
os.makedirs(onnx_dir, exist_ok=True)
|
||||
|
||||
# 確保 nef_model_path 不是 None 或空值
|
||||
if not nef_model_path:
|
||||
raise RuntimeError("❌ Error: ktc.compile() did not return a valid .nef file path!")
|
||||
|
||||
# 確保 .nef 檔案存在
|
||||
if not os.path.exists(nef_model_path):
|
||||
raise RuntimeError(f"❌ Error: NEF model was not generated at {nef_model_path}! Please check your compilation process.")
|
||||
|
||||
# 確保 NEF 檔案儲存到指定目錄
|
||||
nef_save_path = os.path.join(onnx_dir, os.path.basename(nef_model_path))
|
||||
if os.path.exists(nef_model_path):
|
||||
shutil.copy(nef_model_path, nef_save_path)
|
||||
else:
|
||||
raise RuntimeError(f"❌ Error: NEF model was expected at {nef_model_path}, but it does not exist!") # 同樣使用 shutil.move
|
||||
|
||||
if not os.path.exists(nef_save_path):
|
||||
raise RuntimeError(f"\u274c Error: NEF model was not generated! Please check your compilation process.")
|
||||
|
||||
print("\n\u2705 Compile done! NEF file saved to:", nef_save_path)
|
||||
110
kneron/onnx2nefSTDC630.py
Normal file
@ -0,0 +1,110 @@
|
||||
import ktc
|
||||
import numpy as np
|
||||
import os
|
||||
import onnx
|
||||
import shutil
|
||||
from PIL import Image
|
||||
import torch
|
||||
from yolov5_preprocess import Yolov5_preprocess
|
||||
import kneron_preprocessing
|
||||
|
||||
# 設定 ONNX 模型儲存路徑
|
||||
onnx_dir = 'work_dirs/kn_stdc1_in1k-pre_512x1024_80k_cityscapes/'
|
||||
onnx_path = os.path.join(onnx_dir, 'latest.onnx')
|
||||
|
||||
# 確保目標資料夾存在
|
||||
os.makedirs(onnx_dir, exist_ok=True)
|
||||
|
||||
# 加載並優化 ONNX 模型
|
||||
m = onnx.load(onnx_path)
|
||||
m = ktc.onnx_optimizer.onnx2onnx_flow(m)
|
||||
opt_onnx_path = os.path.join(onnx_dir, 'latest.opt.onnx')
|
||||
onnx.save(m, opt_onnx_path)
|
||||
|
||||
km = ktc.ModelConfig(20008, "0001", "630", onnx_model=m)
|
||||
eval_result = km.evaluate()
|
||||
print("\nNpu performance evaluation result:\n" + str(eval_result))
|
||||
|
||||
device = torch.device("cuda" if torch.cuda.is_available() else "cpu")
|
||||
|
||||
imgsz_h, imgsz_w = 640, 640
|
||||
|
||||
data_path = "data50"
|
||||
files_found = [f for _, _, files in os.walk(data_path) for f in files if f.lower().endswith((".jpg", ".jpeg", ".png", ".bmp"))]
|
||||
|
||||
if not files_found:
|
||||
raise FileNotFoundError(f"\u274c Error: No images found in {data_path}! Please check your dataset.")
|
||||
|
||||
print(f"\u2705 Found {len(files_found)} images in {data_path}")
|
||||
|
||||
# 獲取 ONNX 模型的輸入名稱
|
||||
input_name = m.graph.input[0].name # 確保 key 與 ONNX input name 一致
|
||||
|
||||
# 存儲預處理後的圖片數據
|
||||
img_list = []
|
||||
|
||||
# 遍歷 data50 並進行預處理
|
||||
for root, _, files in os.walk(data_path):
|
||||
for f in files:
|
||||
fullpath = os.path.join(root, f)
|
||||
|
||||
# 只處理圖片文件
|
||||
if not f.lower().endswith((".jpg", ".jpeg", ".png", ".bmp")):
|
||||
print(f"\u26a0\ufe0f Skipping non-image file: {fullpath}")
|
||||
continue
|
||||
|
||||
# 嘗試處理圖片
|
||||
try:
|
||||
img_data, _ = Yolov5_preprocess(fullpath, device, imgsz_h, imgsz_w)
|
||||
img_data = img_data.cpu().numpy()
|
||||
print(f"\u2705 Processed: {fullpath}")
|
||||
img_list.append(img_data)
|
||||
except Exception as e:
|
||||
print(f"\u274c Failed to process {fullpath}: {e}")
|
||||
|
||||
# 確保 img_list 不是空的
|
||||
if not img_list:
|
||||
raise ValueError("\u274c Error: No valid images were processed! Please check the image paths and formats.")
|
||||
|
||||
# 執行 BIE 量化
|
||||
bie_model_path = km.analysis({input_name: img_list})
|
||||
|
||||
# 確保 BIE 檔案儲存到指定目錄
|
||||
bie_save_path = os.path.join(onnx_dir, os.path.basename(bie_model_path))
|
||||
shutil.copy(bie_model_path, bie_save_path) # 使用 shutil.move 來處理跨磁碟移動
|
||||
|
||||
# 確認 BIE 模型是否生成
|
||||
if not os.path.exists(bie_save_path):
|
||||
raise RuntimeError(f"\u274c Error: BIE model was not generated! Please check your quantization process.")
|
||||
|
||||
print("\n\u2705 Fixed-point analysis done! BIE model saved to:", bie_save_path)
|
||||
|
||||
# 確保 `km` 已經初始化,並且 `.bie` 模型已生成
|
||||
nef_model_path = ktc.compile([km])
|
||||
|
||||
# 確保 nef_model_path 不是 None 或空值
|
||||
if not nef_model_path:
|
||||
raise RuntimeError("❌ Error: ktc.compile() did not return a valid .nef file path!")
|
||||
|
||||
# 確保 NEF 目標資料夾存在
|
||||
os.makedirs(onnx_dir, exist_ok=True)
|
||||
|
||||
# 確保 nef_model_path 不是 None 或空值
|
||||
if not nef_model_path:
|
||||
raise RuntimeError("❌ Error: ktc.compile() did not return a valid .nef file path!")
|
||||
|
||||
# 確保 .nef 檔案存在
|
||||
if not os.path.exists(nef_model_path):
|
||||
raise RuntimeError(f"❌ Error: NEF model was not generated at {nef_model_path}! Please check your compilation process.")
|
||||
|
||||
# 確保 NEF 檔案儲存到指定目錄
|
||||
nef_save_path = os.path.join(onnx_dir, os.path.basename(nef_model_path))
|
||||
if os.path.exists(nef_model_path):
|
||||
shutil.copy(nef_model_path, nef_save_path)
|
||||
else:
|
||||
raise RuntimeError(f"❌ Error: NEF model was expected at {nef_model_path}, but it does not exist!") # 同樣使用 shutil.move
|
||||
|
||||
if not os.path.exists(nef_save_path):
|
||||
raise RuntimeError(f"\u274c Error: NEF model was not generated! Please check your compilation process.")
|
||||
|
||||
print("\n\u2705 Compile done! NEF file saved to:", nef_save_path)
|
||||
684
kneron/preprocessing/API.py
Normal file
@ -0,0 +1,684 @@
|
||||
# -*- coding: utf-8 -*-
|
||||
|
||||
import numpy as np
|
||||
import os
|
||||
from .funcs.utils import str2int, str2bool
|
||||
from . import Flow
|
||||
|
||||
flow = Flow()
|
||||
flow.set_numerical_type('floating')
|
||||
flow_520 = Flow()
|
||||
flow_520.set_numerical_type('520')
|
||||
flow_720 = Flow()
|
||||
flow_720.set_numerical_type('720')
|
||||
|
||||
DEFAULT = None
|
||||
default = {
|
||||
'crop':{
|
||||
'align_w_to_4':False
|
||||
},
|
||||
'resize':{
|
||||
'type':'bilinear',
|
||||
'calculate_ratio_using_CSim':False
|
||||
}
|
||||
}
|
||||
|
||||
def set_default_as_520():
|
||||
"""
|
||||
Set some default parameter as 520 setting
|
||||
|
||||
crop.align_w_to_4 = True
|
||||
crop.pad_square_to_4 = True
|
||||
resize.type = 'fixed_520'
|
||||
resize.calculate_ratio_using_CSim = True
|
||||
"""
|
||||
global default
|
||||
default['crop']['align_w_to_4'] = True
|
||||
default['resize']['type'] = 'fixed_520'
|
||||
default['resize']['calculate_ratio_using_CSim'] = True
|
||||
return
|
||||
|
||||
def set_default_as_floating():
|
||||
"""
|
||||
Set some default parameter as floating setting
|
||||
|
||||
crop.align_w_to_4 = False
|
||||
crop.pad_square_to_4 = False
|
||||
resize.type = 'bilinear'
|
||||
resize.calculate_ratio_using_CSim = False
|
||||
"""
|
||||
global default
|
||||
default['crop']['align_w_to_4'] = False
|
||||
default['resize']['type'] = 'bilinear'
|
||||
default['resize']['calculate_ratio_using_CSim'] = False
|
||||
pass
|
||||
|
||||
def print_info_on():
|
||||
"""
|
||||
turn print infomation on.
|
||||
"""
|
||||
flow.set_print_info(True)
|
||||
flow_520.set_print_info(True)
|
||||
|
||||
def print_info_off():
|
||||
"""
|
||||
turn print infomation off.
|
||||
"""
|
||||
flow.set_print_info(False)
|
||||
flow_520.set_print_info(False)
|
||||
|
||||
def load_image(image):
|
||||
"""
|
||||
load_image function
|
||||
load load_image and output as rgb888 format np.array
|
||||
|
||||
Args:
|
||||
image: [np.array/str], can be np.array or image file path
|
||||
|
||||
Returns:
|
||||
out: [np.array], rgb888 format
|
||||
|
||||
Examples:
|
||||
"""
|
||||
image = flow.load_image(image, is_raw = False)
|
||||
return image
|
||||
|
||||
def load_bin(image, fmt=None, size=None):
|
||||
"""
|
||||
load_bin function
|
||||
load bin file and output as rgb888 format np.array
|
||||
|
||||
Args:
|
||||
image: [str], bin file path
|
||||
fmt: [str], "rgb888" / "rgb565" / "nir"
|
||||
size: [tuble], (image_w, image_h)
|
||||
|
||||
Returns:
|
||||
out: [np.array], rgb888 format
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.load_bin(image,'rgb565',(raw_w,raw_h))
|
||||
"""
|
||||
assert isinstance(size, tuple)
|
||||
assert isinstance(fmt, str)
|
||||
# assert (fmt.lower() in ['rgb888', "rgb565" , "nir",'RGB888', "RGB565" , "NIR", 'NIR888', 'nir888'])
|
||||
|
||||
image = flow.load_image(image, is_raw = True, raw_img_type='bin', raw_img_fmt = fmt, img_in_width = size[0], img_in_height = size[1])
|
||||
flow.set_color_conversion(source_format=fmt, out_format = 'rgb888')
|
||||
image,_ = flow.funcs['color'](image)
|
||||
return image
|
||||
|
||||
def load_hex(file, fmt=None, size=None):
|
||||
"""
|
||||
load_hex function
|
||||
load hex file and output as rgb888 format np.array
|
||||
|
||||
Args:
|
||||
image: [str], hex file path
|
||||
fmt: [str], "rgb888" / "yuv444" / "ycbcr444" / "yuv422" / "ycbcr422" / "rgb565"
|
||||
size: [tuble], (image_w, image_h)
|
||||
|
||||
Returns:
|
||||
out: [np.array], rgb888 format
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.load_hex(image,'rgb565',(raw_w,raw_h))
|
||||
"""
|
||||
assert isinstance(size, tuple)
|
||||
assert isinstance(fmt, str)
|
||||
assert (fmt.lower() in ['rgb888',"yuv444" , "ycbcr444" , "yuv422" , "ycbcr422" , "rgb565"])
|
||||
|
||||
image = flow.load_image(file, is_raw = True, raw_img_type='hex', raw_img_fmt = fmt, img_in_width = size[0], img_in_height = size[1])
|
||||
flow.set_color_conversion(source_format=fmt, out_format = 'rgb888')
|
||||
image,_ = flow.funcs['color'](image)
|
||||
return image
|
||||
|
||||
def dump_image(image, output=None, file_fmt='txt',image_fmt='rgb888',order=0):
|
||||
"""
|
||||
dump_image function
|
||||
|
||||
dump txt, bin or hex, default is txt
|
||||
image format as following format: RGB888, RGBA8888, RGB565, NIR, YUV444, YCbCr444, YUV422, YCbCr422, default is RGB888
|
||||
|
||||
Args:
|
||||
image: [np.array/str], can be np.array or image file path
|
||||
output: [str], dump file path
|
||||
file_fmt: [str], "bin" / "txt" / "hex", set dump file format, default is txt
|
||||
image_fmt: [str], RGB888 / RGBA8888 / RGB565 / NIR / YUV444 / YCbCr444 / YUV422 / YCbCr422, default is RGB888
|
||||
|
||||
Examples:
|
||||
>>> kneron_preprocessing.API.dump_image(image_data,out_path,fmt='bin')
|
||||
"""
|
||||
if isinstance(image, str):
|
||||
image = load_image(image)
|
||||
|
||||
assert isinstance(image, np.ndarray)
|
||||
if output is None:
|
||||
return
|
||||
|
||||
flow.set_output_setting(is_dump=False, dump_format=file_fmt, image_format=image_fmt ,output_file=output)
|
||||
flow.dump_image(image)
|
||||
return
|
||||
|
||||
def convert(image, out_fmt = 'RGB888', source_fmt = 'RGB888'):
|
||||
"""
|
||||
color convert
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
out_fmt: [str], "rgb888" / "rgba8888" / "rgb565" / "yuv" / "ycbcr" / "yuv422" / "ycbcr422"
|
||||
source_fmt: [str], "rgb888" / "rgba8888" / "rgb565" / "yuv" / "ycbcr" / "yuv422" / "ycbcr422"
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
|
||||
"""
|
||||
flow.set_color_conversion(source_format = source_fmt, out_format=out_fmt, simulation=False)
|
||||
image,_ = flow.funcs['color'](image)
|
||||
return image
|
||||
|
||||
def get_crop_range(box,align_w_to_4=DEFAULT, pad_square_to_4=False,rounding_type=0):
|
||||
"""
|
||||
get exact crop box according different setting
|
||||
|
||||
Args:
|
||||
box: [tuble], (x1, y1, x2, y2)
|
||||
align_w_to_4: [bool], crop length in w direction align to 4 or not, default False
|
||||
pad_square_to_4: [bool], pad to square(align 4) or not, default False
|
||||
rounding_type: [int], 0-> x1,y1 take floor, x2,y2 take ceil; 1->all take rounding
|
||||
|
||||
Returns:
|
||||
out: [tuble,4], (crop_x1, crop_y1, crop_x2, crop_y2)
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.get_crop_range((272,145,461,341), align_w_to_4=True, pad_square_to_4=True)
|
||||
(272, 145, 460, 341)
|
||||
"""
|
||||
if box is None:
|
||||
return (0,0,0,0)
|
||||
if align_w_to_4 is None:
|
||||
align_w_to_4 = default['crop']['align_w_to_4']
|
||||
|
||||
flow.set_crop(type='specific', start_x=box[0],start_y=box[1],end_x=box[2],end_y=box[3], align_w_to_4=align_w_to_4, pad_square_to_4=pad_square_to_4,rounding_type=rounding_type)
|
||||
image = np.zeros((1,1,3)).astype('uint8')
|
||||
_,info = flow.funcs['crop'](image)
|
||||
|
||||
return info['box']
|
||||
|
||||
def crop(image, box=None, align_w_to_4=DEFAULT, pad_square_to_4=False,rounding_type=0 ,info_out = {}):
|
||||
"""
|
||||
crop function
|
||||
|
||||
specific crop range by box
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
box: [tuble], (x1, y1, x2, y2)
|
||||
align_w_to_4: [bool], crop length in w direction align to 4 or not, default False
|
||||
pad_square_to_4: [bool], pad to square(align 4) or not, default False
|
||||
rounding_type: [int], 0-> x1,y1 take floor, x2,y2 take ceil; 1->all take rounding
|
||||
info_out: [dic], save the final crop box into info_out['box']
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> info = {}
|
||||
>>> image_data = kneron_preprocessing.API.crop(image_data,(272,145,461,341), align_w_to_4=True, info_out=info)
|
||||
>>> info['box']
|
||||
(272, 145, 460, 341)
|
||||
|
||||
>>> info = {}
|
||||
>>> image_data = kneron_preprocessing.API.crop(image_data,(272,145,461,341), pad_square_to_4=True, info_out=info)
|
||||
>>> info['box']
|
||||
(268, 145, 464, 341)
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
if box is None:
|
||||
return image
|
||||
if align_w_to_4 is None:
|
||||
align_w_to_4 = default['crop']['align_w_to_4']
|
||||
|
||||
flow.set_crop(type='specific', start_x=box[0],start_y=box[1],end_x=box[2],end_y=box[3], align_w_to_4=align_w_to_4, pad_square_to_4=pad_square_to_4,rounding_type=rounding_type)
|
||||
image,info = flow.funcs['crop'](image)
|
||||
|
||||
info_out['box'] = info['box']
|
||||
return image
|
||||
|
||||
def crop_center(image, range=None, align_w_to_4=DEFAULT, pad_square_to_4=False,rounding_type=0 ,info_out = {}):
|
||||
"""
|
||||
crop function
|
||||
|
||||
center crop by range
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
range: [tuble], (crop_w, crop_h)
|
||||
align_w_to_4: [bool], crop length in w direction align to 4 or not, default False
|
||||
pad_square_to_4: [bool], pad to square(align 4) or not, default False
|
||||
rounding_type: [int], 0-> x1,y1 take floor, x2,y2 take ceil; 1->all take rounding
|
||||
info_out: [dic], save the final crop box into info_out['box']
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> info = {}
|
||||
>>> image_data = kneron_preprocessing.API.crop_center(image_data,(102,40), align_w_to_4=True,info_out=info)
|
||||
>>> info['box']
|
||||
(268, 220, 372, 260)
|
||||
|
||||
>>> info = {}
|
||||
>>> image_data = kneron_preprocessing.API.crop_center(image_data,(102,40), pad_square_to_4=True, info_out=info)
|
||||
>>> info['box']
|
||||
(269, 192, 371, 294)
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
if range is None:
|
||||
return image
|
||||
if align_w_to_4 is None:
|
||||
align_w_to_4 = default['crop']['align_w_to_4']
|
||||
|
||||
flow.set_crop(type='center', crop_w=range[0],crop_h=range[1], align_w_to_4=align_w_to_4, pad_square_to_4=pad_square_to_4,rounding_type=rounding_type)
|
||||
image,info = flow.funcs['crop'](image)
|
||||
|
||||
info_out['box'] = info['box']
|
||||
return image
|
||||
|
||||
def crop_corner(image, range=None, align_w_to_4=DEFAULT,pad_square_to_4=False,rounding_type=0 ,info_out = {}):
|
||||
"""
|
||||
crop function
|
||||
|
||||
corner crop by range
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
range: [tuble], (crop_w, crop_h)
|
||||
align_w_to_4: [bool], crop length in w direction align to 4 or not, default False
|
||||
pad_square_to_4: [bool], pad to square(align 4) or not, default False
|
||||
rounding_type: [int], 0-> x1,y1 take floor, x2,y2 take ceil; 1->all take rounding
|
||||
info_out: [dic], save the final crop box into info_out['box']
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> info = {}
|
||||
>>> image_data = kneron_preprocessing.API.crop_corner(image_data,(102,40), align_w_to_4=True,info_out=info)
|
||||
>>> info['box']
|
||||
(0, 0, 104, 40)
|
||||
|
||||
>>> info = {}
|
||||
>>> image_data = kneron_preprocessing.API.crop_corner(image_data,(102,40), pad_square_to_4=True,info_out=info)
|
||||
>>> info['box']
|
||||
(0, -28, 102, 74)
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
if range is None:
|
||||
return image
|
||||
if align_w_to_4 is None:
|
||||
align_w_to_4 = default['crop']['align_w_to_4']
|
||||
|
||||
flow.set_crop(type='corner', crop_w=range[0],crop_h=range[1], align_w_to_4=align_w_to_4, pad_square_to_4=pad_square_to_4)
|
||||
image, info = flow.funcs['crop'](image)
|
||||
|
||||
info_out['box'] = info['box']
|
||||
return image
|
||||
|
||||
def resize(image, size=None, keep_ratio = True, zoom = True, type=DEFAULT, calculate_ratio_using_CSim = DEFAULT, info_out = {}):
|
||||
"""
|
||||
resize function
|
||||
|
||||
resize type can be bilinear or bilicubic as floating type, fixed or fixed_520/fixed_720 as fixed type.
|
||||
fixed_520/fixed_720 type has add some function to simulate 520/720 bug.
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
size: [tuble], (input_w, input_h)
|
||||
keep_ratio: [bool], keep_ratio or not, default True
|
||||
zoom: [bool], enable resize can zoom image or not, default True
|
||||
type: [str], "bilinear" / "bilicubic" / "cv2" / "fixed" / "fixed_520" / "fixed_720"
|
||||
calculate_ratio_using_CSim: [bool], calculate the ratio and scale using Csim function and C float, default False
|
||||
info_out: [dic], save the final scale size(w,h) into info_out['size']
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> info = {}
|
||||
>>> image_data = kneron_preprocessing.API.resize(image_data,size=(56,56),type='fixed',info_out=info)
|
||||
>>> info_out['size']
|
||||
(54,56)
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
if size is None:
|
||||
return image
|
||||
if type is None:
|
||||
type = default['resize']['type']
|
||||
if calculate_ratio_using_CSim is None:
|
||||
calculate_ratio_using_CSim = default['resize']['calculate_ratio_using_CSim']
|
||||
|
||||
flow.set_resize(resize_w = size[0], resize_h = size[1], type=type, keep_ratio=keep_ratio,zoom=zoom, calculate_ratio_using_CSim=calculate_ratio_using_CSim)
|
||||
image, info = flow.funcs['resize'](image)
|
||||
info_out['size'] = info['size']
|
||||
|
||||
return image
|
||||
|
||||
def pad(image, pad_l=0, pad_r=0, pad_t=0, pad_b=0, pad_val=0):
|
||||
"""
|
||||
pad function
|
||||
|
||||
specific left, right, top and bottom pad size.
|
||||
|
||||
Args:
|
||||
image[np.array]: input
|
||||
pad_l: [int], pad size from left, default 0
|
||||
pad_r: [int], pad size form right, default 0
|
||||
pad_t: [int], pad size from top, default 0
|
||||
pad_b: [int], pad size form bottom, default 0
|
||||
pad_val: [float], the value of pad, , default 0
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.pad(image_data,20,40,20,40,-0.5)
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
|
||||
flow.set_padding(type='specific',pad_l=pad_l,pad_r=pad_r,pad_t=pad_t,pad_b=pad_b,pad_val=pad_val)
|
||||
image, _ = flow.funcs['padding'](image)
|
||||
return image
|
||||
|
||||
def pad_center(image,size=None, pad_val=0):
|
||||
"""
|
||||
pad function
|
||||
|
||||
center pad with pad size.
|
||||
|
||||
Args:
|
||||
image[np.array]: input
|
||||
size: [tuble], (padded_size_w, padded_size_h)
|
||||
pad_val: [float], the value of pad, , default 0
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.pad_center(image_data,size=(56,56),pad_val=-0.5)
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
if size is None:
|
||||
return image
|
||||
assert ( (image.shape[0] <= size[1]) & (image.shape[1] <= size[0]) )
|
||||
|
||||
flow.set_padding(type='center',padded_w=size[0],padded_h=size[1],pad_val=pad_val)
|
||||
image, _ = flow.funcs['padding'](image)
|
||||
return image
|
||||
|
||||
def pad_corner(image,size=None, pad_val=0):
|
||||
"""
|
||||
pad function
|
||||
|
||||
corner pad with pad size.
|
||||
|
||||
Args:
|
||||
image[np.array]: input
|
||||
size: [tuble], (padded_size_w, padded_size_h)
|
||||
pad_val: [float], the value of pad, , default 0
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.pad_corner(image_data,size=(56,56),pad_val=-0.5)
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
if size is None:
|
||||
return image
|
||||
assert ( (image.shape[0] <= size[1]) & (image.shape[1] <= size[0]) )
|
||||
|
||||
flow.set_padding(type='corner',padded_w=size[0],padded_h=size[1],pad_val=pad_val)
|
||||
image, _ = flow.funcs['padding'](image)
|
||||
return image
|
||||
|
||||
def norm(image,scale=256.,bias=-0.5, mean=None, std=None):
|
||||
"""
|
||||
norm function
|
||||
|
||||
x = (x/scale - bias)
|
||||
x[0,1,2] = x - mean[0,1,2]
|
||||
x[0,1,2] = x / std[0,1,2]
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
scale: [float], default = 256
|
||||
bias: [float], default = -0.5
|
||||
mean: [tuble,3], default = None
|
||||
std: [tuble,3], default = None
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.norm(image_data)
|
||||
>>> image_data = kneron_preprocessing.API.norm(image_data,mean=[0.485, 0.456, 0.406], std=[0.229, 0.224, 0.225])
|
||||
"""
|
||||
assert isinstance(image, np.ndarray)
|
||||
|
||||
flow.set_normalize(type='specific',scale=scale, bias=bias, mean=mean, std =std)
|
||||
image, _ = flow.funcs['normalize'](image)
|
||||
return image
|
||||
|
||||
def inproc_520(image,raw_fmt='rgb565',raw_size=None,npu_size=None, crop_box=None, pad_mode=0, norm='kneron', gray=False, rotate=0, radix=8, bit_width=8, round_w_to_16=True, NUM_BANK_LINE=32,BANK_ENTRY_CNT=512,MAX_IMG_PREPROC_ROW_NUM=511,MAX_IMG_PREPROC_COL_NUM=256):
|
||||
"""
|
||||
inproc_520
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
crop_box: [tuble], (x1, y1, x2, y2), if None will skip crop
|
||||
pad_mode: [int], 0: pad 2 sides, 1: pad 1 side, 2: no pad. default = 0
|
||||
norm: [str], default = 'kneron'
|
||||
rotate: [int], 0 / 1 / 2 ,default = 0
|
||||
radix: [int], default = 8
|
||||
bit_width: [int], default = 8
|
||||
round_w_to_16: [bool], default = True
|
||||
gray: [bool], default = False
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.inproc_520(image_data,npu_size=(56,56),crop_box=(272,145,460,341),pad_mode=1)
|
||||
"""
|
||||
# assert isinstance(image, np.ndarray)
|
||||
|
||||
if (not isinstance(image, np.ndarray)):
|
||||
flow_520.set_raw_img(is_raw_img='yes',raw_img_type = 'bin',raw_img_fmt=raw_fmt, img_in_width=raw_size[0], img_in_height=raw_size[1])
|
||||
else:
|
||||
flow_520.set_raw_img(is_raw_img='no')
|
||||
flow_520.set_color_conversion(source_format='rgb888')
|
||||
|
||||
if npu_size is None:
|
||||
return image
|
||||
|
||||
flow_520.set_model_size(w=npu_size[0],h=npu_size[1])
|
||||
|
||||
## Crop
|
||||
if crop_box != None:
|
||||
flow_520.set_crop(start_x=crop_box[0],start_y=crop_box[1],end_x=crop_box[2],end_y=crop_box[3])
|
||||
crop_fisrt = True
|
||||
else:
|
||||
crop_fisrt = False
|
||||
|
||||
## Color
|
||||
if gray:
|
||||
flow_520.set_color_conversion(out_format='l',simulation='no')
|
||||
else:
|
||||
flow_520.set_color_conversion(out_format='rgb888',simulation='no')
|
||||
|
||||
## Resize & Pad
|
||||
pad_mode = str2int(pad_mode)
|
||||
if (pad_mode == 0):
|
||||
pad_type = 'center'
|
||||
resize_keep_ratio = 'yes'
|
||||
elif (pad_mode == 1):
|
||||
pad_type = 'corner'
|
||||
resize_keep_ratio = 'yes'
|
||||
else:
|
||||
pad_type = 'center'
|
||||
resize_keep_ratio = 'no'
|
||||
|
||||
flow_520.set_resize(keep_ratio=resize_keep_ratio)
|
||||
flow_520.set_padding(type=pad_type)
|
||||
|
||||
## Norm
|
||||
flow_520.set_normalize(type=norm)
|
||||
|
||||
## 520 inproc
|
||||
flow_520.set_520_setting(radix=radix,bit_width=bit_width,rotate=rotate,crop_fisrt=crop_fisrt,round_w_to_16=round_w_to_16,NUM_BANK_LINE=NUM_BANK_LINE,BANK_ENTRY_CNT=BANK_ENTRY_CNT,MAX_IMG_PREPROC_ROW_NUM=MAX_IMG_PREPROC_ROW_NUM,MAX_IMG_PREPROC_COL_NUM=MAX_IMG_PREPROC_COL_NUM)
|
||||
image_data, _ = flow_520.run_whole_process(image)
|
||||
|
||||
return image_data
|
||||
|
||||
def inproc_720(image,raw_fmt='rgb565',raw_size=None,npu_size=None, crop_box=None, pad_mode=0, norm='kneron', gray=False):
|
||||
"""
|
||||
inproc_720
|
||||
|
||||
Args:
|
||||
image: [np.array], input
|
||||
crop_box: [tuble], (x1, y1, x2, y2), if None will skip crop
|
||||
pad_mode: [int], 0: pad 2 sides, 1: pad 1 side, 2: no pad. default = 0
|
||||
norm: [str], default = 'kneron'
|
||||
rotate: [int], 0 / 1 / 2 ,default = 0
|
||||
radix: [int], default = 8
|
||||
bit_width: [int], default = 8
|
||||
round_w_to_16: [bool], default = True
|
||||
gray: [bool], default = False
|
||||
|
||||
Returns:
|
||||
out: [np.array]
|
||||
|
||||
Examples:
|
||||
>>> image_data = kneron_preprocessing.API.inproc_520(image_data,npu_size=(56,56),crop_box=(272,145,460,341),pad_mode=1)
|
||||
"""
|
||||
# assert isinstance(image, np.ndarray)
|
||||
|
||||
if (not isinstance(image, np.ndarray)):
|
||||
flow_720.set_raw_img(is_raw_img='yes',raw_img_type = 'bin',raw_img_fmt=raw_fmt, img_in_width=raw_size[0], img_in_height=raw_size[1])
|
||||
else:
|
||||
flow_720.set_raw_img(is_raw_img='no')
|
||||
flow_720.set_color_conversion(source_format='rgb888')
|
||||
|
||||
if npu_size is None:
|
||||
return image
|
||||
|
||||
flow_720.set_model_size(w=npu_size[0],h=npu_size[1])
|
||||
|
||||
## Crop
|
||||
if crop_box != None:
|
||||
flow_720.set_crop(start_x=crop_box[0],start_y=crop_box[1],end_x=crop_box[2],end_y=crop_box[3])
|
||||
crop_fisrt = True
|
||||
else:
|
||||
crop_fisrt = False
|
||||
|
||||
## Color
|
||||
if gray:
|
||||
flow_720.set_color_conversion(out_format='l',simulation='no')
|
||||
else:
|
||||
flow_720.set_color_conversion(out_format='rgb888',simulation='no')
|
||||
|
||||
## Resize & Pad
|
||||
pad_mode = str2int(pad_mode)
|
||||
if (pad_mode == 0):
|
||||
pad_type = 'center'
|
||||
resize_keep_ratio = 'yes'
|
||||
elif (pad_mode == 1):
|
||||
pad_type = 'corner'
|
||||
resize_keep_ratio = 'yes'
|
||||
else:
|
||||
pad_type = 'center'
|
||||
resize_keep_ratio = 'no'
|
||||
|
||||
flow_720.set_resize(keep_ratio=resize_keep_ratio)
|
||||
flow_720.set_padding(type=pad_type)
|
||||
|
||||
## 720 inproc
|
||||
# flow_720.set_720_setting(radix=radix,bit_width=bit_width,rotate=rotate,crop_fisrt=crop_fisrt,round_w_to_16=round_w_to_16,NUM_BANK_LINE=NUM_BANK_LINE,BANK_ENTRY_CNT=BANK_ENTRY_CNT,MAX_IMG_PREPROC_ROW_NUM=MAX_IMG_PREPROC_ROW_NUM,MAX_IMG_PREPROC_COL_NUM=MAX_IMG_PREPROC_COL_NUM)
|
||||
image_data, _ = flow_720.run_whole_process(image)
|
||||
|
||||
return image_data
|
||||
|
||||
def bit_match(data1, data2):
|
||||
"""
|
||||
bit_match function
|
||||
|
||||
check data1 is equal to data2 or not.
|
||||
|
||||
Args:
|
||||
data1: [np.array / str], can be array or txt/bin file
|
||||
data2: [np.array / str], can be array or txt/bin file
|
||||
|
||||
Returns:
|
||||
out1: [bool], is match or not
|
||||
out2: [np.array], if not match, save the position for mismatched data
|
||||
|
||||
Examples:
|
||||
>>> result, mismatched = kneron_preprocessing.API.bit_match(data1,data2)
|
||||
"""
|
||||
if isinstance(data1, str):
|
||||
if os.path.splitext(data1)[1] == '.bin':
|
||||
data1 = np.fromfile(data1, dtype='uint8')
|
||||
elif os.path.splitext(data1)[1] == '.txt':
|
||||
data1 = np.loadtxt(data1)
|
||||
|
||||
assert isinstance(data1, np.ndarray)
|
||||
|
||||
if isinstance(data2, str):
|
||||
if os.path.splitext(data2)[1] == '.bin':
|
||||
data2 = np.fromfile(data2, dtype='uint8')
|
||||
elif os.path.splitext(data2)[1] == '.txt':
|
||||
data2 = np.loadtxt(data2)
|
||||
|
||||
assert isinstance(data2, np.ndarray)
|
||||
|
||||
|
||||
data1 = data1.reshape((-1,1))
|
||||
data2 = data2.reshape((-1,1))
|
||||
|
||||
if not(len(data1) == len(data2)):
|
||||
print('error len')
|
||||
return False, np.zeros((1))
|
||||
else:
|
||||
ans = data2 - data1
|
||||
if len(np.where(ans>0)[0]) > 0:
|
||||
print('error',np.where(ans>0)[0])
|
||||
return False, np.where(ans>0)[0]
|
||||
else:
|
||||
print('pass')
|
||||
return True, np.zeros((1))
|
||||
|
||||
def cpr_to_crp(x_start, x_end, y_start, y_end, pad_l, pad_r, pad_t, pad_b, rx_start, rx_end, ry_start, ry_end):
|
||||
"""
|
||||
calculate the parameters of crop->pad->resize flow to HW crop->resize->padding flow
|
||||
|
||||
Args:
|
||||
|
||||
Returns:
|
||||
|
||||
Examples:
|
||||
|
||||
"""
|
||||
pad_l = round(pad_l * (rx_end-rx_start) / (x_end - x_start + pad_l + pad_r))
|
||||
pad_r = round(pad_r * (rx_end-rx_start) / (x_end - x_start + pad_l + pad_r))
|
||||
pad_t = round(pad_t * (ry_end-ry_start) / (y_end - y_start + pad_t + pad_b))
|
||||
pad_b = round(pad_b * (ry_end-ry_start) / (y_end - y_start + pad_t + pad_b))
|
||||
|
||||
rx_start +=pad_l
|
||||
rx_end -=pad_r
|
||||
ry_start +=pad_t
|
||||
ry_end -=pad_b
|
||||
|
||||
return x_start, x_end, y_start, y_end, pad_l, pad_r, pad_t, pad_b, rx_start, rx_end, ry_start, ry_end
|
||||
172
kneron/preprocessing/Cflow.py
Normal file
@ -0,0 +1,172 @@
|
||||
import numpy as np
|
||||
import argparse
|
||||
import kneron_preprocessing
|
||||
|
||||
def main_(args):
|
||||
image = args.input_file
|
||||
filefmt = args.file_fmt
|
||||
if filefmt == 'bin':
|
||||
raw_format = args.raw_format
|
||||
raw_w = args.input_width
|
||||
raw_h = args.input_height
|
||||
|
||||
image_data = kneron_preprocessing.API.load_bin(image,raw_format,(raw_w,raw_h))
|
||||
else:
|
||||
image_data = kneron_preprocessing.API.load_image(image)
|
||||
|
||||
|
||||
npu_w = args.width
|
||||
npu_h = args.height
|
||||
|
||||
crop_first = True if args.crop_first == "True" else False
|
||||
if crop_first:
|
||||
x1 = args.x_pos
|
||||
y1 = args.y_pos
|
||||
x2 = args.crop_w + x1
|
||||
y2 = args.crop_h + y1
|
||||
crop_box = [x1,y1,x2,y2]
|
||||
else:
|
||||
crop_box = None
|
||||
|
||||
pad_mode = args.pad_mode
|
||||
norm_mode = args.norm_mode
|
||||
bitwidth = args.bitwidth
|
||||
radix = args.radix
|
||||
rotate = args.rotate_mode
|
||||
|
||||
##
|
||||
image_data = kneron_preprocessing.API.inproc_520(image_data,npu_size=(npu_w,npu_h),crop_box=crop_box,pad_mode=pad_mode,norm=norm_mode,rotate=rotate,radix=radix,bit_width=bitwidth)
|
||||
|
||||
output_file = args.output_file
|
||||
kneron_preprocessing.API.dump_image(image_data,output_file,'bin','rgba')
|
||||
|
||||
return
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
argparser = argparse.ArgumentParser(
|
||||
description="preprocessing"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-i',
|
||||
'--input_file',
|
||||
help="input file name"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-ff',
|
||||
'--file_fmt',
|
||||
help="input file format, jpg or bin"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-rf',
|
||||
'--raw_format',
|
||||
help="input file image format, rgb or rgb565 or nir"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-i_w',
|
||||
'--input_width',
|
||||
type=int,
|
||||
help="input image width"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-i_h',
|
||||
'--input_height',
|
||||
type=int,
|
||||
help="input image height"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-o',
|
||||
'--output_file',
|
||||
help="output file name"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-s_w',
|
||||
'--width',
|
||||
type=int,
|
||||
help="output width for npu input",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-s_h',
|
||||
'--height',
|
||||
type=int,
|
||||
help="output height for npu input",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-c_f',
|
||||
'--crop_first',
|
||||
help="crop first True or False",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-x',
|
||||
'--x_pos',
|
||||
type=int,
|
||||
help="left up coordinate x",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-y',
|
||||
'--y_pos',
|
||||
type=int,
|
||||
help="left up coordinate y",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-c_w',
|
||||
'--crop_w',
|
||||
type=int,
|
||||
help="crop width",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-c_h',
|
||||
'--crop_h',
|
||||
type=int,
|
||||
help="crop height",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-p_m',
|
||||
'--pad_mode',
|
||||
type=int,
|
||||
help=" 0: pad 2 sides, 1: pad 1 side, 2: no pad.",
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-n_m',
|
||||
'--norm_mode',
|
||||
help="normalizaton mode: yolo, kneron, tf."
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-r_m',
|
||||
'--rotate_mode',
|
||||
type=int,
|
||||
help="rotate mode:0,1,2"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-bw',
|
||||
'--bitwidth',
|
||||
type=int,
|
||||
help="Int for bitwidth"
|
||||
)
|
||||
|
||||
argparser.add_argument(
|
||||
'-r',
|
||||
'--radix',
|
||||
type=int,
|
||||
help="Int for radix"
|
||||
)
|
||||
|
||||
args = argparser.parse_args()
|
||||
main_(args)
|
||||
1226
kneron/preprocessing/Flow.py
Normal file
2
kneron/preprocessing/__init__.py
Normal file
@ -0,0 +1,2 @@
|
||||
from .Flow import *
|
||||
from .API import *
|
||||
285
kneron/preprocessing/funcs/ColorConversion.py
Normal file
@ -0,0 +1,285 @@
|
||||
import numpy as np
|
||||
from PIL import Image
|
||||
from .utils import signed_rounding, clip, str2bool
|
||||
|
||||
format_bit = 10
|
||||
c00_yuv = 1
|
||||
c02_yuv = 1436
|
||||
c10_yuv = 1
|
||||
c11_yuv = -354
|
||||
c12_yuv = -732
|
||||
c20_yuv = 1
|
||||
c21_yuv = 1814
|
||||
c00_ycbcr = 1192
|
||||
c02_ycbcr = 1634
|
||||
c10_ycbcr = 1192
|
||||
c11_ycbcr = -401
|
||||
c12_ycbcr = -833
|
||||
c20_ycbcr = 1192
|
||||
c21_ycbcr = 2065
|
||||
|
||||
Matrix_ycbcr_to_rgb888 = np.array(
|
||||
[[1.16438356e+00, 1.16438356e+00, 1.16438356e+00],
|
||||
[2.99747219e-07, - 3.91762529e-01, 2.01723263e+00],
|
||||
[1.59602686e+00, - 8.12968294e-01, 3.04059479e-06]])
|
||||
|
||||
Matrix_rgb888_to_ycbcr = np.array(
|
||||
[[0.25678824, - 0.14822353, 0.43921569],
|
||||
[0.50412941, - 0.29099216, - 0.36778824],
|
||||
[0.09790588, 0.43921569, - 0.07142745]])
|
||||
|
||||
Matrix_rgb888_to_yuv = np.array(
|
||||
[[ 0.29899106, -0.16877996, 0.49988381],
|
||||
[ 0.5865453, -0.33110385, -0.41826072],
|
||||
[ 0.11446364, 0.49988381, -0.08162309]])
|
||||
|
||||
# Matrix_rgb888_to_yuv = np.array(
|
||||
# [[0.299, - 0.147, 0.615],
|
||||
# [0.587, - 0.289, - 0.515],
|
||||
# [0.114, 0.436, - 0.100]])
|
||||
|
||||
# Matrix_yuv_to_rgb888 = np.array(
|
||||
# [[1.000, 1.000, 1.000],
|
||||
# [0.000, - 0.394, 2.032],
|
||||
# [1.140, - 0.581, 0.000]])
|
||||
|
||||
class runner(object):
|
||||
def __init__(self):
|
||||
self.set = {
|
||||
'print_info':'no',
|
||||
'model_size':[0,0],
|
||||
'numerical_type':'floating',
|
||||
"source_format": "rgb888",
|
||||
"out_format": "rgb888",
|
||||
"options": {
|
||||
"simulation": "no",
|
||||
"simulation_format": "rgb888"
|
||||
}
|
||||
}
|
||||
|
||||
def update(self, **kwargs):
|
||||
#
|
||||
self.set.update(kwargs)
|
||||
|
||||
## simulation
|
||||
self.funs = []
|
||||
if str2bool(self.set['options']['simulation']) and self.set['source_format'].lower() in ['RGB888', 'rgb888', 'RGB', 'rgb']:
|
||||
if self.set['options']['simulation_format'].lower() in ['YUV422', 'yuv422', 'YUV', 'yuv']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_YUV422)
|
||||
self.set['source_format'] = 'YUV422'
|
||||
elif self.set['options']['simulation_format'].lower() in ['YCBCR422', 'YCbCr422', 'ycbcr422', 'YCBCR', 'YCbCr', 'ycbcr']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_YCbCr422)
|
||||
self.set['source_format'] = 'YCbCr422'
|
||||
elif self.set['options']['simulation_format'].lower() in['RGB565', 'rgb565']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_RGB565)
|
||||
self.set['source_format'] = 'RGB565'
|
||||
|
||||
## to rgb888
|
||||
if self.set['source_format'].lower() in ['YUV444', 'yuv444','YUV422', 'yuv422', 'YUV', 'yuv']:
|
||||
self.funs.append(self._ColorConversion_YUV_to_RGB888)
|
||||
elif self.set['source_format'].lower() in ['YCBCR444', 'YCbCr444', 'ycbcr444','YCBCR422', 'YCbCr422', 'ycbcr422', 'YCBCR', 'YCbCr', 'ycbcr']:
|
||||
self.funs.append(self._ColorConversion_YCbCr_to_RGB888)
|
||||
elif self.set['source_format'].lower() in ['RGB565', 'rgb565']:
|
||||
self.funs.append(self._ColorConversion_RGB565_to_RGB888)
|
||||
elif self.set['source_format'].lower() in ['l', 'L' , 'nir', 'NIR']:
|
||||
self.funs.append(self._ColorConversion_L_to_RGB888)
|
||||
elif self.set['source_format'].lower() in ['RGBA8888', 'rgba8888' , 'RGBA', 'rgba']:
|
||||
self.funs.append(self._ColorConversion_RGBA8888_to_RGB888)
|
||||
|
||||
## output format
|
||||
if self.set['out_format'].lower() in ['L', 'l']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_L)
|
||||
elif self.set['out_format'].lower() in['RGB565', 'rgb565']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_RGB565)
|
||||
elif self.set['out_format'].lower() in['RGBA', 'RGBA8888','rgba','rgba8888']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_RGBA8888)
|
||||
elif self.set['out_format'].lower() in['YUV', 'YUV444','yuv','yuv444']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_YUV444)
|
||||
elif self.set['out_format'].lower() in['YUV422','yuv422']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_YUV422)
|
||||
elif self.set['out_format'].lower() in['YCBCR', 'YCBCR444','YCbCr','YCbCr444','ycbcr','ycbcr444']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_YCbCr444)
|
||||
elif self.set['out_format'].lower() in['YCBCR422','YCbCr422','ycbcr422']:
|
||||
self.funs.append(self._ColorConversion_RGB888_to_YCbCr422)
|
||||
|
||||
def print_info(self):
|
||||
print("<colorConversion>",
|
||||
"source_format:", self.set['source_format'],
|
||||
', out_format:', self.set['out_format'],
|
||||
', simulation:', self.set['options']['simulation'],
|
||||
', simulation_format:', self.set['options']['simulation_format'])
|
||||
|
||||
def run(self, image_data):
|
||||
assert isinstance(image_data, np.ndarray)
|
||||
# print info
|
||||
if str2bool(self.set['print_info']):
|
||||
self.print_info()
|
||||
|
||||
# color
|
||||
for _, f in enumerate(self.funs):
|
||||
image_data = f(image_data)
|
||||
|
||||
# output
|
||||
info = {}
|
||||
return image_data, info
|
||||
|
||||
def _ColorConversion_RGB888_to_YUV444(self, image):
|
||||
## floating
|
||||
image = image.astype('float')
|
||||
image = (image @ Matrix_rgb888_to_yuv + 0.5).astype('uint8')
|
||||
return image
|
||||
|
||||
def _ColorConversion_RGB888_to_YUV422(self, image):
|
||||
# rgb888 to yuv444
|
||||
image = self._ColorConversion_RGB888_to_YUV444(image)
|
||||
|
||||
# yuv444 to yuv422
|
||||
u2 = image[:, 0::2, 1]
|
||||
u4 = np.repeat(u2, 2, axis=1)
|
||||
v2 = image[:, 1::2, 2]
|
||||
v4 = np.repeat(v2, 2, axis=1)
|
||||
image[..., 1] = u4
|
||||
image[..., 2] = v4
|
||||
return image
|
||||
|
||||
def _ColorConversion_YUV_to_RGB888(self, image):
|
||||
## fixed
|
||||
h, w, c = image.shape
|
||||
image_f = image.reshape((h * w, c))
|
||||
image_rgb_f = np.zeros(image_f.shape, dtype=np.uint8)
|
||||
|
||||
for i in range(h * w):
|
||||
image_y = image_f[i, 0] *1024
|
||||
if image_f[i, 1] > 127:
|
||||
image_u = -((~(image_f[i, 1] - 1)) & 0xFF)
|
||||
else:
|
||||
image_u = image_f[i, 1]
|
||||
if image_f[i, 2] > 127:
|
||||
image_v = -((~(image_f[i, 2] - 1)) & 0xFF)
|
||||
else:
|
||||
image_v = image_f[i, 2]
|
||||
|
||||
image_r = c00_yuv * image_y + c02_yuv * image_v
|
||||
image_g = c10_yuv * image_y + c11_yuv * image_u + c12_yuv * image_v
|
||||
image_b = c20_yuv * image_y + c21_yuv * image_u
|
||||
|
||||
image_r = signed_rounding(image_r, format_bit)
|
||||
image_g = signed_rounding(image_g, format_bit)
|
||||
image_b = signed_rounding(image_b, format_bit)
|
||||
|
||||
image_r = image_r >> format_bit
|
||||
image_g = image_g >> format_bit
|
||||
image_b = image_b >> format_bit
|
||||
|
||||
image_rgb_f[i, 0] = clip(image_r, 0, 255)
|
||||
image_rgb_f[i, 1] = clip(image_g, 0, 255)
|
||||
image_rgb_f[i, 2] = clip(image_b, 0, 255)
|
||||
|
||||
image_rgb = image_rgb_f.reshape((h, w, c))
|
||||
return image_rgb
|
||||
|
||||
def _ColorConversion_RGB888_to_YCbCr444(self, image):
|
||||
## floating
|
||||
image = image.astype('float')
|
||||
image = (image @ Matrix_rgb888_to_ycbcr + 0.5).astype('uint8')
|
||||
image[:, :, 0] += 16
|
||||
image[:, :, 1] += 128
|
||||
image[:, :, 2] += 128
|
||||
|
||||
return image
|
||||
|
||||
def _ColorConversion_RGB888_to_YCbCr422(self, image):
|
||||
# rgb888 to ycbcr444
|
||||
image = self._ColorConversion_RGB888_to_YCbCr444(image)
|
||||
|
||||
# ycbcr444 to ycbcr422
|
||||
cb2 = image[:, 0::2, 1]
|
||||
cb4 = np.repeat(cb2, 2, axis=1)
|
||||
cr2 = image[:, 1::2, 2]
|
||||
cr4 = np.repeat(cr2, 2, axis=1)
|
||||
image[..., 1] = cb4
|
||||
image[..., 2] = cr4
|
||||
return image
|
||||
|
||||
def _ColorConversion_YCbCr_to_RGB888(self, image):
|
||||
## floating
|
||||
if (self.set['numerical_type'] == 'floating'):
|
||||
image = image.astype('float')
|
||||
image[:, :, 0] -= 16
|
||||
image[:, :, 1] -= 128
|
||||
image[:, :, 2] -= 128
|
||||
image = ((image @ Matrix_ycbcr_to_rgb888) + 0.5).astype('uint8')
|
||||
return image
|
||||
|
||||
## fixed
|
||||
h, w, c = image.shape
|
||||
image_f = image.reshape((h * w, c))
|
||||
image_rgb_f = np.zeros(image_f.shape, dtype=np.uint8)
|
||||
|
||||
for i in range(h * w):
|
||||
image_y = (image_f[i, 0] - 16) * c00_ycbcr
|
||||
image_cb = image_f[i, 1] - 128
|
||||
image_cr = image_f[i, 2] - 128
|
||||
|
||||
image_r = image_y + c02_ycbcr * image_cr
|
||||
image_g = image_y + c11_ycbcr * image_cb + c12_ycbcr * image_cr
|
||||
image_b = image_y + c21_ycbcr * image_cb
|
||||
|
||||
image_r = signed_rounding(image_r, format_bit)
|
||||
image_g = signed_rounding(image_g, format_bit)
|
||||
image_b = signed_rounding(image_b, format_bit)
|
||||
|
||||
image_r = image_r >> format_bit
|
||||
image_g = image_g >> format_bit
|
||||
image_b = image_b >> format_bit
|
||||
|
||||
image_rgb_f[i, 0] = clip(image_r, 0, 255)
|
||||
image_rgb_f[i, 1] = clip(image_g, 0, 255)
|
||||
image_rgb_f[i, 2] = clip(image_b, 0, 255)
|
||||
|
||||
image_rgb = image_rgb_f.reshape((h, w, c))
|
||||
return image_rgb
|
||||
|
||||
def _ColorConversion_RGB888_to_RGB565(self, image):
|
||||
assert (len(image.shape)==3)
|
||||
assert (image.shape[2]>=3)
|
||||
|
||||
image_rgb565 = np.zeros(image.shape, dtype=np.uint8)
|
||||
image_rgb = image.astype('uint8')
|
||||
image_rgb565[:, :, 0] = image_rgb[:, :, 0] >> 3
|
||||
image_rgb565[:, :, 1] = image_rgb[:, :, 1] >> 2
|
||||
image_rgb565[:, :, 2] = image_rgb[:, :, 2] >> 3
|
||||
return image_rgb565
|
||||
|
||||
def _ColorConversion_RGB565_to_RGB888(self, image):
|
||||
assert (len(image.shape)==3)
|
||||
assert (image.shape[2]==3)
|
||||
|
||||
image_rgb = np.zeros(image.shape, dtype=np.uint8)
|
||||
image_rgb[:, :, 0] = image[:, :, 0] << 3
|
||||
image_rgb[:, :, 1] = image[:, :, 1] << 2
|
||||
image_rgb[:, :, 2] = image[:, :, 2] << 3
|
||||
return image_rgb
|
||||
|
||||
def _ColorConversion_L_to_RGB888(self, image):
|
||||
image_L = image.astype('uint8')
|
||||
img = Image.fromarray(image_L).convert('RGB')
|
||||
image_data = np.array(img).astype('uint8')
|
||||
return image_data
|
||||
|
||||
def _ColorConversion_RGB888_to_L(self, image):
|
||||
image_rgb = image.astype('uint8')
|
||||
img = Image.fromarray(image_rgb).convert('L')
|
||||
image_data = np.array(img).astype('uint8')
|
||||
return image_data
|
||||
|
||||
def _ColorConversion_RGBA8888_to_RGB888(self, image):
|
||||
assert (len(image.shape)==3)
|
||||
assert (image.shape[2]==4)
|
||||
return image[:,:,:3]
|
||||
|
||||
def _ColorConversion_RGB888_to_RGBA8888(self, image):
|
||||
assert (len(image.shape)==3)
|
||||
assert (image.shape[2]==3)
|
||||
imageA = np.concatenate((image, np.zeros((image.shape[0], image.shape[1], 1), dtype=np.uint8) ), axis=2)
|
||||
return imageA
|
||||
145
kneron/preprocessing/funcs/Crop.py
Normal file
@ -0,0 +1,145 @@
|
||||
import numpy as np
|
||||
from PIL import Image
|
||||
from .utils import str2int, str2float, str2bool, pad_square_to_4
|
||||
from .utils_520 import round_up_n
|
||||
from .Runner_base import Runner_base, Param_base
|
||||
|
||||
class General(Param_base):
|
||||
type = 'center'
|
||||
align_w_to_4 = False
|
||||
pad_square_to_4 = False
|
||||
rounding_type = 0
|
||||
crop_w = 0
|
||||
crop_h = 0
|
||||
start_x = 0.
|
||||
start_y = 0.
|
||||
end_x = 0.
|
||||
end_y = 0.
|
||||
def update(self, **dic):
|
||||
self.type = dic['type']
|
||||
self.align_w_to_4 = str2bool(dic['align_w_to_4'])
|
||||
self.rounding_type = str2int(dic['rounding_type'])
|
||||
self.crop_w = str2int(dic['crop_w'])
|
||||
self.crop_h = str2int(dic['crop_h'])
|
||||
self.start_x = str2float(dic['start_x'])
|
||||
self.start_y = str2float(dic['start_y'])
|
||||
self.end_x = str2float(dic['end_x'])
|
||||
self.end_y = str2float(dic['end_y'])
|
||||
|
||||
def __str__(self):
|
||||
str_out = [
|
||||
', type:',str(self.type),
|
||||
', align_w_to_4:',str(self.align_w_to_4),
|
||||
', pad_square_to_4:',str(self.pad_square_to_4),
|
||||
', crop_w:',str(self.crop_w),
|
||||
', crop_h:',str(self.crop_h),
|
||||
', start_x:',str(self.start_x),
|
||||
', start_y:',str(self.start_y),
|
||||
', end_x:',str(self.end_x),
|
||||
', end_y:',str(self.end_y)]
|
||||
return(' '.join(str_out))
|
||||
|
||||
class runner(Runner_base):
|
||||
## overwrite the class in Runner_base
|
||||
general = General()
|
||||
|
||||
def __str__(self):
|
||||
return('<Crop>')
|
||||
|
||||
def update(self, **kwargs):
|
||||
##
|
||||
super().update(**kwargs)
|
||||
|
||||
##
|
||||
if (self.general.start_x != self.general.end_x) and (self.general.start_y != self.general.end_y):
|
||||
self.general.type = 'specific'
|
||||
elif(self.general.type != 'specific'):
|
||||
if self.general.crop_w == 0 or self.general.crop_h == 0:
|
||||
self.general.crop_w = self.common.model_size[0]
|
||||
self.general.crop_h = self.common.model_size[1]
|
||||
assert(self.general.crop_w > 0)
|
||||
assert(self.general.crop_h > 0)
|
||||
assert(self.general.type.lower() in ['CENTER', 'Center', 'center', 'CORNER', 'Corner', 'corner'])
|
||||
else:
|
||||
assert(self.general.type == 'specific')
|
||||
|
||||
def run(self, image_data):
|
||||
## init
|
||||
img = Image.fromarray(image_data)
|
||||
w, h = img.size
|
||||
|
||||
## get range
|
||||
if self.general.type.lower() in ['CENTER', 'Center', 'center']:
|
||||
x1, y1, x2, y2 = self._calcuate_xy_center(w, h)
|
||||
elif self.general.type.lower() in ['CORNER', 'Corner', 'corner']:
|
||||
x1, y1, x2, y2 = self._calcuate_xy_corner(w, h)
|
||||
else:
|
||||
x1 = self.general.start_x
|
||||
y1 = self.general.start_y
|
||||
x2 = self.general.end_x
|
||||
y2 = self.general.end_y
|
||||
assert( ((x1 != x2) and (y1 != y2)) )
|
||||
|
||||
## rounding
|
||||
if self.general.rounding_type == 0:
|
||||
x1 = int(np.floor(x1))
|
||||
y1 = int(np.floor(y1))
|
||||
x2 = int(np.ceil(x2))
|
||||
y2 = int(np.ceil(y2))
|
||||
else:
|
||||
x1 = int(round(x1))
|
||||
y1 = int(round(y1))
|
||||
x2 = int(round(x2))
|
||||
y2 = int(round(y2))
|
||||
|
||||
if self.general.align_w_to_4:
|
||||
# x1 = (x1+1) &(~3) #//+2
|
||||
# x2 = (x2+2) &(~3) #//+1
|
||||
x1 = (x1+3) &(~3) #//+2
|
||||
left = w - x2
|
||||
left = (left+3) &(~3)
|
||||
x2 = w - left
|
||||
|
||||
## pad_square_to_4
|
||||
if str2bool(self.general.pad_square_to_4):
|
||||
x1,x2,y1,y2 = pad_square_to_4(x1,x2,y1,y2)
|
||||
|
||||
# do crop
|
||||
box = (x1,y1,x2,y2)
|
||||
img = img.crop(box)
|
||||
|
||||
# print info
|
||||
if str2bool(self.common.print_info):
|
||||
self.general.start_x = x1
|
||||
self.general.start_y = y1
|
||||
self.general.end_x = x2
|
||||
self.general.end_y = y2
|
||||
self.general.crop_w = x2 - x1
|
||||
self.general.crop_h = y2 - y1
|
||||
self.print_info()
|
||||
|
||||
# output
|
||||
image_data = np.array(img)
|
||||
info = {}
|
||||
info['box'] = box
|
||||
|
||||
return image_data, info
|
||||
|
||||
|
||||
## protect fun
|
||||
def _calcuate_xy_center(self, w, h):
|
||||
x1 = w/2 - self.general.crop_w / 2
|
||||
y1 = h/2 - self.general.crop_h / 2
|
||||
x2 = w/2 + self.general.crop_w / 2
|
||||
y2 = h/2 + self.general.crop_h / 2
|
||||
return x1, y1, x2, y2
|
||||
|
||||
def _calcuate_xy_corner(self, _1, _2):
|
||||
x1 = 0
|
||||
y1 = 0
|
||||
x2 = self.general.crop_w
|
||||
y2 = self.general.crop_h
|
||||
return x1, y1, x2, y2
|
||||
|
||||
def do_crop(self, image_data, startW, startH, endW, endH):
|
||||
return image_data[startH:endH, startW:endW, :]
|
||||
186
kneron/preprocessing/funcs/Normalize.py
Normal file
@ -0,0 +1,186 @@
|
||||
import numpy as np
|
||||
from .utils import str2bool, str2int, str2float, clip_ary
|
||||
|
||||
class runner(object):
|
||||
def __init__(self):
|
||||
self.set = {
|
||||
'general': {
|
||||
'print_info':'no',
|
||||
'model_size':[0,0],
|
||||
'numerical_type':'floating',
|
||||
'type': 'kneron'
|
||||
},
|
||||
'floating':{
|
||||
"scale": 1,
|
||||
"bias": 0,
|
||||
"mean": "",
|
||||
"std": "",
|
||||
},
|
||||
'hw':{
|
||||
"radix":8,
|
||||
"shift":"",
|
||||
"sub":""
|
||||
}
|
||||
}
|
||||
return
|
||||
|
||||
def update(self, **kwargs):
|
||||
#
|
||||
self.set.update(kwargs)
|
||||
|
||||
#
|
||||
if self.set['general']['numerical_type'] == '520':
|
||||
if self.set['general']['type'].lower() in ['TF', 'Tf', 'tf']:
|
||||
self.fun_normalize = self._chen_520
|
||||
self.shift = 7 - self.set['hw']['radix']
|
||||
self.sub = 128
|
||||
elif self.set['general']['type'].lower() in ['YOLO', 'Yolo', 'yolo']:
|
||||
self.fun_normalize = self._chen_520
|
||||
self.shift = 8 - self.set['hw']['radix']
|
||||
self.sub = 0
|
||||
elif self.set['general']['type'].lower() in ['KNERON', 'Kneron', 'kneron']:
|
||||
self.fun_normalize = self._chen_520
|
||||
self.shift = 8 - self.set['hw']['radix']
|
||||
self.sub = 128
|
||||
else:
|
||||
self.fun_normalize = self._chen_520
|
||||
self.shift = 0
|
||||
self.sub = 0
|
||||
elif self.set['general']['numerical_type'] == '720':
|
||||
self.fun_normalize = self._chen_720
|
||||
self.shift = 0
|
||||
self.sub = 0
|
||||
else:
|
||||
if self.set['general']['type'].lower() in ['TORCH', 'Torch', 'torch']:
|
||||
self.fun_normalize = self._normalize_torch
|
||||
self.set['floating']['scale'] = 255.
|
||||
self.set['floating']['mean'] = [0.485, 0.456, 0.406]
|
||||
self.set['floating']['std'] = [0.229, 0.224, 0.225]
|
||||
elif self.set['general']['type'].lower() in ['TF', 'Tf', 'tf']:
|
||||
self.fun_normalize = self._normalize_tf
|
||||
self.set['floating']['scale'] = 127.5
|
||||
self.set['floating']['bias'] = -1.
|
||||
elif self.set['general']['type'].lower() in ['CAFFE', 'Caffe', 'caffe']:
|
||||
self.fun_normalize = self._normalize_caffe
|
||||
self.set['floating']['mean'] = [103.939, 116.779, 123.68]
|
||||
elif self.set['general']['type'].lower() in ['YOLO', 'Yolo', 'yolo']:
|
||||
self.fun_normalize = self._normalize_yolo
|
||||
self.set['floating']['scale'] = 255.
|
||||
elif self.set['general']['type'].lower() in ['KNERON', 'Kneron', 'kneron']:
|
||||
self.fun_normalize = self._normalize_kneron
|
||||
self.set['floating']['scale'] = 256.
|
||||
self.set['floating']['bias'] = -0.5
|
||||
else:
|
||||
self.fun_normalize = self._normalize_customized
|
||||
self.set['floating']['scale'] = str2float(self.set['floating']['scale'])
|
||||
self.set['floating']['bias'] = str2float(self.set['floating']['bias'])
|
||||
if self.set['floating']['mean'] != None:
|
||||
if len(self.set['floating']['mean']) != 3:
|
||||
self.set['floating']['mean'] = None
|
||||
if self.set['floating']['std'] != None:
|
||||
if len(self.set['floating']['std']) != 3:
|
||||
self.set['floating']['std'] = None
|
||||
|
||||
|
||||
def print_info(self):
|
||||
if self.set['general']['numerical_type'] == '520':
|
||||
print("<normalize>",
|
||||
'numerical_type', self.set['general']['numerical_type'],
|
||||
", type:", self.set['general']['type'],
|
||||
', shift:',self.shift,
|
||||
', sub:', self.sub)
|
||||
else:
|
||||
print("<normalize>",
|
||||
'numerical_type', self.set['general']['numerical_type'],
|
||||
", type:", self.set['general']['type'],
|
||||
', scale:',self.set['floating']['scale'],
|
||||
', bias:', self.set['floating']['bias'],
|
||||
', mean:', self.set['floating']['mean'],
|
||||
', std:',self.set['floating']['std'])
|
||||
|
||||
def run(self, image_data):
|
||||
# print info
|
||||
if str2bool(self.set['general']['print_info']):
|
||||
self.print_info()
|
||||
|
||||
# norm
|
||||
image_data = self.fun_normalize(image_data)
|
||||
|
||||
# output
|
||||
info = {}
|
||||
return image_data, info
|
||||
|
||||
def _normalize_torch(self, x):
|
||||
if len(x.shape) != 3:
|
||||
return x
|
||||
x = x.astype('float')
|
||||
x = x / self.set['floating']['scale']
|
||||
x[..., 0] -= self.set['floating']['mean'][0]
|
||||
x[..., 1] -= self.set['floating']['mean'][1]
|
||||
x[..., 2] -= self.set['floating']['mean'][2]
|
||||
x[..., 0] /= self.set['floating']['std'][0]
|
||||
x[..., 1] /= self.set['floating']['std'][1]
|
||||
x[..., 2] /= self.set['floating']['std'][2]
|
||||
return x
|
||||
|
||||
def _normalize_tf(self, x):
|
||||
# print('_normalize_tf')
|
||||
x = x.astype('float')
|
||||
x = x / self.set['floating']['scale']
|
||||
x = x + self.set['floating']['bias']
|
||||
return x
|
||||
|
||||
def _normalize_caffe(self, x):
|
||||
if len(x.shape) != 3:
|
||||
return x
|
||||
x = x.astype('float')
|
||||
x = x[..., ::-1]
|
||||
x[..., 0] -= self.set['floating']['mean'][0]
|
||||
x[..., 1] -= self.set['floating']['mean'][1]
|
||||
x[..., 2] -= self.set['floating']['mean'][2]
|
||||
return x
|
||||
|
||||
def _normalize_yolo(self, x):
|
||||
# print('_normalize_yolo')
|
||||
x = x.astype('float')
|
||||
x = x / self.set['floating']['scale']
|
||||
return x
|
||||
|
||||
def _normalize_kneron(self, x):
|
||||
# print('_normalize_kneron')
|
||||
x = x.astype('float')
|
||||
x = x/self.set['floating']['scale']
|
||||
x = x + self.set['floating']['bias']
|
||||
return x
|
||||
|
||||
def _normalize_customized(self, x):
|
||||
# print('_normalize_customized')
|
||||
x = x.astype('float')
|
||||
if self.set['floating']['scale'] != 0:
|
||||
x = x/ self.set['floating']['scale']
|
||||
x = x + self.set['floating']['bias']
|
||||
if self.set['floating']['mean'] is not None:
|
||||
x[..., 0] -= self.set['floating']['mean'][0]
|
||||
x[..., 1] -= self.set['floating']['mean'][1]
|
||||
x[..., 2] -= self.set['floating']['mean'][2]
|
||||
if self.set['floating']['std'] is not None:
|
||||
x[..., 0] /= self.set['floating']['std'][0]
|
||||
x[..., 1] /= self.set['floating']['std'][1]
|
||||
x[..., 2] /= self.set['floating']['std'][2]
|
||||
|
||||
return x
|
||||
|
||||
def _chen_520(self, x):
|
||||
# print('_chen_520')
|
||||
x = (x - self.sub).astype('uint8')
|
||||
x = (np.right_shift(x,self.shift))
|
||||
x=x.astype('uint8')
|
||||
return x
|
||||
|
||||
def _chen_720(self, x):
|
||||
# print('_chen_720')
|
||||
if self.shift == 1:
|
||||
x = x + np.array([[self.sub], [self.sub], [self.sub]])
|
||||
else:
|
||||
x = x + np.array([[self.sub], [self.sub], [self.sub]])
|
||||
return x
|
||||
187
kneron/preprocessing/funcs/Padding.py
Normal file
@ -0,0 +1,187 @@
|
||||
import numpy as np
|
||||
from PIL import Image
|
||||
from .utils import str2bool, str2int, str2float
|
||||
from .Runner_base import Runner_base, Param_base
|
||||
|
||||
class General(Param_base):
|
||||
type = ''
|
||||
pad_val = ''
|
||||
padded_w = ''
|
||||
padded_h = ''
|
||||
pad_l = ''
|
||||
pad_r = ''
|
||||
pad_t = ''
|
||||
pad_b = ''
|
||||
padding_ch = 3
|
||||
padding_ch_type = 'RGB'
|
||||
def update(self, **dic):
|
||||
self.type = dic['type']
|
||||
self.pad_val = dic['pad_val']
|
||||
self.padded_w = str2int(dic['padded_w'])
|
||||
self.padded_h = str2int(dic['padded_h'])
|
||||
self.pad_l = str2int(dic['pad_l'])
|
||||
self.pad_r = str2int(dic['pad_r'])
|
||||
self.pad_t = str2int(dic['pad_t'])
|
||||
self.pad_b = str2int(dic['pad_b'])
|
||||
|
||||
def __str__(self):
|
||||
str_out = [
|
||||
', type:',str(self.type),
|
||||
', pad_val:',str(self.pad_val),
|
||||
', pad_l:',str(self.pad_l),
|
||||
', pad_r:',str(self.pad_r),
|
||||
', pad_r:',str(self.pad_t),
|
||||
', pad_b:',str(self.pad_b),
|
||||
', padding_ch:',str(self.padding_ch)]
|
||||
return(' '.join(str_out))
|
||||
|
||||
class Hw(Param_base):
|
||||
radix = 8
|
||||
normalize_type = 'floating'
|
||||
def update(self, **dic):
|
||||
self.radix = dic['radix']
|
||||
self.normalize_type = dic['normalize_type']
|
||||
|
||||
def __str__(self):
|
||||
str_out = [
|
||||
', radix:', str(self.radix),
|
||||
', normalize_type:',str(self.normalize_type)]
|
||||
return(' '.join(str_out))
|
||||
|
||||
|
||||
class runner(Runner_base):
|
||||
## overwrite the class in Runner_base
|
||||
general = General()
|
||||
hw = Hw()
|
||||
|
||||
def __str__(self):
|
||||
return('<Padding>')
|
||||
|
||||
def update(self, **kwargs):
|
||||
super().update(**kwargs)
|
||||
|
||||
## update pad type & pad length
|
||||
if (self.general.pad_l != 0) or (self.general.pad_r != 0) or (self.general.pad_t != 0) or (self.general.pad_b != 0):
|
||||
self.general.type = 'specific'
|
||||
assert(self.general.pad_l >= 0)
|
||||
assert(self.general.pad_r >= 0)
|
||||
assert(self.general.pad_t >= 0)
|
||||
assert(self.general.pad_b >= 0)
|
||||
elif(self.general.type != 'specific'):
|
||||
if self.general.padded_w == 0 or self.general.padded_h == 0:
|
||||
self.general.padded_w = self.common.model_size[0]
|
||||
self.general.padded_h = self.common.model_size[1]
|
||||
assert(self.general.padded_w > 0)
|
||||
assert(self.general.padded_h > 0)
|
||||
assert(self.general.type.lower() in ['CENTER', 'Center', 'center', 'CORNER', 'Corner', 'corner'])
|
||||
else:
|
||||
assert(self.general.type == 'specific')
|
||||
|
||||
## decide pad_val & padding ch
|
||||
# if numerical_type is floating
|
||||
if (self.common.numerical_type == 'floating'):
|
||||
if self.general.pad_val != 'edge':
|
||||
self.general.pad_val = str2float(self.general.pad_val)
|
||||
self.general.padding_ch = 3
|
||||
self.general.padding_ch_type = 'RGB'
|
||||
# if numerical_type is 520 or 720
|
||||
else:
|
||||
if self.general.pad_val == '':
|
||||
if self.hw.normalize_type.lower() in ['TF', 'Tf', 'tf']:
|
||||
self.general.pad_val = np.uint8(-128 >> (7 - self.hw.radix))
|
||||
elif self.hw.normalize_type.lower() in ['YOLO', 'Yolo', 'yolo']:
|
||||
self.general.pad_val = np.uint8(0 >> (8 - self.hw.radix))
|
||||
elif self.hw.normalize_type.lower() in ['KNERON', 'Kneron', 'kneron']:
|
||||
self.general.pad_val = np.uint8(-128 >> (8 - self.hw.radix))
|
||||
else:
|
||||
self.general.pad_val = np.uint8(0 >> (8 - self.hw.radix))
|
||||
else:
|
||||
self.general.pad_val = str2int(self.general.pad_val)
|
||||
self.general.padding_ch = 4
|
||||
self.general.padding_ch_type = 'RGBA'
|
||||
|
||||
def run(self, image_data):
|
||||
# init
|
||||
shape = image_data.shape
|
||||
w = shape[1]
|
||||
h = shape[0]
|
||||
if len(shape) < 3:
|
||||
self.general.padding_ch = 1
|
||||
self.general.padding_ch_type = 'L'
|
||||
else:
|
||||
if shape[2] == 3 and self.general.padding_ch == 4:
|
||||
image_data = np.concatenate((image_data, np.zeros((h, w, 1), dtype=np.uint8) ), axis=2)
|
||||
|
||||
## padding
|
||||
if self.general.type.lower() in ['CENTER', 'Center', 'center']:
|
||||
img_pad = self._padding_center(image_data, w, h)
|
||||
elif self.general.type.lower() in ['CORNER', 'Corner', 'corner']:
|
||||
img_pad = self._padding_corner(image_data, w, h)
|
||||
else:
|
||||
img_pad = self._padding_sp(image_data, w, h)
|
||||
|
||||
# print info
|
||||
if str2bool(self.common.print_info):
|
||||
self.print_info()
|
||||
|
||||
# output
|
||||
info = {}
|
||||
return img_pad, info
|
||||
|
||||
## protect fun
|
||||
def _padding_center(self, img, ori_w, ori_h):
|
||||
# img_pad = Image.new(self.general.padding_ch_type, (self.general.padded_w, self.general.padded_h), int(self.general.pad_val[0]))
|
||||
# img = Image.fromarray(img)
|
||||
# img_pad.paste(img, ((self.general.padded_w-ori_w)//2, (self.general.padded_h-ori_h)//2))
|
||||
# return img_pad
|
||||
padH = self.general.padded_h - ori_h
|
||||
padW = self.general.padded_w - ori_w
|
||||
self.general.pad_t = padH // 2
|
||||
self.general.pad_b = (padH // 2) + (padH % 2)
|
||||
self.general.pad_l = padW // 2
|
||||
self.general.pad_r = (padW // 2) + (padW % 2)
|
||||
if self.general.pad_l < 0 or self.general.pad_r <0 or self.general.pad_t <0 or self.general.pad_b<0:
|
||||
return img
|
||||
img_pad = self._padding_sp(img,ori_w,ori_h)
|
||||
return img_pad
|
||||
|
||||
def _padding_corner(self, img, ori_w, ori_h):
|
||||
# img_pad = Image.new(self.general.padding_ch_type, (self.general.padded_w, self.general.padded_h), self.general.pad_val)
|
||||
# img_pad.paste(img, (0, 0))
|
||||
self.general.pad_l = 0
|
||||
self.general.pad_r = self.general.padded_w - ori_w
|
||||
self.general.pad_t = 0
|
||||
self.general.pad_b = self.general.padded_h - ori_h
|
||||
if self.general.pad_l < 0 or self.general.pad_r <0 or self.general.pad_t <0 or self.general.pad_b<0:
|
||||
return img
|
||||
img_pad = self._padding_sp(img,ori_w,ori_h)
|
||||
return img_pad
|
||||
|
||||
def _padding_sp(self, img, ori_w, ori_h):
|
||||
# block_t = np.zeros((self.general.pad_t, self.general.pad_l + self.general.pad_r + ori_w, self.general.padding_ch), dtype=np.float)
|
||||
# block_l = np.zeros((ori_h, self.general.pad_l, self.general.padding_ch), dtype=np.float)
|
||||
# block_r = np.zeros((ori_h, self.general.pad_r, self.general.padding_ch), dtype=np.float)
|
||||
# block_b = np.zeros((self.general.pad_b, self.general.pad_l + self.general.pad_r + ori_w, self.general.padding_ch), dtype=np.float)
|
||||
# for i in range(self.general.padding_ch):
|
||||
# block_t[:, :, i] = np.ones(block_t[:, :, i].shape, dtype=np.float) * self.general.pad_val
|
||||
# block_l[:, :, i] = np.ones(block_l[:, :, i].shape, dtype=np.float) * self.general.pad_val
|
||||
# block_r[:, :, i] = np.ones(block_r[:, :, i].shape, dtype=np.float) * self.general.pad_val
|
||||
# block_b[:, :, i] = np.ones(block_b[:, :, i].shape, dtype=np.float) * self.general.pad_val
|
||||
# padded_image_hor = np.concatenate((block_l, img, block_r), axis=1)
|
||||
# padded_image = np.concatenate((block_t, padded_image_hor, block_b), axis=0)
|
||||
# return padded_image
|
||||
if self.general.padding_ch == 1:
|
||||
pad_range = ( (self.general.pad_t, self.general.pad_b),(self.general.pad_l, self.general.pad_r) )
|
||||
else:
|
||||
pad_range = ((self.general.pad_t, self.general.pad_b),(self.general.pad_l, self.general.pad_r),(0,0))
|
||||
|
||||
if isinstance(self.general.pad_val, str):
|
||||
if self.general.pad_val == 'edge':
|
||||
padded_image = np.pad(img, pad_range, mode="edge")
|
||||
else:
|
||||
padded_image = np.pad(img, pad_range, mode="constant",constant_values=0)
|
||||
else:
|
||||
padded_image = np.pad(img, pad_range, mode="constant",constant_values=self.general.pad_val)
|
||||
|
||||
return padded_image
|
||||
|
||||
237
kneron/preprocessing/funcs/Resize.py
Normal file
@ -0,0 +1,237 @@
|
||||
import numpy as np
|
||||
import cv2
|
||||
from PIL import Image
|
||||
from .utils import str2bool, str2int
|
||||
from ctypes import c_float
|
||||
from .Runner_base import Runner_base, Param_base
|
||||
|
||||
class General(Param_base):
|
||||
type = 'bilinear'
|
||||
keep_ratio = True
|
||||
zoom = True
|
||||
calculate_ratio_using_CSim = True
|
||||
resize_w = 0
|
||||
resize_h = 0
|
||||
resized_w = 0
|
||||
resized_h = 0
|
||||
def update(self, **dic):
|
||||
self.type = dic['type']
|
||||
self.keep_ratio = str2bool(dic['keep_ratio'])
|
||||
self.zoom = str2bool(dic['zoom'])
|
||||
self.calculate_ratio_using_CSim = str2bool(dic['calculate_ratio_using_CSim'])
|
||||
self.resize_w = str2int(dic['resize_w'])
|
||||
self.resize_h = str2int(dic['resize_h'])
|
||||
|
||||
def __str__(self):
|
||||
str_out = [
|
||||
', type:',str(self.type),
|
||||
', keep_ratio:',str(self.keep_ratio),
|
||||
', zoom:',str(self.zoom),
|
||||
', calculate_ratio_using_CSim:',str(self.calculate_ratio_using_CSim),
|
||||
', resize_w:',str(self.resize_w),
|
||||
', resize_h:',str(self.resize_h),
|
||||
', resized_w:',str(self.resized_w),
|
||||
', resized_h:',str(self.resized_h)]
|
||||
return(' '.join(str_out))
|
||||
|
||||
class Hw(Param_base):
|
||||
resize_bit = 12
|
||||
def update(self, **dic):
|
||||
pass
|
||||
|
||||
def __str__(self):
|
||||
str_out = [
|
||||
', resize_bit:',str(self.resize_bit)]
|
||||
return(' '.join(str_out))
|
||||
|
||||
class runner(Runner_base):
|
||||
## overwrite the class in Runner_base
|
||||
general = General()
|
||||
hw = Hw()
|
||||
|
||||
def __str__(self):
|
||||
return('<Resize>')
|
||||
|
||||
def update(self, **kwargs):
|
||||
super().update(**kwargs)
|
||||
|
||||
## if resize size has not been assigned, then it will take model size as resize size
|
||||
if self.general.resize_w == 0 or self.general.resize_h == 0:
|
||||
self.general.resize_w = self.common.model_size[0]
|
||||
self.general.resize_h = self.common.model_size[1]
|
||||
assert(self.general.resize_w > 0)
|
||||
assert(self.general.resize_h > 0)
|
||||
|
||||
##
|
||||
if self.common.numerical_type == '520':
|
||||
self.general.type = 'fixed_520'
|
||||
elif self.common.numerical_type == '720':
|
||||
self.general.type = 'fixed_720'
|
||||
assert(self.general.type.lower() in ['BILINEAR', 'Bilinear', 'bilinear', 'BICUBIC', 'Bicubic', 'bicubic', 'FIXED', 'Fixed', 'fixed', 'FIXED_520', 'Fixed_520', 'fixed_520', 'FIXED_720', 'Fixed_720', 'fixed_720','CV', 'cv', 'opencv', 'OpenCV', 'CV2', 'cv2'])
|
||||
|
||||
|
||||
def run(self, image_data):
|
||||
## init
|
||||
ori_w = image_data.shape[1]
|
||||
ori_h = image_data.shape[0]
|
||||
info = {}
|
||||
|
||||
##
|
||||
if self.general.keep_ratio:
|
||||
self.general.resized_w, self.general.resized_h = self.calcuate_scale_keep_ratio(self.general.resize_w,self.general.resize_h, ori_w, ori_h, self.general.calculate_ratio_using_CSim)
|
||||
else:
|
||||
self.general.resized_w = int(self.general.resize_w)
|
||||
self.general.resized_h = int(self.general.resize_h)
|
||||
assert(self.general.resized_w > 0)
|
||||
assert(self.general.resized_h > 0)
|
||||
|
||||
##
|
||||
if (self.general.resized_w > ori_w) or (self.general.resized_h > ori_h):
|
||||
if not self.general.zoom:
|
||||
info['size'] = (ori_w,ori_h)
|
||||
if str2bool(self.common.print_info):
|
||||
print('no resize')
|
||||
self.print_info()
|
||||
return image_data, info
|
||||
|
||||
## resize
|
||||
if self.general.type.lower() in ['BILINEAR', 'Bilinear', 'bilinear']:
|
||||
image_data = self.do_resize_bilinear(image_data, self.general.resized_w, self.general.resized_h)
|
||||
elif self.general.type.lower() in ['BICUBIC', 'Bicubic', 'bicubic']:
|
||||
image_data = self.do_resize_bicubic(image_data, self.general.resized_w, self.general.resized_h)
|
||||
elif self.general.type.lower() in ['CV', 'cv', 'opencv', 'OpenCV', 'CV2', 'cv2']:
|
||||
image_data = self.do_resize_cv2(image_data, self.general.resized_w, self.general.resized_h)
|
||||
elif self.general.type.lower() in ['FIXED', 'Fixed', 'fixed', 'FIXED_520', 'Fixed_520', 'fixed_520', 'FIXED_720', 'Fixed_720', 'fixed_720']:
|
||||
image_data = self.do_resize_fixed(image_data, self.general.resized_w, self.general.resized_h, self.hw.resize_bit, self.general.type)
|
||||
|
||||
|
||||
# output
|
||||
info['size'] = (self.general.resized_w, self.general.resized_h)
|
||||
|
||||
# print info
|
||||
if str2bool(self.common.print_info):
|
||||
self.print_info()
|
||||
|
||||
return image_data, info
|
||||
|
||||
def calcuate_scale_keep_ratio(self, tar_w, tar_h, ori_w, ori_h, calculate_ratio_using_CSim):
|
||||
if not calculate_ratio_using_CSim:
|
||||
scale_w = tar_w * 1.0 / ori_w*1.0
|
||||
scale_h = tar_h * 1.0 / ori_h*1.0
|
||||
scale = scale_w if scale_w < scale_h else scale_h
|
||||
new_w = int(round(ori_w * scale))
|
||||
new_h = int(round(ori_h * scale))
|
||||
return new_w, new_h
|
||||
|
||||
## calculate_ratio_using_CSim
|
||||
scale_w = c_float(tar_w * 1.0 / (ori_w * 1.0)).value
|
||||
scale_h = c_float(tar_h * 1.0 / (ori_h * 1.0)).value
|
||||
scale_ratio = 0.0
|
||||
scale_target_w = 0
|
||||
scale_target_h = 0
|
||||
padH = 0
|
||||
padW = 0
|
||||
|
||||
bScaleW = True if scale_w < scale_h else False
|
||||
if bScaleW:
|
||||
scale_ratio = scale_w
|
||||
scale_target_w = int(c_float(scale_ratio * ori_w + 0.5).value)
|
||||
scale_target_h = int(c_float(scale_ratio * ori_h + 0.5).value)
|
||||
assert (abs(scale_target_w - tar_w) <= 1), "Error: scale down width cannot meet expectation\n"
|
||||
padH = tar_h - scale_target_h
|
||||
padW = 0
|
||||
assert (padH >= 0), "Error: padH shouldn't be less than zero\n"
|
||||
else:
|
||||
scale_ratio = scale_h
|
||||
scale_target_w = int(c_float(scale_ratio * ori_w + 0.5).value)
|
||||
scale_target_h = int(c_float(scale_ratio * ori_h + 0.5).value)
|
||||
assert (abs(scale_target_h - tar_h) <= 1), "Error: scale down height cannot meet expectation\n"
|
||||
padW = tar_w - scale_target_w
|
||||
padH = 0
|
||||
assert (padW >= 0), "Error: padW shouldn't be less than zero\n"
|
||||
new_w = tar_w - padW
|
||||
new_h = tar_h - padH
|
||||
return new_w, new_h
|
||||
|
||||
def do_resize_bilinear(self, image_data, resized_w, resized_h):
|
||||
img = Image.fromarray(image_data)
|
||||
img = img.resize((resized_w, resized_h), Image.BILINEAR)
|
||||
image_data = np.array(img).astype('uint8')
|
||||
return image_data
|
||||
|
||||
def do_resize_bicubic(self, image_data, resized_w, resized_h):
|
||||
img = Image.fromarray(image_data)
|
||||
img = img.resize((resized_w, resized_h), Image.BICUBIC)
|
||||
image_data = np.array(img).astype('uint8')
|
||||
return image_data
|
||||
|
||||
def do_resize_cv2(self, image_data, resized_w, resized_h):
|
||||
image_data = cv2.resize(image_data, (resized_w, resized_h))
|
||||
image_data = np.array(image_data)
|
||||
# image_data = np.array(image_data).astype('uint8')
|
||||
return image_data
|
||||
|
||||
def do_resize_fixed(self, image_data, resized_w, resized_h, resize_bit, type):
|
||||
if len(image_data.shape) < 3:
|
||||
m, n = image_data.shape
|
||||
tmp = np.zeros((m,n,3), dtype=np.uint8)
|
||||
tmp[:,:,0] = image_data
|
||||
image_data = tmp
|
||||
c = 3
|
||||
gray = True
|
||||
else:
|
||||
m, n, c = image_data.shape
|
||||
gray = False
|
||||
|
||||
resolution = 1 << resize_bit
|
||||
|
||||
# Width
|
||||
ratio = int(((n - 1) << resize_bit) / (resized_w - 1))
|
||||
ratio_cnt = 0
|
||||
src_x = 0
|
||||
resized_image_w = np.zeros((m, resized_w, c), dtype=np.uint8)
|
||||
|
||||
for dst_x in range(resized_w):
|
||||
while ratio_cnt > resolution:
|
||||
ratio_cnt = ratio_cnt - resolution
|
||||
src_x = src_x + 1
|
||||
mul1 = np.ones((m, c)) * (resolution - ratio_cnt)
|
||||
mul2 = np.ones((m, c)) * ratio_cnt
|
||||
resized_image_w[:, dst_x, :] = np.multiply(np.multiply(
|
||||
image_data[:, src_x, :], mul1) + np.multiply(image_data[:, src_x + 1, :], mul2), 1/resolution)
|
||||
ratio_cnt = ratio_cnt + ratio
|
||||
|
||||
# Height
|
||||
ratio = int(((m - 1) << resize_bit) / (resized_h - 1))
|
||||
## NPU HW special case 2 , only on 520
|
||||
if type.lower() in ['FIXED_520', 'Fixed_520', 'fixed_520']:
|
||||
if (((ratio * (resized_h - 1)) % 4096 == 0) and ratio != 4096):
|
||||
ratio -= 1
|
||||
|
||||
ratio_cnt = 0
|
||||
src_x = 0
|
||||
resized_image = np.zeros(
|
||||
(resized_h, resized_w, c), dtype=np.uint8)
|
||||
for dst_x in range(resized_h):
|
||||
while ratio_cnt > resolution:
|
||||
ratio_cnt = ratio_cnt - resolution
|
||||
src_x = src_x + 1
|
||||
|
||||
mul1 = np.ones((resized_w, c)) * (resolution - ratio_cnt)
|
||||
mul2 = np.ones((resized_w, c)) * ratio_cnt
|
||||
|
||||
## NPU HW special case 1 , both on 520 / 720
|
||||
if (((dst_x > 0) and ratio_cnt == resolution) and (ratio != resolution)):
|
||||
if type.lower() in ['FIXED_520', 'Fixed_520', 'fixed_520','FIXED_720', 'Fixed_720', 'fixed_720' ]:
|
||||
resized_image[dst_x, :, :] = np.multiply(np.multiply(
|
||||
resized_image_w[src_x+1, :, :], mul1) + np.multiply(resized_image_w[src_x + 2, :, :], mul2), 1/resolution)
|
||||
else:
|
||||
resized_image[dst_x, :, :] = np.multiply(np.multiply(
|
||||
resized_image_w[src_x, :, :], mul1) + np.multiply(resized_image_w[src_x + 1, :, :], mul2), 1/resolution)
|
||||
|
||||
ratio_cnt = ratio_cnt + ratio
|
||||
|
||||
if gray:
|
||||
resized_image = resized_image[:,:,0]
|
||||
|
||||
return resized_image
|
||||
45
kneron/preprocessing/funcs/Rotate.py
Normal file
@ -0,0 +1,45 @@
|
||||
import numpy as np
|
||||
from .utils import str2bool, str2int
|
||||
|
||||
class runner(object):
|
||||
def __init__(self, *args, **kwargs):
|
||||
self.set = {
|
||||
'operator': '',
|
||||
"rotate_direction": 0,
|
||||
|
||||
}
|
||||
self.update(*args, **kwargs)
|
||||
|
||||
def update(self, *args, **kwargs):
|
||||
self.set.update(kwargs)
|
||||
self.rotate_direction = str2int(self.set['rotate_direction'])
|
||||
|
||||
# print info
|
||||
if str2bool(self.set['b_print']):
|
||||
self.print_info()
|
||||
|
||||
def print_info(self):
|
||||
print("<rotate>",
|
||||
'rotate_direction', self.rotate_direction,)
|
||||
|
||||
|
||||
def run(self, image_data):
|
||||
image_data = self._rotate(image_data)
|
||||
return image_data
|
||||
|
||||
def _rotate(self,img):
|
||||
if self.rotate_direction == 1 or self.rotate_direction == 2:
|
||||
col, row, unit = img.shape
|
||||
pInBuf = img.reshape((-1,1))
|
||||
pOutBufTemp = np.zeros((col* row* unit))
|
||||
for r in range(row):
|
||||
for c in range(col):
|
||||
for u in range(unit):
|
||||
if self.rotate_direction == 1:
|
||||
pOutBufTemp[unit * (c * row + (row - r - 1))+u] = pInBuf[unit * (r * col + c)+u]
|
||||
elif self.rotate_direction == 2:
|
||||
pOutBufTemp[unit * (row * (col - c - 1) + r)+u] = pInBuf[unit * (r * col + c)+u]
|
||||
|
||||
img = pOutBufTemp.reshape((col,row,unit))
|
||||
|
||||
return img
|
||||
59
kneron/preprocessing/funcs/Runner_base.py
Normal file
@ -0,0 +1,59 @@
|
||||
from abc import ABCMeta, abstractmethod
|
||||
|
||||
class Param_base(object):
|
||||
@abstractmethod
|
||||
def update(self,**dic):
|
||||
raise NotImplementedError("Must override")
|
||||
|
||||
def load_dic(self, key, **dic):
|
||||
if key in dic:
|
||||
param = eval('self.'+key)
|
||||
param = dic[key]
|
||||
|
||||
def __str__(self):
|
||||
str_out = []
|
||||
return(' '.join(str_out))
|
||||
|
||||
|
||||
class Common(Param_base):
|
||||
print_info = False
|
||||
model_size = [0,0]
|
||||
numerical_type = 'floating'
|
||||
|
||||
def update(self, **dic):
|
||||
self.print_info = dic['print_info']
|
||||
self.model_size = dic['model_size']
|
||||
self.numerical_type = dic['numerical_type']
|
||||
|
||||
def __str__(self):
|
||||
str_out = ['numerical_type:',str(self.numerical_type)]
|
||||
return(' '.join(str_out))
|
||||
|
||||
class Runner_base(metaclass=ABCMeta):
|
||||
common = Common()
|
||||
general = Param_base()
|
||||
floating = Param_base()
|
||||
hw = Param_base()
|
||||
|
||||
def update(self, **kwargs):
|
||||
## update param
|
||||
self.common.update(**kwargs['common'])
|
||||
self.general.update(**kwargs['general'])
|
||||
assert(self.common.numerical_type.lower() in ['floating', '520', '720'])
|
||||
if (self.common.numerical_type == 'floating'):
|
||||
if (self.floating.__class__.__name__ != 'Param_base'):
|
||||
self.floating.update(**kwargs['floating'])
|
||||
else:
|
||||
if (self.hw.__class__.__name__ != 'Param_base'):
|
||||
self.hw.update(**kwargs['hw'])
|
||||
|
||||
def print_info(self):
|
||||
if (self.common.numerical_type == 'floating'):
|
||||
print(self, self.common, self.general, self.floating)
|
||||
else:
|
||||
print(self, self.common, self.general, self.hw)
|
||||
|
||||
|
||||
|
||||
|
||||
|
||||
2
kneron/preprocessing/funcs/__init__.py
Normal file
@ -0,0 +1,2 @@
|
||||
from . import ColorConversion, Padding, Resize, Crop, Normalize, Rotate
|
||||
|
||||
372
kneron/preprocessing/funcs/utils.py
Normal file
@ -0,0 +1,372 @@
|
||||
import numpy as np
|
||||
from PIL import Image
|
||||
import struct
|
||||
|
||||
def pad_square_to_4(x_start, x_end, y_start, y_end):
|
||||
w_int = x_end - x_start
|
||||
h_int = y_end - y_start
|
||||
pad = w_int - h_int
|
||||
if pad > 0:
|
||||
pad_s = (pad >> 1) &(~3)
|
||||
pad_e = pad - pad_s
|
||||
y_start -= pad_s
|
||||
y_end += pad_e
|
||||
else:#//pad <=0
|
||||
pad_s = -(((pad) >> 1) &(~3))
|
||||
pad_e = (-pad) - pad_s
|
||||
x_start -= pad_s
|
||||
x_end += pad_e
|
||||
return x_start, x_end, y_start, y_end
|
||||
|
||||
def str_fill(value):
|
||||
if len(value) == 1:
|
||||
value = "0" + value
|
||||
elif len(value) == 0:
|
||||
value = "00"
|
||||
|
||||
return value
|
||||
|
||||
def clip_ary(value):
|
||||
list_v = []
|
||||
for i in range(len(value)):
|
||||
v = value[i] % 256
|
||||
list_v.append(v)
|
||||
|
||||
return list_v
|
||||
|
||||
def str2bool(v):
|
||||
if isinstance(v,bool):
|
||||
return v
|
||||
return v.lower() in ('TRUE', 'True', 'true', '1', 'T', 't', 'Y', 'YES', 'y', 'yes')
|
||||
|
||||
|
||||
def str2int(s):
|
||||
if s == "":
|
||||
s = 0
|
||||
s = int(s)
|
||||
return s
|
||||
|
||||
def str2float(s):
|
||||
if s == "":
|
||||
s = 0
|
||||
s = float(s)
|
||||
return s
|
||||
|
||||
def clip(value, mini, maxi):
|
||||
if value < mini:
|
||||
result = mini
|
||||
elif value > maxi:
|
||||
result = maxi
|
||||
else:
|
||||
result = value
|
||||
|
||||
return result
|
||||
|
||||
|
||||
def clip_ary(value):
|
||||
list_v = []
|
||||
for i in range(len(value)):
|
||||
v = value[i] % 256
|
||||
list_v.append(v)
|
||||
|
||||
return list_v
|
||||
|
||||
|
||||
def signed_rounding(value, bit):
|
||||
if value < 0:
|
||||
value = value - (1 << (bit - 1))
|
||||
else:
|
||||
value = value + (1 << (bit - 1))
|
||||
|
||||
return value
|
||||
|
||||
def hex_loader(data_folder,**kwargs):
|
||||
format_mode = kwargs['raw_img_fmt']
|
||||
src_h = kwargs['img_in_height']
|
||||
src_w = kwargs['img_in_width']
|
||||
|
||||
if format_mode in ['YUV444', 'yuv444', 'YCBCR444', 'YCbCr444', 'ycbcr444']:
|
||||
output = hex_yuv444(data_folder,src_h,src_w)
|
||||
elif format_mode in ['RGB565', 'rgb565']:
|
||||
output = hex_rgb565(data_folder,src_h,src_w)
|
||||
elif format_mode in ['YUV422', 'yuv422', 'YCBCR422', 'YCbCr422', 'ycbcr422']:
|
||||
output = hex_yuv422(data_folder,src_h,src_w)
|
||||
|
||||
return output
|
||||
|
||||
def hex_rgb565(hex_folder,src_h,src_w):
|
||||
pix_per_line = 8
|
||||
byte_per_line = 16
|
||||
|
||||
f = open(hex_folder)
|
||||
pixel_r = []
|
||||
pixel_g = []
|
||||
pixel_b = []
|
||||
|
||||
# Ignore the first line
|
||||
f.readline()
|
||||
input_line = int((src_h * src_w)/pix_per_line)
|
||||
for i in range(input_line):
|
||||
readline = f.readline()
|
||||
for j in range(int(byte_per_line/2)-1, -1, -1):
|
||||
data1 = int(readline[(j * 4 + 0):(j * 4 + 2)], 16)
|
||||
data0 = int(readline[(j * 4 + 2):(j * 4 + 4)], 16)
|
||||
r = ((data1 & 0xf8) >> 3)
|
||||
g = (((data0 & 0xe0) >> 5) + ((data1 & 0x7) << 3))
|
||||
b = (data0 & 0x1f)
|
||||
pixel_r.append(r)
|
||||
pixel_g.append(g)
|
||||
pixel_b.append(b)
|
||||
|
||||
ary_r = np.array(pixel_r, dtype=np.uint8)
|
||||
ary_g = np.array(pixel_g, dtype=np.uint8)
|
||||
ary_b = np.array(pixel_b, dtype=np.uint8)
|
||||
output = np.concatenate((ary_r[:, None], ary_g[:, None], ary_b[:, None]), axis=1)
|
||||
output = output.reshape((src_h, src_w, 3))
|
||||
|
||||
return output
|
||||
|
||||
def hex_yuv444(hex_folder,src_h,src_w):
|
||||
pix_per_line = 4
|
||||
byte_per_line = 16
|
||||
|
||||
f = open(hex_folder)
|
||||
byte0 = []
|
||||
byte1 = []
|
||||
byte2 = []
|
||||
byte3 = []
|
||||
|
||||
# Ignore the first line
|
||||
f.readline()
|
||||
input_line = int((src_h * src_w)/pix_per_line)
|
||||
for i in range(input_line):
|
||||
readline = f.readline()
|
||||
for j in range(byte_per_line-1, -1, -1):
|
||||
data = int(readline[(j*2):(j*2+2)], 16)
|
||||
if (j+1) % 4 == 0:
|
||||
byte0.append(data)
|
||||
elif (j+2) % 4 == 0:
|
||||
byte1.append(data)
|
||||
elif (j+3) % 4 == 0:
|
||||
byte2.append(data)
|
||||
elif (j+4) % 4 == 0:
|
||||
byte3.append(data)
|
||||
# ary_a = np.array(byte0, dtype=np.uint8)
|
||||
ary_v = np.array(byte1, dtype=np.uint8)
|
||||
ary_u = np.array(byte2, dtype=np.uint8)
|
||||
ary_y = np.array(byte3, dtype=np.uint8)
|
||||
output = np.concatenate((ary_y[:, None], ary_u[:, None], ary_v[:, None]), axis=1)
|
||||
output = output.reshape((src_h, src_w, 3))
|
||||
|
||||
return output
|
||||
|
||||
def hex_yuv422(hex_folder,src_h,src_w):
|
||||
pix_per_line = 8
|
||||
byte_per_line = 16
|
||||
f = open(hex_folder)
|
||||
pixel_y = []
|
||||
pixel_u = []
|
||||
pixel_v = []
|
||||
|
||||
# Ignore the first line
|
||||
f.readline()
|
||||
input_line = int((src_h * src_w)/pix_per_line)
|
||||
for i in range(input_line):
|
||||
readline = f.readline()
|
||||
for j in range(int(byte_per_line/4)-1, -1, -1):
|
||||
data3 = int(readline[(j * 8 + 0):(j * 8 + 2)], 16)
|
||||
data2 = int(readline[(j * 8 + 2):(j * 8 + 4)], 16)
|
||||
data1 = int(readline[(j * 8 + 4):(j * 8 + 6)], 16)
|
||||
data0 = int(readline[(j * 8 + 6):(j * 8 + 8)], 16)
|
||||
pixel_y.append(data3)
|
||||
pixel_y.append(data1)
|
||||
pixel_u.append(data2)
|
||||
pixel_u.append(data2)
|
||||
pixel_v.append(data0)
|
||||
pixel_v.append(data0)
|
||||
|
||||
ary_y = np.array(pixel_y, dtype=np.uint8)
|
||||
ary_u = np.array(pixel_u, dtype=np.uint8)
|
||||
ary_v = np.array(pixel_v, dtype=np.uint8)
|
||||
output = np.concatenate((ary_y[:, None], ary_u[:, None], ary_v[:, None]), axis=1)
|
||||
output = output.reshape((src_h, src_w, 3))
|
||||
|
||||
return output
|
||||
|
||||
def bin_loader(data_folder,**kwargs):
|
||||
format_mode = kwargs['raw_img_fmt']
|
||||
src_h = kwargs['img_in_height']
|
||||
src_w = kwargs['img_in_width']
|
||||
if format_mode in ['YUV','yuv','YUV444', 'yuv444', 'YCBCR','YCbCr','ycbcr','YCBCR444', 'YCbCr444', 'ycbcr444']:
|
||||
output = bin_yuv444(data_folder,src_h,src_w)
|
||||
elif format_mode in ['RGB565', 'rgb565']:
|
||||
output = bin_rgb565(data_folder,src_h,src_w)
|
||||
elif format_mode in ['NIR', 'nir','NIR888', 'nir888']:
|
||||
output = bin_nir(data_folder,src_h,src_w)
|
||||
elif format_mode in ['YUV422', 'yuv422', 'YCBCR422', 'YCbCr422', 'ycbcr422']:
|
||||
output = bin_yuv422(data_folder,src_h,src_w)
|
||||
elif format_mode in ['RGB888','rgb888']:
|
||||
output = np.fromfile(data_folder, dtype='uint8')
|
||||
output = output.reshape(src_h,src_w,3)
|
||||
elif format_mode in ['RGBA8888','rgba8888', 'RGBA' , 'rgba']:
|
||||
output_temp = np.fromfile(data_folder, dtype='uint8')
|
||||
output_temp = output_temp.reshape(src_h,src_w,4)
|
||||
output = output_temp[:,:,0:3]
|
||||
|
||||
return output
|
||||
|
||||
def bin_yuv444(in_img_path,src_h,src_w):
|
||||
# load bin
|
||||
struct_fmt = '1B'
|
||||
struct_len = struct.calcsize(struct_fmt)
|
||||
struct_unpack = struct.Struct(struct_fmt).unpack_from
|
||||
|
||||
row = src_h
|
||||
col = src_w
|
||||
pixels = row*col
|
||||
|
||||
raw = []
|
||||
with open(in_img_path, "rb") as f:
|
||||
while True:
|
||||
data = f.read(struct_len)
|
||||
if not data: break
|
||||
s = struct_unpack(data)
|
||||
raw.append(s[0])
|
||||
|
||||
|
||||
raw = raw[:pixels*4]
|
||||
|
||||
#
|
||||
output = np.zeros((pixels * 3), dtype=np.uint8)
|
||||
cnt = 0
|
||||
for i in range(0, pixels*4, 4):
|
||||
#Y
|
||||
output[cnt] = raw[i+3]
|
||||
#U
|
||||
cnt += 1
|
||||
output[cnt] = raw[i+2]
|
||||
#V
|
||||
cnt += 1
|
||||
output[cnt] = raw[i+1]
|
||||
|
||||
cnt += 1
|
||||
|
||||
output = output.reshape((src_h,src_w,3))
|
||||
return output
|
||||
|
||||
def bin_yuv422(in_img_path,src_h,src_w):
|
||||
# load bin
|
||||
struct_fmt = '1B'
|
||||
struct_len = struct.calcsize(struct_fmt)
|
||||
struct_unpack = struct.Struct(struct_fmt).unpack_from
|
||||
|
||||
row = src_h
|
||||
col = src_w
|
||||
pixels = row*col
|
||||
|
||||
raw = []
|
||||
with open(in_img_path, "rb") as f:
|
||||
while True:
|
||||
data = f.read(struct_len)
|
||||
if not data: break
|
||||
s = struct_unpack(data)
|
||||
raw.append(s[0])
|
||||
|
||||
|
||||
raw = raw[:pixels*2]
|
||||
|
||||
#
|
||||
output = np.zeros((pixels * 3), dtype=np.uint8)
|
||||
cnt = 0
|
||||
for i in range(0, pixels*2, 4):
|
||||
#Y0
|
||||
output[cnt] = raw[i+3]
|
||||
#U0
|
||||
cnt += 1
|
||||
output[cnt] = raw[i+2]
|
||||
#V0
|
||||
cnt += 1
|
||||
output[cnt] = raw[i]
|
||||
#Y1
|
||||
cnt += 1
|
||||
output[cnt] = raw[i+1]
|
||||
#U1
|
||||
cnt += 1
|
||||
output[cnt] = raw[i+2]
|
||||
#V1
|
||||
cnt += 1
|
||||
output[cnt] = raw[i]
|
||||
|
||||
cnt += 1
|
||||
|
||||
output = output.reshape((src_h,src_w,3))
|
||||
return output
|
||||
|
||||
def bin_rgb565(in_img_path,src_h,src_w):
|
||||
# load bin
|
||||
struct_fmt = '1B'
|
||||
struct_len = struct.calcsize(struct_fmt)
|
||||
struct_unpack = struct.Struct(struct_fmt).unpack_from
|
||||
|
||||
row = src_h
|
||||
col = src_w
|
||||
pixels = row*col
|
||||
|
||||
rgba565 = []
|
||||
with open(in_img_path, "rb") as f:
|
||||
while True:
|
||||
data = f.read(struct_len)
|
||||
if not data: break
|
||||
s = struct_unpack(data)
|
||||
rgba565.append(s[0])
|
||||
|
||||
|
||||
rgba565 = rgba565[:pixels*2]
|
||||
|
||||
# rgb565_bin to numpy_array
|
||||
output = np.zeros((pixels * 3), dtype=np.uint8)
|
||||
cnt = 0
|
||||
for i in range(0, pixels*2, 2):
|
||||
temp = rgba565[i]
|
||||
temp2 = rgba565[i+1]
|
||||
#R-5
|
||||
output[cnt] = (temp2 >>3)
|
||||
|
||||
#G-6
|
||||
cnt += 1
|
||||
output[cnt] = ((temp & 0xe0) >> 5) + ((temp2 & 0x07) << 3)
|
||||
|
||||
#B-5
|
||||
cnt += 1
|
||||
output[cnt] = (temp & 0x1f)
|
||||
|
||||
cnt += 1
|
||||
|
||||
output = output.reshape((src_h,src_w,3))
|
||||
return output
|
||||
|
||||
def bin_nir(in_img_path,src_h,src_w):
|
||||
# load bin
|
||||
struct_fmt = '1B'
|
||||
struct_len = struct.calcsize(struct_fmt)
|
||||
struct_unpack = struct.Struct(struct_fmt).unpack_from
|
||||
|
||||
nir = []
|
||||
with open(in_img_path, "rb") as f:
|
||||
while True:
|
||||
data = f.read(struct_len)
|
||||
if not data: break
|
||||
s = struct_unpack(data)
|
||||
nir.append(s[0])
|
||||
|
||||
nir = nir[:src_h*src_w]
|
||||
pixels = len(nir)
|
||||
# nir_bin to numpy_array
|
||||
output = np.zeros((len(nir) * 3), dtype=np.uint8)
|
||||
for i in range(0, pixels):
|
||||
output[i*3]=nir[i]
|
||||
output[i*3+1]=nir[i]
|
||||
output[i*3+2]=nir[i]
|
||||
|
||||
output = output.reshape((src_h,src_w,3))
|
||||
return output
|
||||
50
kneron/preprocessing/funcs/utils_520.py
Normal file
@ -0,0 +1,50 @@
|
||||
import math
|
||||
|
||||
def round_up_16(num):
|
||||
return ((num + (16 - 1)) & ~(16 - 1))
|
||||
|
||||
def round_up_n(num, n):
|
||||
if (num > 0):
|
||||
temp = float(num) / n
|
||||
return math.ceil(temp) * n
|
||||
else:
|
||||
return -math.ceil(float(-num) / n) * n
|
||||
|
||||
def cal_img_row_offset(crop_num, pad_num, start_row, out_row, orig_row):
|
||||
|
||||
scaled_img_row = int(out_row - (pad_num[1] + pad_num[3]))
|
||||
if ((start_row - pad_num[1]) > 0):
|
||||
img_str_row = int((start_row - pad_num[1]))
|
||||
else:
|
||||
img_str_row = 0
|
||||
valid_row = int(orig_row - (crop_num[1] + crop_num[3]))
|
||||
img_str_row = int(valid_row * img_str_row / scaled_img_row)
|
||||
return int(img_str_row + crop_num[1])
|
||||
|
||||
def get_pad_num(pad_num_orig, left, up, right, bottom):
|
||||
pad_num = [0]*4
|
||||
for i in range(0,4):
|
||||
pad_num[i] = pad_num_orig[i]
|
||||
|
||||
if not (left):
|
||||
pad_num[0] = 0
|
||||
if not (up):
|
||||
pad_num[1] = 0
|
||||
if not (right):
|
||||
pad_num[2] = 0
|
||||
if not (bottom):
|
||||
pad_num[3] = 0
|
||||
|
||||
return pad_num
|
||||
|
||||
def get_byte_per_pixel(raw_fmt):
|
||||
if raw_fmt.lower() in ['RGB888', 'rgb888', 'RGB', 'rgb888']:
|
||||
return 4
|
||||
elif raw_fmt.lower() in ['YUV', 'yuv', 'YUV422', 'yuv422']:
|
||||
return 2
|
||||
elif raw_fmt.lower() in ['RGB565', 'rgb565']:
|
||||
return 2
|
||||
elif raw_fmt.lower() in ['NIR888', 'nir888', 'NIR', 'nir']:
|
||||
return 1
|
||||
else:
|
||||
return -1
|
||||
42
kneron/preprocessing/funcs/utils_720.py
Normal file
@ -0,0 +1,42 @@
|
||||
import numpy as np
|
||||
from PIL import Image
|
||||
|
||||
def twos_complement(value):
|
||||
value = int(value)
|
||||
# msb = (value & 0x8000) * (1/np.power(2, 15))
|
||||
msb = (value & 0x8000) >> 15
|
||||
if msb == 1:
|
||||
if (((~value) & 0xFFFF) + 1) >= 0xFFFF:
|
||||
result = ((~value) & 0xFFFF)
|
||||
else:
|
||||
result = (((~value) & 0xFFFF) + 1)
|
||||
result = result * (-1)
|
||||
else:
|
||||
result = value
|
||||
|
||||
return result
|
||||
|
||||
|
||||
def twos_complement_pix(value):
|
||||
h, _ = value.shape
|
||||
for i in range(h):
|
||||
value[i, 0] = twos_complement(value[i, 0])
|
||||
|
||||
return value
|
||||
|
||||
def clip(value, mini, maxi):
|
||||
if value < mini:
|
||||
result = mini
|
||||
elif value > maxi:
|
||||
result = maxi
|
||||
else:
|
||||
result = value
|
||||
|
||||
return result
|
||||
|
||||
def clip_pix(value, mini, maxi):
|
||||
h, _ = value.shape
|
||||
for i in range(h):
|
||||
value[i, 0] = clip(value[i, 0], mini, maxi)
|
||||
|
||||
return value
|
||||
66
kneron/quantize_yolov5.py
Normal file
@ -0,0 +1,66 @@
|
||||
import os
|
||||
import numpy as np
|
||||
import torch
|
||||
import ktc # Kneron Toolchain
|
||||
import onnx
|
||||
from yolov5_preprocess import Yolov5_preprocess
|
||||
import kneron_preprocessing
|
||||
|
||||
# 設定裝置
|
||||
device = torch.device("cuda" if torch.cuda.is_available() else "cpu")
|
||||
|
||||
# 設定圖片大小
|
||||
imgsz_h, imgsz_w = 640, 640
|
||||
|
||||
# 設定正確的數據目錄
|
||||
data_path = "/workspace/yolov5/data50"
|
||||
|
||||
# 確保 data50 內有圖片
|
||||
files_found = [f for _, _, files in os.walk(data_path) for f in files if f.lower().endswith((".jpg", ".jpeg", ".png", ".bmp"))]
|
||||
|
||||
if not files_found:
|
||||
raise FileNotFoundError(f"❌ Error: No images found in {data_path}! Please check your dataset.")
|
||||
|
||||
print(f"✅ Found {len(files_found)} images in {data_path}")
|
||||
|
||||
# **獲取 ONNX 模型的輸入名稱**
|
||||
onnx_model_path = "/workspace/yolov5/runs/train/exp24/weights/latest.opt.onnx"
|
||||
m = onnx.load(onnx_model_path)
|
||||
input_name = m.graph.input[0].name # 確保 key 與 ONNX input name 一致
|
||||
|
||||
km = ktc.ModelConfig(20008, "0001", "720", onnx_model=onnx_model_path)
|
||||
# 存儲預處理後的圖片數據
|
||||
img_list = []
|
||||
|
||||
# 遍歷 data50 並進行預處理
|
||||
for root, _, files in os.walk(data_path):
|
||||
for f in files:
|
||||
fullpath = os.path.join(root, f)
|
||||
|
||||
# **只處理圖片文件**
|
||||
if not f.lower().endswith((".jpg", ".jpeg", ".png", ".bmp")):
|
||||
print(f"⚠️ Skipping non-image file: {fullpath}")
|
||||
continue
|
||||
|
||||
# **嘗試處理圖片**
|
||||
try:
|
||||
img_data, _ = Yolov5_preprocess(fullpath, device, imgsz_h, imgsz_w)
|
||||
img_data = img_data.cpu().numpy()
|
||||
print(f"✅ Processed: {fullpath}")
|
||||
img_list.append(img_data)
|
||||
except Exception as e:
|
||||
print(f"❌ Failed to process {fullpath}: {e}")
|
||||
|
||||
# **確保 img_list 不是空的**
|
||||
if not img_list:
|
||||
raise ValueError("❌ Error: No valid images were processed! Please check the image paths and formats.")
|
||||
|
||||
# **執行 BIE 量化**
|
||||
bie_model_path = km.analysis({input_name: img_list})
|
||||
|
||||
# **確認 BIE 模型是否生成**
|
||||
if not os.path.exists(bie_model_path):
|
||||
raise RuntimeError(f"❌ Error: BIE model was not generated! Please check your quantization process.")
|
||||
|
||||
# 顯示成功訊息
|
||||
print("\n✅ Fixed-point analysis done! BIE model saved to:", bie_model_path)
|
||||
34
kneron/removenode.py
Normal file
@ -0,0 +1,34 @@
|
||||
import onnx
|
||||
import ktc.onnx_optimizer as kneron_opt
|
||||
from onnx import helper
|
||||
|
||||
def replace_sigmoid_with_identity(model):
|
||||
"""
|
||||
Replaces all Sigmoid nodes with Identity nodes to maintain model integrity.
|
||||
"""
|
||||
for node in model.graph.node:
|
||||
if node.op_type == "Sigmoid":
|
||||
print(f"Replacing {node.name} with Identity")
|
||||
identity_node = helper.make_node(
|
||||
"Identity",
|
||||
inputs=node.input,
|
||||
outputs=node.output,
|
||||
name=node.name + "_identity"
|
||||
)
|
||||
model.graph.node.extend([identity_node])
|
||||
model.graph.node.remove(node)
|
||||
|
||||
return model
|
||||
|
||||
def process_onnx(input_onnx_path, output_onnx_path):
|
||||
""" Replaces Sigmoid with Identity and saves the new model """
|
||||
model = onnx.load(input_onnx_path)
|
||||
model = replace_sigmoid_with_identity(model)
|
||||
onnx.save(model, output_onnx_path)
|
||||
print(f"Modified ONNX model saved to: {output_onnx_path}")
|
||||
|
||||
# 使用 Docker 掛載的路徑
|
||||
input_onnx = "/workspace/yolov5/runs/train/exp24/weights/best_simplified.onnx"
|
||||
output_onnx = "/workspace/yolov5/runs/train/exp24/weights/best_no_sigmoid.onnx"
|
||||
|
||||
process_onnx(input_onnx, output_onnx)
|
||||
80
kneron/yolov5_export.py
Normal file
@ -0,0 +1,80 @@
|
||||
import os
|
||||
import torch
|
||||
import sys
|
||||
import yaml
|
||||
import argparse
|
||||
|
||||
from yolov5_runner import Yolov5Runner
|
||||
|
||||
def save_weight(num_classes):
|
||||
current_path=os.getcwd()
|
||||
par_path = os.path.dirname(current_path)
|
||||
sys.path.append(os.path.join(par_path, 'yolov5'))
|
||||
from models.yolo import Model
|
||||
num_classes = num_classes
|
||||
device=torch.device('cpu')
|
||||
ckpt = torch.load(path, map_location=device)
|
||||
model = Model(yaml_path, nc=num_classes)
|
||||
ckpt['model'] = {k: v for k, v in ckpt['model'].float().state_dict().items() if k in model.state_dict() and model.state_dict()[k].shape == v.shape}
|
||||
model.load_state_dict(ckpt['model'])
|
||||
torch.save(model.state_dict(),pt_path,_use_new_zipfile_serialization=False)
|
||||
|
||||
def export_onnx(input_h, input_w, num_classes):
|
||||
|
||||
onnx_batch_size, onnx_img_h, onnx_img_w = 1, input_h, input_w
|
||||
yolov5_model = Yolov5Runner(model_path=pt_path, yaml_path=yaml_path, grid20_path=grid20_path, grid40_path=grid40_path, grid80_path=grid80_path, num_classes=num_classes, imgsz_h=onnx_img_h, imgsz_w=onnx_img_w, conf_thres=0.001, iou_thres=0.65, top_k_num=3000, vanish_point=0.0)
|
||||
|
||||
# Input
|
||||
img = torch.zeros((onnx_batch_size, 3, onnx_img_h, onnx_img_w))
|
||||
# img = img.type(torch.cuda.FloatTensor)
|
||||
|
||||
# Load PyTorch model
|
||||
model = yolov5_model.yolov5_model
|
||||
model.eval()
|
||||
model.model[-1].export = True # set Detect() layer export=True
|
||||
y = model(img) # dry run
|
||||
|
||||
# ONNX export
|
||||
try:
|
||||
import onnx
|
||||
print('\nStarting ONNX export with onnx %s...' % onnx.__version__)
|
||||
print('****onnx file****',onnx_export_file)
|
||||
torch.onnx.export(model, img, onnx_export_file, verbose=False, opset_version=11, keep_initializers_as_inputs=True, input_names=['images'], output_names=['classes', 'boxes'] if y is None else ['output'])
|
||||
# Checks
|
||||
onnx_model = onnx.load(onnx_export_file) # load onnx model
|
||||
onnx.checker.check_model(onnx_model) # check onnx model
|
||||
print(onnx.helper.printable_graph(onnx_model.graph)) # print a human readable model
|
||||
print('ONNX export success, saved as %s' % onnx_export_file)
|
||||
except Exception as e:
|
||||
print('ONNX export failure: %s' % e)
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
parser = argparse.ArgumentParser()
|
||||
parser.add_argument('--data', type=str, default='../yolov5/data/pretrained_paths_520.yaml', help='the path to pretrained model paths yaml file')
|
||||
|
||||
args = parser.parse_args()
|
||||
|
||||
with open(args.data) as f:
|
||||
data_dict = yaml.load(f, Loader=yaml.FullLoader) # data dict
|
||||
|
||||
os.environ["CUDA_VISIBLE_DEVICES"] = '0'
|
||||
num_classes = data_dict['nc']
|
||||
input_w = data_dict['input_w']
|
||||
input_h = data_dict['input_h']
|
||||
grid_dir = data_dict['grid_dir']
|
||||
grid20_path = data_dict['grid20_path']
|
||||
grid40_path = data_dict['grid40_path']
|
||||
grid80_path = data_dict['grid80_path']
|
||||
path = data_dict['path']
|
||||
pt_path=data_dict['pt_path']
|
||||
yaml_path=data_dict['yaml_path']
|
||||
onnx_export_file = data_dict['onnx_export_file']
|
||||
save_weight(num_classes)
|
||||
export_onnx(input_h, input_w, num_classes)
|
||||
|
||||
|
||||
|
||||
|
||||
|
||||
|
||||
161
kneron/yolov5_preprocess.py
Normal file
@ -0,0 +1,161 @@
|
||||
# coding: utf-8
|
||||
import torch
|
||||
import cv2
|
||||
import numpy as np
|
||||
import math
|
||||
import time
|
||||
import kneron_preprocessing
|
||||
|
||||
kneron_preprocessing.API.set_default_as_520()
|
||||
torch.backends.cudnn.deterministic = True
|
||||
img_formats = ['.bmp', '.jpg', '.jpeg', '.png', '.tif', '.tiff', '.dng']
|
||||
def make_divisible(x, divisor):
|
||||
# Returns x evenly divisble by divisor
|
||||
return math.ceil(x / divisor) * divisor
|
||||
|
||||
def check_img_size(img_size, s=32):
|
||||
# Verify img_size is a multiple of stride s
|
||||
new_size = make_divisible(img_size, int(s)) # ceil gs-multiple
|
||||
if new_size != img_size:
|
||||
print('WARNING: --img-size %g must be multiple of max stride %g, updating to %g' % (img_size, s, new_size))
|
||||
return new_size
|
||||
|
||||
def letterbox_ori(img, new_shape=(640, 640), color=(0, 0, 0), auto=True, scaleFill=False, scaleup=True):
|
||||
# Resize image to a 32-pixel-multiple rectangle https://github.com/ultralytics/yolov3/issues/232
|
||||
shape = img.shape[:2] # current shape [height, width]
|
||||
if isinstance(new_shape, int):
|
||||
new_shape = (new_shape, new_shape)
|
||||
|
||||
# Scale ratio (new / old)
|
||||
r = min(new_shape[0] / shape[0], new_shape[1] / shape[1])
|
||||
if not scaleup: # only scale down, do not scale up (for better test mAP)
|
||||
r = min(r, 1.0)
|
||||
|
||||
# Compute padding
|
||||
ratio = r, r # width, height ratios
|
||||
new_unpad = int(round(shape[1] * r)), int(round(shape[0] * r)) # width, height
|
||||
dw, dh = new_shape[1] - new_unpad[0], new_shape[0] - new_unpad[1] # wh padding
|
||||
|
||||
dw /= 2 # divide padding into 2 sides
|
||||
dh /= 2
|
||||
|
||||
if shape[::-1] != new_unpad: # resize
|
||||
img = cv2.resize(img, new_unpad, interpolation=cv2.INTER_LINEAR)
|
||||
#img = kneron_preprocessing.API.resize(img,size=new_unpad, keep_ratio = False)
|
||||
|
||||
top, bottom = int(round(dh - 0.1)), int(round(dh + 0.1))
|
||||
left, right = int(round(dw - 0.1)), int(round(dw + 0.1))
|
||||
# top, bottom = int(0), int(round(dh + 0.1))
|
||||
# left, right = int(0), int(round(dw + 0.1))
|
||||
img = cv2.copyMakeBorder(img, top, bottom, left, right, cv2.BORDER_CONSTANT, value=color) # add border
|
||||
#img = kneron_preprocessing.API.pad(img, left, right, top, bottom, 0)
|
||||
|
||||
return img, ratio, (dw, dh)
|
||||
|
||||
def letterbox(img, new_shape=(640, 640), color=(0, 0, 0), auto=True, scaleFill=False, scaleup=True):
|
||||
# Resize image to a 32-pixel-multiple rectangle https://github.com/ultralytics/yolov3/issues/232
|
||||
shape = img.shape[:2] # current shape [height, width]
|
||||
if isinstance(new_shape, int):
|
||||
new_shape = (new_shape, new_shape)
|
||||
|
||||
# Scale ratio (new / old)
|
||||
r = min(new_shape[0] / shape[0], new_shape[1] / shape[1])
|
||||
if not scaleup: # only scale down, do not scale up (for better test mAP)
|
||||
r = min(r, 1.0)
|
||||
|
||||
# Compute padding
|
||||
ratio = r, r # width, height ratios
|
||||
new_unpad = int(round(shape[1] * r)), int(round(shape[0] * r)) # width, height
|
||||
dw, dh = new_shape[1] - new_unpad[0], new_shape[0] - new_unpad[1] # wh padding
|
||||
|
||||
# dw /= 2 # divide padding into 2 sides
|
||||
# dh /= 2
|
||||
|
||||
if shape[::-1] != new_unpad: # resize
|
||||
#img = cv2.resize(img, new_unpad, interpolation=cv2.INTER_LINEAR)
|
||||
img = kneron_preprocessing.API.resize(img,size=new_unpad, keep_ratio = False)
|
||||
|
||||
# top, bottom = int(round(dh - 0.1)), int(round(dh + 0.1))
|
||||
# left, right = int(round(dw - 0.1)), int(round(dw + 0.1))
|
||||
top, bottom = int(0), int(round(dh + 0.1))
|
||||
left, right = int(0), int(round(dw + 0.1))
|
||||
#img = cv2.copyMakeBorder(img, top, bottom, left, right, cv2.BORDER_CONSTANT, value=color) # add border
|
||||
img = kneron_preprocessing.API.pad(img, left, right, top, bottom, 0)
|
||||
|
||||
return img, ratio, (dw, dh)
|
||||
|
||||
def letterbox_test(img, new_shape=(640, 640), color=(0, 0, 0), auto=True, scaleFill=False, scaleup=True):
|
||||
|
||||
ratio = 1.0, 1.0
|
||||
dw, dh = 0, 0
|
||||
img = kneron_preprocessing.API.resize(img, size=(480, 256), keep_ratio=False, type='bilinear')
|
||||
return img, ratio, (dw, dh)
|
||||
|
||||
def LoadImages(path,img_size): #_rgb # for inference
|
||||
if isinstance(path, str):
|
||||
img0 = cv2.imread(path) # BGR
|
||||
else:
|
||||
img0 = path # BGR
|
||||
|
||||
# Padded resize
|
||||
img = letterbox(img0, new_shape=img_size)[0]
|
||||
# Convert
|
||||
img = img[:, :, ::-1].transpose(2, 0, 1) # BGR to RGB, to 3x416x416
|
||||
img = np.ascontiguousarray(img)
|
||||
return img, img0
|
||||
|
||||
def LoadImages_yyy(path,img_size): #_yyy # for inference
|
||||
if isinstance(path, str):
|
||||
img0 = cv2.imread(path) # BGR
|
||||
else:
|
||||
img0 = path # BGR
|
||||
|
||||
yvu = cv2.cvtColor(img0, cv2.COLOR_BGR2YCrCb)
|
||||
y, v, u = cv2.split(yvu)
|
||||
img0 = np.stack((y,)*3, axis=-1)
|
||||
|
||||
# Padded resize
|
||||
img = letterbox(img0, new_shape=img_size)[0]
|
||||
|
||||
# Convert
|
||||
img = img[:, :, ::-1].transpose(2, 0, 1) # BGR to RGB, to 3x416x416
|
||||
img = np.ascontiguousarray(img)
|
||||
return img, img0
|
||||
|
||||
def LoadImages_yuv420(path,img_size): #_yuv420 # for inference
|
||||
if isinstance(path, str):
|
||||
img0 = cv2.imread(path) # BGR
|
||||
else:
|
||||
img0 = path # BGR
|
||||
img_h, img_w = img0.shape[:2]
|
||||
img_h = (img_h // 2) * 2
|
||||
img_w = (img_w // 2) * 2
|
||||
img = img0[:img_h,:img_w,:]
|
||||
yuv = cv2.cvtColor(img, cv2.COLOR_BGR2YUV_I420)
|
||||
img0= cv2.cvtColor(yuv, cv2.COLOR_YUV2BGR_I420) #yuv420
|
||||
|
||||
|
||||
# Padded resize
|
||||
img = letterbox(img0, new_shape=img_size)[0]
|
||||
|
||||
# Convert
|
||||
img = img[:, :, ::-1].transpose(2, 0, 1) # BGR to RGB, to 3x416x416
|
||||
img = np.ascontiguousarray(img)
|
||||
return img, img0
|
||||
|
||||
def Yolov5_preprocess(image_path, device, imgsz_h, imgsz_w) :
|
||||
model_stride_max = 32
|
||||
imgsz_h = check_img_size(imgsz_h, s=model_stride_max) # check img_size
|
||||
imgsz_w = check_img_size(imgsz_w, s=model_stride_max) # check img_size
|
||||
img, im0 = LoadImages(image_path, img_size=(imgsz_h,imgsz_w))
|
||||
img = kneron_preprocessing.API.norm(img) #path1
|
||||
#print('img',img.shape)
|
||||
img = torch.from_numpy(img).to(device) #path1,path2
|
||||
# img = img.float() # uint8 to fp16/32 #path2
|
||||
# img /= 255.0#256.0 - 0.5 # 0 - 255 to -0.5 - 0.5 #path2
|
||||
|
||||
if img.ndimension() == 3:
|
||||
img = img.unsqueeze(0)
|
||||
|
||||
return img, im0
|
||||
|
||||
42
kneron/yolov5_savingWeight.py
Normal file
@ -0,0 +1,42 @@
|
||||
import os
|
||||
import torch
|
||||
import sys
|
||||
import argparse
|
||||
import yaml
|
||||
|
||||
def save_weight(num_classes):
|
||||
from models.yolo import Model
|
||||
num_classes = num_classes
|
||||
device=torch.device('cpu')
|
||||
ckpt = torch.load(path, map_location=device)
|
||||
model = Model(yaml_path, nc=num_classes)
|
||||
ckpt['model'] = {k: v for k, v in ckpt['model'].float().state_dict().items() if k in model.state_dict() and model.state_dict()[k].shape == v.shape}
|
||||
model.load_state_dict(ckpt['model'])
|
||||
torch.save(model.state_dict(),pt_path,_use_new_zipfile_serialization=False)
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
parser = argparse.ArgumentParser()
|
||||
parser.add_argument('--data', type=str, default='data/pretrained_paths_520.yaml', help='the path to pretrained model paths yaml file')
|
||||
args = parser.parse_args()
|
||||
|
||||
with open(args.data) as f:
|
||||
data_dict = yaml.load(f, Loader=yaml.FullLoader) # data dict
|
||||
|
||||
os.environ["CUDA_VISIBLE_DEVICES"] = '0'
|
||||
input_w = data_dict['input_w']
|
||||
input_h = data_dict['input_h']
|
||||
grid_dir = data_dict['grid_dir']
|
||||
grid20_path = data_dict['grid20_path']
|
||||
grid40_path = data_dict['grid40_path']
|
||||
grid80_path = data_dict['grid80_path']
|
||||
path = data_dict['path']
|
||||
pt_path=data_dict['pt_path']
|
||||
yaml_path=data_dict['yaml_path']
|
||||
|
||||
save_weight(data_dict['nc'])
|
||||
|
||||
|
||||
|
||||
|
||||
|
||||
0
models/__init__.py
Normal file
246
models/common.py
Normal file
@ -0,0 +1,246 @@
|
||||
# This file contains modules common to various models
|
||||
|
||||
import math
|
||||
|
||||
import numpy as np
|
||||
import torch
|
||||
import torch.nn as nn
|
||||
import torch.nn.functional as F
|
||||
from PIL import Image, ImageDraw
|
||||
|
||||
from utils.datasets import letterbox
|
||||
from utils.general import non_max_suppression, make_divisible, scale_coords, xyxy2xywh
|
||||
from utils.plots import color_list
|
||||
|
||||
|
||||
def autopad(k, p=None): # kernel, padding
|
||||
# Pad to 'same'
|
||||
if p is None:
|
||||
p = k // 2 if isinstance(k, int) else [x // 2 for x in k] # auto-pad
|
||||
return p
|
||||
|
||||
|
||||
def DWConv(c1, c2, k=1, s=1, act=True):
|
||||
# Depthwise convolution
|
||||
return Conv(c1, c2, k, s, g=math.gcd(c1, c2), act=act)
|
||||
|
||||
|
||||
class Conv(nn.Module):
|
||||
# Standard convolution
|
||||
def __init__(self, c1, c2, k=1, s=1, p=None, g=1, act=True): # ch_in, ch_out, kernel, stride, padding, groups
|
||||
super(Conv, self).__init__()
|
||||
self.conv = nn.Conv2d(c1, c2, k, s, autopad(k, p), groups=g, bias=False)
|
||||
self.bn = nn.BatchNorm2d(c2)
|
||||
#self.act = nn.Hardswish() if act else nn.Identity()
|
||||
self.act = nn.LeakyReLU(0.1, inplace=True) if act else nn.Identity()
|
||||
def forward(self, x):
|
||||
# print('x',x.size())
|
||||
y = self.act(self.bn(self.conv(x)))
|
||||
# print('y',y.size())
|
||||
return y
|
||||
|
||||
def fuseforward(self, x):
|
||||
return self.act(self.conv(x))
|
||||
|
||||
|
||||
class Bottleneck(nn.Module):
|
||||
# Standard bottleneck
|
||||
def __init__(self, c1, c2, shortcut=True, g=1, e=0.5): # ch_in, ch_out, shortcut, groups, expansion
|
||||
super(Bottleneck, self).__init__()
|
||||
c_ = int(c2 * e) # hidden channels
|
||||
self.cv1 = Conv(c1, c_, 1, 1)
|
||||
self.cv2 = Conv(c_, c2, 3, 1, g=g)
|
||||
self.add = shortcut and c1 == c2
|
||||
|
||||
def forward(self, x):
|
||||
return x + self.cv2(self.cv1(x)) if self.add else self.cv2(self.cv1(x))
|
||||
|
||||
|
||||
class BottleneckCSP(nn.Module):
|
||||
# CSP Bottleneck https://github.com/WongKinYiu/CrossStagePartialNetworks
|
||||
def __init__(self, c1, c2, n=1, shortcut=True, g=1, e=0.5): # ch_in, ch_out, number, shortcut, groups, expansion
|
||||
super(BottleneckCSP, self).__init__()
|
||||
c_ = int(c2 * e) # hidden channels
|
||||
self.cv1 = Conv(c1, c_, 1, 1)
|
||||
self.cv2 = nn.Conv2d(c1, c_, 1, 1, bias=False)
|
||||
self.cv3 = nn.Conv2d(c_, c_, 1, 1, bias=False)
|
||||
self.cv4 = Conv(2 * c_, c2, 1, 1)
|
||||
self.bn = nn.BatchNorm2d(2 * c_) # applied to cat(cv2, cv3)
|
||||
self.act = nn.LeakyReLU(0.1, inplace=True)
|
||||
self.m = nn.Sequential(*[Bottleneck(c_, c_, shortcut, g, e=1.0) for _ in range(n)])
|
||||
|
||||
def forward(self, x):
|
||||
y1 = self.cv3(self.m(self.cv1(x)))
|
||||
y2 = self.cv2(x)
|
||||
return self.cv4(self.act(self.bn(torch.cat((y1, y2), dim=1))))
|
||||
|
||||
|
||||
|
||||
|
||||
class Focus(nn.Module):
|
||||
# Focus wh information into c-space
|
||||
def __init__(self, c1, c2, k=1, s=1, p=None, g=1, act=True): # ch_in, ch_out, kernel, stride, padding, groups
|
||||
super(Focus, self).__init__()
|
||||
self.conv = Conv(c1 * 4, c2, k, s, p, g, act)
|
||||
|
||||
def forward(self, x): # x(b,c,w,h) -> y(b,4c,w/2,h/2)
|
||||
return self.conv(torch.cat([x[..., ::2, ::2], x[..., 1::2, ::2], x[..., ::2, 1::2], x[..., 1::2, 1::2]], 1))
|
||||
|
||||
|
||||
class Concat(nn.Module):
|
||||
# Concatenate a list of tensors along dimension
|
||||
def __init__(self, dimension=1):
|
||||
super(Concat, self).__init__()
|
||||
self.d = dimension
|
||||
|
||||
def forward(self, x):
|
||||
# print('Concat x.size()',x.size())
|
||||
y=torch.cat(x, self.d)
|
||||
# print('Concat y.size()',y.size())
|
||||
return y
|
||||
|
||||
|
||||
class NMS(nn.Module):
|
||||
# Non-Maximum Suppression (NMS) module
|
||||
conf = 0.25 # confidence threshold
|
||||
iou = 0.45 # IoU threshold
|
||||
classes = None # (optional list) filter by class
|
||||
|
||||
def __init__(self):
|
||||
super(NMS, self).__init__()
|
||||
|
||||
def forward(self, x):
|
||||
return non_max_suppression(x[0], conf_thres=self.conf, iou_thres=self.iou, classes=self.classes)
|
||||
|
||||
|
||||
class autoShape(nn.Module):
|
||||
# input-robust model wrapper for passing cv2/np/PIL/torch inputs. Includes preprocessing, inference and NMS
|
||||
img_size = 640 # inference size (pixels)
|
||||
conf = 0.25 # NMS confidence threshold
|
||||
iou = 0.45 # NMS IoU threshold
|
||||
classes = None # (optional list) filter by class
|
||||
|
||||
def __init__(self, model):
|
||||
super(autoShape, self).__init__()
|
||||
self.model = model.eval()
|
||||
|
||||
def forward(self, imgs, size=640, augment=False, profile=False):
|
||||
# supports inference from various sources. For height=720, width=1280, RGB images example inputs are:
|
||||
# opencv: imgs = cv2.imread('image.jpg')[:,:,::-1] # HWC BGR to RGB x(720,1280,3)
|
||||
# PIL: imgs = Image.open('image.jpg') # HWC x(720,1280,3)
|
||||
# numpy: imgs = np.zeros((720,1280,3)) # HWC
|
||||
# torch: imgs = torch.zeros(16,3,720,1280) # BCHW
|
||||
# multiple: imgs = [Image.open('image1.jpg'), Image.open('image2.jpg'), ...] # list of images
|
||||
|
||||
p = next(self.model.parameters()) # for device and type
|
||||
if isinstance(imgs, torch.Tensor): # torch
|
||||
return self.model(imgs.to(p.device).type_as(p), augment, profile) # inference
|
||||
|
||||
# Pre-process
|
||||
if not isinstance(imgs, list):
|
||||
imgs = [imgs]
|
||||
shape0, shape1 = [], [] # image and inference shapes
|
||||
batch = range(len(imgs)) # batch size
|
||||
for i in batch:
|
||||
imgs[i] = np.array(imgs[i]) # to numpy
|
||||
imgs[i] = imgs[i][:, :, :3] if imgs[i].ndim == 3 else np.tile(imgs[i][:, :, None], 3) # enforce 3ch input
|
||||
s = imgs[i].shape[:2] # HWC
|
||||
shape0.append(s) # image shape
|
||||
g = (size / max(s)) # gain
|
||||
shape1.append([y * g for y in s])
|
||||
shape1 = [make_divisible(x, int(self.stride.max())) for x in np.stack(shape1, 0).max(0)] # inference shape
|
||||
x = [letterbox(imgs[i], new_shape=shape1, auto=False)[0] for i in batch] # pad
|
||||
x = np.stack(x, 0) if batch[-1] else x[0][None] # stack
|
||||
x = np.ascontiguousarray(x.transpose((0, 3, 1, 2))) # BHWC to BCHW
|
||||
x = torch.from_numpy(x).to(p.device).type_as(p) / 255. # uint8 to fp16/32
|
||||
|
||||
# Inference
|
||||
with torch.no_grad():
|
||||
y = self.model(x, augment, profile)[0] # forward
|
||||
y = non_max_suppression(y, conf_thres=self.conf, iou_thres=self.iou, classes=self.classes) # NMS
|
||||
|
||||
# Post-process
|
||||
for i in batch:
|
||||
if y[i] is not None:
|
||||
y[i][:, :4] = scale_coords(shape1, y[i][:, :4], shape0[i])
|
||||
|
||||
return Detections(imgs, y, self.names)
|
||||
|
||||
|
||||
class Detections:
|
||||
# detections class for YOLOv5 inference results
|
||||
def __init__(self, imgs, pred, names=None):
|
||||
super(Detections, self).__init__()
|
||||
self.imgs = imgs # list of images as numpy arrays
|
||||
self.pred = pred # list of tensors pred[0] = (xyxy, conf, cls)
|
||||
self.names = names # class names
|
||||
self.xyxy = pred # xyxy pixels
|
||||
self.xywh = [xyxy2xywh(x) for x in pred] # xywh pixels
|
||||
gn = [torch.Tensor([*[im.shape[i] for i in [1, 0, 1, 0]], 1., 1.]) for im in imgs] # normalization gains
|
||||
self.xyxyn = [x / g for x, g in zip(self.xyxy, gn)] # xyxy normalized
|
||||
self.xywhn = [x / g for x, g in zip(self.xywh, gn)] # xywh normalized
|
||||
|
||||
def display(self, pprint=False, show=False, save=False):
|
||||
colors = color_list()
|
||||
for i, (img, pred) in enumerate(zip(self.imgs, self.pred)):
|
||||
str = f'Image {i + 1}/{len(self.pred)}: {img.shape[0]}x{img.shape[1]} '
|
||||
if pred is not None:
|
||||
for c in pred[:, -1].unique():
|
||||
n = (pred[:, -1] == c).sum() # detections per class
|
||||
str += f'{n} {self.names[int(c)]}s, ' # add to string
|
||||
if show or save:
|
||||
img = Image.fromarray(img.astype(np.uint8)) if isinstance(img, np.ndarray) else img # from np
|
||||
for *box, conf, cls in pred: # xyxy, confidence, class
|
||||
# str += '%s %.2f, ' % (names[int(cls)], conf) # label
|
||||
ImageDraw.Draw(img).rectangle(box, width=4, outline=colors[int(cls) % 10]) # plot
|
||||
if save:
|
||||
f = f'results{i}.jpg'
|
||||
str += f"saved to '{f}'"
|
||||
img.save(f) # save
|
||||
if show:
|
||||
img.show(f'Image {i}') # show
|
||||
if pprint:
|
||||
print(str)
|
||||
|
||||
def print(self):
|
||||
self.display(pprint=True) # print results
|
||||
|
||||
def show(self):
|
||||
self.display(show=True) # show results
|
||||
|
||||
def save(self):
|
||||
self.display(save=True) # save results
|
||||
|
||||
|
||||
class Flatten(nn.Module):
|
||||
# Use after nn.AdaptiveAvgPool2d(1) to remove last 2 dimensions
|
||||
@staticmethod
|
||||
def forward(x):
|
||||
return x.view(x.size(0), -1)
|
||||
|
||||
|
||||
class Classify(nn.Module):
|
||||
# Classification head, i.e. x(b,c1,20,20) to x(b,c2)
|
||||
def __init__(self, c1, c2, k=1, s=1, p=None, g=1): # ch_in, ch_out, kernel, stride, padding, groups
|
||||
super(Classify, self).__init__()
|
||||
self.aap = nn.AdaptiveAvgPool2d(1) # to x(b,c1,1,1)
|
||||
self.conv = nn.Conv2d(c1, c2, k, s, autopad(k, p), groups=g, bias=False) # to x(b,c2,1,1)
|
||||
self.flat = Flatten()
|
||||
|
||||
def forward(self, x):
|
||||
z = torch.cat([self.aap(y) for y in (x if isinstance(x, list) else [x])], 1) # cat if list
|
||||
return self.flat(self.conv(z)) # flatten to x(b,c2)
|
||||
|
||||
|
||||
class SPP(nn.Module):
|
||||
# Spatial pyramid pooling layer used in YOLOv3-SPP
|
||||
def __init__(self, c1, c2, k=(5, 9, 13)):
|
||||
super(SPP, self).__init__()
|
||||
c_ = c1 // 2 # hidden channels
|
||||
self.cv1 = Conv(c1, c_, 1, 1)
|
||||
self.cv2 = Conv(c_ * (len(k) + 1), c2, 1, 1)
|
||||
self.m = nn.ModuleList([nn.MaxPool2d(kernel_size=x, stride=1, padding=x // 2) for x in k])
|
||||
|
||||
def forward(self, x):
|
||||
x = self.cv1(x)
|
||||
return self.cv2(torch.cat([x] + [m(x) for m in self.m], 1))
|
||||
152
models/experimental.py
Normal file
@ -0,0 +1,152 @@
|
||||
# This file contains experimental modules
|
||||
|
||||
import numpy as np
|
||||
import torch
|
||||
import torch.nn as nn
|
||||
|
||||
from models.common import Conv, DWConv
|
||||
from utils.google_utils import attempt_download
|
||||
|
||||
|
||||
class CrossConv(nn.Module):
|
||||
# Cross Convolution Downsample
|
||||
def __init__(self, c1, c2, k=3, s=1, g=1, e=1.0, shortcut=False):
|
||||
# ch_in, ch_out, kernel, stride, groups, expansion, shortcut
|
||||
super(CrossConv, self).__init__()
|
||||
c_ = int(c2 * e) # hidden channels
|
||||
self.cv1 = Conv(c1, c_, (1, k), (1, s))
|
||||
self.cv2 = Conv(c_, c2, (k, 1), (s, 1), g=g)
|
||||
self.add = shortcut and c1 == c2
|
||||
|
||||
def forward(self, x):
|
||||
return x + self.cv2(self.cv1(x)) if self.add else self.cv2(self.cv1(x))
|
||||
|
||||
|
||||
class C3(nn.Module):
|
||||
# Cross Convolution CSP
|
||||
def __init__(self, c1, c2, n=1, shortcut=True, g=1, e=0.5): # ch_in, ch_out, number, shortcut, groups, expansion
|
||||
super(C3, self).__init__()
|
||||
c_ = int(c2 * e) # hidden channels
|
||||
self.cv1 = Conv(c1, c_, 1, 1)
|
||||
self.cv2 = nn.Conv2d(c1, c_, 1, 1, bias=False)
|
||||
self.cv3 = nn.Conv2d(c_, c_, 1, 1, bias=False)
|
||||
self.cv4 = Conv(2 * c_, c2, 1, 1)
|
||||
self.bn = nn.BatchNorm2d(2 * c_) # applied to cat(cv2, cv3)
|
||||
self.act = nn.LeakyReLU(0.1, inplace=True)
|
||||
self.m = nn.Sequential(*[CrossConv(c_, c_, 3, 1, g, 1.0, shortcut) for _ in range(n)])
|
||||
|
||||
def forward(self, x):
|
||||
y1 = self.cv3(self.m(self.cv1(x)))
|
||||
y2 = self.cv2(x)
|
||||
return self.cv4(self.act(self.bn(torch.cat((y1, y2), dim=1))))
|
||||
|
||||
|
||||
class Sum(nn.Module):
|
||||
# Weighted sum of 2 or more layers https://arxiv.org/abs/1911.09070
|
||||
def __init__(self, n, weight=False): # n: number of inputs
|
||||
super(Sum, self).__init__()
|
||||
self.weight = weight # apply weights boolean
|
||||
self.iter = range(n - 1) # iter object
|
||||
if weight:
|
||||
self.w = nn.Parameter(-torch.arange(1., n) / 2, requires_grad=True) # layer weights
|
||||
|
||||
def forward(self, x):
|
||||
y = x[0] # no weight
|
||||
if self.weight:
|
||||
w = torch.sigmoid(self.w) * 2
|
||||
for i in self.iter:
|
||||
y = y + x[i + 1] * w[i]
|
||||
else:
|
||||
for i in self.iter:
|
||||
y = y + x[i + 1]
|
||||
return y
|
||||
|
||||
|
||||
class GhostConv(nn.Module):
|
||||
# Ghost Convolution https://github.com/huawei-noah/ghostnet
|
||||
def __init__(self, c1, c2, k=1, s=1, g=1, act=True): # ch_in, ch_out, kernel, stride, groups
|
||||
super(GhostConv, self).__init__()
|
||||
c_ = c2 // 2 # hidden channels
|
||||
self.cv1 = Conv(c1, c_, k, s, None, g, act)
|
||||
self.cv2 = Conv(c_, c_, 5, 1, None, c_, act)
|
||||
|
||||
def forward(self, x):
|
||||
y = self.cv1(x)
|
||||
return torch.cat([y, self.cv2(y)], 1)
|
||||
|
||||
|
||||
class GhostBottleneck(nn.Module):
|
||||
# Ghost Bottleneck https://github.com/huawei-noah/ghostnet
|
||||
def __init__(self, c1, c2, k, s):
|
||||
super(GhostBottleneck, self).__init__()
|
||||
c_ = c2 // 2
|
||||
self.conv = nn.Sequential(GhostConv(c1, c_, 1, 1), # pw
|
||||
DWConv(c_, c_, k, s, act=False) if s == 2 else nn.Identity(), # dw
|
||||
GhostConv(c_, c2, 1, 1, act=False)) # pw-linear
|
||||
self.shortcut = nn.Sequential(DWConv(c1, c1, k, s, act=False),
|
||||
Conv(c1, c2, 1, 1, act=False)) if s == 2 else nn.Identity()
|
||||
|
||||
def forward(self, x):
|
||||
return self.conv(x) + self.shortcut(x)
|
||||
|
||||
|
||||
class MixConv2d(nn.Module):
|
||||
# Mixed Depthwise Conv https://arxiv.org/abs/1907.09595
|
||||
def __init__(self, c1, c2, k=(1, 3), s=1, equal_ch=True):
|
||||
super(MixConv2d, self).__init__()
|
||||
groups = len(k)
|
||||
if equal_ch: # equal c_ per group
|
||||
i = torch.linspace(0, groups - 1E-6, c2).floor() # c2 indices
|
||||
c_ = [(i == g).sum() for g in range(groups)] # intermediate channels
|
||||
else: # equal weight.numel() per group
|
||||
b = [c2] + [0] * groups
|
||||
a = np.eye(groups + 1, groups, k=-1)
|
||||
a -= np.roll(a, 1, axis=1)
|
||||
a *= np.array(k) ** 2
|
||||
a[0] = 1
|
||||
c_ = np.linalg.lstsq(a, b, rcond=None)[0].round() # solve for equal weight indices, ax = b
|
||||
|
||||
self.m = nn.ModuleList([nn.Conv2d(c1, int(c_[g]), k[g], s, k[g] // 2, bias=False) for g in range(groups)])
|
||||
self.bn = nn.BatchNorm2d(c2)
|
||||
self.act = nn.LeakyReLU(0.1, inplace=True)
|
||||
|
||||
def forward(self, x):
|
||||
return x + self.act(self.bn(torch.cat([m(x) for m in self.m], 1)))
|
||||
|
||||
|
||||
class Ensemble(nn.ModuleList):
|
||||
# Ensemble of models
|
||||
def __init__(self):
|
||||
super(Ensemble, self).__init__()
|
||||
|
||||
def forward(self, x, augment=False):
|
||||
y = []
|
||||
for module in self:
|
||||
y.append(module(x, augment)[0])
|
||||
# y = torch.stack(y).max(0)[0] # max ensemble
|
||||
# y = torch.cat(y, 1) # nms ensemble
|
||||
y = torch.stack(y).mean(0) # mean ensemble
|
||||
return y, None # inference, train output
|
||||
|
||||
|
||||
def attempt_load(weights, map_location=None):
|
||||
# Loads an ensemble of models weights=[a,b,c] or a single model weights=[a] or weights=a
|
||||
model = Ensemble()
|
||||
for w in weights if isinstance(weights, list) else [weights]:
|
||||
ckpt = torch.load(w, map_location=map_location)
|
||||
model.append( ckpt['model'].float().fuse().eval() ) # load FP32 model
|
||||
|
||||
# Compatibility updates
|
||||
for m in model.modules():
|
||||
if type(m) in [nn.Hardswish, nn.LeakyReLU, nn.ReLU, nn.ReLU6]:
|
||||
m.inplace = True # pytorch 1.7.0 compatibility
|
||||
elif type(m) is Conv:
|
||||
m._non_persistent_buffers_set = set() # pytorch 1.6.0 compatibility
|
||||
|
||||
if len(model) == 1:
|
||||
return model[-1] # return model
|
||||
else:
|
||||
print('Ensemble created with %s\n' % weights)
|
||||
for k in ['names', 'stride']:
|
||||
setattr(model, k, getattr(model[-1], k))
|
||||
return model # return ensemble
|
||||
94
models/export.py
Normal file
@ -0,0 +1,94 @@
|
||||
"""Exports a YOLOv5 *.pt model to ONNX and TorchScript formats
|
||||
|
||||
Usage:
|
||||
$ export PYTHONPATH="$PWD" && python models/export.py --weights ./weights/yolov5s.pt --img 640 --batch 1
|
||||
"""
|
||||
|
||||
import argparse
|
||||
import sys
|
||||
import time
|
||||
|
||||
sys.path.append('./') # to run '$ python *.py' files in subdirectories
|
||||
|
||||
import torch
|
||||
import torch.nn as nn
|
||||
|
||||
import models
|
||||
from models.experimental import attempt_load
|
||||
from utils.activations import Hardswish
|
||||
from utils.general import set_logging, check_img_size
|
||||
|
||||
if __name__ == '__main__':
|
||||
parser = argparse.ArgumentParser()
|
||||
parser.add_argument('--weights', type=str, default='./yolov5s.pt', help='weights path') # from yolov5/models/
|
||||
parser.add_argument('--img-size', nargs='+', type=int, default=[640, 640], help='image size') # height, width
|
||||
parser.add_argument('--batch-size', type=int, default=1, help='batch size')
|
||||
opt = parser.parse_args()
|
||||
opt.img_size *= 2 if len(opt.img_size) == 1 else 1 # expand
|
||||
print(opt)
|
||||
set_logging()
|
||||
t = time.time()
|
||||
|
||||
# Load PyTorch model
|
||||
model = attempt_load(opt.weights, map_location=torch.device('cpu')) # load FP32 model
|
||||
labels = model.names
|
||||
|
||||
# Checks
|
||||
gs = int(max(model.stride)) # grid size (max stride)
|
||||
opt.img_size = [check_img_size(x, gs) for x in opt.img_size] # verify img_size are gs-multiples
|
||||
|
||||
# Input
|
||||
img = torch.zeros(opt.batch_size, 3, *opt.img_size) # image size(1,3,320,192) iDetection
|
||||
|
||||
# Update model
|
||||
for k, m in model.named_modules():
|
||||
m._non_persistent_buffers_set = set() # pytorch 1.6.0 compatibility
|
||||
if isinstance(m, models.common.Conv) and isinstance(m.act, nn.Hardswish):
|
||||
m.act = Hardswish() # assign activation
|
||||
# if isinstance(m, models.yolo.Detect):
|
||||
# m.forward = m.forward_export # assign forward (optional)
|
||||
model.model[-1].export = True # set Detect() layer export=True
|
||||
y = model(img) # dry run
|
||||
|
||||
# TorchScript export
|
||||
try:
|
||||
print('\nStarting TorchScript export with torch %s...' % torch.__version__)
|
||||
f = opt.weights.replace('.pt', '.torchscript.pt') # filename
|
||||
ts = torch.jit.trace(model, img)
|
||||
ts.save(f)
|
||||
print('TorchScript export success, saved as %s' % f)
|
||||
except Exception as e:
|
||||
print('TorchScript export failure: %s' % e)
|
||||
|
||||
# ONNX export
|
||||
try:
|
||||
import onnx
|
||||
|
||||
print('\nStarting ONNX export with onnx %s...' % onnx.__version__)
|
||||
f = opt.weights.replace('.pt', '.onnx') # filename
|
||||
torch.onnx.export(model, img, f, verbose=False, opset_version=12, input_names=['images'],
|
||||
output_names=['classes', 'boxes'] if y is None else ['output'])
|
||||
|
||||
# Checks
|
||||
onnx_model = onnx.load(f) # load onnx model
|
||||
onnx.checker.check_model(onnx_model) # check onnx model
|
||||
# print(onnx.helper.printable_graph(onnx_model.graph)) # print a human readable model
|
||||
print('ONNX export success, saved as %s' % f)
|
||||
except Exception as e:
|
||||
print('ONNX export failure: %s' % e)
|
||||
|
||||
# CoreML export
|
||||
try:
|
||||
import coremltools as ct
|
||||
|
||||
print('\nStarting CoreML export with coremltools %s...' % ct.__version__)
|
||||
# convert model from torchscript and apply pixel scaling as per detect.py
|
||||
model = ct.convert(ts, inputs=[ct.ImageType(name='image', shape=img.shape, scale=1 / 255.0, bias=[0, 0, 0])])
|
||||
f = opt.weights.replace('.pt', '.mlmodel') # filename
|
||||
model.save(f)
|
||||
print('CoreML export success, saved as %s' % f)
|
||||
except Exception as e:
|
||||
print('CoreML export failure: %s' % e)
|
||||
|
||||
# Finish
|
||||
print('\nExport complete (%.2fs). Visualize with https://github.com/lutzroeder/netron.' % (time.time() - t))
|
||||